{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5f5cb923-7b2e-4f6b-b83a-285296230768",
          "code": "DIETHYL TARTRATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=195",
          "code_system": "JECFA EVALUATION",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "a243f635-bb9c-4e04-996a-d40f0c59a494",
          "code": "87-91-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-91-2",
          "code_system": "CAS",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c",
            "14ff255d-a1f2-4a6f-b24c-6c13cc9525ce"
          ]
        },
        {
          "uuid": "58d33092-2fad-4096-b010-b0a017924590",
          "code": "C064501",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67064501",
          "code_system": "MESH",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "d45718b0-3c5d-451b-b082-49544ee4217f",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "d41446f9-f7f2-4b0b-8f07-904d12eeff07",
          "code": "m4420",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4420?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "3ef59db9-723b-49c3-9ae3-e61ab4ef1c8e",
          "code": "201-783-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.622",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "12185156-1268-48ee-b253-6fd627a8d4d0",
          "code": "6993580",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6993580",
          "code_system": "PUBCHEM",
          "references": [
            "d96d456d-9d09-4335-975d-eee1f3390b3c"
          ]
        },
        {
          "uuid": "f0de79e3-eb9b-c5e4-42dc-fc608b8cdd0a",
          "code": "Diethyl tartrate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diethyl_tartrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "6eb30708-4bf4-01e4-aac4-ffafe0e13b29"
          ]
        },
        {
          "uuid": "ab5171ad-495b-b68c-ae55-d6cde2d235f9",
          "code": "DTXSID5052597",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052597",
          "code_system": "EPA CompTox",
          "references": [
            "99c1cf65-4680-482c-efb2-fab090a73b50"
          ]
        },
        {
          "uuid": "ce8ac12a-00bd-47f6-8f8f-5c8cb55aeae1",
          "code": "OQ72CPY58Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d9c1791d-15f9-619e-d054-5e7d55de507e",
          "code": "44808",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=44808",
          "code_system": "NSC",
          "references": [
            "38e89934-9317-7e91-24e1-4d263248a598"
          ]
        },
        {
          "uuid": "064293cf-cebb-2330-0156-e0ece189578a",
          "code": "1116",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1116/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "f2a5a76e-581e-4e15-34cb-18d0f6300991"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d163c523-27cc-468c-b8ed-fbd4df5ee1e9",
          "name": "(+)-(R,R)-DIETHYL TARTRATE",
          "stdName": "(+)-(R,R)-DIETHYL TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "d3eb073e-a665-4c19-85cf-1c392adb94e8",
          "name": "(R,R)-DIETHYL TARTRATE",
          "stdName": "(R,R)-DIETHYL TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "a11f2c8a-6864-4329-82b1-57be1a1cdfce",
          "name": "(R,R)-TARTARIC ACID DIETHYL ESTER",
          "stdName": "(R,R)-TARTARIC ACID DIETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "23bff3ea-2e02-449b-8398-4b5cf6f9b156",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, 1,4-DIETHYL ESTER",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, 1,4-DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "2a921137-0cc3-4b89-b50a-21da4251bfa4",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, DIETHYL ESTER",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "6f0ed5ae-6b55-4170-be59-57df774de320",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-(R-(R*,R*))-, DIETHYL ESTER",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY-(R-(R*,R*))-, DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "185d7a9f-db4e-4056-ac3a-c570920453b4",
          "name": "DIETHYL (+)-TARTRATE",
          "stdName": "DIETHYL (+)-TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "0cd25ab3-ff4d-4107-a7dd-8ed4607cd485",
          "name": "DIETHYL (2R,3R)-(+)-TARTRATE",
          "stdName": "DIETHYL (2R,3R)-(+)-TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "9eebe6aa-265e-4492-b18c-2ac3a9761f69",
          "name": "DIETHYL (2R,3R)-2,3-DIHYDROXYSUCCINATE",
          "stdName": "DIETHYL (2R,3R)-2,3-DIHYDROXYSUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "55c567a8-4f6f-4384-9132-d03a303a50be",
          "name": "DIETHYL 1,2-DIHYDROXY-1,2-ETHANEDICARBOXYLATE",
          "stdName": "DIETHYL 1,2-DIHYDROXY-1,2-ETHANEDICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "eaaa4773-7f19-4fba-a52a-6fd1d5789bb0",
          "name": "DIETHYL L-(+)-TARTRATE",
          "stdName": "DIETHYL L-(+)-TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "752f87d5-8f88-42e5-b7e3-b053de67aca2",
          "name": "DIETHYL L-TARTRATE",
          "stdName": "DIETHYL L-TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59c5159c-8064-4263-8f8a-e7da4291f168",
            "2ffede31-8a31-47f7-abf1-0f5d9047aa4c"
          ],
          "display_name": false
        },
        {
          "uuid": "1e98cf72-2f72-4eba-8fe7-4346daf60297",
          "name": "DIETHYL TARTRATE",
          "stdName": "DIETHYL TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "090f31d4-1f8e-44b0-85fc-94b0336c1b25",
            "59c5159c-8064-4263-8f8a-e7da4291f168",
            "6fc5c4f2-ca12-428b-8f90-70ff4a844522",
            "bc312d64-5427-43ee-ab94-9d08b0ece75e",
            "bed1b69f-f1f3-46cc-9107-c53a31a50cc2",
            "9bc740b8-bc76-4df9-8a1e-feaff1e4a245"
          ],
          "display_name": true
        },
        {
          "uuid": "abd388a6-e083-49ea-af4a-c88c8dca6f16",
          "name": "DIETHYL TARTRATE [FHFI]",
          "stdName": "DIETHYL TARTRATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fc5c4f2-ca12-428b-8f90-70ff4a844522",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "4442b7d8-4a7f-41f4-983d-0936e2f0272b",
          "name": "DIETHYL TARTRATE [MI]",
          "stdName": "DIETHYL TARTRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59c5159c-8064-4263-8f8a-e7da4291f168",
            "9bc740b8-bc76-4df9-8a1e-feaff1e4a245"
          ],
          "display_name": false
        },
        {
          "uuid": "88f2c44f-d211-4bf2-85b9-95fa3891abf6",
          "name": "FEMA NO. 2378",
          "stdName": "FEMA NO. 2378",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fc5c4f2-ca12-428b-8f90-70ff4a844522",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "32c634be-1996-4b8b-9710-9d3bbc061728",
          "name": "L-DIETHYL TARTRATE",
          "stdName": "L-DIETHYL TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "eaf1e59f-0508-4c6a-a711-0dbce259d808",
          "name": "L-TARTARIC ACID DIETHYL ESTER",
          "stdName": "L-TARTARIC ACID DIETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        },
        {
          "uuid": "35c7cecb-0a94-498b-9c41-affd314561a8",
          "name": "NSC-44808",
          "stdName": "NSC-44808",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59c5159c-8064-4263-8f8a-e7da4291f168",
            "bc312d64-5427-43ee-ab94-9d08b0ece75e"
          ],
          "display_name": false
        },
        {
          "uuid": "7c870a6d-866a-4122-bfc4-75e904080736",
          "name": "TARTARIC ACID, DIETHYL ESTER",
          "stdName": "TARTARIC ACID, DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82c0315c-2784-4119-af6e-fab2484a8a6d",
            "59c5159c-8064-4263-8f8a-e7da4291f168"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bc312d64-5427-43ee-ab94-9d08b0ece75e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59c5159c-8064-4263-8f8a-e7da4291f168",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fc5c4f2-ca12-428b-8f90-70ff4a844522",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82c0315c-2784-4119-af6e-fab2484a8a6d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bc740b8-bc76-4df9-8a1e-feaff1e4a245",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ffede31-8a31-47f7-abf1-0f5d9047aa4c",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d96d456d-9d09-4335-975d-eee1f3390b3c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391210000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddd0eb65-d2b1-43fc-8604-91df7fd87b0f",
          "citation": "SRS import [OQ72CPY58Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OQ72CPY58Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391210000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bed1b69f-f1f3-46cc-9107-c53a31a50cc2",
          "citation": "DIETHYL TARTRATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "090f31d4-1f8e-44b0-85fc-94b0336c1b25",
          "citation": "DIETHYL TARTRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6eb30708-4bf4-01e4-aac4-ffafe0e13b29",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Diethyl_tartrate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "99c1cf65-4680-482c-efb2-fab090a73b50",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-91-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "14ff255d-a1f2-4a6f-b24c-6c13cc9525ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38e89934-9317-7e91-24e1-4d263248a598",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f2a5a76e-581e-4e15-34cb-18d0f6300991",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "60607502-314a-4008-8b65-a6890f9abeac",
          "id": "60607502-314a-4008-8b65-a6890f9abeac",
          "molfile": "\n  Marvin  01132104592D          \n\n 14 13  0  0  1  0            999 V2000\n    5.1763   -3.1940    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.1763   -2.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8908   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8908   -4.4315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6052   -3.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3197   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0342   -3.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4619   -3.6065    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.4619   -4.4315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7474   -3.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7474   -2.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0329   -3.6065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3185   -3.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6041   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)[C@@H]([C@H](C(=O)OCC)O)O",
          "formula": "C8H14O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b95a45e2-6554-4ede-ac6c-18a886327657"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "206.1935",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63b8f65d-ab80-4417-ab09-57400b0264f1",
      "version": "9",
      "structure": {
        "id": "9ff929f9-db1c-440a-9de6-a66d244594d5",
        "molfile": "\n  Marvin  01132108192D          \n\n 14 13  0  0  1  0            999 V2000\n    8.0342   -3.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3197   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6052   -3.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8908   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1763   -3.1940    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.4619   -3.6065    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.7474   -3.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0329   -3.6065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3185   -3.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6041   -3.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7474   -2.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4619   -4.4315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1763   -2.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8908   -4.4315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  6 12  1  1  0  0  0\n  5 13  1  1  0  0  0\n  4 14  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)[C@@H]([C@H](C(=O)OCC)O)O",
        "formula": "C8H14O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "206.1935",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc312d64-5427-43ee-ab94-9d08b0ece75e",
          "ddd0eb65-d2b1-43fc-8604-91df7fd87b0f"
        ],
        "stereo_centers": 2
      },
      "unii": "OQ72CPY58Z"
    }
  ]
}