{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2e99d99c-4c5c-4dd6-9c0a-99d9dad1a8fc", "code": "144761-91-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=144761-91-1", "code_system": "CAS", "references": [ "28baefa9-680c-42ac-a1c3-a37e9944b59c", "63fbc87e-7780-4625-bc0b-a79d7514e538" ] }, { "uuid": "054e62fc-e4fb-409a-9015-154a80d2827d", "code": "19815003", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19815003", "code_system": "PUBCHEM", "references": [ "28baefa9-680c-42ac-a1c3-a37e9944b59c" ] }, { "uuid": "dec2ac73-d8e0-49b8-9e82-4940ab2db675", "code": "ORC6IV30FS", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "689215fb-8d3a-0f9e-b898-51c47304d05f", "code": "DTXSID7051343", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7051343", "code_system": "EPA CompTox", "references": [ "1c8c7482-5351-f270-edf8-c5b9e78b36bd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "6b3f1223-832c-4537-a1e6-e78b054f45c3", "name": "BENZOIC ACID, 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO), METHYL ESTER", "stdName": "BENZOIC ACID, 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO), METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b9388a60-de2e-4332-b3dd-896d34b018b4" ], "display_name": false }, { "uuid": "62233ede-b589-4b81-b230-c35c57b9e9b7", "name": "BENZOIC ACID, 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO)-, METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e50af3c3-49e2-472e-a263-e8b205abe31f" ], "display_name": false }, { "uuid": "c06d72ba-3811-4c4c-9048-2bacd780abfe", "name": "METHYL 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO)BENZOATE", "stdName": "METHYL 2-((1-HYDROXY-3-PHENYLBUTYL)AMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e50af3c3-49e2-472e-a263-e8b205abe31f" ], "display_name": true } ], "references": [ { "uuid": "b9388a60-de2e-4332-b3dd-896d34b018b4", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e50af3c3-49e2-472e-a263-e8b205abe31f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "28baefa9-680c-42ac-a1c3-a37e9944b59c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391987000, "tags": [ "NOMEN" ] }, { "uuid": "faff37ce-5aa9-4697-b712-8e48b538f341", "citation": "SRS import [ORC6IV30FS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ORC6IV30FS", "doc_type": "SRS", "public_domain": true, "document_date": 1493391987000, "tags": [ "NOMEN" ] }, { "uuid": "1c8c7482-5351-f270-edf8-c5b9e78b36bd", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=144761-91-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "63fbc87e-7780-4625-bc0b-a79d7514e538", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a00b1936-d1c3-483e-b764-36080dfdef61", "id": "a00b1936-d1c3-483e-b764-36080dfdef61", "molfile": "\n Marvin 01132108192D \n\n 22 23 0 0 0 0 999 V2000\n 7.1737 -2.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -2.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -2.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2971 -1.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5797 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5797 -0.4089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8767 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1521 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -2.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 10 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 22 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\nM END", "smiles": "CC(CC(Nc1ccccc1C(=O)OC)O)c2ccccc2", "formula": "C18H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "81e29c66-8763-4c4b-92b7-43b36c35b5cc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "299.3649", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "0941ac3d-01df-4eff-ac0c-c595896cefdb", "version": "3", "structure": { "id": "a8ffbb05-f7ad-4364-a005-28c0d146289f", "molfile": "\n Marvin 01132108462D \n\n 22 23 0 0 0 0 999 V2000\n 7.1737 -2.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -2.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -2.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5797 -0.4089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2971 -1.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5797 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8767 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4347 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7173 -2.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4420 -1.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7390 -1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 21 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 21 1 0 0 0 0\n 5 22 2 0 0 0 0\n 6 8 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 11 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 19 21 2 0 0 0 0\n 20 22 1 0 0 0 0\nM END", "smiles": "CC(CC(Nc1ccccc1C(=O)OC)O)c2ccccc2", "formula": "C18H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "299.3649", "optical_activity": "UNSPECIFIED", "references": [ "b9388a60-de2e-4332-b3dd-896d34b018b4", "faff37ce-5aa9-4697-b712-8e48b538f341" ], "stereo_centers": 2 }, "unii": "ORC6IV30FS" } ] }