{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "355064e8-e073-4655-8d18-85d22f11a1bd",
          "code": "554-95-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=554-95-0",
          "code_system": "CAS",
          "references": [
            "d19bbe7e-8424-491a-b40c-0e77a386bcd5",
            "b3a75f26-80e0-4465-8cdf-5c5e22293f35"
          ]
        },
        {
          "uuid": "da4e1750-0875-4e59-b62c-65ce8d26efe0",
          "code": "C069849",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67069849",
          "code_system": "MESH",
          "references": [
            "d19bbe7e-8424-491a-b40c-0e77a386bcd5"
          ]
        },
        {
          "uuid": "976b9191-b3cf-499b-a010-068a60da831c",
          "code": "TRIMESIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trimesic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "d19bbe7e-8424-491a-b40c-0e77a386bcd5"
          ]
        },
        {
          "uuid": "5b71e225-22dd-4bf4-b575-9d8603592d8e",
          "code": "209-077-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.253",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d19bbe7e-8424-491a-b40c-0e77a386bcd5"
          ]
        },
        {
          "uuid": "210c6d50-5b1f-4012-9e9b-fcd1431085f1",
          "code": "11138",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11138",
          "code_system": "PUBCHEM",
          "references": [
            "d19bbe7e-8424-491a-b40c-0e77a386bcd5"
          ]
        },
        {
          "uuid": "7f7831a9-4d2a-7466-535c-e8d156a78715",
          "code": "DTXSID8021488",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8021488",
          "code_system": "EPA CompTox",
          "references": [
            "c6e1bb05-2cc7-49ee-59d1-9b95a1bbb956"
          ]
        },
        {
          "uuid": "58f4bb30-d1c5-c5c4-48b9-08decfce6617",
          "code": "DB08632",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08632",
          "code_system": "DRUG BANK",
          "references": [
            "394f186e-afb2-5368-198d-220c3aab7a8c"
          ]
        },
        {
          "uuid": "99de3116-752e-472c-ac2d-d6c4843fcb70",
          "code": "OU36OO5MTN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "349470b7-ec6f-1638-03eb-f1e7bf2b1a6c",
          "code": "46032",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:46032",
          "code_system": "CHEBI",
          "references": [
            "394f186e-afb2-5368-198d-220c3aab7a8c"
          ]
        },
        {
          "uuid": "707c0b56-e0ea-8d84-dd14-ed308b51d570",
          "code": "3998",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3998",
          "code_system": "NSC",
          "references": [
            "bc851f66-3521-581d-2823-b026ed91d591"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b42528a7-09c9-4d23-8881-f8670cde4764",
          "name": "1,3,5-BENZENETRICARBOXYLIC ACID",
          "stdName": "1,3,5-BENZENETRICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c10a0c-e5bd-45f2-86e1-f7d16e9ad27c"
          ],
          "display_name": true
        },
        {
          "uuid": "97e3df01-9da0-40d4-a3e2-9ab61029497b",
          "name": "1,3,5-TRICARBOXYBENZENE",
          "stdName": "1,3,5-TRICARBOXYBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false
        },
        {
          "uuid": "82e053ad-a5d9-489a-83f4-85a2e5e3d90a",
          "name": "5-CARBOXYISOPHTHALIC ACID",
          "stdName": "5-CARBOXYISOPHTHALIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false
        },
        {
          "uuid": "02f4b130-9106-4f60-a96a-2912e3ba1545",
          "name": "NSC-3998",
          "stdName": "NSC-3998",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false
        },
        {
          "uuid": "874eedc2-f69f-4d54-b8c2-9b58b38bdfff",
          "name": "TRIMESIC ACID",
          "stdName": "TRIMESIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "64de134f-91f7-45d3-a9d2-6405416d5e1f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "375a37d2-da26-49e6-8641-08e326806758",
          "name": "TRIMESINIC ACID",
          "stdName": "TRIMESINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false
        },
        {
          "uuid": "31e99734-0a00-4dce-974c-eb638381a2f7",
          "name": "TRIMESITINIC ACID",
          "stdName": "TRIMESITINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502bdf79-45a3-400e-85ca-9c504a006c4f",
            "540f7194-1ddf-48e7-bff3-417897d6f654"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "51c10a0c-e5bd-45f2-86e1-f7d16e9ad27c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "502bdf79-45a3-400e-85ca-9c504a006c4f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "540f7194-1ddf-48e7-bff3-417897d6f654",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d19bbe7e-8424-491a-b40c-0e77a386bcd5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee595d21-991e-4936-a12b-072ff226320a",
          "citation": "SRS import [OU36OO5MTN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OU36OO5MTN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bb0a724-4b7e-459a-99cf-36249efad975",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6e1bb05-2cc7-49ee-59d1-9b95a1bbb956",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=554-95-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "394f186e-afb2-5368-198d-220c3aab7a8c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b3a75f26-80e0-4465-8cdf-5c5e22293f35",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bc851f66-3521-581d-2823-b026ed91d591",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "51c92c59-683a-48f7-b469-fc8ae7a012fc",
          "id": "51c92c59-683a-48f7-b469-fc8ae7a012fc",
          "molfile": "\n  Marvin  01132104152D          \n\n 15 15  0  0  0  0            999 V2000\n    4.9082   -5.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -6.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -7.0912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3541   -5.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3541   -4.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -4.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7737   -5.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7737   -5.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -6.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5062   -6.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5062   -7.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2357   -5.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -3.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7434   -3.3444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3168   -3.3772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 13  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "c1c(cc(cc1C(=O)O)C(=O)O)C(=O)O",
          "formula": "C9H6O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4bce5fb5-836f-46d6-b06c-45144ba98e98"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "210.1407",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cefa6ae1-854d-489a-8215-cd860b6e5cbb",
      "version": "9",
      "structure": {
        "id": "bbd1d7b1-2905-454b-9eeb-0fd7776f1a18",
        "molfile": "\n  Marvin  01132109432D          \n\n 15 15  0  0  0  0            999 V2000\n    7.7737   -5.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7737   -5.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -4.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3541   -4.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3541   -5.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -6.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -6.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9082   -5.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -7.0912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0675   -3.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7434   -3.3444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3168   -3.3772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5062   -6.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5062   -7.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2357   -5.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
        "smiles": "c1c(cc(cc1C(=O)O)C(=O)O)C(=O)O",
        "formula": "C9H6O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "210.1407",
        "optical_activity": "NONE",
        "references": [
          "ee595d21-991e-4936-a12b-072ff226320a",
          "6bb0a724-4b7e-459a-99cf-36249efad975"
        ],
        "stereo_centers": 0
      },
      "unii": "OU36OO5MTN"
    }
  ]
}