{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "46ddd156-ddee-4588-99c3-a1612dbe1d49", "code": "72007-81-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=72007-81-9", "code_system": "CAS", "references": [ "287e1ca7-d4ac-4e5b-b696-4fb5871d9924", "64923ed9-a1d8-45de-b597-d61a13807a56" ] }, { "uuid": "5884feab-db49-4307-b652-d43cf696f14e", "code": "276-282-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.069.326", "code_system": "ECHA (EC/EINECS)", "references": [ "287e1ca7-d4ac-4e5b-b696-4fb5871d9924" ] }, { "uuid": "d9cd089a-f293-4f2b-9870-d6ef0001e632", "code": "160065", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160065", "code_system": "PUBCHEM", "references": [ "287e1ca7-d4ac-4e5b-b696-4fb5871d9924" ] }, { "uuid": "179cb24a-770f-8ca9-24a7-f33e74237428", "code": "DTXSID10888033", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10888033", "code_system": "EPA CompTox", "references": [ "5386853b-536a-3611-21f6-c1c33af956af" ] }, { "uuid": "d1ad4528-9f6c-400a-9ac5-4861f6e9e34d", "code": "OX1DN3B7LS", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "0ac99793-af20-42da-970d-eda0aca95d17", "name": "1-ETHYL-1-METHYL-3-PHENYLPROPYL ACETATE", "stdName": "1-ETHYL-1-METHYL-3-PHENYLPROPYL ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "41aae471-c788-49fa-9094-8d70ff9aae0c" ], "display_name": true }, { "uuid": "856d7f6a-d10f-41d4-bea8-a00660f35a43", "name": "1-PHENYL-3-METHYL-3-PENTANYL ACETATE", "stdName": "1-PHENYL-3-METHYL-3-PENTANYL ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f053ca8f-9f76-4dde-804c-7a671cc667c6" ], "display_name": false }, { "uuid": "f0a7cb82-183d-4ac7-ba5e-083b4a6009e0", "name": "BENZENEPROPANOL, .ALPHA.-ETHYL-.ALPHA.-METHYL-, 1-ACETATE", "stdName": "BENZENEPROPANOL, .ALPHA.-ETHYL-.ALPHA.-METHYL-, 1-ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f053ca8f-9f76-4dde-804c-7a671cc667c6" ], "display_name": false } ], "references": [ { "uuid": "41aae471-c788-49fa-9094-8d70ff9aae0c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f053ca8f-9f76-4dde-804c-7a671cc667c6", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "287e1ca7-d4ac-4e5b-b696-4fb5871d9924", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392579000, "tags": [ "NOMEN" ] }, { "uuid": "b591794c-d81e-46d2-8099-fd6ae92c8fb8", "citation": "SRS import [OX1DN3B7LS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OX1DN3B7LS", "doc_type": "SRS", "public_domain": true, "document_date": 1493392579000, "tags": [ "NOMEN" ] }, { "uuid": "64923ed9-a1d8-45de-b597-d61a13807a56", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5386853b-536a-3611-21f6-c1c33af956af", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6c71ce04-1fee-49e1-a3bc-7e64d3782131", "id": "6c71ce04-1fee-49e1-a3bc-7e64d3782131", "molfile": "\n Marvin 01132105382D \n\n 16 16 0 0 0 0 999 V2000\n 5.9992 -6.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7463 -6.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8168 -5.6321 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.8873 -4.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5639 -5.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2405 -5.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9876 -5.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0582 -4.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8053 -4.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4818 -4.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4113 -5.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6642 -5.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1402 -5.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3931 -5.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7165 -5.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3226 -6.3319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 13 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\nM END", "smiles": "CCC(C)(CCc1ccccc1)OC(=O)C", "formula": "C14H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0cada8ce-e9e4-4f51-9f5a-c3368364a24f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.3079", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "ef551cc5-26cd-425c-a26f-746d88ec17cd", "version": "6", "structure": { "id": "fb3ed6a0-a84d-44f3-8f15-a88cce7ef48c", "molfile": "\n Marvin 01132113012D \n\n 16 16 0 0 0 0 999 V2000\n 8.9876 -5.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2405 -5.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5639 -5.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8168 -5.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1402 -5.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3931 -5.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7165 -5.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3226 -6.3319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8873 -4.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7463 -6.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9992 -6.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0582 -4.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8053 -4.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4818 -4.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4113 -5.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6642 -5.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 4 9 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 10 1 0 0 0 0\n 1 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 1 16 2 0 0 0 0\nM END", "smiles": "CCC(C)(CCc1ccccc1)OC(=O)C", "formula": "C14H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.3079", "optical_activity": "( + / - )", "references": [ "b591794c-d81e-46d2-8099-fd6ae92c8fb8", "41aae471-c788-49fa-9094-8d70ff9aae0c" ], "stereo_centers": 1 }, "unii": "OX1DN3B7LS" } ] }