{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a0579d29-04f8-42e4-880c-69e755f4f506", "code": "2922-56-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2922-56-7", "code_system": "CAS", "references": [ "541d9e3b-fab9-477b-a6e3-322bfd846a26", "bc1bd75d-a733-4821-9f16-b22d140be64b" ] }, { "uuid": "c79a1a71-6e06-446c-a383-3865b10156f2", "code": "115260", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115260", "code_system": "PUBCHEM", "references": [ "541d9e3b-fab9-477b-a6e3-322bfd846a26" ] }, { "uuid": "1855c7c9-2c24-520e-40ef-c9a89b77d89a", "code": "DTXSID10183479", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10183479", "code_system": "EPA CompTox", "references": [ "9a8270c4-22c9-160f-7805-8bd73c90d577" ] }, { "uuid": "55eeb55f-ad38-c6e8-1097-a63156e5fdc1", "code": "DB04701", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB04701", "code_system": "DRUG BANK", "references": [ "801419b1-b58e-e565-a87d-be9275a46a70" ] }, { "uuid": "8893bd44-163a-4d29-ad34-2307270af452", "code": "OOW3025SR1", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "2da76771-3b20-44ac-84a5-c30954ed75b8", "name": "GLYCINE, L-.GAMMA.-GLUTAMYL-S-METHYL-L-CYSTEINYL-", "stdName": "GLYCINE, L-.GAMMA.-GLUTAMYL-S-METHYL-L-CYSTEINYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d027947e-54ec-439c-b56b-afd16ed379fd", "14f321b8-0e87-4a00-bbed-391a3d12f55d" ], "display_name": false }, { "uuid": "4218b9f7-ba43-4fdb-b7a6-9fd479206637", "name": "S-METHYL-GSH", "stdName": "S-METHYL-GSH", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d027947e-54ec-439c-b56b-afd16ed379fd", "14f321b8-0e87-4a00-bbed-391a3d12f55d" ], "display_name": false }, { "uuid": "3f385769-3e1c-468c-9aab-af61ec271f28", "name": "S-METHYLGLUTATHIONE", "stdName": "S-METHYLGLUTATHIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4b52feb2-ef7a-425d-877e-f87f6da9d0d0" ], "display_name": true } ], "references": [ { "uuid": "4b52feb2-ef7a-425d-877e-f87f6da9d0d0", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d027947e-54ec-439c-b56b-afd16ed379fd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "14f321b8-0e87-4a00-bbed-391a3d12f55d", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "541d9e3b-fab9-477b-a6e3-322bfd846a26", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391768000, "tags": [ "NOMEN" ] }, { "uuid": "08b68931-69a6-470d-bca9-482009649f56", "citation": "SRS import [OOW3025SR1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OOW3025SR1", "doc_type": "SRS", "public_domain": true, "document_date": 1493391768000, "tags": [ "NOMEN" ] }, { "uuid": "5d1a2098-f958-4e7e-8a55-07c336d45a24", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9a8270c4-22c9-160f-7805-8bd73c90d577", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2922-56-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "801419b1-b58e-e565-a87d-be9275a46a70", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "bc1bd75d-a733-4821-9f16-b22d140be64b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e89b2b94-1ae3-4082-89e9-11af59b5f010", "id": "e89b2b94-1ae3-4082-89e9-11af59b5f010", "molfile": "\n Marvin 01132112022D \n\n 21 20 0 0 1 0 999 V2000\n 9.0316 -3.2871 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.0316 -2.4595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3179 -3.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5993 -3.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8856 -3.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8856 -4.5336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1668 -3.2973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4480 -3.7111 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.4480 -4.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -4.9421 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -5.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -2.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0157 -3.7161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3066 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5879 -3.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8692 -3.3029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5879 -4.5488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7458 -3.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4645 -3.2821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7458 -4.5234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 19 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 1 0 0 0\n 8 9 1 0 0 0 0\n 12 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\nM END", "smiles": "CSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N", "formula": "C11H19N3O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5b2ba927-15f4-4734-adac-cb199b11c162" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "321.3516", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "11126229-681d-4274-930a-03013edde16f", "version": "4", "structure": { "id": "ccd18ec3-99d2-4f0a-a5b5-759fd56006e6", "molfile": "\n Marvin 01132110352D \n\n 21 20 0 0 1 0 999 V2000\n 1.8692 -3.3029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5879 -3.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5879 -4.5488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3066 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0157 -3.7161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4480 -3.7111 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1668 -3.2973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8856 -3.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5993 -3.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3179 -3.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0316 -3.2871 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.7458 -3.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4645 -3.2821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7458 -4.5234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0316 -2.4595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8856 -4.5336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4480 -4.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -4.9421 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -5.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7344 -2.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 12 16 1 6 0 0 0\n 9 17 2 0 0 0 0\n 7 18 1 1 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 6 21 2 0 0 0 0\nM END", "smiles": "CSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N", "formula": "C11H19N3O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "321.3516", "optical_activity": "UNSPECIFIED", "references": [ "5d1a2098-f958-4e7e-8a55-07c336d45a24", "08b68931-69a6-470d-bca9-482009649f56" ], "stereo_centers": 2 }, "unii": "OOW3025SR1" } ] }