{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ac4cf793-5ce9-41ad-a6d9-e95214c70cb9",
          "code": "62-38-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=62-38-4",
          "code_system": "CAS",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f",
            "ff827a5d-3717-41c1-9aee-c8d3c6857c93"
          ]
        },
        {
          "uuid": "1e07eada-06f2-4507-8165-9a9284f2b5d0",
          "code": "C84050",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84050",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "64447a28-d938-4f00-940c-264255d10555",
          "code": "D010662",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010662",
          "code_system": "MESH",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "80207824-addd-4ea0-bc74-4a55af6761fe",
          "code": "66003",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3321",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "05d21762-8b24-4e9a-9cdb-9eb1f3ad421e",
          "code": "200-532-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.239.181",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "bf4169b2-abb2-4053-ab0e-f20c0352d459",
          "code": "1426778",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426778/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "a7beffbf-6225-4ec4-93fa-1404a3c48814",
          "code": "m8681",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8681?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "5ea8a392-ceba-4975-9c60-e4dce4c23d2b",
          "code": "SUB14841MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4c611869-9ab7-408d-ab60-6a1d5a613c2f"
          ]
        },
        {
          "uuid": "6365e2a0-ce96-b776-8309-95d95c36b91e",
          "code": "1670",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1670",
          "code_system": "HSDB",
          "references": [
            "55a4178a-2929-1151-c93c-e96e00f159c6"
          ]
        },
        {
          "uuid": "a9120d8d-2dbe-c140-5424-5d5e8b5e3ab6",
          "code": "DTXSID7021150",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7021150",
          "code_system": "EPA CompTox",
          "references": [
            "a8d44a9a-75e4-19fb-2d57-b782c96cebe0"
          ]
        },
        {
          "uuid": "f7844a3e-b336-63e6-1444-1a48189a06e8",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "78f0c06b-0c3b-986e-b714-18fe716e90bf"
          ]
        },
        {
          "uuid": "705a8701-9955-1042-7b99-162be63ad2f6",
          "code": "9905811",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9905811",
          "code_system": "PUBCHEM",
          "references": [
            "77648918-6f16-5741-4708-039379c48f78"
          ]
        },
        {
          "uuid": "542841f1-a4e7-f801-8066-bc145ec49d6c",
          "code": "27684",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27684",
          "code_system": "CHEBI",
          "references": [
            "78f0c06b-0c3b-986e-b714-18fe716e90bf"
          ]
        },
        {
          "uuid": "a86687b8-f436-4481-bda0-470694cbec8d",
          "code": "OSX88361UX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "903d5b67-b0cb-cfdf-9c3e-0828b0ddf4cc",
          "code": "OSX88361UX",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OSX88361UX",
          "code_system": "DAILYMED",
          "references": [
            "7e4b2645-d03c-1488-6ab8-6e8bb6201965"
          ]
        },
        {
          "uuid": "13356ca4-e502-7dbf-af87-5eef4d5ae084",
          "code": "100000079434",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7d539ac6-9dc9-1e3a-4926-cc928fcb7c3b"
          ]
        },
        {
          "uuid": "52fff649-8af0-3414-f9db-38448dc68683",
          "code": "Phenylmercury acetate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenylmercury_acetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "d636a464-0b57-fe98-0000-6ca1ed32dfff"
          ]
        },
        {
          "uuid": "bc1a181c-84fa-d0b5-bb55-298a82272576",
          "code": "phenylmercury acetate",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/phenylmercury acetate.html",
          "code_system": "ALANWOOD",
          "references": [
            "298550dd-4b11-2a1e-e6d7-aba148ae4f89"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f31635e9-5e9f-4be6-9c14-b15dac80ccbd",
          "name": "(Acetato)phenylmercury",
          "stdName": "(ACETATO)PHENYLMERCURY",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8af3aae3-d4ce-4244-9af8-e1d1852352db"
          ],
          "display_name": false
        },
        {
          "uuid": "1e66c1bc-0dee-4e75-9e53-005573c16f67",
          "name": "MERCURY, (ACETATO-O)PHENYL-",
          "stdName": "MERCURY, (ACETATO-O)PHENYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8af3aae3-d4ce-4244-9af8-e1d1852352db"
          ],
          "display_name": false
        },
        {
          "uuid": "35495bdc-9498-47cd-812d-f0adaf3d919a",
          "name": "PHENYL MERCURIC ACETATE",
          "stdName": "PHENYL MERCURIC ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "899955f5-7249-408c-b43a-2abd150fb1d7",
            "aaa2e6eb-5ca0-418c-a358-025612233e09",
            "580e3cb0-60a7-4e4c-9a3c-398527355136"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4f1d4b13-3831-4dd8-8fdd-b89c5ebf4649",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2a63fbe3-75cc-418f-8857-1b644fcb888c",
          "name": "PHENYLMERCURIC ACETATE",
          "stdName": "PHENYLMERCURIC ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9724a6a-bf2e-43fe-8391-7da5338de36b",
            "03cf82df-008c-4dd9-aa66-ebed81622ecd",
            "801b498b-bf49-42bc-b51f-2df10bb9243b",
            "6a7c17f3-5308-4d7e-92cc-6e00c13f8af8",
            "17f7b230-32f9-4de7-8ca3-8868f63c6ae0",
            "42141c90-52d1-4c9c-9451-c2b39b27aafd",
            "791b37ad-7fa8-4e02-95b1-8c45a4acd90b",
            "7c804baa-9d63-4aaa-8875-366ecb066c46",
            "54a1dc4c-59c4-421f-bf94-7194cf63a92f",
            "d7d242c3-584e-4c8f-b635-6daa597f54bc",
            "ddad7988-5b9e-4288-91eb-9823d2ed755a",
            "1f06c822-eda9-49ee-8daa-bc32799bdd00",
            "98a055a0-f569-4b1e-a81e-d01802968400",
            "19c7e08c-8d57-4727-8a66-cbfe76823770"
          ],
          "display_name": true
        },
        {
          "uuid": "1236f0fc-9969-4c5b-4cb6-de72945d1543",
          "name": "PHENYLMERCURIC ACETATE [EP IMPURITY]",
          "stdName": "PHENYLMERCURIC ACETATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54a1dc4c-59c4-421f-bf94-7194cf63a92f"
          ],
          "display_name": false
        },
        {
          "uuid": "fa053e4a-4b1c-6c6f-e486-051fdb855085",
          "name": "PHENYLMERCURIC ACETATE [EP MONOGRAPH]",
          "stdName": "PHENYLMERCURIC ACETATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe07762a-5049-0b83-983f-7b3fa9146fb5"
          ],
          "display_name": false
        },
        {
          "uuid": "20bd4720-cab3-406d-bfe5-99ca7334f270",
          "name": "PHENYLMERCURIC ACETATE [HSDB]",
          "stdName": "PHENYLMERCURIC ACETATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "791b37ad-7fa8-4e02-95b1-8c45a4acd90b"
          ],
          "display_name": false
        },
        {
          "uuid": "176ddf25-727e-4a1a-be27-1c923803296a",
          "name": "PHENYLMERCURIC ACETATE [II]",
          "stdName": "PHENYLMERCURIC ACETATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c804baa-9d63-4aaa-8875-366ecb066c46"
          ],
          "display_name": false
        },
        {
          "uuid": "904f11cd-272c-45aa-b0b3-3d1e15947259",
          "name": "PHENYLMERCURIC ACETATE [MART.]",
          "stdName": "PHENYLMERCURIC ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a7c17f3-5308-4d7e-92cc-6e00c13f8af8"
          ],
          "display_name": false
        },
        {
          "uuid": "2fcc35bc-4ff1-4771-8fca-171b00e9994e",
          "name": "PHENYLMERCURIC ACETATE [MI]",
          "stdName": "PHENYLMERCURIC ACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f06c822-eda9-49ee-8daa-bc32799bdd00"
          ],
          "display_name": false
        },
        {
          "uuid": "6c6a8baa-b76d-49c9-8a7f-09177729f208",
          "name": "PHENYLMERCURIC ACETATE [VANDF]",
          "stdName": "PHENYLMERCURIC ACETATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17f7b230-32f9-4de7-8ca3-8868f63c6ae0"
          ],
          "display_name": false
        },
        {
          "uuid": "ec335376-794c-4499-85ee-538da2b957a1",
          "name": "PHENYLMERCURY ACETATE",
          "stdName": "PHENYLMERCURY ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "987f0727-2e7e-42a7-a355-e4c7f6d713d5",
            "3b01cfbf-08af-4878-9657-41d3b8121e3a"
          ],
          "display_name": false
        },
        {
          "uuid": "55b300c5-9c13-45ea-ba83-168c3108f871",
          "name": "PHENYLMERCURY ACETATE [ISO]",
          "stdName": "PHENYLMERCURY ACETATE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b01cfbf-08af-4878-9657-41d3b8121e3a"
          ],
          "display_name": false
        },
        {
          "uuid": "3d0412e0-ad72-6b13-d57b-b47d25d57038",
          "name": "Phenylmercuric acetate [WHO-DD]",
          "stdName": "PHENYLMERCURIC ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2427db24-0f26-8f74-8e70-717481bbec70"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7c804baa-9d63-4aaa-8875-366ecb066c46",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8af3aae3-d4ce-4244-9af8-e1d1852352db",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54a1dc4c-59c4-421f-bf94-7194cf63a92f",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a7c17f3-5308-4d7e-92cc-6e00c13f8af8",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f06c822-eda9-49ee-8daa-bc32799bdd00",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "899955f5-7249-408c-b43a-2abd150fb1d7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "791b37ad-7fa8-4e02-95b1-8c45a4acd90b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddad7988-5b9e-4288-91eb-9823d2ed755a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17f7b230-32f9-4de7-8ca3-8868f63c6ae0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aaa2e6eb-5ca0-418c-a358-025612233e09",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b01cfbf-08af-4878-9657-41d3b8121e3a",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35c492e0-2208-4019-903a-16e87b857db4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c611869-9ab7-408d-ab60-6a1d5a613c2f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389670000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c855f6e0-4449-4b01-913f-18b7f47d687a",
          "citation": "SRS import [OSX88361UX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OSX88361UX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389670000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19c7e08c-8d57-4727-8a66-cbfe76823770",
          "citation": "PHENYLMERCURIC ACETATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03cf82df-008c-4dd9-aa66-ebed81622ecd",
          "citation": "PHENYLMERCURIC ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "42141c90-52d1-4c9c-9451-c2b39b27aafd",
          "citation": "PHENYLMERCURIC ACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "580e3cb0-60a7-4e4c-9a3c-398527355136",
          "citation": "PHENYL MERCURIC ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "801b498b-bf49-42bc-b51f-2df10bb9243b",
          "citation": "PHENYLMERCURIC ACETATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9724a6a-bf2e-43fe-8391-7da5338de36b",
          "citation": "PHENYLMERCURIC ACETATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98a055a0-f569-4b1e-a81e-d01802968400",
          "citation": "PHENYLMERCURIC ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7d242c3-584e-4c8f-b635-6daa597f54bc",
          "citation": "PHENYLMERCURIC ACETATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "987f0727-2e7e-42a7-a355-e4c7f6d713d5",
          "citation": "PHENYLMERCURY ACETATE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55a4178a-2929-1151-c93c-e96e00f159c6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+62-38-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8d44a9a-75e4-19fb-2d57-b782c96cebe0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=62-38-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "78f0c06b-0c3b-986e-b714-18fe716e90bf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "77648918-6f16-5741-4708-039379c48f78",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "ff827a5d-3717-41c1-9aee-c8d3c6857c93",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d636a464-0b57-fe98-0000-6ca1ed32dfff",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "298550dd-4b11-2a1e-e6d7-aba148ae4f89",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "fe07762a-5049-0b83-983f-7b3fa9146fb5",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "2427db24-0f26-8f74-8e70-717481bbec70",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7e4b2645-d03c-1488-6ab8-6e8bb6201965",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7d539ac6-9dc9-1e3a-4926-cc928fcb7c3b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af6b6468-4848-491f-abdc-e22c14dc3138",
          "id": "af6b6468-4848-491f-abdc-e22c14dc3138",
          "molfile": "\n  Marvin  01132109062D          \n\n  4  3  0  0  0  0            999 V2000\n    2.0689   -2.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6767   -1.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8508   -1.4307    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1064   -0.7425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(=O)[O-]",
          "formula": "C2H3O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1bab879f-8fec-4139-a078-f9fc9ec22e97"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "59.0441",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "434755dd-f754-4fb5-b7c6-047899ba653b",
          "id": "434755dd-f754-4fb5-b7c6-047899ba653b",
          "molfile": "\n  Marvin  01132103332D          \n\n  7  7  0  0  0  0            999 V2000\n   -0.8104   -1.4330    0.0000 Hg  0  3  0  0  0  0  0  0  0  0  0  0\n   -1.6376   -1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0387   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8659   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2837   -1.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8784   -2.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0429   -2.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "c1ccc(cc1)[Hg+]",
          "formula": "C6H5Hg",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9d9d7a30-24ab-4d8d-b977-a0d9b691b9c9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.7033",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8a22ca89-e73f-46fe-82ac-a10ade08acd0",
      "version": "19",
      "structure": {
        "id": "0bb90dae-59e4-4388-9894-9e838b428e76",
        "molfile": "\n  Marvin  01132100512D          \n\n 11 10  0  0  0  0            999 V2000\n    1.6794   -1.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8522   -1.4330    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1098   -0.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0722   -2.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8104   -1.4330    0.0000 Hg  0  3  0  0  0  0  0  0  0  0  0  0\n   -1.6376   -1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0429   -2.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0387   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8659   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8784   -2.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2837   -1.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11  9  1  0  0  0  0\n 11 10  2  0  0  0  0\nM  CHG  2   2  -1   5   1\nM  END",
        "smiles": "c1ccc(cc1)[Hg+].CC(=O)[O-]",
        "formula": "C6H5Hg.C2H3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.7474",
        "optical_activity": "NONE",
        "references": [
          "7c804baa-9d63-4aaa-8875-366ecb066c46",
          "c855f6e0-4449-4b01-913f-18b7f47d687a"
        ],
        "stereo_centers": 0
      },
      "unii": "OSX88361UX"
    }
  ]
}