{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bb3c6945-4769-4838-b75f-03be1103f720",
          "code": "60555-57-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60555-57-9",
          "code_system": "CAS",
          "references": [
            "2f74088f-7904-4cd0-a254-9f0194ea723b",
            "8d0baeb9-b649-4709-8c2e-7751afbce7d8"
          ]
        },
        {
          "uuid": "0e7d9717-1ebc-4c45-8853-bb3cb4a52b64",
          "code": "262-291-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.611",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2f74088f-7904-4cd0-a254-9f0194ea723b"
          ]
        },
        {
          "uuid": "6e086b3a-d055-4382-8aaf-23ffd372292b",
          "code": "1487116",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1487116/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2f74088f-7904-4cd0-a254-9f0194ea723b"
          ]
        },
        {
          "uuid": "c214a6e5-8101-4212-8256-0b2b69a3a3b1",
          "code": "2381219",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2381219",
          "code_system": "PUBCHEM",
          "references": [
            "2f74088f-7904-4cd0-a254-9f0194ea723b"
          ]
        },
        {
          "uuid": "7f2faa8b-d8dc-4d7e-a54e-e4ccf0db0347",
          "code": "OUS14HJ3HZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a179c56-64f2-1026-8a83-70d58e740baa",
          "code": "OUS14HJ3HZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OUS14HJ3HZ",
          "code_system": "DAILYMED",
          "references": [
            "05a82aa2-a111-fa2f-7386-7c231257f8d7"
          ]
        },
        {
          "uuid": "bfcd2395-e814-5fd0-3e84-a92265262c07",
          "code": "DTXSID00975966",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00975966",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d0eca124-26e9-493b-bf68-c7ecdc672bd2",
          "name": "BENZYL PCA",
          "stdName": "BENZYL PCA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a2487e7-ec2e-4022-a064-0e50702cd961",
            "a4e1d5e7-eed2-49d0-86ff-541b9b4f2c9d",
            "1da802d9-5faf-4910-83f0-2ccdf96fd238",
            "38765490-7d17-4aa1-8ecc-9025613049a8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "df225f0a-c92d-4f61-b278-d71c30e2c503",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "76b06e8d-6bed-49a0-9d45-6d543efa82e4",
          "name": "ORISTAR BPCA",
          "stdName": "ORISTAR BPCA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e1d5e7-eed2-49d0-86ff-541b9b4f2c9d",
            "1da802d9-5faf-4910-83f0-2ccdf96fd238"
          ],
          "display_name": false
        },
        {
          "uuid": "f4072236-e495-4d57-a487-58c84143a2b2",
          "name": "PROLINE, 5-OXO-, PHENYLMETHYL ESTER",
          "stdName": "PROLINE, 5-OXO-, PHENYLMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e1d5e7-eed2-49d0-86ff-541b9b4f2c9d",
            "1da802d9-5faf-4910-83f0-2ccdf96fd238"
          ],
          "display_name": false
        },
        {
          "uuid": "fc037cce-195f-44f2-a899-312c511ac0f7",
          "name": "VAMACTIVE 52",
          "stdName": "VAMACTIVE 52",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e1d5e7-eed2-49d0-86ff-541b9b4f2c9d",
            "1da802d9-5faf-4910-83f0-2ccdf96fd238"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1da802d9-5faf-4910-83f0-2ccdf96fd238",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a4e1d5e7-eed2-49d0-86ff-541b9b4f2c9d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38765490-7d17-4aa1-8ecc-9025613049a8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f74088f-7904-4cd0-a254-9f0194ea723b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391126000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dabacb51-0823-4da9-8764-5572065d6179",
          "citation": "SRS import [OUS14HJ3HZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OUS14HJ3HZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391126000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a2487e7-ec2e-4022-a064-0e50702cd961",
          "citation": "BENZYL PCA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d0baeb9-b649-4709-8c2e-7751afbce7d8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "05a82aa2-a111-fa2f-7386-7c231257f8d7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "76efac86-b8e0-44d9-8005-3955e75c1d30",
          "id": "76efac86-b8e0-44d9-8005-3955e75c1d30",
          "molfile": "\n  Marvin  01132106112D          \n\n 16 17  0  0  1  0            999 V2000\n   12.1838   -0.5722    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.4401   -1.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2740   -1.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5350   -0.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3269   -0.3207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8594   -0.0878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4477   -0.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4477    0.6344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7396   -0.6468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0033   -0.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3092   -0.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3451   -1.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6526   -1.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9221   -1.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8846   -0.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5757   -0.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)COC(=O)[C@@H]2CCC(=O)N2",
          "formula": "C12H13NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a40130b8-906d-4db2-bc66-37f5247757c9"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "219.237",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1b4f3eae-7973-48f3-b2ed-313a901062cd",
      "version": "5",
      "structure": {
        "id": "9274a7a5-a650-4e10-8d41-33f2cfc57bd6",
        "molfile": "\n  Marvin  01132107362D          \n\n 16 17  0  0  1  0            999 V2000\n    9.3092   -0.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0033   -0.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7396   -0.6468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4477   -0.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4477    0.6344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1838   -0.5722    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.8594   -0.0878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5350   -0.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2740   -1.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4401   -1.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3269   -0.3207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3451   -1.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6526   -1.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9221   -1.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8846   -0.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5757   -0.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  1  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  1  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n  1 16  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)COC(=O)[C@@H]2CCC(=O)N2",
        "formula": "C12H13NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "219.237",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dabacb51-0823-4da9-8764-5572065d6179",
          "1da802d9-5faf-4910-83f0-2ccdf96fd238"
        ],
        "stereo_centers": 1
      },
      "unii": "OUS14HJ3HZ"
    }
  ]
}