{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2025-09-19",
"results": {
"skip": 0,
"limit": 1,
"total": 1
}
},
"results": [
{
"codes": [
{
"uuid": "82cb5c09-3620-45e9-827a-38c94bc2193d",
"code": "213539-83-4",
"type": "ALTERNATIVE",
"url": "https://commonchemistry.cas.org/detail?cas_rn=213539-83-4",
"code_system": "CAS",
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
]
},
{
"uuid": "6f419a19-74bb-45c0-91fa-26b9eb4e3273",
"code": "14308353",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/14308353",
"code_system": "PUBCHEM",
"references": [
"2c32e29c-0b95-4cb1-8270-fcf0b454855e"
]
},
{
"uuid": "6d2fbb9c-29dd-4b59-aa4a-f888a17d1ea2",
"code": "OMF16V5TQF",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "957e3f08-ee22-5e7b-0bca-efb6f36af347",
"code": "100000183637",
"type": "PRIMARY",
"code_system": "SMS_ID",
"references": [
"4e53428f-b11f-db3b-d55e-a7c60f579782"
]
},
{
"uuid": "b942f036-3cf7-4b51-9ab3-9917f997df22",
"code": "21512-99-2",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=21512-99-2",
"code_system": "CAS",
"references": [
"bca0f961-ce28-4811-8fae-073471eb829b"
]
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "488331bd-67ad-4b87-b258-daa9b965967e",
"name": "Bis(L-lysinato)copper",
"stdName": "BIS(L-LYSINATO)COPPER",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
],
"display_name": false
},
{
"uuid": "57b64aa1-c5e2-4ac2-b4b2-697ab45fe0d1",
"name": "Bis(L-lysinato-κN2,κO1)copper",
"stdName": "BIS(L-LYSINATO-.KAPPA.N2,.KAPPA.O1)COPPER",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
],
"display_name": false
},
{
"uuid": "acf0b1bd-9a1c-49aa-b795-13162f70e890",
"name": "COPPER LYSINATE [WHO-DD]",
"stdName": "COPPER LYSINATE [WHO-DD]",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"e9a3d2bb-479e-447d-b4d7-ac67709d4fd6"
],
"display_name": false
},
{
"uuid": "2a95ee94-dc46-4554-a9b8-8885cba8733a",
"name": "Copper lysinate",
"stdName": "COPPER LYSINATE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
],
"display_name": true
},
{
"uuid": "e841a356-2138-424f-92a9-e9c8c58fad5f",
"name": "Copper, bis(L-lysinato-κN2,κO1)-",
"stdName": "COPPER, BIS(L-LYSINATO-.KAPPA.N2,.KAPPA.O1)-",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
],
"display_name": false
}
],
"references": [
{
"uuid": "24dc7056-9d8d-42cd-f24f-633ebad7df39",
"citation": "scifinder",
"doc_type": "STN (SCIFINDER)",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE",
"NOMEN"
]
},
{
"uuid": "e9a3d2bb-479e-447d-b4d7-ac67709d4fd6",
"citation": "who-dd",
"doc_type": "WHO DRUG DICTIONARY",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "44b77f3e-7d20-3502-8807-942c4ca9a365",
"citation": "pubchem",
"doc_type": "NCBI",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "bca0f961-ce28-4811-8fae-073471eb829b",
"citation": "STN",
"doc_type": "STN (SCIFINDER)",
"public_domain": true
},
{
"uuid": "2c32e29c-0b95-4cb1-8270-fcf0b454855e",
"citation": "PUBCHEM",
"doc_type": "PUBCHEM",
"public_domain": true
},
{
"uuid": "ef67927a-7dd6-1802-a3af-b0e3c306ec50",
"citation": "EPA CompTox",
"doc_type": "EPA",
"public_domain": true
},
{
"uuid": "4e53428f-b11f-db3b-d55e-a7c60f579782",
"citation": "EU-SRS",
"doc_type": "EMA LIST",
"public_domain": true
},
{
"uuid": "5c307ff5-455b-f5be-e557-bc1dacd3a802",
"citation": "STARI",
"doc_type": "CFSAN",
"public_domain": true
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "0226d1e8-0e31-4945-9d06-06cea74a82e8",
"id": "0226d1e8-0e31-4945-9d06-06cea74a82e8",
"molfile": "\n Marvin 04062310212D \n\n 10 9 0 0 1 0 999 V2000\n 12.9718 -3.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5849 -3.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3694 -3.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9826 -4.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7672 -3.9256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1871 -3.5863 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.9321 -4.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4171 -5.0384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1073 -4.3710 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 11.5197 -3.1014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 6 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\nM CHG 1 9 -1\nM END",
"smiles": "C(CCN)C[C@@H](C(=O)[O-])N",
"formula": "C6H13N2O2",
"atropisomerism": "No",
"charge": -1,
"count": 2,
"stereochemistry": "ABSOLUTE",
"count_amount": {
"type": "MOL RATIO",
"average": 2,
"units": "MOL RATIO",
"uuid": "b2aa8e45-ac70-4114-95be-56a63ae8663e"
},
"defined_stereo": 1,
"ez_centers": 0,
"molecular_weight": "145.1799",
"optical_activity": "UNSPECIFIED",
"stereo_centers": 1
},
{
"uuid": "8dfb40ed-cd81-4e4b-b626-101bd429f313",
"id": "8dfb40ed-cd81-4e4b-b626-101bd429f313",
"molfile": "\n Marvin 04062310212D \n\n 1 0 0 0 1 0 999 V2000\n 8.2498 -3.7949 0.0000 Cu 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END",
"smiles": "[Cu+2]",
"formula": "Cu",
"atropisomerism": "No",
"charge": 2,
"count": 1,
"stereochemistry": "ACHIRAL",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "f80c29de-477d-4cb9-9122-f67f702b66f7"
},
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "63.5456",
"optical_activity": "NONE",
"stereo_centers": 0
}
],
"definition_level": "COMPLETE",
"uuid": "564ad61a-eee5-48ea-8ae4-02f4d18a7d60",
"version": "19",
"structure": {
"id": "637ba6cd-ea6f-ecb9-30d1-ee0d370abf97",
"molfile": "Copper(1+), (L-lysinato-.kappa.N2,.kappa.O1)-\n JSDraw204062310212D\n\n 21 18 0 0 1 0 0 V2000\n 24.5289 -6.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6882 -7.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1718 -6.8613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3312 -7.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8148 -7.4231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0452 -6.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5630 -8.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4801 -9.5274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0032 -8.2654 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.7832 -5.8646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6000 -7.1760 0.0000 Cu 0 2 0 0 0 0 0 0 0 0 0 0\n 24.5289 -6.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6882 -7.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1718 -6.8613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3312 -7.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8148 -7.4231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0452 -6.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5630 -8.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4801 -9.5274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0032 -8.2654 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.7832 -5.8646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 1 1 1 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 12 1 1 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 17 21 1 0 0 0 0\nM STY 1 1 MUL\nM SAL 1 8 1 2 3 4 5 6 7 8\nM SAL 1 8 9 10 12 13 14 15 16 17\nM SAL 1 4 18 19 20 21\nM SPA 1 8 1 2 3 4 5 6 7 8\nM SPA 1 2 9 10\nM SDI 1 4 19.1360 -12.1564 19.1360 -3.8364\nM SDI 1 4 31.6160 -3.8364 31.6160 -12.1564\nM SMT 1 2\nM CHG 3 9 -1 11 2 20 -1\nM END",
"smiles": "C(CCN)C[C@@H](C(=O)[O-])N.C(CCN)C[C@@H](C(=O)[O-])N.[Cu+2]",
"formula": "2C6H13N2O2.Cu",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ABSOLUTE",
"defined_stereo": 2,
"ez_centers": 0,
"molecular_weight": "353.9054",
"optical_activity": "UNSPECIFIED",
"references": [
"24dc7056-9d8d-42cd-f24f-633ebad7df39"
],
"stereo_centers": 2
},
"modifications": {
"uuid": "43496795-524d-4200-bacc-a4611ce65fda"
},
"unii": "OMF16V5TQF"
}
]
}