{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ae25a99b-734c-4ab3-a7de-4654a66d9039",
          "code": "62702-44-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=62702-44-7",
          "code_system": "CAS",
          "references": [
            "e7f4cb4e-2c18-40f3-ae60-fc9346b3d513",
            "b63818ab-e569-433f-b2c5-3963170af3ef"
          ]
        },
        {
          "uuid": "c9e339de-0e5a-73b4-810c-472230d6889d",
          "code": "9863595",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9863595",
          "code_system": "PUBCHEM",
          "references": [
            "dd68f343-738f-ec7a-c9e5-66ebae39360b"
          ]
        },
        {
          "uuid": "d9fed56c-dc04-4789-a24c-9fe22a1680c9",
          "code": "ORT515V9E1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0514a7eb-e048-475d-bb6c-0242bf67816e",
          "name": "1,6-HEXANEDIOL BIS(2-HYDROXYBENZOATE)",
          "stdName": "1,6-HEXANEDIOL BIS(2-HYDROXYBENZOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f3939-aa76-4b6f-a6b4-b276713ebdfb",
            "fca4dc58-7cec-468e-b6b1-32732f317692"
          ],
          "display_name": false
        },
        {
          "uuid": "a9f1fbfd-fda1-4fbc-981c-95a68c0046ff",
          "name": "1,6-HEXYLENE DISALICYLATE",
          "stdName": "1,6-HEXYLENE DISALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f3939-aa76-4b6f-a6b4-b276713ebdfb",
            "29e07715-8ef1-4122-8948-61db8eebf38b"
          ],
          "display_name": false
        },
        {
          "uuid": "c22827e9-0fcf-430d-9e79-baf4a5b33dd1",
          "name": "BENZOIC ACID, 2-HYDROXY-, 1,1'-(1,6-HEXANEDIYL) ESTER",
          "stdName": "BENZOIC ACID, 2-HYDROXY-, 1,1'-(1,6-HEXANEDIYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f3939-aa76-4b6f-a6b4-b276713ebdfb",
            "fca4dc58-7cec-468e-b6b1-32732f317692"
          ],
          "display_name": false
        },
        {
          "uuid": "9b88fa47-30e6-4913-9eb9-ff067f61664e",
          "name": "HEXANEDIOL DISALICYLATE",
          "stdName": "HEXANEDIOL DISALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "058f3939-aa76-4b6f-a6b4-b276713ebdfb",
            "a26565b8-4f79-4c1c-b292-91ce75fabdd4",
            "6e6b0230-82ed-4bf1-9e0b-66fbc4e2dc72"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a0456cb4-a8e1-4c21-932a-88ccc671f607",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "a26565b8-4f79-4c1c-b292-91ce75fabdd4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "058f3939-aa76-4b6f-a6b4-b276713ebdfb",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fca4dc58-7cec-468e-b6b1-32732f317692",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29e07715-8ef1-4122-8948-61db8eebf38b",
          "citation": "http://ec.europa.eu/consumers/cosmetics/cosing/index.cfm?fuseaction=search.details&id=56374",
          "url": "http://ec.europa.eu/consumers/cosmetics/cosing/index.cfm?fuseaction=search.details&id=56374",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7f4cb4e-2c18-40f3-ae60-fc9346b3d513",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392848000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67201903-462d-4ba6-b310-2ce00765423c",
          "citation": "SRS import [ORT515V9E1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ORT515V9E1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392848000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e6b0230-82ed-4bf1-9e0b-66fbc4e2dc72",
          "citation": "HEXANEDIOL DISALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dd68f343-738f-ec7a-c9e5-66ebae39360b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b63818ab-e569-433f-b2c5-3963170af3ef",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "57c25db4-6b6e-4ecc-85b1-491d564d86b6",
          "id": "57c25db4-6b6e-4ecc-85b1-491d564d86b6",
          "molfile": "\n  Marvin  01132104332D          \n\n 26 27  0  0  0  0            999 V2000\n    3.2151    1.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6441    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3585    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3585    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6441   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2151   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2151   -1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7862   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151    1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9296   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6441    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.3585   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.3585   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6441   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9296   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151   -1.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "C(CCCOC(=O)c1ccccc1O)CCOC(=O)c2ccccc2O",
          "formula": "C20H22O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a7ac0c5b-81fd-430f-8777-da65d6b74d01"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.3858",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c2f21954-990a-47ae-938b-d3cf6623f79f",
      "version": "5",
      "structure": {
        "id": "1fffe328-c278-4693-9586-10e8182c510e",
        "molfile": "\n  Marvin  01132101492D          \n\n 26 27  0  0  0  0            999 V2000\n    1.7862   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0717    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0717   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7862    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2151   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2151    1.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6441    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3585    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3585    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6441   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2151   -1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5006    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9296   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9296   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151   -1.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6441   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.3585   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.3585   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6441    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2151    1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5006   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  8 14  2  0  0  0  0\n  7 15  2  0  0  0  0\n  7 16  1  0  0  0  0\n  1 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 18 24  2  0  0  0  0\n 17 25  2  0  0  0  0\n 17 26  1  0  0  0  0\n  6 26  1  0  0  0  0\nM  END",
        "smiles": "C(CCCOC(=O)c1ccccc1O)CCOC(=O)c2ccccc2O",
        "formula": "C20H22O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.3858",
        "optical_activity": "NONE",
        "references": [
          "a26565b8-4f79-4c1c-b292-91ce75fabdd4",
          "67201903-462d-4ba6-b310-2ce00765423c"
        ],
        "stereo_centers": 0
      },
      "unii": "ORT515V9E1"
    }
  ]
}