{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1aa52a33-7c07-479d-aec1-b44df0472113", "code": "131929-60-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=131929-60-7", "code_system": "CAS", "references": [ "d42f885a-63f1-479b-90ce-d961e91f7dfd", "727bfd39-98bc-459c-9744-73f13872d5ce" ] }, { "uuid": "ef1af15c-6f37-4250-acab-11e1c3b4dff9", "code": "C101537", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C101537", "code_system": "NCI_THESAURUS", "references": [ "d42f885a-63f1-479b-90ce-d961e91f7dfd" ] }, { "uuid": "10e807f1-ccf3-46c7-a02b-9e999ed2b6f1", "code": "129102", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3754", "code_system": "EPA PESTICIDE CODE", "references": [ "d42f885a-63f1-479b-90ce-d961e91f7dfd" ] }, { "uuid": "3f66940d-5191-4eae-976b-cfc1de29f9e0", "code": "m10147", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10147?q=authorize", "code_system": "MERCK INDEX", "references": [ "d42f885a-63f1-479b-90ce-d961e91f7dfd" ] }, { "uuid": "83a397a1-39f8-4df4-8501-e05450cc4452", "code": "443059", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/443059", "code_system": "PUBCHEM", "references": [ "d42f885a-63f1-479b-90ce-d961e91f7dfd" ] }, { "uuid": "3a4d80a9-b971-7d39-0084-4b4f4bc7bf9f", "code": "7006", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7006", "code_system": "HSDB", "references": [ "d34c30c6-326b-2328-39e9-d3a333d87525" ] }, { "uuid": "7a7b1d0c-7712-e65d-a0db-6feed990d8f8", "code": "DTXSID8037598", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8037598", "code_system": "EPA CompTox", "references": [ "f1f4dfe0-9e67-8c5c-6f32-9727ed97e980" ] }, { "uuid": "73abae23-c081-4d5e-36c0-b51f7600fbda", "code": "C737", "comments": "Industrial Aid[C45678]|Pesticide", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737", "code_system": "NCI_THESAURUS", "references": [ "2bcbf820-3a61-e1b3-6ddb-cc9dd6419bf6" ] }, { "uuid": "fd04411f-74cf-4118-bb77-1df3760f54ec", "code": "OY0L59V61N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c8baf1a0-0607-7027-12df-f719002c5974", "code": "9230", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9230", "code_system": "CHEBI", "references": [ "2bcbf820-3a61-e1b3-6ddb-cc9dd6419bf6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2fce1a8b-1d6c-4924-b33d-a6fd351f7165", "name": "SPINOSAD FACTOR A", "stdName": "SPINOSAD FACTOR A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "16546509-5fac-4269-9547-90414aa7715c", "555cc866-5df4-47f2-8113-d2103ea4ef04", "44bbc4cd-2c1d-4f3e-9228-ffa73755a6f9", "7bb98c91-3719-4f47-9933-b06e8fbb2ea4" ], "display_name": true }, { "uuid": "a147e1f0-f654-46e6-9243-3d15dad788e7", "name": "SPINOSAD FACTOR A [HSDB]", "stdName": "SPINOSAD FACTOR A [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "16546509-5fac-4269-9547-90414aa7715c", "555cc866-5df4-47f2-8113-d2103ea4ef04" ], "display_name": false }, { "uuid": "d927c3ec-0d13-4c9d-98dc-80c5d854069d", "name": "SPINOSYNS [MI]", "stdName": "SPINOSYNS [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "555cc866-5df4-47f2-8113-d2103ea4ef04", "c9f71af6-a478-4644-9999-dc4649bbbc29" ], "display_name": false } ], "references": [ { "uuid": "7bb98c91-3719-4f47-9933-b06e8fbb2ea4", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c9f71af6-a478-4644-9999-dc4649bbbc29", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "555cc866-5df4-47f2-8113-d2103ea4ef04", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "16546509-5fac-4269-9547-90414aa7715c", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d42f885a-63f1-479b-90ce-d961e91f7dfd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390150000, "tags": [ "NOMEN" ] }, { "uuid": "354756dc-e0b9-4bb2-9b5c-05c98279d18c", "citation": "SRS import [OY0L59V61N]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OY0L59V61N", "doc_type": "SRS", "public_domain": true, "document_date": 1493390150000, "tags": [ "NOMEN" ] }, { "uuid": "44bbc4cd-2c1d-4f3e-9228-ffa73755a6f9", "citation": "SPINOSAD FACTOR A [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d34c30c6-326b-2328-39e9-d3a333d87525", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+131929-60-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f1f4dfe0-9e67-8c5c-6f32-9727ed97e980", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131929-60-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2bcbf820-3a61-e1b3-6ddb-cc9dd6419bf6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "727bfd39-98bc-459c-9744-73f13872d5ce", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c9fbf7f2-9b0c-460f-a6c8-ddbaf2be3ba7", "id": "c9fbf7f2-9b0c-460f-a6c8-ddbaf2be3ba7", "molfile": "\n Marvin 01132110262D \n\n 52 57 0 0 1 0 999 V2000\n 6.8821 -3.6997 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.7007 -4.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8800 -4.5795 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.3882 -5.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5696 -5.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2432 -4.3893 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.4660 -4.1293 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.7538 -4.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7474 -5.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4609 -5.7836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0305 -5.7739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3198 -5.3556 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 0.6006 -5.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1126 -5.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3245 -4.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6166 -4.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6166 -3.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3264 -2.8843 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1.3242 -2.0574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6068 -1.6457 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -0.1076 -2.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8254 -1.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8256 -0.8143 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -1.5409 -0.3992 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -1.5393 0.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2581 -0.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1080 -0.4042 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -0.1071 0.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6051 -0.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0450 -3.2992 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.0452 -4.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7590 -2.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7614 -2.0596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4741 -3.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2603 -3.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7372 -3.7289 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.5554 -3.8195 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.1770 -3.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5923 -3.2817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5865 -2.4577 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.8700 -2.0531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8677 -1.2263 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.1516 -0.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5804 -0.8105 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.5747 0.0147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2878 0.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2951 -1.2213 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.0038 -0.8007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7226 -1.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2990 -2.0419 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.0155 -2.4460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7256 -2.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 38 1 0 0 0 0\n 1 39 1 6 0 0 0\n 3 2 1 1 0 0 0\n 3 4 1 0 0 0 0\n 37 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 1 0 0 0\n 6 7 1 0 0 0 0\n 6 36 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 34 1 6 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 1 0 0 0\n 15 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 30 1 0 0 0 0\n 20 19 1 1 0 0 0\n 20 21 1 0 0 0 0\n 20 29 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 6 0 0 0\n 23 27 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 27 28 1 1 0 0 0\n 27 29 1 0 0 0 0\n 30 31 1 6 0 0 0\n 30 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 34 32 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 1 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 6 0 0 0\n 40 39 1 6 0 0 0\n 40 41 1 0 0 0 0\n 50 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 42 43 1 1 0 0 0\n 44 42 1 0 0 0 0\n 44 45 1 6 0 0 0\n 44 47 1 0 0 0 0\n 45 46 1 0 0 0 0\n 47 48 1 1 0 0 0\n 47 50 1 0 0 0 0\n 48 49 1 0 0 0 0\n 50 51 1 1 0 0 0\n 51 52 1 0 0 0 0\nM END", "smiles": "CC[C@H]1CCC[C@@H]([C@@H](C)C(=O)C2=C[C@@H]3[C@@H](C=C[C@@H]4C[C@H](C[C@H]43)O[C@H]5[C@@H]([C@@H]([C@H]([C@H](C)O5)OC)OC)OC)[C@@H]2CC(=O)O1)O[C@H]6CC[C@@H]([C@@H](C)O6)N(C)C", "formula": "C41H65NO10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2826be40-0555-4a77-8ca0-0b14f2fb846e" }, "defined_stereo": 17, "ez_centers": 0, "molecular_weight": "731.9571", "optical_activity": "UNSPECIFIED", "stereo_centers": 17 } ], "definition_level": "COMPLETE", "uuid": "fba7286a-b683-4608-acc0-bb07803f9fb0", "version": "6", "structure": { "id": "b72c4d7c-9d24-4b7f-9dd5-c3dc50e7afa1", "molfile": "\n Marvin 01132109292D \n\n 59 64 0 0 1 0 999 V2000\n 6.8816 -3.6994 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.5917 -3.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5859 -2.4575 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2984 -2.0417 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2945 -1.2212 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.5798 -0.8104 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.8672 -1.2262 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8695 -2.0529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8796 -4.5792 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.2042 -5.3391 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5579 -2.9922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5550 -3.8192 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.7397 -2.9017 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7368 -3.7286 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2429 -4.3890 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.2400 -5.2160 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4657 -4.1290 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.4627 -4.9559 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6166 -3.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6166 -4.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3263 -2.8841 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0448 -3.2990 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.7588 -2.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3244 -4.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3197 -5.3552 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0303 -5.7735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7472 -5.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7536 -4.5381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4738 -3.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2600 -3.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7612 -2.0594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0450 -4.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3241 -2.0572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6068 -1.6456 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.4606 -5.7832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6006 -5.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1126 -5.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5693 -5.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3878 -5.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7002 -4.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1765 -3.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6051 -0.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1080 -0.4042 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.8255 -0.8142 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.8253 -1.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1076 -2.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5408 -0.3992 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n -1.5392 0.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2579 -0.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1071 0.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6020 -2.4721 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0148 -2.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7249 -2.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0031 -0.8006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7219 -1.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5741 0.0147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2872 0.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1511 -0.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3018 -2.8695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23 31 2 0 0 0 0\n 17 18 1 1 0 0 0\n 22 32 1 6 0 0 0\n 19 20 1 0 0 0 0\n 21 33 1 6 0 0 0\n 9 10 1 6 0 0 0\n 33 34 1 0 0 0 0\n 2 3 1 0 0 0 0\n 27 35 2 0 0 0 0\n 3 4 1 0 0 0 0\n 25 36 1 1 0 0 0\n 19 21 1 0 0 0 0\n 36 37 1 0 0 0 0\n 14 15 1 0 0 0 0\n 20 24 1 0 0 0 0\n 22 21 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 9 1 0 0 0 0\n 12 9 1 0 0 0 0\n 1 2 1 6 0 0 0\n 12 11 1 1 0 0 0\n 9 40 1 0 0 0 0\n 40 1 1 0 0 0 0\n 1 41 1 0 0 0 0\n 41 12 1 0 0 0 0\n 22 23 1 0 0 0 0\n 34 42 1 0 0 0 0\n 28 17 1 0 0 0 0\n 29 23 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 14 13 1 6 0 0 0\n 34 46 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 5 6 1 0 0 0 0\n 44 47 1 6 0 0 0\n 6 7 1 0 0 0 0\n 47 48 1 0 0 0 0\n 24 25 1 0 0 0 0\n 47 49 1 0 0 0 0\n 25 26 1 0 0 0 0\n 43 50 1 1 0 0 0\n 26 27 1 0 0 0 0\n 34 51 1 6 0 0 0\n 27 28 1 0 0 0 0\n 4 52 1 1 0 0 0\n 29 17 1 0 0 0 0\n 52 53 1 0 0 0 0\n 15 16 1 6 0 0 0\n 5 54 1 1 0 0 0\n 7 8 1 0 0 0 0\n 54 55 1 0 0 0 0\n 17 15 1 0 0 0 0\n 6 56 1 6 0 0 0\n 14 30 1 0 0 0 0\n 56 57 1 0 0 0 0\n 30 29 2 0 0 0 0\n 7 58 1 1 0 0 0\n 3 59 1 1 0 0 0\nM END", "smiles": "CC[C@H]1CCC[C@@H]([C@@H](C)C(=O)C2=C[C@]3([H])[C@@]([H])(C=C[C@]4([H])C[C@H](C[C@]43[H])O[C@@]5([H])[C@@H]([C@@H]([C@H]([C@H](C)O5)OC)OC)OC)[C@]2([H])CC(=O)O1)O[C@@]6([H])CC[C@@H]([C@@H](C)O6)N(C)C", "formula": "C41H65NO10", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 17, "ez_centers": 0, "molecular_weight": "731.9571", "optical_activity": "UNSPECIFIED", "references": [ "354756dc-e0b9-4bb2-9b5c-05c98279d18c", "7bb98c91-3719-4f47-9933-b06e8fbb2ea4" ], "stereo_centers": 17 }, "unii": "OY0L59V61N" } ] }