{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "77f82712-1bb7-4c43-8044-6348d32822a4", "code": "158567-65-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=158567-65-8", "code_system": "CAS", "references": [ "d3e7d2bc-ba66-4cf5-8d31-ef566b2f14d7", "cd2f0c46-41c8-4919-b4bc-fc526a270fc8" ] }, { "uuid": "ea2a2929-92f8-4e05-96fc-6786c3edb85b", "code": "71587547", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587547", "code_system": "PUBCHEM", "references": [ "d3e7d2bc-ba66-4cf5-8d31-ef566b2f14d7" ] }, { "uuid": "bc21c667-d33b-44ca-9791-f86498a65aa3", "code": "OWP0UL2B67", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2de5703a-6482-3ca0-b802-50230d8e5e0d", "code": "DTXSID50166468", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50166468", "code_system": "EPA CompTox", "references": [ "bd355606-4a04-4673-c685-da6d6f58b21c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "80379914-956f-4694-a72e-2d57c348b5df", "name": "CHOLESTAN-3-OL, 2-OCTYLDECANOATE, (3.BETA.,5.ALPHA.)-", "stdName": "CHOLESTAN-3-OL, 2-OCTYLDECANOATE, (3.BETA.,5.ALPHA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "db569ae8-69a9-4dbd-8598-e6328f177674", "31984be2-4c7d-4514-ab9d-caae2a24d3d6" ], "display_name": false }, { "uuid": "ee140d3f-00db-408a-bbeb-f42de0a8db64", "name": "DIHYDROCHOLESTERYL 2-OCTYLDECANOATE", "stdName": "DIHYDROCHOLESTERYL 2-OCTYLDECANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "db569ae8-69a9-4dbd-8598-e6328f177674", "31984be2-4c7d-4514-ab9d-caae2a24d3d6" ], "display_name": false }, { "uuid": "1a7b443d-f098-45a2-a276-99c1b2431210", "name": "DIHYDROCHOLESTERYL OCTYLDECANOATE", "stdName": "DIHYDROCHOLESTERYL OCTYLDECANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "db569ae8-69a9-4dbd-8598-e6328f177674", "f3d4c68b-191b-4779-85a6-c1dc76b0532d", "cf10166a-8fe7-4bea-8250-3436536a5e84" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "110f6d7a-a32b-4143-adb6-76fea90b65fe", "name_org": "INCI" } ] }, { "uuid": "4565f5cc-7ccc-42d5-aa93-a71df1eedd02", "name": "NIKKOL DCIS", "stdName": "NIKKOL DCIS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "db569ae8-69a9-4dbd-8598-e6328f177674", "31984be2-4c7d-4514-ab9d-caae2a24d3d6" ], "display_name": false }, { "uuid": "8e31f34a-203d-4649-9849-4df18626a7e5", "name": "OCTYLDECANOIC ACID, DIHYDROCHOLESTERYL ESTER", "stdName": "OCTYLDECANOIC ACID, DIHYDROCHOLESTERYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "db569ae8-69a9-4dbd-8598-e6328f177674", "cf10166a-8fe7-4bea-8250-3436536a5e84" ], "display_name": false } ], "references": [ { "uuid": "cf10166a-8fe7-4bea-8250-3436536a5e84", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "db569ae8-69a9-4dbd-8598-e6328f177674", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "31984be2-4c7d-4514-ab9d-caae2a24d3d6", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3e7d2bc-ba66-4cf5-8d31-ef566b2f14d7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "15354402-6143-4567-ac05-fe87a0245ec8", "citation": "SRS import [OWP0UL2B67]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OWP0UL2B67", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "f3d4c68b-191b-4779-85a6-c1dc76b0532d", "citation": "DIHYDROCHOLESTERYL OCTYLDECANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a390250d-b740-a6c4-570f-94a87d19a163", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=158567-65-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cd2f0c46-41c8-4919-b4bc-fc526a270fc8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bd355606-4a04-4673-c685-da6d6f58b21c", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5c33bccb-226b-45a8-adb1-358fa1519a12", "id": "5c33bccb-226b-45a8-adb1-358fa1519a12", "molfile": "\n Marvin 01132104472D \n\n 47 50 0 0 1 0 999 V2000\n 8.4684 -10.3121 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.7270 -9.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1524 -9.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -9.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7788 -8.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7213 -7.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9797 -7.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4052 -7.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5260 -11.1352 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.0110 -11.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5260 -12.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -12.2151 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.0269 -12.6276 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.0269 -13.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -13.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -13.4526 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.8835 -13.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -13.4526 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.1690 -12.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -12.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -12.6276 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.5980 -11.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -12.2151 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.3125 -11.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -10.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -11.3901 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.8276 -10.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4546 -13.8651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4546 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7401 -15.1026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4559 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1703 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4559 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1703 -14.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8848 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 9 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 1 0 0 0\n 26 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 1 0 0 0\n 13 12 1 0 0 0 0\n 12 26 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 23 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 1 0 0 0\n 21 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 28 1 1 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 1 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 40 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)C(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1", "formula": "C45H82O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5cb1fa83-75bb-4e33-85b3-f0a36ff2789b" }, "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "655.1331", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "b68b00be-f7d9-4459-b440-510e15167de1", "version": "6", "structure": { "id": "b73b82ac-a47c-4de4-894d-7508ca4908ee", "molfile": "\n Marvin 01132109292D \n\n 52 55 0 0 1 0 999 V2000\n 7.7414 -11.3901 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8276 -10.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5260 -11.1352 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.2405 -10.7226 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4684 -10.3121 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7270 -9.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1524 -9.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0949 -9.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7788 -8.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7213 -7.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9797 -7.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4052 -7.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0110 -11.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5260 -12.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -12.2151 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8276 -13.0356 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -12.6276 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.0269 -11.8026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -13.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -13.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -13.4526 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5980 -14.2776 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -13.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -13.4526 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.4546 -13.8651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4546 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7401 -15.1026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1690 -12.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -12.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -12.6276 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5980 -11.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -12.2151 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.3125 -11.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -10.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -13.0401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4559 -15.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1703 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8835 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5980 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3125 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0269 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7414 -14.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4559 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1703 -14.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8848 -15.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 3 4 1 6 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 6 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 3 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 6 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 17 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 6 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 1 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 24 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 1 0 0 0\n 21 33 1 0 0 0 0\n 33 35 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 1 1 0 0 0 0\n 35 38 1 6 0 0 0\n 35 17 1 0 0 0 0\n 15 1 1 0 0 0 0\n 30 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 28 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)C(=O)O[C@H]1CC[C@@]2(C)[C@@]([H])(CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@]32[H])C1", "formula": "C45H82O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "655.1331", "optical_activity": "UNSPECIFIED", "references": [ "31984be2-4c7d-4514-ab9d-caae2a24d3d6", "15354402-6143-4567-ac05-fe87a0245ec8" ], "stereo_centers": 9 }, "unii": "OWP0UL2B67" } ] }