{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a9abeae-c52c-4af6-9cea-b73a87f0d5b2",
          "code": "H01CC02",
          "comments": "ATC|SYSTEMIC HORMONAL PREPARATIONS, EXCL. SEX HORMONES AND INSULINS|PITUITARY AND HYPOTHALAMIC HORMONES AND ANALOGUES|HYPOTHALAMIC HORMONES|Anti-gonadotropin-releasing hormones|cetrorelix",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=H01CC02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "8035ef2e-ea7b-47eb-b85a-0f8aaeaa1a44",
          "code": "N0000175084",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Transcription Factor Activity [MoA]|Hormone Receptor Interactions [MoA]|Hormone Receptor Antagonists [MoA]|Gonadotropin Releasing Hormone Receptor Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175084",
          "code_system": "NDF-RT",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "2f6342f0-43e4-4683-86a4-c42477e45135",
          "code": "N0000175839",
          "comments": "Established Pharmacologic Class [EPC]|Gonadotropin Releasing Hormone Antagonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175839",
          "code_system": "NDF-RT",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "ba668b1a-a9c9-41a9-9efc-0a839b522033",
          "code": "N0000008638",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Endocrine Activity Alteration [PE]|Hypothalamic Endocrine Activity Alteration [PE]|Gonadotropin Releasing Hormone Alteration [PE]|GnRH Secretion Alteration [PE]|Decreased GnRH Secretion [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008638",
          "code_system": "NDF-RT",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "826ec959-36e5-485f-8607-d5d7a6c87a90",
          "code": "QH01CC02",
          "comments": "VATC|PITUITARY AND HYPOTHALAMIC HORMONES AND ANALOGUES|HYPOTHALAMIC HORMONES|Anti-gonadrotropin-releasing hormones|cetrorelix",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QH01CC02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "2084611c-6194-4826-9026-5928f5d9c475",
          "code": "120287-85-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120287-85-6",
          "code_system": "CAS",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d",
            "5f322afe-b389-491c-88d0-ee2914f5d562"
          ]
        },
        {
          "uuid": "33db7563-64d2-416f-8cfa-62ba6d3f3530",
          "code": "C2481",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2481",
          "code_system": "NCI_THESAURUS",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "8734222b-0e6b-4f7b-b425-6a15e8a6aa4b",
          "code": "CETRORELIX",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cetrorelix",
          "code_system": "WIKIPEDIA",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "296c2758-bea6-42f4-84e9-23803e9ee653",
          "code": "6661",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6661",
          "code_system": "INN",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "a9215c12-53af-480f-a7cd-c994c8ff3ddd",
          "code": "CETROTIDE (AUTHORIZED: OVULATION INDUCTION)",
          "comments": "EMA EPAR|ANALYTICAL, DIAGNOSTIC AND THERAPEUTIC TECHNIQUES AND EQUIPMENT|THERAPEUTIC TECHNIQUES|REPRODUCTIVE TECHNIQUES|REPRODUCTIVE TECHNIQUES, ASSISTED|OVULATION INDUCTION",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000233/human_med_000695.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "7431dfd0-3654-4962-8ca0-40f9b76b44a5",
          "code": "1190",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1190",
          "code_system": "IUPHAR",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "98bffe60-5fdc-40b7-a3f1-7c6f35cfe460",
          "code": "68147",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/68147/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "9809fbe0-204e-4dd5-b340-8afe6fefe8e0",
          "code": "m3295",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3295?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "0beda45d-492c-468d-94a0-328a1d008251",
          "code": "DB00050",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00050",
          "code_system": "DRUG BANK",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "7183e950-d866-4af7-969e-b7b1a2884e18",
          "code": "SUB07459MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "05073a04-c18c-4e57-a327-b63ead322255",
          "code": "CHEMBL1200490",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200490",
          "code_system": "ChEMBL",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "6da76ac2-5d2c-44a1-a7a4-3b0154b709ef",
          "code": "25074887",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25074887",
          "code_system": "PUBCHEM",
          "references": [
            "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d"
          ]
        },
        {
          "uuid": "efedd465-4d48-e7b7-64e6-e2ffbc445119",
          "code": "7696",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7696",
          "code_system": "HSDB",
          "references": [
            "e0b95533-f161-732f-a35f-2b041b2b984f"
          ]
        },
        {
          "uuid": "e218e09d-7124-a1b0-2924-01e57c3ce7f3",
          "code": "DTXSID7040996",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7040996",
          "code_system": "EPA CompTox",
          "references": [
            "14f4fa49-f958-5629-97e1-04b1beebb30e"
          ]
        },
        {
          "uuid": "439b9020-01c8-f710-5540-7323769557b1",
          "code": "C2092",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Hormone Antagonist[C547]|Gonadotropin Releasing Hormone Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2092",
          "code_system": "NCI_THESAURUS",
          "references": [
            "56c96aab-c67d-4e27-4e74-30ac63a68598"
          ]
        },
        {
          "uuid": "1c8fc23b-0960-4006-a160-cb9ec7675ead",
          "code": "OON1HFZ4BA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "916de2b0-6435-8a28-d0f7-fc196cec1982",
          "code": "583",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/583",
          "code_system": "DRUG CENTRAL",
          "references": [
            "56c96aab-c67d-4e27-4e74-30ac63a68598"
          ]
        },
        {
          "uuid": "2ae6d544-9a06-9ec2-9a26-018d16330d5e",
          "code": "59224",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:59224",
          "code_system": "CHEBI",
          "references": [
            "56c96aab-c67d-4e27-4e74-30ac63a68598"
          ]
        },
        {
          "uuid": "303508c9-fe5b-84b9-42c7-8d2b2e1eb6fa",
          "code": "100000085454",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "da7c937c-ce81-2998-5fc3-4ed6fb7ae945"
          ]
        },
        {
          "uuid": "9e002197-aa18-0c7f-cbb9-9bfde110892c",
          "code": "OON1HFZ4BA",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OON1HFZ4BA",
          "code_system": "DAILYMED",
          "references": [
            "9b9a3af2-78ae-3262-87f6-5f91c7ea2cc0"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e9de291f-2238-6529-b7a4-b758c3282aa0",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2000/21197lbl.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cde67ec1-0228-4463-aae8-f721a7698c39",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dc7077cb-b28b-43fb-836d-80aae302bbac",
          "citation": "INN Proposed List 66",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00f374fa-d048-41f9-aa97-e540809aa412",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76d216cc-b1d4-4707-aab2-a7552cd202c5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "637d3f72-377a-40d3-9dd6-05019f214e73",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a8b4d67-405c-46fc-9afa-c86c6fdf23d6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d09c37d0-2659-4d79-a7b2-c0a2c324c53d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32a26dad-c7b4-4783-9114-30ab5399f48f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16ef714e-3f4c-4125-a9c7-dba3abcf7d0d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cf46a3d-31dc-4e89-9010-066a45e840ee",
          "citation": "SRS import [OON1HFZ4BA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OON1HFZ4BA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d884370-d63d-4093-9d4a-fa12c879434b",
          "citation": "CETRORELIX [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "99d2120e-7b51-42e2-b790-f1271cae0def",
          "citation": "CETRORELIX [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "88c1b61c-648e-4305-a7fd-ff58c5c61c3d",
          "citation": "CETRORELIX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "73df6c3a-df8c-451e-b7d0-5f9bfdcb5ca2",
          "citation": "CETRORELIX [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a7f189a-8f03-4bdc-97b9-377c1dc66a05",
          "citation": "CETRORELIX [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4108ccc6-a156-4d9d-b91c-0b8acdf9b9aa",
          "citation": "CETRORELIX [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec42cca3-97a4-4ad5-90c4-1e9483262dae",
          "citation": "CETRORELIX [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14f4fa49-f958-5629-97e1-04b1beebb30e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120287-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e0b95533-f161-732f-a35f-2b041b2b984f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+120287-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d6c52b3-a717-3550-2d3b-c7dafb58c495",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5548535#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "56c96aab-c67d-4e27-4e74-30ac63a68598",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5f322afe-b389-491c-88d0-ee2914f5d562",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "035f75a8-c237-4c88-b821-8ebb8b14d8a2",
          "citation": "https://en.wikipedia.org/wiki/Gonadotropin-releasing_hormone_receptor#Agonists",
          "url": "https://en.wikipedia.org/wiki/Gonadotropin-releasing_hormone_receptor#Agonists",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "9b9a3af2-78ae-3262-87f6-5f91c7ea2cc0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "22f7ae91-d5cd-80ff-6668-97124cbb0957",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "da7c937c-ce81-2998-5fc3-4ed6fb7ae945",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36a28d1c-12f7-4336-9df9-75bb405c6a50",
          "id": "36a28d1c-12f7-4336-9df9-75bb405c6a50",
          "molfile": "\n  Marvin  01132102542D          \n\n102107  0  0  1  0            999 V2000\n   31.1025  -10.6315    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   30.9310   -9.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4894  -11.1836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.7048  -10.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.0917  -11.4807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5333  -10.1216    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   30.0853   -9.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6728   -8.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8658   -8.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7796   -9.7861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0651  -10.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0652  -11.0236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3507   -9.7861    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   27.3506   -8.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0651   -8.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0651   -7.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8404   -7.4415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.9836   -6.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3516   -6.0988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.7589   -6.3469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6362  -10.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -9.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -8.9611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072  -10.1987    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   25.2072  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217  -11.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6362  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217  -12.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4927   -9.7862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -10.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -11.0237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638   -9.7862    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   23.0638   -8.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7782   -8.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4927   -8.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072   -8.5487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072   -7.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4927   -7.3112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -7.3112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3493  -10.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349   -9.7862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6348   -8.9612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9204  -10.1987    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   20.9204  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3494  -12.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -12.6737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3494  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2059   -9.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915  -10.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915  -11.0237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770   -9.7863    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   18.7770   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915   -8.5487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0625  -10.1988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -9.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -8.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336  -10.1988    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   16.6336  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0625  -12.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770  -11.4363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0625  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -9.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046  -11.0238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4901   -9.7863    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.4901   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046   -8.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046   -7.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -7.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336   -7.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -7.3113    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336   -8.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7757  -10.1988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612   -8.9614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3467  -10.1988    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.6323   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9178  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9178  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4889  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7744  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0599  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0599  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7744   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4889  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3467  -11.0238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7757  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612  -12.2614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8871  -10.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5002  -10.3344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   32.0587  -11.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1100  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  1  0  0  0\n  6  7  1  0  0  0  0\n 10  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  1  1  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  3  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 29  1  6  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 32 30  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 40  1  6  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  2  3  0  0  0\n 37 38  1  0  0  0  0\n 37 39  1  0  0  0  0\n 40 41  1  0  0  0  0\n 41 42  2  0  0  0  0\n 43 41  1  0  0  0  0\n 43 44  1  0  0  0  0\n 43 52  1  6  0  0  0\n 44 45  1  0  0  0  0\n 45 46  1  0  0  0  0\n 45 51  2  0  0  0  0\n 46 47  2  0  0  0  0\n 47 48  1  0  0  0  0\n 48 49  1  0  0  0  0\n 50 48  2  0  0  0  0\n 51 50  1  0  0  0  0\n 52 53  2  3  0  0  0\n 53 54  1  0  0  0  0\n 53 55  1  0  0  0  0\n 55 56  1  0  0  0  0\n 55 58  1  1  0  0  0\n 56 57  1  0  0  0  0\n 58 59  1  0  0  0  0\n 59 60  2  0  0  0  0\n 59 61  1  0  0  0  0\n 61 62  1  0  0  0  0\n 61 69  1  1  0  0  0\n 62 63  1  0  0  0  0\n 63 64  1  0  0  0  0\n 63 68  2  0  0  0  0\n 64 65  2  0  0  0  0\n 65 66  1  0  0  0  0\n 67 66  2  0  0  0  0\n 68 67  1  0  0  0  0\n 69 70  1  0  0  0  0\n 70 71  2  0  0  0  0\n 72 70  1  0  0  0  0\n 72 73  1  0  0  0  0\n 72 81  1  6  0  0  0\n 73 74  1  0  0  0  0\n 74 75  1  0  0  0  0\n 74 80  2  0  0  0  0\n 75 76  2  0  0  0  0\n 76 77  1  0  0  0  0\n 77 78  1  0  0  0  0\n 79 77  2  0  0  0  0\n 80 79  1  0  0  0  0\n 81 82  1  0  0  0  0\n 82 83  2  0  0  0  0\n 84 82  1  0  0  0  0\n 84 85  1  0  0  0  0\n 84 96  1  6  0  0  0\n 85 86  1  0  0  0  0\n 86 87  1  0  0  0  0\n 86 95  2  0  0  0  0\n 87 88  2  0  0  0  0\n 88 89  1  0  0  0  0\n 89 90  1  0  0  0  0\n 94 89  2  0  0  0  0\n 90 91  2  0  0  0  0\n 92 91  1  0  0  0  0\n 93 92  2  0  0  0  0\n 94 93  1  0  0  0  0\n 95 94  1  0  0  0  0\n 96 97  2  3  0  0  0\n 97 98  1  0  0  0  0\n 97 99  1  0  0  0  0\n100101  1  0  0  0  0\n100102  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(=O)N)NC(=O)[C@@H](CCCN=C(N)O)NC(=O)[C@H](Cc2ccc(cc2)O)N=C([C@H](CO)NC(=O)[C@@H](Cc3cccnc3)NC(=O)[C@@H](Cc4ccc(cc4)Cl)NC(=O)[C@@H](Cc5ccc6ccccc6c5)N=C(C)O)O",
          "formula": "C70H92ClN17O14",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d3134fe0-7e9f-4c2b-99d7-77f88668b47d"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "1431.0406",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5ee5c618-3b32-4a9a-9a62-b4026fc16717",
      "version": "18",
      "structure": {
        "id": "9369c8c1-747b-41af-8e9c-b39a6796d93f",
        "molfile": "\n  Marvin  01132107392D          \n\n102107  0  0  1  0            999 V2000\n   28.0651  -10.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3507   -9.7861    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   26.6362  -10.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -9.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072  -10.1987    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   24.4927   -9.7862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -10.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638   -9.7862    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   22.3493  -10.1987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349   -9.7862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9204  -10.1987    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   20.9204  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6349  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3494  -12.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3494  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -12.6737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2059   -9.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915  -10.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770   -9.7863    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   18.0625  -10.1988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -9.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336  -10.1988    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6336  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0625  -12.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770  -12.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770  -11.4363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0625  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -9.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4901   -9.7863    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.4901   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046   -8.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046   -7.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -7.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336   -7.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6336   -8.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9191   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -7.3113    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   13.7757  -10.1988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3467  -10.1988    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.6323   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9178  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4889  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4889  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9178  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7744  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0599  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0599  -10.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7744   -9.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3467  -11.0238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612  -11.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7757  -11.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612  -12.2614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0612   -8.9614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2046  -11.0238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3481   -8.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7770   -8.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915   -8.5487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4915  -11.0237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6348   -8.9612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0638   -8.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7782   -8.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4927   -8.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072   -8.5487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072   -7.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4927   -7.3112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -7.3112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7783  -11.0237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2072  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217  -11.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6362  -11.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217  -12.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9217   -8.9611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3506   -8.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0651   -8.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0651   -7.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8404   -7.4415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.9836   -6.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3516   -6.0988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.7589   -6.3469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0652  -11.0236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7796   -9.7861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5333  -10.1216    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   29.7048  -10.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4894  -11.1836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1025  -10.6315    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   31.8871  -10.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5002  -10.3344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   32.0587  -11.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.9310   -9.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.0917  -11.4807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.0853   -9.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.6728   -8.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8658   -8.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 13 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 11 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  1  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 31 30  2  0  0  0  0\n 32 31  1  0  0  0  0\n 27 32  2  0  0  0  0\n 25 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  6  0  0  0\n 36 37  1  0  0  0  0\n 37 38  2  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  2  0  0  0  0\n 41 40  1  0  0  0  0\n 42 41  2  0  0  0  0\n 37 42  1  0  0  0  0\n 40 43  1  0  0  0  0\n 35 44  1  0  0  0  0\n 44 45  1  0  0  0  0\n 45 46  1  0  0  0  0\n 46 47  1  0  0  0  0\n 47 48  1  0  0  0  0\n 48 49  2  0  0  0  0\n 49 50  1  0  0  0  0\n 50 51  1  0  0  0  0\n 52 51  1  0  0  0  0\n 53 52  2  0  0  0  0\n 48 53  1  0  0  0  0\n 51 54  2  0  0  0  0\n 54 55  1  0  0  0  0\n 56 55  2  0  0  0  0\n 57 56  1  0  0  0  0\n 50 57  2  0  0  0  0\n 46 58  1  6  0  0  0\n 58 59  1  0  0  0  0\n 59 60  1  0  0  0  0\n 59 61  2  0  0  0  0\n 45 62  2  0  0  0  0\n 34 63  2  0  0  0  0\n 24 64  2  0  0  0  0\n 22 65  1  1  0  0  0\n 65 66  1  0  0  0  0\n 21 67  2  0  0  0  0\n 10 68  2  0  0  0  0\n  8 69  1  6  0  0  0\n 69 70  1  0  0  0  0\n 70 71  1  0  0  0  0\n 71 72  1  0  0  0  0\n 72 73  1  0  0  0  0\n 73 74  1  0  0  0  0\n 73 75  2  0  0  0  0\n  7 76  2  0  0  0  0\n  5 77  1  6  0  0  0\n 77 78  1  0  0  0  0\n 78 79  1  0  0  0  0\n 78 80  1  0  0  0  0\n  4 81  2  0  0  0  0\n  2 82  1  1  0  0  0\n 82 83  1  0  0  0  0\n 83 84  1  0  0  0  0\n 84 85  1  0  0  0  0\n 85 86  1  0  0  0  0\n 86 87  2  0  0  0  0\n 86 88  1  0  0  0  0\n  1 89  2  0  0  0  0\n  1 90  1  0  0  0  0\n 90 91  1  0  0  0  0\n 91 92  1  1  0  0  0\n 92 93  1  0  0  0  0\n 93 94  1  0  0  0  0\n 94 95  1  0  0  0  0\n 95 96  1  0  0  0  0\n 95 97  2  0  0  0  0\n 94 98  1  6  0  0  0\n 92 99  2  0  0  0  0\n 91100  1  0  0  0  0\n100101  1  0  0  0  0\n102101  1  0  0  0  0\n 90102  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(=O)N)NC(=O)[C@@H](CCCNC(=O)N)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CO)NC(=O)[C@@H](Cc3cccnc3)NC(=O)[C@@H](Cc4ccc(cc4)Cl)NC(=O)[C@@H](Cc5ccc6ccccc6c5)NC(=O)C",
        "formula": "C70H92ClN17O14",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "1431.0406",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5cf46a3d-31dc-4e89-9010-066a45e840ee",
          "cde67ec1-0228-4463-aae8-f721a7698c39",
          "dc7077cb-b28b-43fb-836d-80aae302bbac"
        ],
        "stereo_centers": 10
      },
      "unii": "OON1HFZ4BA",
      "relationships": [
        {
          "uuid": "572ec75e-dc28-49cc-a7f3-59ad03e8f248",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "af52d9f4-62ee-47e7-a579-1a35636efbc2",
            "refuuid": "5ee5c618-3b32-4a9a-9a62-b4026fc16717",
            "name": "CETRORELIX",
            "unii": "OON1HFZ4BA",
            "linking_id": "OON1HFZ4BA",
            "ref_pname": "CETRORELIX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67b13020-e4e3-4bc8-8037-5417bc0573e1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9e6ac21b-0467-43f5-9cee-939a1ff9880a",
            "refuuid": "f29ea5ff-5f6b-4373-a566-09dc53733d86",
            "name": "CETRORELIX ACETATE",
            "unii": "W9Y8L7GP4C",
            "linking_id": "W9Y8L7GP4C",
            "ref_pname": "CETRORELIX ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c39385a8-82a5-4b1c-9769-80ccd968a0f3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5082e8d4-20eb-44e5-988f-d587c283d0f0",
            "refuuid": "7f9a5173-73e4-4693-82e6-3815ce135a1f",
            "name": "CETRORELIX TRIFLUOROACETATE",
            "unii": "26089221C6",
            "linking_id": "26089221C6",
            "ref_pname": "CETRORELIX TRIFLUOROACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4d4f147-a1d5-4d1f-a2bb-77b29469ce6e",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f38b0c01-ff4d-4222-a2f8-27e8ebdc2ba1",
            "refuuid": "7b86bfc5-5e36-4fe6-adfa-17ea84078426",
            "name": "DICETRORELIX PAMOATE",
            "unii": "DY3PDH8A8N",
            "linking_id": "DY3PDH8A8N",
            "ref_pname": "DICETRORELIX PAMOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0f68597-57bf-4dd8-ab95-0fb4551f2898",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "96826dfd-b995-466a-847e-68ae39c9daeb",
            "refuuid": "6967b83c-8d5c-4e0c-8605-b0a809a845bc",
            "name": "CETRORELIX MONOACETATE",
            "unii": "XPQ226310Q",
            "linking_id": "XPQ226310Q",
            "ref_pname": "CETRORELIX MONOACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9b36c699-6cb0-4b0b-92fe-031ff1df00ff",
          "amount": {
            "uuid": "a071657d-ff1b-477a-a251-44ab5190923f",
            "average": 86,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "8d6c52b3-a717-3550-2d3b-c7dafb58c495"
          ],
          "related_substance": {
            "uuid": "750e6570-e4c6-4a21-a4be-eb55a86c3e9b",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "052ce52d-2027-485d-ba96-7b6b3dd4a3ac",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "e16caf0a-4731-45f0-94ad-0a12dff1a108",
            "refuuid": "fa10c9fd-7fbf-409e-b4ef-efdf87dc0e1a",
            "name": "ALTERNATIVE DEFINITION for [CETRORELIX]",
            "linking_id": "fa10c9fd-7fbf-409e-b4ef-efdf87dc0e1a",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "b3ae0d8b-9e58-4741-842e-f942dd519e14",
          "amount": {
            "uuid": "4fb0dd86-7248-4a6c-a636-9fa854e2a3ad",
            "high": 4,
            "low": 2,
            "units": "%",
            "non_numeric_value": "of the dose"
          },
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "interaction_type": "AMOUNT EXCRETED",
          "references": [
            "e9de291f-2238-6529-b7a4-b758c3282aa0"
          ],
          "related_substance": {
            "uuid": "db0c1c45-3f19-4a45-9480-e313802f80ca",
            "refuuid": "5ee5c618-3b32-4a9a-9a62-b4026fc16717",
            "name": "CETRORELIX",
            "unii": "OON1HFZ4BA",
            "linking_id": "OON1HFZ4BA",
            "ref_pname": "CETRORELIX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "41f07177-47ac-43c7-bd8c-ff93fe868614",
          "amount": {
            "uuid": "a30bc9ad-2933-4388-b37a-5d1076e17508"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "035f75a8-c237-4c88-b821-8ebb8b14d8a2"
          ],
          "related_substance": {
            "uuid": "056741d3-b6bd-4057-bd35-14009942de31",
            "refuuid": "1544b78a-a05f-4b9b-a805-ebb7dec87e5a",
            "name": "GONADOTROPIN-RELEASING HORMONE RECEPTOR",
            "unii": "MJK4KMT12V",
            "linking_id": "MJK4KMT12V",
            "ref_pname": "GONADOTROPIN-RELEASING HORMONE RECEPTOR"
          }
        }
      ],
      "names": [
        {
          "uuid": "5cf9ab9d-2b4a-4a34-9b53-da1da5aa1cef",
          "name": "CETRORELIX",
          "stdName": "CETRORELIX",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cde67ec1-0228-4463-aae8-f721a7698c39",
            "4108ccc6-a156-4d9d-b91c-0b8acdf9b9aa",
            "dc7077cb-b28b-43fb-836d-80aae302bbac",
            "32a26dad-c7b4-4783-9114-30ab5399f48f",
            "0d884370-d63d-4093-9d4a-fa12c879434b",
            "99d2120e-7b51-42e2-b790-f1271cae0def",
            "00f374fa-d048-41f9-aa97-e540809aa412",
            "5a7f189a-8f03-4bdc-97b9-377c1dc66a05",
            "88c1b61c-648e-4305-a7fd-ff58c5c61c3d",
            "d09c37d0-2659-4d79-a7b2-c0a2c324c53d",
            "637d3f72-377a-40d3-9dd6-05019f214e73",
            "ec42cca3-97a4-4ad5-90c4-1e9483262dae",
            "8a8b4d67-405c-46fc-9afa-c86c6fdf23d6",
            "76d216cc-b1d4-4707-aab2-a7552cd202c5",
            "73df6c3a-df8c-451e-b7d0-5f9bfdcb5ca2"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fd16d844-d03b-432d-bc32-3cf781b6109c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "26eda1e2-0360-425c-8102-34c615433eec",
          "name": "CETRORELIX [EMA EPAR]",
          "stdName": "CETRORELIX [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "637d3f72-377a-40d3-9dd6-05019f214e73"
          ],
          "display_name": false
        },
        {
          "uuid": "d40976c2-2fdd-4c46-8e80-eb7fcdb9c0eb",
          "name": "CETRORELIX [HSDB]",
          "stdName": "CETRORELIX [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a8b4d67-405c-46fc-9afa-c86c6fdf23d6"
          ],
          "display_name": false
        },
        {
          "uuid": "a104082a-3640-40fb-9a5c-3cfa573a8feb",
          "name": "CETRORELIX [MI]",
          "stdName": "CETRORELIX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76d216cc-b1d4-4707-aab2-a7552cd202c5"
          ],
          "display_name": false
        },
        {
          "uuid": "883132e2-f7b0-4697-b56a-1780ae529113",
          "name": "CETRORELIX [ORANGE BOOK]",
          "stdName": "CETRORELIX [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00f374fa-d048-41f9-aa97-e540809aa412"
          ],
          "display_name": false
        },
        {
          "uuid": "1c2562b9-b675-47df-9c12-8f2700935d6e",
          "name": "CETRORELIX [VANDF]",
          "stdName": "CETRORELIX [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32a26dad-c7b4-4783-9114-30ab5399f48f"
          ],
          "display_name": false
        },
        {
          "uuid": "3c4a1903-40c9-865d-a749-00ff391e181d",
          "name": "Cetrorelix [WHO-DD]",
          "stdName": "CETRORELIX [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f7ae91-d5cd-80ff-6668-97124cbb0957"
          ],
          "display_name": false
        },
        {
          "uuid": "12dbcdaa-03c3-44ad-865c-ff28ada0991b",
          "name": "N-ACETYL-3-(2-NAPHTHYL)-D-ALANYL-P-CHLORO-D-PHENYLALANYL-3-(3-PYRIDYL)-D-ALANYL-L-SERYL-L-TYROSYL-N(SUP 5)-CARBAMOYL-D-ORNITHYL-L-LEUCYL-L-ARGINYL-L-PROLYL-D-ALANINAMIDE",
          "stdName": "N-ACETYL-3-(2-NAPHTHYL)-D-ALANYL-P-CHLORO-D-PHENYLALANYL-3-(3-PYRIDYL)-D-ALANYL-L-SERYL-L-TYROSYL-N(SUP 5)-CARBAMOYL-D-ORNITHYL-L-LEUCYL-L-ARGINYL-L-PROLYL-D-ALANINAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cde67ec1-0228-4463-aae8-f721a7698c39"
          ],
          "display_name": false
        },
        {
          "uuid": "da80c71e-1a18-41d9-af7d-86ac7b43116c",
          "name": "cetrorelix [INN]",
          "stdName": "CETRORELIX [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc7077cb-b28b-43fb-836d-80aae302bbac"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "98be7ac0-c1f3-4018-a2bc-2fd0c27f795d",
          "name": "Biological Half-life",
          "value": {
            "uuid": "ef4be9b2-cbc1-40db-81f6-a5f01791b65d",
            "average": 62.8,
            "high": 108,
            "low": 38.2,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "068747d9-17bb-44c8-bfbb-468c99ae8a8e",
              "name": "SUBCUTANEOUS ADMINISTRATION",
              "references": []
            },
            {
              "uuid": "24ae65fd-64b6-42ac-9c2d-9157dc28f876",
              "name": "SINGLE DOSE",
              "value": {
                "uuid": "f260d812-9b0a-48a7-8bda-cd11582ced7d",
                "average": 3,
                "units": "mg",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "8d6c52b3-a717-3550-2d3b-c7dafb58c495",
            "e9de291f-2238-6529-b7a4-b758c3282aa0"
          ]
        },
        {
          "uuid": "41c3aa64-1c0b-447f-9e01-f0505f8478cb",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "eb10cb6b-962f-438f-8019-487deba9a927",
            "average": 1.16,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "32b33450-d259-4eac-a8dd-b27947ea73b1",
              "name": "SUBCUTANEOUS ADMINISTRATION",
              "references": []
            },
            {
              "uuid": "3de947e2-aa02-47ce-a666-bb50884f245d",
              "name": "SINGLE DOSE",
              "value": {
                "uuid": "ae9a7187-8b18-466f-b0c0-b463e0d45447",
                "average": 3,
                "units": "mg",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "8d6c52b3-a717-3550-2d3b-c7dafb58c495",
            "e9de291f-2238-6529-b7a4-b758c3282aa0"
          ]
        },
        {
          "uuid": "7ee35e02-2a12-4dfa-ad65-0b998958a573",
          "name": "Tmax",
          "value": {
            "uuid": "7c1bf17b-89f0-4add-8975-3f010c0139e1",
            "average": 1.5,
            "high": 2,
            "low": 0.5,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "f90167d2-6558-4903-a061-bde09eef36b9",
              "name": "SUBCUTANEOUS ADMINISTRATION",
              "references": []
            },
            {
              "uuid": "ad26daba-3350-4a06-92ac-c00064b304d2",
              "name": "SINGLE DOSE",
              "value": {
                "uuid": "ccd427d9-ab02-4e71-b2a1-40e37e1e466f",
                "average": 3,
                "units": "mg",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "e9de291f-2238-6529-b7a4-b758c3282aa0"
          ]
        }
      ]
    }
  ]
}