{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "298754f6-53ed-46ba-b351-f548165ab4b9", "code": "12691-60-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=12691-60-0", "code_system": "CAS", "references": [ "7e59483c-1b9f-45b6-9312-b85b1cca163d", "7bc8e904-141b-48d8-a16a-87e79bd19630" ] }, { "uuid": "226a9237-8dea-4049-8753-a9486901c80a", "code": "94891-33-5", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=94891-33-5", "code_system": "CAS", "references": [ "7e59483c-1b9f-45b6-9312-b85b1cca163d", "d1922591-50d8-49c0-a604-2a9e4cb51f24" ] }, { "uuid": "bafb6bae-3e6f-4b16-a5c9-2fcd68ebcfea", "code": "1372931", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1372931/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "7e59483c-1b9f-45b6-9312-b85b1cca163d" ] }, { "uuid": "21f87316-2b6e-4c4c-9547-351d50ef1f06", "code": "SUB40469", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "7e59483c-1b9f-45b6-9312-b85b1cca163d" ] }, { "uuid": "470c3361-6126-46d2-924f-b279bfe1beff", "code": "86278144", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86278144", "code_system": "PUBCHEM", "references": [ "7e59483c-1b9f-45b6-9312-b85b1cca163d" ] }, { "uuid": "dc914cdf-e728-4b77-ba36-228c3511f7b5", "code": "OLX698AH5P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "201ad826-5bab-a82f-5211-e5724d66368b", "code": "OLX698AH5P", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OLX698AH5P", "code_system": "DAILYMED", "references": [ "903d6a1e-9c9c-e4e1-967b-56d19d9ea0fa" ] }, { "uuid": "8eb7f328-7e28-0340-935f-367cb75dadd9", "code": "100000129769", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "aacde5bb-754f-0eef-d23f-78bf21efd140" ] }, { "uuid": "8786d4c1-8238-85c6-da39-625e939d641b", "code": "DTXSID201027425", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201027425", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "c88ff62f-b800-4810-a93f-ba0b1a5a3f23", "name": "AN OCTADECYLDIMETHYLBENZYLAMMONIUM CHLORIDE-MODIFIED HECTORITE", "stdName": "AN OCTADECYLDIMETHYLBENZYLAMMONIUM CHLORIDE-MODIFIED HECTORITE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b02ad7e0-ebd0-4103-bf27-df1193c6b568", "88f237ca-9092-4504-b1ce-f3cd49d4bd6e" ], "display_name": false }, { "uuid": "4fd3e068-20b3-4723-84d2-2d9dc4e01476", "name": "BENTONE 27V", "stdName": "BENTONE 27V", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b02ad7e0-ebd0-4103-bf27-df1193c6b568", "88f237ca-9092-4504-b1ce-f3cd49d4bd6e" ], "display_name": false }, { "uuid": "e0df983f-ab78-42c5-9cb2-6fe75dd8ee84", "name": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTADECYL-, CHLORIDE, REACTION PRODUCTS WITH HECTORITE", "stdName": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTADECYL-, CHLORIDE, REACTION PRODUCTS WITH HECTORITE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b02ad7e0-ebd0-4103-bf27-df1193c6b568", "88f237ca-9092-4504-b1ce-f3cd49d4bd6e" ], "display_name": false }, { "uuid": "c84aa506-b2d6-4915-8829-e90bb8229aeb", "name": "BENZYLDIMETHYLSTEARYLAMMONIUM HECTORITE", "stdName": "BENZYLDIMETHYLSTEARYLAMMONIUM HECTORITE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "88f237ca-9092-4504-b1ce-f3cd49d4bd6e", "e7c62a91-4de9-45ce-9a87-aab3aad79851" ], "display_name": false }, { "uuid": "8e252752-603d-4a6d-bbba-7bd2e0a0a330", "name": "LUCENTITE SSN", "stdName": "LUCENTITE SSN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "88f237ca-9092-4504-b1ce-f3cd49d4bd6e", "e7c62a91-4de9-45ce-9a87-aab3aad79851" ], "display_name": false }, { "uuid": "18a9dfd2-87bb-4466-b814-0e331cf41915", "name": "STEARALKONIUM HECTORITE", "stdName": "STEARALKONIUM HECTORITE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "88f237ca-9092-4504-b1ce-f3cd49d4bd6e", "476da0f6-afe3-4ec1-9990-4c90bd2a0f16", "620eb12e-b8d7-43ca-a556-bb45039d17f9", "e7c62a91-4de9-45ce-9a87-aab3aad79851" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "87db4cdb-a454-45d0-9678-6b9104569936", "name_org": "INCI" } ] } ], "references": [ { "uuid": "e7c62a91-4de9-45ce-9a87-aab3aad79851", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "620eb12e-b8d7-43ca-a556-bb45039d17f9", "citation": "NDA 18456", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b02ad7e0-ebd0-4103-bf27-df1193c6b568", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88f237ca-9092-4504-b1ce-f3cd49d4bd6e", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e59483c-1b9f-45b6-9312-b85b1cca163d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390735000, "tags": [ "NOMEN" ] }, { "uuid": "4eac8b54-807b-4a9a-b840-bb22c3b0a1da", "citation": "SRS import [OLX698AH5P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OLX698AH5P", "doc_type": "SRS", "public_domain": true, "document_date": 1493390735000, "tags": [ "NOMEN" ] }, { "uuid": "476da0f6-afe3-4ec1-9990-4c90bd2a0f16", "citation": "STEARALKONIUM HECTORITE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "903d6a1e-9c9c-e4e1-967b-56d19d9ea0fa", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "7bc8e904-141b-48d8-a16a-87e79bd19630", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d1922591-50d8-49c0-a604-2a9e4cb51f24", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "aacde5bb-754f-0eef-d23f-78bf21efd140", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6f38f32d-9e1e-4444-8dbc-c5f18f1d7fe5", "id": "6f38f32d-9e1e-4444-8dbc-c5f18f1d7fe5", "molfile": "\n Marvin 02212207392D \n\n 1 0 0 0 0 0 999 V2000\n 19.6292 -7.2425 0.0000 Li 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Li+]", "formula": "Li", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "73e68967-5df3-4bb8-afe7-cbfa312d0bce" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "6.94", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "d72d0cae-b333-40a0-af28-ae44311318ac", "id": "d72d0cae-b333-40a0-af28-ae44311318ac", "molfile": "\n Marvin 01132111092D \n\n 1 0 0 0 0 0 999 V2000\n 9.0302 -4.0137 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 -1\nM END", "smiles": "[OH-]", "formula": "HO", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "81c2a0cb-2d23-479a-bef9-2ea3e672b9f0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "17.0073", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "db25347e-256f-42ee-b8ed-ec5b000a2259", "id": "db25347e-256f-42ee-b8ed-ec5b000a2259", "molfile": "\n Marvin 01132111222D \n\n 1 0 0 0 0 0 999 V2000\n 6.2537 -6.0610 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fe9b8cfc-fead-418b-816c-b2ce8579174d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "e6b5809e-eeec-4815-b716-c1cd6473856a", "id": "e6b5809e-eeec-4815-b716-c1cd6473856a", "molfile": "\n Marvin 01132111572D \n\n 1 0 0 0 0 0 999 V2000\n 7.5417 -6.0327 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mg+2]", "formula": "Mg", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f8732d3e-a289-4729-880d-6854f86d53b3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "24.3051", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "983ff37f-b488-4c95-be67-21cee43a36e3", "id": "983ff37f-b488-4c95-be67-21cee43a36e3", "molfile": "\n Marvin 01132107542D \n\n 14 16 0 0 0 0 999 V2000\n 6.0881 -5.5418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5006 -4.8274 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9505 -3.9325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1255 -3.9325 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3005 -3.9325 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.7130 -4.6469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4356 -2.9067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2604 -2.9067 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0469 -2.1098 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.5871 -3.1356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3737 -3.9325 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1986 -3.9325 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.4740 -3.7035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5047 -4.7619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 6 2 1 0 0 0 0\n 2 14 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 1 0 0 0 0\n 8 13 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 11 1 0 0 0 0\nM CHG 3 5 -1 9 -1 12 -1\nM END", "smiles": "O[Si]12O[Si]([O-])(O1)O[Si]3([O-])O[Si]([O-])(O3)O2", "formula": "HO10Si4", "atropisomerism": "No", "charge": -3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c12c2236-55c2-43d0-88d9-1bc5f844ff86" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.3435", "optical_activity": "NONE", "stereo_centers": 4 }, { "uuid": "2d425c05-e49c-430a-b95f-add1c4aabc00", "id": "2d425c05-e49c-430a-b95f-add1c4aabc00", "molfile": "\n Marvin 01132102262D \n\n 28 28 0 0 0 0 999 V2000\n 1.7068 -9.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4457 -9.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1237 -9.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8708 -9.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5617 -9.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2703 -9.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9598 -9.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7029 -9.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4016 -9.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1411 -9.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8301 -9.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5269 -9.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2205 -9.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9643 -9.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6669 -9.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3777 -9.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0884 -8.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8157 -9.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -8.9043 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 15.1141 -7.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5766 -7.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1190 -9.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9052 -9.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5047 -9.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3032 -9.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4853 -8.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8733 -8.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0840 -8.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 19 1 0 0 0 0\n 22 19 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 28 23 2 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\nM CHG 1 19 1\nM END", "smiles": "CCCCCCCCCCCCCCCCCC[N+](C)(C)Cc1ccccc1", "formula": "C27H50N", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f5cc76a6-5ba2-457e-b756-1c68c2a566fb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "388.6936", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "39a1c91f-f608-490e-9263-9b160e6ceb36", "version": "9", "structure": { "id": "37ac6416-c8d1-495a-99b5-8a48331a82fd", "molfile": "\n JSDraw202212207392D\n\n 47 44 0 0 0 0 0 V2000\n 36.8537 -13.5978 0.0000 Li 0 3 0 0 0 0 0 0 0 0 0 0\n 37.0655 -9.7416 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 31.8525 -13.5854 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 34.2707 -13.5321 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\n 29.0303 -9.0488 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5698 -7.2637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0053 -7.2637 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3138 -7.6621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9424 -9.0488 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3768 -8.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3779 -9.0488 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 33.1703 -10.4921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4231 -10.6061 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7053 -11.8492 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 30.4658 -9.0488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3125 -10.2920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6337 -5.8771 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 27.5948 -9.0488 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 52.9477 -18.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 51.7983 -17.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 52.6054 -20.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3164 -19.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 43.3559 -19.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.0209 -19.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.7014 -19.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.3047 -19.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.0022 -20.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.6936 -19.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3997 -20.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0108 -19.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6989 -20.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3034 -19.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0085 -20.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6779 -19.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3802 -20.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9772 -19.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7042 -20.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.6904 -19.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 51.1060 -20.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 50.3159 -17.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 46.0563 -19.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 49.9802 -19.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.5038 -19.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 47.3187 -18.9275 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 48.4946 -16.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.6071 -16.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.0655 -9.7416 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 7 10 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 5 15 1 0 0 0 0\n 13 15 1 0 0 0 0\n 5 16 1 0 0 0 0\n 16 13 1 0 0 0 0\n 7 17 1 0 0 0 0\n 5 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 22 37 1 0 0 0 0\n 23 38 1 0 0 0 0\n 21 39 1 0 0 0 0\n 20 40 2 0 0 0 0\n 38 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 39 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 41 44 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 44 1 0 0 0 0\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 2 47\nM SPA 1 1 2\nM SDI 1 4 35.8050 -10.9818 35.8050 -8.1013\nM SDI 1 4 38.9650 -8.1013 38.9650 -10.9818\nM SMT 1 2\nM CHG 8 1 1 2 -1 3 1 4 2 11 -1 14 -1 17 -1 18 -1\nM CHG 2 44 1 47 -1\nM END", "smiles": "CCCCCCCCCCCCCCCCCC[N+](C)(C)Cc1ccccc1.[Li+].[Mg+2].[Na+].[O-][Si]12O[Si]([O-])(O1)O[Si]3([O-])O[Si]([O-])(O3)O2.[OH-].[OH-]", "formula": "C27H50N.Li.Mg.Na.O10Si4.2HO", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "749.2787", "optical_activity": "NONE", "references": [ "b02ad7e0-ebd0-4103-bf27-df1193c6b568", "4eac8b54-807b-4a9a-b840-bb22c3b0a1da" ], "stereo_centers": 4 }, "unii": "OLX698AH5P" } ] }