{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8cba3591-3e98-4245-8fa2-4ce274561730",
          "code": "5034-77-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5034-77-5",
          "code_system": "CAS",
          "references": [
            "f90a3471-47a3-4030-a6dc-2513750b5407",
            "f71859f7-98b8-4404-8b79-bf784827ee0c"
          ]
        },
        {
          "uuid": "614d824f-916b-348f-1249-25e75c71fc02",
          "code": "C902",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Alkylating Agent[C1590]|Triazene Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C902",
          "code_system": "NCI_THESAURUS",
          "references": [
            "38019042-592a-c2ac-9c02-306b2873317d"
          ]
        },
        {
          "uuid": "d3b36f4e-4b83-6e97-30ac-a7369d2872bc",
          "code": "135478849",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135478849",
          "code_system": "PUBCHEM",
          "references": [
            "66dfa446-3f6a-7784-7c58-f5ed911c7d57"
          ]
        },
        {
          "uuid": "d0b5df27-ce14-48cf-af89-e8534b2fe7d6",
          "code": "OY338X4M2P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "04a3e08e-b9a0-0015-0302-8d8fef50d3ef",
          "code": "C2216",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2216",
          "code_system": "NCI_THESAURUS",
          "references": [
            "acdc8d1f-4979-6272-0d60-ba70ebfa6681"
          ]
        },
        {
          "uuid": "f6c08c36-abeb-fa9b-4f6e-43c7d4d22a0e",
          "code": "DTXSID001032375",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001032375",
          "code_system": "EPA CompTox",
          "references": [
            "38019042-592a-c2ac-9c02-306b2873317d"
          ]
        },
        {
          "uuid": "45475df9-6d1b-25db-9e3e-97964e9cd8da",
          "code": "82196",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=82196",
          "code_system": "NSC",
          "references": [
            "3f7f83c0-5727-d6a9-7bcd-646953175ead"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5b6e4fc8-9337-4100-88a8-9675f522f5cb",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ad13fc3a-5a8a-42d0-a9ee-9d097ab57bba",
            "refuuid": "ff953749-ca22-44af-bbf7-56c52573ea87",
            "name": "IMIDAZOLE MUSTARD DIHYDROCHLORIDE",
            "unii": "21SF0YTX64",
            "linking_id": "21SF0YTX64",
            "ref_pname": "IMIDAZOLE MUSTARD DIHYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d4023176-c9a3-4c54-9a21-88c53a9feafe",
          "type": "ACTIVE MOIETY",
          "references": [
            "53956e20-e4ab-9d0e-d1a8-74892e2a5142"
          ],
          "related_substance": {
            "uuid": "9a2bb93e-9106-4937-bf7f-50c694222d69",
            "refuuid": "c932f1e7-f528-4f9a-bfa4-616ed2307d26",
            "name": "5-(3,3-BIS(2-CHLORETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
            "unii": "OY338X4M2P",
            "linking_id": "OY338X4M2P",
            "ref_pname": "5-(3,3-BIS(2-CHLORETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70355aaf-fe22-4df0-9fd1-8daeb6175795",
          "name": "1H-IMIDAZOLE-4-CARBOXAMIDE, 5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENYL)-",
          "stdName": "1H-IMIDAZOLE-4-CARBOXAMIDE, 5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9662f27-9e1c-45ac-b0c6-d231d90aa435",
            "bb6603d4-069b-44be-80b9-17046f09f4ac"
          ],
          "display_name": false
        },
        {
          "uuid": "2f6e2f30-9c48-4c16-a78f-b154ba461ce7",
          "name": "5-(3,3-BIS(2-CHLORETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
          "stdName": "5-(3,3-BIS(2-CHLORETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9662f27-9e1c-45ac-b0c6-d231d90aa435",
            "bb6603d4-069b-44be-80b9-17046f09f4ac"
          ],
          "display_name": true
        },
        {
          "uuid": "d965453f-3174-4977-81b6-7aaf88c7079e",
          "name": "5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
          "stdName": "5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENO)IMIDAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa640d9f-8cc3-5c4c-a5d0-6cd0b3e24319"
          ],
          "display_name": false
        },
        {
          "uuid": "836b04d2-f1ac-126c-5887-63416099385f",
          "name": "BIC",
          "stdName": "BIC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa640d9f-8cc3-5c4c-a5d0-6cd0b3e24319",
            "c9662f27-9e1c-45ac-b0c6-d231d90aa435"
          ],
          "display_name": false
        },
        {
          "uuid": "dcaf4aae-20b8-698a-e22c-2ca2e9933442",
          "name": "IMIDAZOLE MUSTARD",
          "stdName": "IMIDAZOLE MUSTARD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53956e20-e4ab-9d0e-d1a8-74892e2a5142",
            "f71859f7-98b8-4404-8b79-bf784827ee0c"
          ],
          "display_name": false
        },
        {
          "uuid": "a9e970f6-af05-40f6-8891-eef0ba292a11",
          "name": "IMIDAZOLE-4-CARBOXAMIDE, 5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENO)-",
          "stdName": "IMIDAZOLE-4-CARBOXAMIDE, 5-(3,3-BIS(2-CHLOROETHYL)-1-TRIAZENO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9662f27-9e1c-45ac-b0c6-d231d90aa435",
            "bb6603d4-069b-44be-80b9-17046f09f4ac"
          ],
          "display_name": false
        },
        {
          "uuid": "99018b36-1108-4723-8592-389ce490a5ac",
          "name": "NSC-82196",
          "stdName": "NSC-82196",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9662f27-9e1c-45ac-b0c6-d231d90aa435",
            "9a1c2147-b9ff-4360-b79e-d03b424006fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bb6603d4-069b-44be-80b9-17046f09f4ac",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9662f27-9e1c-45ac-b0c6-d231d90aa435",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a1c2147-b9ff-4360-b79e-d03b424006fe",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f90a3471-47a3-4030-a6dc-2513750b5407",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389677000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa640d9f-8cc3-5c4c-a5d0-6cd0b3e24319",
          "citation": "imidazole mustard",
          "url": "https://www.cancer.gov/publications/dictionaries/cancer-drug/def/imidazole-mustard",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38019042-592a-c2ac-9c02-306b2873317d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "53956e20-e4ab-9d0e-d1a8-74892e2a5142",
          "citation": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2216",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2216",
          "doc_type": "NCI THESAURUS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f71859f7-98b8-4404-8b79-bf784827ee0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "acdc8d1f-4979-6272-0d60-ba70ebfa6681",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "66dfa446-3f6a-7784-7c58-f5ed911c7d57",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a6596245-d55b-403a-aa26-d8a306b3ceb3",
          "citation": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2216",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2216",
          "doc_type": "NCI THESAURUS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f7f83c0-5727-d6a9-7bcd-646953175ead",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dbee2b30-75b3-9797-081a-987306ce527f",
          "id": "dbee2b30-75b3-9797-081a-987306ce527f",
          "molfile": "\n  Marvin  01132111242D          \n\n 17 17  0  0  0  0            999 V2000\n   15.1996   -5.2463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0201   -5.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3556   -6.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5050   -4.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3300   -4.6651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5850   -3.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9174   -3.3956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2500   -3.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4655   -3.6256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8524   -4.1776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0678   -3.9227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4546   -4.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6262   -5.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0131   -5.8336    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.8962   -3.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1116   -2.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9400   -2.0538    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  8  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "C(CN(CCCl)/N=N/c1c(C(=O)N)nc[nH]1)Cl",
          "formula": "C8H12Cl2N6O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3c8d634a-f321-47a7-8d4c-a9ceae24666f"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "279.1267",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c932f1e7-f528-4f9a-bfa4-616ed2307d26",
      "version": "17",
      "structure": {
        "id": "bc4edb55-c5ca-497d-9178-2c6c9b79dd63",
        "molfile": "L-Phenylalaninamide, N-[(phenylmethoxy)carbonyl]-L-tryptophyl-L-methionyl-L-....\n  Marvin  01132109442D          \n\n 17 17  0  0  0  0            999 V2000\n   15.1996   -5.2463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0201   -5.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3556   -6.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5050   -4.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3300   -4.6651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5850   -3.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9174   -3.3956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2500   -3.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4655   -3.6256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8524   -4.1776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0678   -3.9227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4546   -4.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6262   -5.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0131   -5.8336    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.8962   -3.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1116   -2.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9400   -2.0538    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "C(CN(CCCl)/N=N/c1c(C(=O)N)nc[nH]1)Cl",
        "formula": "C8H12Cl2N6O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "279.1267",
        "optical_activity": "NONE",
        "references": [
          "fa640d9f-8cc3-5c4c-a5d0-6cd0b3e24319",
          "c9662f27-9e1c-45ac-b0c6-d231d90aa435"
        ],
        "stereo_centers": 0,
        "stereo_comments": "Assumed E-isomer (MM2 minimum energy E and Z-isomers are 17.3896 and 27.8060 kcal/mol"
      },
      "unii": "OY338X4M2P"
    }
  ]
}