{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "43188d14-8936-4b01-a00c-4aa28babaff4",
          "code": "118134-30-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118134-30-8",
          "code_system": "CAS",
          "references": [
            "1dbcaa79-746a-447e-94a2-df497771c710",
            "3e88370e-26e3-4f3a-8f78-1bc7cceac5b8"
          ]
        },
        {
          "uuid": "cf318966-4454-42df-bebc-a4001f7ed898",
          "code": "m10159",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10159?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1dbcaa79-746a-447e-94a2-df497771c710"
          ]
        },
        {
          "uuid": "e6ab0166-fcf2-4949-877b-1174f688f8d2",
          "code": "86160",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86160",
          "code_system": "PUBCHEM",
          "references": [
            "1dbcaa79-746a-447e-94a2-df497771c710"
          ]
        },
        {
          "uuid": "1588ccfc-f00d-b8c9-cde9-ed64b33c0e5d",
          "code": "DTXSID1034212",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1034212",
          "code_system": "EPA CompTox",
          "references": [
            "1a9e6837-3547-957e-0afd-c938199eda31"
          ]
        },
        {
          "uuid": "cec5a683-ff1a-4902-b63b-176d6095ce17",
          "code": "OUT5YHB7BO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2ee3f653-6595-f9e3-f774-13a6810ad896",
          "code": "9242",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9242",
          "code_system": "CHEBI",
          "references": [
            "ebb9bbf7-428b-d904-d4a5-a92ea4ee52cd"
          ]
        },
        {
          "uuid": "af408053-38db-16b4-2d17-4be4a525140f",
          "code": "spiroxamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/spiroxamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "ccf30886-7e40-7bed-64f8-9dadd7b19d72"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d04deb36-1217-4f03-9022-e966452a777e",
          "name": "1,4-DIOXASPIRO(4.5)DECANE-2-METHANAMINE, 8-(1,1-DIMETHYLETHYL)-N-ETHYL-N-PROPYL-",
          "stdName": "1,4-DIOXASPIRO(4.5)DECANE-2-METHANAMINE, 8-(1,1-DIMETHYLETHYL)-N-ETHYL-N-PROPYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6045f710-aa56-41cc-a4d5-b13d8cc0a079",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        },
        {
          "uuid": "aa7d2d1a-c7ac-4347-8916-d7e438a7b8bd",
          "name": "IMPULSE",
          "stdName": "IMPULSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6045f710-aa56-41cc-a4d5-b13d8cc0a079",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        },
        {
          "uuid": "5c862dfb-2280-413a-94ca-659188ff6fc7",
          "name": "KWG-4168",
          "stdName": "KWG-4168",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6045f710-aa56-41cc-a4d5-b13d8cc0a079",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        },
        {
          "uuid": "7abe7a7b-916a-4155-a041-0874870bfb8b",
          "name": "SPIROKETALAMINE",
          "stdName": "SPIROKETALAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6045f710-aa56-41cc-a4d5-b13d8cc0a079",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        },
        {
          "uuid": "d08fda28-5947-439b-9d48-4d7d1bf9d6c4",
          "name": "SPIROXAMINE",
          "stdName": "SPIROXAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560118a5-e9c5-4311-9b2f-0fc00626ea63",
            "964197d8-7ad0-49fa-923d-9dcc18f7a0eb",
            "eb430dce-c27d-42a8-a1ea-755eb8555b30",
            "8f508bef-c5c3-44d7-af8f-db852477b29c",
            "55442b3a-b9d4-4e59-8c67-b4c98e770d42",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": true
        },
        {
          "uuid": "9a4347f7-c6d6-4c1e-aa10-31a50bdde681",
          "name": "SPIROXAMINE [ISO]",
          "stdName": "SPIROXAMINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb430dce-c27d-42a8-a1ea-755eb8555b30",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        },
        {
          "uuid": "a1ccf336-5143-4f84-88fa-0860dbf19aec",
          "name": "SPIROXAMINE [MI]",
          "stdName": "SPIROXAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560118a5-e9c5-4311-9b2f-0fc00626ea63",
            "5faede7e-aff9-49d3-a9d0-5a65a4ff4410"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "eb430dce-c27d-42a8-a1ea-755eb8555b30",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5faede7e-aff9-49d3-a9d0-5a65a4ff4410",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6045f710-aa56-41cc-a4d5-b13d8cc0a079",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "964197d8-7ad0-49fa-923d-9dcc18f7a0eb",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "560118a5-e9c5-4311-9b2f-0fc00626ea63",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dbcaa79-746a-447e-94a2-df497771c710",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392040000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "404d6323-b1f0-4576-bc50-8d0452fea089",
          "citation": "SRS import [OUT5YHB7BO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OUT5YHB7BO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392040000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55442b3a-b9d4-4e59-8c67-b4c98e770d42",
          "citation": "SPIROXAMINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8f508bef-c5c3-44d7-af8f-db852477b29c",
          "citation": "SPIROXAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a9e6837-3547-957e-0afd-c938199eda31",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=118134-30-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ccf30886-7e40-7bed-64f8-9dadd7b19d72",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ebb9bbf7-428b-d904-d4a5-a92ea4ee52cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3e88370e-26e3-4f3a-8f78-1bc7cceac5b8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ac0a3ea-2224-4d00-b423-59336fded93a",
          "id": "4ac0a3ea-2224-4d00-b423-59336fded93a",
          "molfile": "\n  Marvin  01132103542D          \n\n 21 22  0  0  0  0            999 V2000\n    6.8037   -2.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7093   -1.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9405   -1.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8462   -0.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4990    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2533   -0.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0774   -0.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4246   -0.6818    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.4246   -1.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -1.7553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2930   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8796   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0527   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6465   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0527   -0.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8796   -0.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -0.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -1.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -0.4280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 21  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  1  0  0  0  0\n 21 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
          "smiles": "CCCN(CC)CC1COC2(CCC(CC2)C(C)(C)C)O1",
          "formula": "C18H35NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0ac6007a-b42e-4fe6-92d3-deb45e2fd3b6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "297.4767",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "20c10533-bbff-4f69-9cad-a1f7fbaccfd2",
      "version": "5",
      "structure": {
        "id": "50efcbed-4123-46eb-ae1e-c4b8b5e49a18",
        "molfile": "\n  Marvin  01132104132D          \n\n 21 22  0  0  0  0            999 V2000\n    5.8462   -0.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0774   -0.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -0.4280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4246   -0.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4246   -1.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -1.7553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2930   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8796   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0527   -1.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6465   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0527   -0.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8796   -0.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -0.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8269   -1.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4990    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2533   -0.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9405   -1.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7093   -1.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8037   -2.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 17  1  0  0  0  0\n  1 19  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "CCCN(CC)CC1COC2(CCC(CC2)C(C)(C)C)O1",
        "formula": "C18H35NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "297.4767",
        "optical_activity": "( + / - )",
        "references": [
          "964197d8-7ad0-49fa-923d-9dcc18f7a0eb",
          "404d6323-b1f0-4576-bc50-8d0452fea089"
        ],
        "stereo_centers": 1
      },
      "unii": "OUT5YHB7BO"
    }
  ]
}