{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "71cfe370-6aa6-4b09-bdab-14fa8f2e08cd", "code": "CYCLOHEPTADECA-9-EN-1-ONE", "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent", "type": "PRIMARY", "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5254", "code_system": "JECFA EVALUATION", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a" ] }, { "uuid": "bc820c91-d736-4c72-88f2-65aef105ec77", "code": "542-46-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=542-46-1", "code_system": "CAS", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a", "bdb8c1aa-ae05-4136-9d2e-510aa5ab41c7" ] }, { "uuid": "8c8a2546-3583-4991-929d-ead80e45dbad", "code": "C571563", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67571563", "code_system": "MESH", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a" ] }, { "uuid": "63298e61-eb48-44f9-964e-040c0ff2ddff", "code": "208-813-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.013", "code_system": "ECHA (EC/EINECS)", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a" ] }, { "uuid": "92ba6340-942e-4804-b0a5-b775f0f3fd28", "code": "m3604", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3604?q=authorize", "code_system": "MERCK INDEX", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a" ] }, { "uuid": "ef28f7b5-23d1-42aa-b864-28300c14618e", "code": "5315941", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5315941", "code_system": "PUBCHEM", "references": [ "06fe1d5c-5bce-4235-b079-656853ab4c6a" ] }, { "uuid": "2342ce03-9851-8dfe-39f9-9de890120e15", "code": "Civetone", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Civetone", "code_system": "WIKIPEDIA", "references": [ "0e0b54fa-397a-4ff9-fa4e-f8c227a32878" ] }, { "uuid": "3c705d52-b2d9-4d54-9fb1-5a0d61ce5318", "code": "P0K30CV1UE", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c96b1d25-9c52-59af-4659-7917495a8d7a", "code": "DTXSID80883434", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80883434", "code_system": "EPA CompTox" }, { "uuid": "fdf915bc-2aed-f213-558e-e2a30b8a1765", "code": "1400", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1400/", "code_system": "JECFA MONOGRAPH", "references": [ "7577267f-8db7-1833-4ef5-3263185efe32" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e9065e68-278d-4fb8-8bcc-4865c80d1378", "name": "(9Z)-9-CYCLOHEPTADECENE-1-ONE", "stdName": "(9Z)-9-CYCLOHEPTADECENE-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2547bc61-8b03-4416-8c37-4f409a246d32", "e1753de3-b1f9-4300-9341-87d78f001b81" ], "display_name": false }, { "uuid": "4929556a-1320-434c-a254-c7e60ae31988", "name": "CIVETONE", "stdName": "CIVETONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2547bc61-8b03-4416-8c37-4f409a246d32", "e1753de3-b1f9-4300-9341-87d78f001b81", "90213484-37e4-4165-aeb7-b01cf32bd33b", "67572a90-edf8-429d-a668-0bc458b9c6da" ], "display_name": true }, { "uuid": "79783419-6cb8-4a32-beeb-5779bfe8e2ab", "name": "CIVETONE [MI]", "stdName": "CIVETONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2547bc61-8b03-4416-8c37-4f409a246d32", "90213484-37e4-4165-aeb7-b01cf32bd33b" ], "display_name": false }, { "uuid": "6b8edbac-e3b3-45ba-908c-418239b40da6", "name": "CIVETTONE", "stdName": "CIVETTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "68102edc-d82e-4a5d-a74c-c0080e091220", "2547bc61-8b03-4416-8c37-4f409a246d32" ], "display_name": false }, { "uuid": "9279cd0a-95f5-4dc2-9433-3378768cfbc0", "name": "CYCLOHEPTADECA-9-EN-1-ONE", "stdName": "CYCLOHEPTADECA-9-EN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0c284351-43d3-474a-b119-d52f6517678d", "2547bc61-8b03-4416-8c37-4f409a246d32", "3a125f93-1810-4cde-a1ed-3102da3935be" ], "display_name": false }, { "uuid": "53fa6f67-fc6a-4b24-bc77-a650f4294fcc", "name": "CYCLOHEPTADECA-9-EN-1-ONE [FHFI]", "stdName": "CYCLOHEPTADECA-9-EN-1-ONE [FHFI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2547bc61-8b03-4416-8c37-4f409a246d32", "3a125f93-1810-4cde-a1ed-3102da3935be" ], "display_name": false }, { "uuid": "65001554-75a0-4acf-8f3a-3a16b06e8e2a", "name": "CYCLOHEPTADECA-9-EN-1-ONE, CIS-", "stdName": "CYCLOHEPTADECA-9-EN-1-ONE, CIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8226ff5f-a31a-448f-9392-a72e829d6a16" ], "display_name": false }, { "uuid": "c30c98f6-08d8-42b0-8d62-035548783c1b", "name": "FEMA NO. 3425", "stdName": "FEMA NO. 3425", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3843b906-eec3-4545-a860-5b08d170b5dc" ], "display_name": false } ], "references": [ { "uuid": "8226ff5f-a31a-448f-9392-a72e829d6a16", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3843b906-eec3-4545-a860-5b08d170b5dc", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e1753de3-b1f9-4300-9341-87d78f001b81", "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB7375103.htm", "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB7375103.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2547bc61-8b03-4416-8c37-4f409a246d32", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3a125f93-1810-4cde-a1ed-3102da3935be", "citation": "FHFI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "68102edc-d82e-4a5d-a74c-c0080e091220", "citation": "JECFA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "90213484-37e4-4165-aeb7-b01cf32bd33b", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "06fe1d5c-5bce-4235-b079-656853ab4c6a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390948000, "tags": [ "NOMEN" ] }, { "uuid": "fb02e1aa-f5df-421d-9823-c3d0db223940", "citation": "SRS import [P0K30CV1UE]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P0K30CV1UE", "doc_type": "SRS", "public_domain": true, "document_date": 1493390948000, "tags": [ "NOMEN" ] }, { "uuid": "0c284351-43d3-474a-b119-d52f6517678d", "citation": "CYCLOHEPTADECA-9-EN-1-ONE [FHFI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "67572a90-edf8-429d-a668-0bc458b9c6da", "citation": "CIVETONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0e0b54fa-397a-4ff9-fa4e-f8c227a32878", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Civetone", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bdb8c1aa-ae05-4136-9d2e-510aa5ab41c7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7577267f-8db7-1833-4ef5-3263185efe32", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f795fe99-6fd9-4175-bb81-a0d3abe20e89", "id": "f795fe99-6fd9-4175-bb81-a0d3abe20e89", "molfile": "\n Marvin 01132112502D \n\n 18 18 0 0 0 0 999 V2000\n 9.5723 -4.0751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3224 -4.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7848 -5.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3224 -6.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5346 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8224 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1195 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3797 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6623 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9618 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2516 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2516 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9618 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6623 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3797 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1195 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8224 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5346 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 18 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\nM END", "smiles": "C/1=C/CCCCCCCC(=O)CCCCCCC1", "formula": "C17H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f99c9d92-4a8a-4200-b862-288ca0b4777b" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "250.4201", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "eded6cec-0721-4317-b01d-a1cf352bebab", "version": "5", "structure": { "id": "11a80b10-1e93-4d81-829d-43ba506bd1b2", "molfile": "\n Marvin 01132101082D \n\n 18 18 0 0 0 0 999 V2000\n 9.3224 -4.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7848 -5.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3224 -6.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5346 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8224 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1195 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3797 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6623 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9618 -6.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2516 -5.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2516 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9618 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6623 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3797 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1195 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8224 -4.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5346 -5.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5723 -4.0751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 1 17 1 0 0 0 0\n 1 18 2 0 0 0 0\nM END", "smiles": "C/1=C/CCCCCCCC(=O)CCCCCCC1", "formula": "C17H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "250.4201", "optical_activity": "NONE", "references": [ "3843b906-eec3-4545-a860-5b08d170b5dc", "fb02e1aa-f5df-421d-9823-c3d0db223940" ], "stereo_centers": 0 }, "unii": "P0K30CV1UE" } ] }