{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "800a239f-5c32-4822-98e7-552e262b6c65", "code": "67801-42-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67801-42-7", "code_system": "CAS", "references": [ "8afe4382-194e-46c2-a05a-2188fe646764", "b83117a1-e04f-48f3-887a-791bcdea24c5" ] }, { "uuid": "f5967658-b319-434c-9f68-e00a426d1db0", "code": "267-162-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.039", "code_system": "ECHA (EC/EINECS)", "references": [ "8afe4382-194e-46c2-a05a-2188fe646764" ] }, { "uuid": "02227863-5003-8c4b-3774-1125f6be7888", "code": "DTXSID30867345", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30867345", "code_system": "EPA CompTox", "references": [ "48a80e5f-33d9-c697-25e5-95cbeb80461b" ] }, { "uuid": "10f30fd6-d416-4d2b-91be-35ad914421e5", "code": "OVO3SUJ88V", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f80a2ea0-e1e3-4100-821b-1d6ea809ca9f", "name": "BENZOIC ACID, 2-((3,5,5-TRIMETHYLHEXYLIDENE)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((3,5,5-TRIMETHYLHEXYLIDENE)AMINO)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e63cb9e7-30ec-4b32-96ca-585fd7f0cf15" ], "display_name": false }, { "uuid": "4966f457-e11b-40fa-8913-4fc1d26b0b24", "name": "ISONOMILAT 258 E", "stdName": "ISONOMILAT 258 E", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d44420d5-2885-443b-9138-321fb9b09d41" ], "display_name": false }, { "uuid": "af340c5c-bcb1-417c-b644-db1bc694c4bd", "name": "METHYL 2-(3,5,5-TRIMETHYLHEXYLIDENEAMINO)BENZOATE", "stdName": "METHYL 2-(3,5,5-TRIMETHYLHEXYLIDENEAMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5510d1cc-0ec4-431f-a93a-ff26eb0baf89" ], "display_name": true } ], "references": [ { "uuid": "e63cb9e7-30ec-4b32-96ca-585fd7f0cf15", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5510d1cc-0ec4-431f-a93a-ff26eb0baf89", "citation": "CHEMDRAW", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d44420d5-2885-443b-9138-321fb9b09d41", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8afe4382-194e-46c2-a05a-2188fe646764", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393616000, "tags": [ "NOMEN" ] }, { "uuid": "e80f34b2-7f5a-43dd-bb23-f5ef1c6a6bc4", "citation": "SRS import [OVO3SUJ88V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OVO3SUJ88V", "doc_type": "SRS", "public_domain": true, "document_date": 1493393616000, "tags": [ "NOMEN" ] }, { "uuid": "b83117a1-e04f-48f3-887a-791bcdea24c5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "48a80e5f-33d9-c697-25e5-95cbeb80461b", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ed65b77d-fe12-4dc1-b703-77d4929b54c4", "id": "ed65b77d-fe12-4dc1-b703-77d4929b54c4", "molfile": "\n Marvin 01132112172D \n\n 20 20 0 0 0 0 999 V2000\n 5.7272 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -2.0723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -0.8348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5838 -2.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8693 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1548 -2.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1548 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8693 -3.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5838 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -3.3098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -4.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -4.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -5.3723 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.2982 -5.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -5.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -6.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4416 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -7.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\nM END", "smiles": "CC(C/C=N/c1ccccc1C(=O)OC)CC(C)(C)C", "formula": "C17H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "88db6ae5-4a03-466b-b594-771e169813cc" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "275.3865", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "100d341f-2143-4354-a8be-42cb75eee95c", "version": "6", "structure": { "id": "ae67adf3-41b3-40e9-b01a-ef3f77d1967e", "molfile": "\n Marvin 01132109032D \n\n 20 20 0 0 0 0 999 V2000\n 2.1548 -2.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1548 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8693 -3.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5838 -2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5838 -2.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8693 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -0.8348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -2.0723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -3.3098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -4.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -4.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -5.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -5.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -6.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4416 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7272 -7.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0127 -7.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2982 -5.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 14 20 1 0 0 0 0\nM END", "smiles": "CC(C/C=N/c1ccccc1C(=O)OC)CC(C)(C)C", "formula": "C17H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "275.3865", "optical_activity": "( + / - )", "references": [ "e80f34b2-7f5a-43dd-bb23-f5ef1c6a6bc4", "e63cb9e7-30ec-4b32-96ca-585fd7f0cf15" ], "stereo_centers": 1 }, "unii": "OVO3SUJ88V" } ] }