{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "81ed2f51-cfe8-46f7-9c10-f7202033255b",
          "code": "528-48-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=528-48-3",
          "code_system": "CAS",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194",
            "55404ec7-93d4-46a9-aee5-1aa3f964b637"
          ]
        },
        {
          "uuid": "928f8530-00b5-49bc-b89a-00a38e05d305",
          "code": "C017875",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67017875",
          "code_system": "MESH",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194"
          ]
        },
        {
          "uuid": "a90461b9-c261-4fe3-b9e3-3a2c167ea304",
          "code": "FISETIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fisetin",
          "code_system": "WIKIPEDIA",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194"
          ]
        },
        {
          "uuid": "dcda90e9-c45d-4f90-85b7-68bfc808fb67",
          "code": "208-434-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.669",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194"
          ]
        },
        {
          "uuid": "9b16f97a-9af6-4b61-bf77-ccba0c794cd7",
          "code": "m5389",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5389?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194"
          ]
        },
        {
          "uuid": "432bd438-7436-4b0d-bfa1-02a9653336dd",
          "code": "5281614",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281614",
          "code_system": "PUBCHEM",
          "references": [
            "6db36ebc-ede7-4455-96b3-89a6e15a6194"
          ]
        },
        {
          "uuid": "ac93f62a-66f3-48a0-8238-ac04bdcd0ddf",
          "code": "OO2ABO9578",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5bd99fb5-6e7f-caf3-53e5-032fc5e7f1de",
          "code": "C179571",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C179571",
          "code_system": "NCI_THESAURUS",
          "references": [
            "443930cb-4bf4-192e-5b12-aa419dfd998c"
          ]
        },
        {
          "uuid": "2a01246b-99f1-b627-5e85-1e2883ffe370",
          "code": "DTXSID4022317",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022317",
          "code_system": "EPA CompTox",
          "references": [
            "ff735cac-9498-a087-7d1f-c7e666a7d610"
          ]
        },
        {
          "uuid": "6aed4d0b-4ec6-65eb-b824-31d9d69b4cd5",
          "code": "2651 (Number of products:20)",
          "comments": "Dietary Supplement Label Database|chemical|Fisetin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2651&item=Fisetin",
          "code_system": "DSLD",
          "references": [
            "905808a7-d808-9909-a7a1-98f25361b1d4"
          ]
        },
        {
          "uuid": "478b35e9-6a3b-4e1e-054a-9b119f418d2c",
          "code": "DB07795",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB07795",
          "code_system": "DRUG BANK",
          "references": [
            "905808a7-d808-9909-a7a1-98f25361b1d4"
          ]
        },
        {
          "uuid": "6e72ed36-8332-b862-a242-3ab8798c7a46",
          "code": "42567",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:42567",
          "code_system": "CHEBI",
          "references": [
            "905808a7-d808-9909-a7a1-98f25361b1d4"
          ]
        },
        {
          "uuid": "eda9dc31-b5d4-0b8c-be6e-1365f71b4ce0",
          "code": "100000172072",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c5aed243-8e89-c3eb-9dfa-3ef367d496b3"
          ]
        },
        {
          "uuid": "82d41f80-dfd8-7a83-0898-9103afbbf1a0",
          "code": "656275",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=656275",
          "code_system": "NSC",
          "references": [
            "c9ec4d4c-aff9-087d-1b31-405a4da212a0"
          ]
        },
        {
          "uuid": "89cb3860-1418-409f-5b07-4e8c9979760f",
          "code": "407010",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407010",
          "code_system": "NSC",
          "references": [
            "c9ec4d4c-aff9-087d-1b31-405a4da212a0"
          ]
        },
        {
          "uuid": "1b8e6a75-d1d7-927f-d344-56e379aecdd8",
          "code": "OO2ABO9578",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(OO2ABO9578)",
          "code_system": "DAILYMED",
          "references": [
            "ab729243-3bfe-0640-d3a2-6a44a6796802"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "12a8ad62-4723-4060-9e1c-71753d910b5f",
          "amount": {
            "uuid": "9c83c213-2469-4e9b-8350-36c2486c98ac"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "0ef38a2a-05b9-488e-b765-415740933f75"
          ],
          "related_substance": {
            "uuid": "b3c64ddb-c110-4494-8be9-b96494f41f4e",
            "refuuid": "bc6359c4-e906-495f-8c83-fa3aeecc0590",
            "name": "GERALDOL",
            "unii": "2KR35TI2XV",
            "linking_id": "2KR35TI2XV",
            "ref_pname": "GERALDOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f1fad40b-24e4-4105-9fab-e6d6c2c60cf7",
          "amount": {
            "uuid": "5aaf4149-debf-48c4-bce7-ef0252fb877f"
          },
          "comments": "Shows a wide variety of activity, including anti-inflammatory, anti-cancer and senolytic ",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f07e9fc4-d0c5-4954-967d-bf9099d71abc",
            "refuuid": "0a6fe9a3-3c76-4262-b977-85495e9f143b",
            "name": "FISETIN",
            "unii": "OO2ABO9578",
            "linking_id": "OO2ABO9578",
            "ref_pname": "FISETIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c1d6f9ea-941d-4f2f-8edb-1218c5bafccd",
          "amount": {
            "uuid": "f08d51b9-e3a8-4fcb-ab00-9b095fc8881b"
          },
          "comments": "Increases expression of SIRT1.",
          "type": "TARGET->ACTIVATOR",
          "references": [
            "db1ecc23-7ecf-4a3f-b6e3-00dd123df0c9"
          ],
          "related_substance": {
            "uuid": "c298365e-4e0e-4b52-83c0-465133cd9280",
            "refuuid": "1b857045-b153-4a45-a9ca-fd9838eda383",
            "name": "NAD-DEPENDENT PROTEIN DEACETYLASE SIRTUIN-1",
            "unii": "R8FS417W9N",
            "linking_id": "R8FS417W9N",
            "ref_pname": "NAD-DEPENDENT PROTEIN DEACETYLASE SIRTUIN-1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eb5ef9f3-1017-4118-8194-ee0cad409022",
          "name": "2-(3,4-DIHYDROXYPHENYL)-3,7-DIHYDROXY-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "2-(3,4-DIHYDROXYPHENYL)-3,7-DIHYDROXY-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "9cad8ea7-3a79-49b8-9d4e-6143d3d2dca0",
          "name": "3,3',4',7-TETRAHYDROXYFLAVONE",
          "stdName": "3,3',4',7-TETRAHYDROXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "3d6e5bd7-a4af-49a1-b9ab-bba9d2884447",
          "name": "5-DESOXYQUERCETIN",
          "stdName": "5-DESOXYQUERCETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "ff98eb48-5861-4a36-943e-e9466414f5c8",
          "name": "C.I. 75620",
          "stdName": "C.I. 75620",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "9e492df5-06ea-48b5-861a-9a1b1f1c71fd",
          "name": "C.I. NATURAL BROWN 1",
          "stdName": "C.I. NATURAL BROWN 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "c3c13184-96c5-4941-8e25-2920953ebcd5",
          "name": "FISETIN",
          "stdName": "FISETIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b6651c5-85b8-4acc-9cbb-03cc2c6179b3",
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "4c1a894a-c4d9-42b1-bd02-66f9fe714953",
            "2a618b7e-eef7-4207-8797-b219d3506cc9",
            "a6925da0-7411-4b78-92dd-0d66183590b4",
            "56963a22-63c2-4c38-8ccf-fed61c26573c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "91d72d42-7882-4de9-9052-9008d9e71873",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4d2f7e58-23cf-4564-972b-59bc9b9a26e1",
          "name": "FISETIN [MI]",
          "stdName": "FISETIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "a6925da0-7411-4b78-92dd-0d66183590b4"
          ],
          "display_name": false
        },
        {
          "uuid": "51abf370-cf44-4dce-92e9-4410a47f6051",
          "name": "FISIDENOLON 1521",
          "stdName": "FISIDENOLON 1521",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "cc2d7d33-5330-4f70-83d8-b78f51517964"
          ],
          "display_name": false
        },
        {
          "uuid": "18b61bf4-be88-c0f6-6234-c42006a6c6e8",
          "name": "Fisetin [WHO-DD]",
          "stdName": "FISETIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2d89190-596c-9c4a-7a2c-8bb7f0b21a65"
          ],
          "display_name": false
        },
        {
          "uuid": "aa86c8d6-ee6e-43db-9def-447e5040b55c",
          "name": "NSC-407010",
          "stdName": "NSC-407010",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "f3485719-953e-4e33-a63b-f1ca81d2d184"
          ],
          "display_name": false
        },
        {
          "uuid": "cfee5287-5891-478a-896c-c15a1a42cce2",
          "name": "NSC-656275",
          "stdName": "NSC-656275",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34d0fb38-7e1b-4510-8874-c0895696440a",
            "f3485719-953e-4e33-a63b-f1ca81d2d184"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2a618b7e-eef7-4207-8797-b219d3506cc9",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6925da0-7411-4b78-92dd-0d66183590b4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34d0fb38-7e1b-4510-8874-c0895696440a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc2d7d33-5330-4f70-83d8-b78f51517964",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3485719-953e-4e33-a63b-f1ca81d2d184",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b6651c5-85b8-4acc-9cbb-03cc2c6179b3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6db36ebc-ede7-4455-96b3-89a6e15a6194",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390952000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef7d436e-f262-4468-aa91-d1a9cf71e682",
          "citation": "SRS import [OO2ABO9578]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OO2ABO9578",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390952000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75c1b732-b0a2-492d-9ed0-fde6dcaa3b9f",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c1a894a-c4d9-42b1-bd02-66f9fe714953",
          "citation": "FISETIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56963a22-63c2-4c38-8ccf-fed61c26573c",
          "citation": "FISETIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff735cac-9498-a087-7d1f-c7e666a7d610",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=528-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "905808a7-d808-9909-a7a1-98f25361b1d4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "55404ec7-93d4-46a9-aee5-1aa3f964b637",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c2d89190-596c-9c4a-7a2c-8bb7f0b21a65",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "443930cb-4bf4-192e-5b12-aa419dfd998c",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "0ef38a2a-05b9-488e-b765-415740933f75",
          "citation": "Demchuk, Oleg, and Grzegorz Grynkiewicz Grynkiewicz. \"New perspectives for fisetin.\" Frontiers in Chemistry 7 (2019): 697.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0006295211006149",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "c9ec4d4c-aff9-087d-1b31-405a4da212a0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "db1ecc23-7ecf-4a3f-b6e3-00dd123df0c9",
          "citation": "Zheng, Wenhao, et al. \"Fisetin inhibits IL-1β-induced inflammatory response in human osteoarthritis chondrocytes through activating SIRT1 and attenuates the progression of osteoarthritis in mice.\" International immunopharmacology 45 (2017): 135-147.",
          "url": "https://www.sciencedirect.com/science/article/pii/S1567576917300644",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "c5aed243-8e89-c3eb-9dfa-3ef367d496b3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ab729243-3bfe-0640-d3a2-6a44a6796802",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "79a00db3-127a-4062-a192-4dcd3aebda88",
          "id": "79a00db3-127a-4062-a192-4dcd3aebda88",
          "molfile": "\n  Marvin  01132106192D          \n\n 21 23  0  0  0  0            999 V2000\n    3.8478   -5.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5799   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5799   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2922   -6.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9943   -6.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9943   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2922   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -5.0965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4203   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5667   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5667   -4.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2953   -3.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -3.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -3.0568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -4.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4203   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1523   -6.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -6.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -7.5532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n 20  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 18  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 17  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1-c2c(c(=O)c3ccc(cc3o2)O)O)O)O",
          "formula": "C15H10O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "82301a95-913d-42c7-8f59-c91c2327e5d4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.2369",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a6fe9a3-3c76-4262-b977-85495e9f143b",
      "version": "21",
      "structure": {
        "id": "d3594f4b-48b0-4b2f-9f50-f737d35fbc33",
        "molfile": "\n  Marvin  01132110552D          \n\n 21 23  0  0  0  0            999 V2000\n    7.4203   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -4.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -3.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5667   -4.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2953   -3.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5667   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -3.0568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -5.0965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9943   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9943   -6.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2922   -6.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5799   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5799   -5.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2922   -5.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8478   -5.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -6.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4203   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1523   -6.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7080   -7.5532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 11 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 18  1  0  0  0  0\n  1 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 18 21  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1-c2c(c(=O)c3ccc(cc3o2)O)O)O)O",
        "formula": "C15H10O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.2369",
        "optical_activity": "NONE",
        "references": [
          "75c1b732-b0a2-492d-9ed0-fde6dcaa3b9f",
          "ef7d436e-f262-4468-aa91-d1a9cf71e682"
        ],
        "stereo_centers": 0
      },
      "unii": "OO2ABO9578"
    }
  ]
}