{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e50493f2-bcfc-4f54-8e0c-d51bca691c90", "code": "67516108", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67516108", "code_system": "PUBCHEM", "references": [ "71e42588-c15b-3a33-8c11-6026bac59095", "a840aa51-00fc-2c55-5826-7389da711bb4" ] }, { "uuid": "a7ec0080-ed33-43a8-b9b1-3d7230c12ffb", "code": "1374760-95-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1374760-95-8", "code_system": "CAS", "references": [ "a840aa51-00fc-2c55-5826-7389da711bb4", "71e42588-c15b-3a33-8c11-6026bac59095" ] }, { "uuid": "34efecf9-429b-45c8-988e-5d34ca01c69f", "code": "OW22Q34GIJ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9680fc5c-84ef-0e4a-6eee-917dcefd1b27", "code": "DTXSID501019712", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501019712", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "df792041-68e6-37ce-3b25-ee03304cbbc0", "name": "2-(4-METHYLPHENOXY)-N-(1H-PYRAZOL-3-YL)-N-(THIOPHEN-2-YLMETHYL)ACETAMIDE", "stdName": "2-(4-METHYLPHENOXY)-N-(1H-PYRAZOL-3-YL)-N-(THIOPHEN-2-YLMETHYL)ACETAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "71e42588-c15b-3a33-8c11-6026bac59095", "a840aa51-00fc-2c55-5826-7389da711bb4" ], "display_name": true }, { "uuid": "692fb826-bc2e-8a0d-5b9c-cf6198b107be", "name": "FEMA NO. 4809", "stdName": "FEMA NO. 4809", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a840aa51-00fc-2c55-5826-7389da711bb4", "71e42588-c15b-3a33-8c11-6026bac59095" ], "display_name": false }, { "uuid": "15cad873-9c35-395c-a21b-e66031a502d5", "name": "N-(1H-PYRAZOL-5-YL)-N-(THIOPHEN-2-YLMETHYL)-2-(P-TOLYLOXY)ACETAMIDE", "stdName": "N-(1H-PYRAZOL-5-YL)-N-(THIOPHEN-2-YLMETHYL)-2-(P-TOLYLOXY)ACETAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "71e42588-c15b-3a33-8c11-6026bac59095", "a840aa51-00fc-2c55-5826-7389da711bb4" ], "display_name": false } ], "references": [ { "uuid": "71e42588-c15b-3a33-8c11-6026bac59095", "citation": "FHFI", "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a840aa51-00fc-2c55-5826-7389da711bb4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "29277269-2e01-aca3-cab1-d0200d5d1ff8", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "83970d77-1efc-d544-ed04-170cde40517a", "id": "83970d77-1efc-d544-ed04-170cde40517a", "molfile": "\n Marvin 01132106502D \n\n 23 25 0 0 0 0 999 V2000\n 13.4147 -4.4824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2154 -2.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0224 -2.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4349 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8828 -3.5806 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8437 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5581 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2725 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2725 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6140 -5.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8070 -5.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3945 -5.1725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9466 -4.5594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 8 1 0 0 0 0\n 1 19 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 18 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 16 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 14 17 1 0 0 0 0\n 16 15 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 23 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)OCC(=O)N(Cc2cccs2)c3cc[nH]n3", "formula": "C17H17N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6a755bdb-b89f-47d2-b005-5d313d221ab8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "327.4025", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bdb4e177-e6ae-4fef-9125-5dfdf0dd5cc7", "version": "8", "structure": { "id": "a5965a07-9057-1e13-d73b-9d4467fc89f5", "molfile": "Acetamide, 2-(4-methylphenoxy)-N-1H-pyrazol-3-yl-N-(2-thienylmethyl)-\n Marvin 01132108362D \n\n 23 25 0 0 0 0 999 V2000\n 13.4147 -4.4824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2154 -2.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0224 -2.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4349 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8828 -3.5806 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8437 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5581 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2725 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2725 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1291 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6140 -5.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8070 -5.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3945 -5.1725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9466 -4.5594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 8 18 2 0 0 0 0\n 1 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 19 23 2 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)OCC(=O)N(Cc2cccs2)c3cc[nH]n3", "formula": "C17H17N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "327.4025", "optical_activity": "NONE", "references": [ "71e42588-c15b-3a33-8c11-6026bac59095", "a840aa51-00fc-2c55-5826-7389da711bb4" ], "stereo_centers": 0 }, "unii": "OW22Q34GIJ" } ] }