{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f7ca6e03-5678-49ef-a899-6062f9640f1f", "code": "3383-96-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3383-96-8", "code_system": "CAS", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e", "e5f157be-0489-4952-a9f8-09e9ce718a7b" ] }, { "uuid": "ebcc326c-5ad0-41fb-8f85-e2aabddb3b4d", "code": "C80606", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80606", "code_system": "NCI_THESAURUS", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "f7d4852d-fa1b-4764-9678-73914e35a057", "code": "TEMEFOS", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Temefos", "code_system": "WIKIPEDIA", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "5337a60f-d05e-4904-90a1-830999359693", "code": "59001", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3990", "code_system": "EPA PESTICIDE CODE", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "bd9b9a12-6d5f-423c-93ca-67b3d7184dc8", "code": "3561", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3561", "code_system": "INN", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "e7b8eb9b-730e-448f-ab62-6f8583ce9f7b", "code": "m10548", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10548?q=authorize", "code_system": "MERCK INDEX", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "c031832a-5bcc-434a-8b79-3f32f00a7d01", "code": "SUB10881MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "a3f0efd0-e03d-4aa7-baff-257ca63e6d90", "code": "CHEMBL1355821", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1355821", "code_system": "ChEMBL", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "3f0421f2-b344-46de-8887-bc7c7131c2af", "code": "5392", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5392", "code_system": "PUBCHEM", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "dc8d43b9-ab8f-4782-8725-6cb28d73f51c", "code": "222-191-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.175", "code_system": "ECHA (EC/EINECS)", "references": [ "c5d4548c-8084-4100-bac5-a1c0469e1d7e" ] }, { "uuid": "23bc9ec7-ea09-9adb-ff17-00a68d812164", "code": "956", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/956", "code_system": "HSDB", "references": [ "67eb714a-55ff-4413-2fe3-a686cfa51499" ] }, { "uuid": "38a08047-935c-8a75-a133-882bb7eb4cfe", "code": "DTXSID1032484", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1032484", "code_system": "EPA CompTox", "references": [ "af84ba61-ff3f-a1b5-177a-6d67a6b26ab6" ] }, { "uuid": "9ab4627f-013a-f130-bb5a-2d0af5a900b1", "code": "C737", "comments": "Industrial Aid[C45678]|Pesticide", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737", "code_system": "NCI_THESAURUS", "references": [ "54c0db11-7708-fbe7-3de2-292635575209" ] }, { "uuid": "79072283-3612-45e2-a4ac-922ee5b38f7c", "code": "ONP3ME32DL", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b4849cfb-9a82-eee1-81cb-a3ccf701e01c", "code": "DB12231", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB12231", "code_system": "DRUG BANK", "references": [ "54c0db11-7708-fbe7-3de2-292635575209" ] }, { "uuid": "c5058809-27b0-b475-2e31-d3cf14ac2d94", "code": "30669", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:30669", "code_system": "CHEBI", "references": [ "54c0db11-7708-fbe7-3de2-292635575209" ] }, { "uuid": "21cd8e5e-e7c4-aab8-ad6a-243e0120a855", "code": "38954", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38954", "code_system": "CHEBI", "references": [ "54c0db11-7708-fbe7-3de2-292635575209" ] }, { "uuid": "cf9ba272-c105-539e-a21d-275767176318", "code": "100000082465", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "e127543e-308a-fb98-7ff3-554c0409d881" ] }, { "uuid": "f78aafe4-2671-18bc-78b3-18ff3cae2df8", "code": "temephos", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/temephos.html", "code_system": "ALANWOOD", "references": [ "e5a9538c-541b-cc7f-8e1c-6ede0abb24a8" ] }, { "uuid": "cee783df-996c-4df7-37fb-3524ec76b658", "code": "755842", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755842", "code_system": "NSC", "references": [ "5b0896d5-85aa-4018-0bb0-51dc5d110941" ] } ], "relationships": [ { "uuid": "e672b539-289b-4669-a4ed-7adc1bb1b6bc", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "dd60a186-bfe7-4966-b3f3-71aeee143825", "refuuid": "78fb48f1-0790-4d7a-8c9a-5c30712e603f", "name": "TEMEFOS", "unii": "ONP3ME32DL", "linking_id": "ONP3ME32DL", "ref_pname": "TEMEFOS", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "eacca6d7-c126-4261-9076-73d6f4c89537", "name": "ABATE", "stdName": "ABATE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "46e3659d-ca42-4bd5-9c61-29f993e8b077", "name": "ABATHION", "stdName": "ABATHION", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "0d150fe9-237b-4530-af1c-bd0a683e65ba", "name": "AC-52160", "stdName": "AC-52160", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "ac5681c6-9f5a-41e3-88d7-095224cfcc9c", "name": "AZAI-SS", "stdName": "AZAI-SS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "b8ac274f-996e-4b8f-a0cd-459fba6d354e", "name": "BIOTHION", "stdName": "BIOTHION", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "ec7d09ca-9bd5-4ae1-bcea-1c8bfba116bd", "name": "BIOTHON", "stdName": "BIOTHON", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "eaab7d93-2d3d-410d-b0f1-5ac77deac9cc", "name": "DIFENPHOS", "stdName": "DIFENPHOS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "0d2b358f-d36b-4d50-9ca0-596ad9bea0fd", "name": "DIFOS", "stdName": "DIFOS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "369cb15f-ea98-414a-b3c6-c9a34eb10a85", "name": "DIPHOS", "stdName": "DIPHOS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "8927a640-c1fa-409d-a47a-e432c3227c3b", "name": "ECOPRO 1707", "stdName": "ECOPRO 1707", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "e298e8dd-7132-4cb7-b86d-705cd937d0ae", "name": "EI-52160", "stdName": "EI-52160", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "c91fda02-557a-4ef6-8aca-29316706856c", "name": "ENT-27165", "stdName": "ENT-27165", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "b17fa00b-33c0-46b8-bf16-4f5aca76af3e", "name": "LAVIFOS", "stdName": "LAVIFOS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "15bbba84-1445-45cf-a669-80af35c5f20e", "name": "MOSQ", "stdName": "MOSQ", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "01efe5db-3614-44c9-868f-2ac5f2e655b4", "name": "NEPHIS", "stdName": "NEPHIS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "a3d1eae8-33b4-e638-3154-94959dfe4ff2", "name": "NSC-755842", "stdName": "NSC-755842", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5b0896d5-85aa-4018-0bb0-51dc5d110941" ], "display_name": false }, { "uuid": "0ac2304a-bbe5-45c6-ac2b-9c66786db89b", "name": "O,O'-(THIODI-4,1-PHENYLENE) BIS(O,O-DIMETHYL PHOSPHOROTHIOATE)", "stdName": "O,O'-(THIODI-4,1-PHENYLENE) BIS(O,O-DIMETHYL PHOSPHOROTHIOATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "93c52862-ceee-4f5b-839a-7e539aa73ec5", "de49961b-f412-4d1a-83c6-c924753691f0" ], "display_name": false }, { "uuid": "0a18eae3-1f10-4a06-b46c-9ce2560a67d9", "name": "O,O'-(THIODI-P-PHENYLENE) O,O,O',O'-TETRAMETHYL BIS(PHOSPHOROTHIOATE)", "stdName": "O,O'-(THIODI-P-PHENYLENE) O,O,O',O'-TETRAMETHYL BIS(PHOSPHOROTHIOATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "0743b841-085b-4608-b358-389cfbaa6ed9" ], "display_name": false }, { "uuid": "fe014a61-515d-4c36-8c70-8b34ade07f0f", "name": "O,O,O',O'-TETRAMETHYL O,O'-(THIODI-4,1-PHENYLENE) BIS(THIOPHOSPHATE)", "stdName": "O,O,O',O'-TETRAMETHYL O,O'-(THIODI-4,1-PHENYLENE) BIS(THIOPHOSPHATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d0dd204e-d48d-4353-ab14-392c9443b2f6" ], "display_name": false }, { "uuid": "711378f9-589d-4867-90eb-a4ba576cfbbe", "name": "O,O,O',O'-TETRAMETHYL O,O'-THIODI-P-PHENYLENE BIS(PHOSPHOROTHIOATE)", "stdName": "O,O,O',O'-TETRAMETHYL O,O'-THIODI-P-PHENYLENE BIS(PHOSPHOROTHIOATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f62e8f90-2a8d-4075-ade7-f934a6bc07fb", "de49961b-f412-4d1a-83c6-c924753691f0" ], "display_name": false }, { "uuid": "3abf4476-e58d-4068-a9e5-89e1180fe6b3", "name": "PHOSPHOROTHIOIC ACID, O,O'-(THIODI-4,1-PHENYLENE) O,O,O',O'-TETRAMETHYL ESTER", "stdName": "PHOSPHOROTHIOIC ACID, O,O'-(THIODI-4,1-PHENYLENE) O,O,O',O'-TETRAMETHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "0743b841-085b-4608-b358-389cfbaa6ed9" ], "display_name": false }, { "uuid": "afea767d-d438-4f6b-ad82-50a319a389ea", "name": "PROCIDA", "stdName": "PROCIDA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "786fef72-7666-4343-9358-5258957f920d", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "f7dee7d9-2dfc-40e1-9b9d-546e8963cd95", "name": "TEMEFOS", "stdName": "TEMEFOS", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "c63e5adf-4cbf-4637-9cc7-9bee6a03cc3a", "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "eb88c375-0135-478d-a7ac-200007354b51", "2418a324-83e0-49f6-aae4-f978cd40eb5f", "718f8e62-e722-4ec6-a6bb-c8334eecf255", "2aed414c-16c6-49c8-830f-9e36852b3109", "4fb76a09-92ce-4d52-9607-c194189919df", "9bff26d8-f2e8-40f0-9e22-f81cbef76fb4", "95463a93-6f00-44b6-9810-b1756b7de698", "2fb4dce1-07b4-4815-b369-eb60caf3f882", "0743b841-085b-4608-b358-389cfbaa6ed9", "1bd93af1-f64e-4f6e-9fd6-c97e64f897fe" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "de2c9f48-e085-4604-bec8-7a1be380f099", "name_org": "INN" }, { "uuid": "433b199a-0700-45a6-aa16-ad871048e8b6", "name_org": "USAN" } ] }, { "uuid": "e18d9c7d-a1d4-49f4-a69a-48928042b97e", "name": "TEMEFOS [HSDB]", "stdName": "TEMEFOS [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "2fb4dce1-07b4-4815-b369-eb60caf3f882" ], "display_name": false }, { "uuid": "b9125c3e-9a08-47bf-b2cc-551768d57be7", "name": "TEMEFOS [MART.]", "stdName": "TEMEFOS [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "718f8e62-e722-4ec6-a6bb-c8334eecf255" ], "display_name": false }, { "uuid": "e3656032-b32a-4a15-8213-bdc291f4bf23", "name": "TEMEFOS [USAN]", "stdName": "TEMEFOS [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4fb76a09-92ce-4d52-9607-c194189919df" ], "display_name": false }, { "uuid": "3777bccb-7f7d-4c6f-acb4-b14b52a42d78", "name": "TEMEPHOS", "stdName": "TEMEPHOS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ddd40d7d-7f3e-4267-b352-62ab20096e68", "1a604773-6af8-41de-b6f6-b2d61a0c0517", "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "2a4e265f-6a8e-431d-b97e-12fd0fb46c69", "15caa2af-75df-4e98-9e6b-1c05aa78fcfa", "d2be35dc-ed58-4e3d-b38e-6c65d89ebd37" ], "display_name": false }, { "uuid": "0e469ad2-97f4-482e-8e78-dc649119650b", "name": "TEMEPHOS [ISO]", "stdName": "TEMEPHOS [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "15caa2af-75df-4e98-9e6b-1c05aa78fcfa" ], "display_name": false }, { "uuid": "e46844e4-13b4-438e-bb56-71da948e9720", "name": "TEMEPHOS [MI]", "stdName": "TEMEPHOS [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ddd40d7d-7f3e-4267-b352-62ab20096e68", "9c32075b-4c4a-4e73-adc9-032c12c6e38b" ], "display_name": false }, { "uuid": "8a4da43a-0805-0344-9daa-1fcf180b2b18", "name": "Temefos [WHO-DD]", "stdName": "TEMEFOS [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "13b1f450-40f8-d987-e515-fa2bfbab42af" ], "display_name": false }, { "uuid": "08c0ef79-721b-42df-a248-a55b0f47c632", "name": "temefos [INN]", "stdName": "TEMEFOS [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eb88c375-0135-478d-a7ac-200007354b51" ], "display_name": false } ], "references": [ { "uuid": "786fef72-7666-4343-9358-5258957f920d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9c32075b-4c4a-4e73-adc9-032c12c6e38b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "15caa2af-75df-4e98-9e6b-1c05aa78fcfa", "citation": "ISO", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d2be35dc-ed58-4e3d-b38e-6c65d89ebd37", "citation": "WHO Report", "doc_type": "ISO", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0743b841-085b-4608-b358-389cfbaa6ed9", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d0dd204e-d48d-4353-ab14-392c9443b2f6", "citation": "USP DICTIONARY 2014", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de49961b-f412-4d1a-83c6-c924753691f0", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f62e8f90-2a8d-4075-ade7-f934a6bc07fb", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "93c52862-ceee-4f5b-839a-7e539aa73ec5", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eb88c375-0135-478d-a7ac-200007354b51", "citation": "INN Proposed List 31", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL31.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4fb76a09-92ce-4d52-9607-c194189919df", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "718f8e62-e722-4ec6-a6bb-c8334eecf255", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ddd40d7d-7f3e-4267-b352-62ab20096e68", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2fb4dce1-07b4-4815-b369-eb60caf3f882", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c63e5adf-4cbf-4637-9cc7-9bee6a03cc3a", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c5d4548c-8084-4100-bac5-a1c0469e1d7e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389660000, "tags": [ "NOMEN" ] }, { "uuid": "ce6ab4ca-a8a1-4d4a-a7f6-68adb1f7679a", "citation": "SRS import [ONP3ME32DL]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ONP3ME32DL", "doc_type": "SRS", "public_domain": true, "document_date": 1493389660000, "tags": [ "NOMEN" ] }, { "uuid": "c6e344c7-a399-465f-ac6f-55e9b96d735d", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9bff26d8-f2e8-40f0-9e22-f81cbef76fb4", "citation": "TEMEFOS [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1bd93af1-f64e-4f6e-9fd6-c97e64f897fe", "citation": "TEMEFOS [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "95463a93-6f00-44b6-9810-b1756b7de698", "citation": "TEMEFOS [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2a4e265f-6a8e-431d-b97e-12fd0fb46c69", "citation": "TEMEPHOS [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2aed414c-16c6-49c8-830f-9e36852b3109", "citation": "TEMEFOS [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2418a324-83e0-49f6-aae4-f978cd40eb5f", "citation": "TEMEFOS [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1a604773-6af8-41de-b6f6-b2d61a0c0517", "citation": "TEMEPHOS [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "67eb714a-55ff-4413-2fe3-a686cfa51499", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3383-96-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "af84ba61-ff3f-a1b5-177a-6d67a6b26ab6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3383-96-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "54c0db11-7708-fbe7-3de2-292635575209", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "e5f157be-0489-4952-a9f8-09e9ce718a7b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e5a9538c-541b-cc7f-8e1c-6ede0abb24a8", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "5b0896d5-85aa-4018-0bb0-51dc5d110941", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "13b1f450-40f8-d987-e515-fa2bfbab42af", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e127543e-308a-fb98-7ff3-554c0409d881", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "81df0a0b-b52d-4b5b-a320-17f34676ff92", "id": "81df0a0b-b52d-4b5b-a320-17f34676ff92", "molfile": "\n Marvin 01132106442D \n\n 27 28 0 0 0 0 999 V2000\n -1.6519 -0.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2359 -1.5694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4054 -1.5666 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4083 -0.7360 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4251 -1.5637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8342 -0.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4033 -2.3866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3113 -2.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3096 -3.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0276 -4.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7385 -3.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4485 -4.0294 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1594 -3.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8735 -4.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5843 -3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5880 -2.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3058 -2.3733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0252 -2.7828 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7383 -3.1919 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4343 -2.0698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2554 -2.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6162 -3.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0271 -4.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8739 -2.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1590 -2.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7381 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0240 -2.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 3 1 0 0 0 0\n 7 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 27 8 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 26 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 25 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 24 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 22 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "COP(=S)(OC)Oc1ccc(cc1)Sc2ccc(cc2)OP(=S)(OC)OC", "formula": "C16H20O6P2S3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d4a5091c-de60-4ff8-b4bc-fb9efcd3e95e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "466.4728", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "78fb48f1-0790-4d7a-8c9a-5c30712e603f", "version": "15", "structure": { "id": "d9da125a-7df9-4930-9111-856963de1f52", "molfile": "\n Marvin 01132111182D \n\n 27 28 0 0 0 0 999 V2000\n -0.4054 -1.5666 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0252 -2.7828 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4083 -0.7360 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7383 -3.1919 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4033 -2.3866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3058 -2.3733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4485 -4.0294 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4251 -1.5637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2359 -1.5694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6162 -3.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4343 -2.0698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7385 -3.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1594 -3.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3113 -2.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5880 -2.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0276 -4.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8735 -4.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7381 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1590 -2.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5843 -3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3096 -3.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8739 -2.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0240 -2.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6519 -0.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2554 -2.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8342 -0.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0271 -4.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 2 0 0 0 0\n 4 2 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 15 1 0 0 0 0\n 7 12 1 0 0 0 0\n 8 1 1 0 0 0 0\n 9 1 1 0 0 0 0\n 10 2 1 0 0 0 0\n 11 2 1 0 0 0 0\n 12 18 2 0 0 0 0\n 13 7 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 22 1 0 0 0 0\n 16 21 2 0 0 0 0\n 17 13 2 0 0 0 0\n 18 23 1 0 0 0 0\n 19 13 1 0 0 0 0\n 20 17 1 0 0 0 0\n 21 14 1 0 0 0 0\n 22 19 2 0 0 0 0\n 23 14 2 0 0 0 0\n 24 9 1 0 0 0 0\n 25 11 1 0 0 0 0\n 12 16 1 0 0 0 0\n 20 15 2 0 0 0 0\n 8 26 1 0 0 0 0\n 2 6 1 0 0 0 0\n 10 27 1 0 0 0 0\nM END", "smiles": "COP(=S)(OC)Oc1ccc(cc1)Sc2ccc(cc2)OP(=S)(OC)OC", "formula": "C16H20O6P2S3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "466.4728", "optical_activity": "NONE", "references": [ "c6e344c7-a399-465f-ac6f-55e9b96d735d", "ce6ab4ca-a8a1-4d4a-a7f6-68adb1f7679a", "eb88c375-0135-478d-a7ac-200007354b51" ], "stereo_centers": 0 }, "unii": "ONP3ME32DL" } ] }