{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc549877-14e8-4844-b93b-6ad878c9a479",
          "code": "38577-97-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=38577-97-8",
          "code_system": "CAS",
          "references": [
            "d72ce466-7898-4147-bf23-4374b119d2b9",
            "0969e085-7fa8-4f77-83f7-7a06a7bfdfb7"
          ]
        },
        {
          "uuid": "4661142d-360b-429e-b7a6-03012651a792",
          "code": "254-010-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.083",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d72ce466-7898-4147-bf23-4374b119d2b9"
          ]
        },
        {
          "uuid": "a417a405-b7ae-4d4d-b36f-9f4698dd8c50",
          "code": "m4477",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4477?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d72ce466-7898-4147-bf23-4374b119d2b9"
          ]
        },
        {
          "uuid": "fadd20b2-0e6a-4d1b-a94c-4b33110c1678",
          "code": "92311",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92311",
          "code_system": "PUBCHEM",
          "references": [
            "d72ce466-7898-4147-bf23-4374b119d2b9"
          ]
        },
        {
          "uuid": "3d298a7b-d17a-4248-af3b-61e5a3e4eba8",
          "code": "518-40-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=518-40-1",
          "code_system": "CAS",
          "references": [
            "0969e085-7fa8-4f77-83f7-7a06a7bfdfb7"
          ]
        },
        {
          "uuid": "e34dcda2-5843-b936-77ee-9e601272a55e",
          "code": "DTXSID0044238",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044238",
          "code_system": "EPA CompTox",
          "references": [
            "f91a3310-1986-8a8f-2443-7520d683567b"
          ]
        },
        {
          "uuid": "f4202d7a-7147-430c-802d-9250d1a6aa60",
          "code": "OO2GYZ1574",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69b58b46-6004-4ed0-82b8-25457595b252",
          "name": "4',5'-DIIODOFLUORESCEIN [MI]",
          "stdName": "4',5'-DIIODOFLUORESCEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c91fe4f0-12ba-44c3-88ed-3d6daee3c9ab",
            "c5b7c4d5-8405-4422-9998-2484a5970992"
          ],
          "display_name": false
        },
        {
          "uuid": "dc246a0d-4745-4ab4-94b9-ae7c81ba9076",
          "name": "4',5'-Diiodofluorescein",
          "stdName": "4',5'-DIIODOFLUORESCEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ce9cce-6cb5-457a-ae6f-5bb57d29f4f9",
            "c91fe4f0-12ba-44c3-88ed-3d6daee3c9ab",
            "c5b7c4d5-8405-4422-9998-2484a5970992",
            "cefcd204-c7e7-416e-9d15-e00cdf4b7640",
            "fab9a4b6-7ceb-43b2-b59d-06434e965f08"
          ],
          "display_name": true
        },
        {
          "uuid": "0f679e42-6ebb-4a22-8888-a5ed9b17bc7d",
          "name": "C.I. NO.45425 (D&C ORANGE NO.10)",
          "stdName": "C.I. NO.45425 (D&C ORANGE NO.10)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7441b4aa-1036-4a7f-8f80-92b3ffdec74a",
            "c5b7c4d5-8405-4422-9998-2484a5970992"
          ],
          "display_name": false
        },
        {
          "uuid": "afe44c43-f9fd-4549-b74b-8f7a6f7fe1fb",
          "name": "CI 45425:1",
          "stdName": "CI 45425:1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b7c4d5-8405-4422-9998-2484a5970992",
            "8d3ac444-2d70-4990-af1d-79c2aa3191f9"
          ],
          "display_name": false
        },
        {
          "uuid": "d23a110d-2623-4f40-a826-9094f74572c7",
          "name": "HYDROXYDIIODO-O-CARBOXYPHENYLFLUORONE",
          "stdName": "HYDROXYDIIODO-O-CARBOXYPHENYLFLUORONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b7c4d5-8405-4422-9998-2484a5970992",
            "8d3ac444-2d70-4990-af1d-79c2aa3191f9"
          ],
          "display_name": false
        },
        {
          "uuid": "f09a24bb-ebf0-4389-91fe-5ecec270f6a5",
          "name": "ORANGE NO. 206",
          "stdName": "ORANGE NO. 206",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b7c4d5-8405-4422-9998-2484a5970992",
            "8d3ac444-2d70-4990-af1d-79c2aa3191f9"
          ],
          "display_name": false
        },
        {
          "uuid": "09fe8408-47c3-4ae6-be5b-9b927f2c50cb",
          "name": "SOLVENT RED 73",
          "stdName": "SOLVENT RED 73",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c5b7c4d5-8405-4422-9998-2484a5970992",
            "c220b1c0-1d19-480e-b11d-8845849518db",
            "8d3ac444-2d70-4990-af1d-79c2aa3191f9"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "21a5e584-a553-449c-bfa7-8155a677523e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "fab9a4b6-7ceb-43b2-b59d-06434e965f08",
          "citation": "ACD 8.0(21CFR74.1260",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cefcd204-c7e7-416e-9d15-e00cdf4b7640",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c91fe4f0-12ba-44c3-88ed-3d6daee3c9ab",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5b7c4d5-8405-4422-9998-2484a5970992",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d3ac444-2d70-4990-af1d-79c2aa3191f9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7441b4aa-1036-4a7f-8f80-92b3ffdec74a",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d72ce466-7898-4147-bf23-4374b119d2b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "967536e4-0d4d-4a9f-acf2-f2a2ca808cf9",
          "citation": "SRS import [OO2GYZ1574]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OO2GYZ1574",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39ce9cce-6cb5-457a-ae6f-5bb57d29f4f9",
          "citation": "4',5'-DIIODOFLUORESCEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c220b1c0-1d19-480e-b11d-8845849518db",
          "citation": "SOLVENT RED 73 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f91a3310-1986-8a8f-2443-7520d683567b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=38577-97-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0969e085-7fa8-4f77-83f7-7a06a7bfdfb7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0b4da399-7bd9-4f14-aa64-8caec43c18a2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "99e3440a-9db7-4d37-a4fb-1c7f0d40bfde",
          "id": "99e3440a-9db7-4d37-a4fb-1c7f0d40bfde",
          "molfile": "\n  Marvin  01132108002D          \n\n 27 31  0  0  0  0            999 V2000\n   -0.7083    0.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0116    0.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0116   -0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7171   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -0.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1455    0.6444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8567    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680    0.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5651    1.4835    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2763    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0050    0.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2763   -0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8567   -0.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1368   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8015   -1.4515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5548   -2.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0193   -2.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7505   -2.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2019   -2.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3774   -2.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1190   -1.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7083   -1.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5009   -1.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7462    0.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7433    1.4689    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 26  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 16  1  0  0  0  0\n  7  6  1  0  0  0  0\n 26  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 25 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  2  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)OC23c4ccc(c(c4Oc5c3ccc(c5I)O)I)O",
          "formula": "C20H10I2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab1dd2fb-64c4-4638-8b21-c395d0593761"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "584.1001",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "64218f88-89dc-48eb-a40c-a293551d837e",
      "version": "7",
      "structure": {
        "id": "36d927ca-dfa5-4621-af57-4bf2301e7f3d",
        "molfile": "\n  Marvin  01132102552D          \n\n 27 31  0  0  0  0            999 V2000\n    2.1368   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8015   -1.4515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -0.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8567   -0.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5009   -1.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5548   -2.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8567    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1455    0.6444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7505   -2.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680    0.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7462    0.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7171   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -0.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0193   -2.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2763    0.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0116    0.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0116   -0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2763   -0.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7083   -1.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7083    0.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0050    0.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2019   -2.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1190   -1.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3774   -2.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5651    1.4835    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7433    1.4689    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  2  0  0  0  0\n  8  4  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  6  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 14  2  0  0  0  0\n 20  5  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 10  1  0  0  0  0\n 24 20  2  0  0  0  0\n 25 24  1  0  0  0  0\n 10  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 25 23  2  0  0  0  0\n 16 11  2  0  0  0  0\n 17 12  2  0  0  0  0\n 11 26  1  0  0  0  0\n  2  1  1  0  0  0  0\n 12 27  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)OC23c4ccc(c(c4Oc5c3ccc(c5I)O)I)O",
        "formula": "C20H10I2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "584.1001",
        "optical_activity": "NONE",
        "references": [
          "967536e4-0d4d-4a9f-acf2-f2a2ca808cf9",
          "cefcd204-c7e7-416e-9d15-e00cdf4b7640"
        ],
        "stereo_centers": 0
      },
      "unii": "OO2GYZ1574"
    }
  ]
}