{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "420187e9-9f44-4997-ab40-4f26a0b9c48f",
          "code": "142459-58-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=142459-58-3",
          "code_system": "CAS",
          "references": [
            "cbf29726-c09f-41d6-b0c8-3c6504b56ed6",
            "b3c64939-6381-4dae-a7be-a7e89907175b"
          ]
        },
        {
          "uuid": "29a1210b-9d74-4aa3-be17-d619f8d8947b",
          "code": "121903",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2392",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "cbf29726-c09f-41d6-b0c8-3c6504b56ed6"
          ]
        },
        {
          "uuid": "c9fc99aa-b40d-4a71-9121-3fa707fa1eed",
          "code": "m5432",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5432?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cbf29726-c09f-41d6-b0c8-3c6504b56ed6"
          ]
        },
        {
          "uuid": "0796e9e8-bf66-4bf5-b14d-52630d6272ea",
          "code": "86429",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86429",
          "code_system": "PUBCHEM",
          "references": [
            "cbf29726-c09f-41d6-b0c8-3c6504b56ed6"
          ]
        },
        {
          "uuid": "fd63b3bb-29cd-aad1-7851-9bb5e939088a",
          "code": "7011",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7011",
          "code_system": "HSDB",
          "references": [
            "9bb11f0e-fdc8-767c-9410-04275aededae"
          ]
        },
        {
          "uuid": "6a274d4f-6611-993c-ebe8-fadbe710ea2c",
          "code": "DTXSID2032552",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2032552",
          "code_system": "EPA CompTox",
          "references": [
            "3109ba98-fa55-3135-13bb-150ca48aaf99"
          ]
        },
        {
          "uuid": "1d7bfcfe-5f69-48fc-a2e6-a153e048b319",
          "code": "OL44PP5145",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "231bd0cf-300e-23ab-42e8-4e8686e622e9",
          "code": "Flufenacet",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Flufenacet",
          "code_system": "WIKIPEDIA",
          "references": [
            "cd02e3f9-9f7c-0cc4-a8b3-ff40f9096902"
          ]
        },
        {
          "uuid": "24e4e585-2e9c-65f6-802f-0766e7e41557",
          "code": "flufenacet",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flufenacet.html",
          "code_system": "ALANWOOD",
          "references": [
            "c28606b2-1675-d928-b16c-c63f3b927b4d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "23d7367d-18f1-47b0-b789-c531ea1d22b7",
          "name": "4'-FLUORO-N-ISOPROPYL-2-(5-(TRIFLUOROMETHYL)-1,3,4-THIADIAZOL-2-YLOXY)ACETANILIDE",
          "stdName": "4'-FLUORO-N-ISOPROPYL-2-(5-(TRIFLUOROMETHYL)-1,3,4-THIADIAZOL-2-YLOXY)ACETANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6bbc4f2-14c8-425b-91ae-ff541aff2cfe",
            "eb7f689a-86a7-4575-93f1-b22aa0e91d7b"
          ],
          "display_name": false
        },
        {
          "uuid": "1d34f56e-798e-41e5-a656-d3b148f31efc",
          "name": "BAY FOE-5043",
          "stdName": "BAY FOE-5043",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "715a1281-7698-4a1d-8aa1-1f79cd803af8",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "7267678a-7300-4b62-bd36-320d870cd26d",
          "name": "DEFINE",
          "stdName": "DEFINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f5acce-7171-4e52-b079-89822e26f1de",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "971f9ca5-ca5e-4329-aeb0-78ebec37352b",
          "name": "FLUFENACET",
          "stdName": "FLUFENACET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cc5d44d-f11f-4ec4-a868-18423eacae05",
            "4ef7805f-a40c-4ecb-9dcb-a8a5aa229f9c",
            "60398146-9bfe-412f-9ecb-fbb2a3ea8f4a",
            "61ca1a71-ce35-4ae9-bd24-6fa3494a9e58",
            "c9322507-8963-4a8e-8eb8-da379ff30ad8",
            "3e848181-8e61-4759-bbf1-1f91383225e9",
            "c6c6e559-9ce3-4e11-b2c8-b802e088cfcd",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": true
        },
        {
          "uuid": "72e92ea9-1800-4656-8ee9-b8b465f82b86",
          "name": "FLUFENACET [HSDB]",
          "stdName": "FLUFENACET [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e848181-8e61-4759-bbf1-1f91383225e9",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "21891bd0-6c9c-4546-957a-e300eb2ce732",
          "name": "FLUFENACET [ISO]",
          "stdName": "FLUFENACET [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cc5d44d-f11f-4ec4-a868-18423eacae05",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "20bad480-e2bd-4c4b-8e51-1c6011a2e57e",
          "name": "FLUFENACET [MI]",
          "stdName": "FLUFENACET [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9322507-8963-4a8e-8eb8-da379ff30ad8",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "06238d29-8cc6-4087-b77a-4b4e0b46d53f",
          "name": "FOE-5043",
          "stdName": "FOE-5043",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "715a1281-7698-4a1d-8aa1-1f79cd803af8",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        },
        {
          "uuid": "357233df-ad09-40c1-98c9-98ae34aa54a9",
          "name": "N-(4-FLUOROPHENYL)-N-(1-METHYLETHYL)-2-((5-(TRIFLUOROMETHYL)-1,3,4-THIADIAZOL-2-YL)OXY)ACETAMIDE",
          "stdName": "N-(4-FLUOROPHENYL)-N-(1-METHYLETHYL)-2-((5-(TRIFLUOROMETHYL)-1,3,4-THIADIAZOL-2-YL)OXY)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87055e2e-9d9a-4d3f-be97-70a5b3b3cea5",
            "eb7f689a-86a7-4575-93f1-b22aa0e91d7b"
          ],
          "display_name": false
        },
        {
          "uuid": "4605729e-bbb5-49c5-bf77-21422778d4c2",
          "name": "N-ISOPROPYL-(5-TRIFLUOROMETHYL-1,3,4-THIADIAZOL-2-YL)-(4'-FLUOROOXYACETANILIDE)",
          "stdName": "N-ISOPROPYL-(5-TRIFLUOROMETHYL-1,3,4-THIADIAZOL-2-YL)-(4'-FLUOROOXYACETANILIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "715a1281-7698-4a1d-8aa1-1f79cd803af8",
            "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "61ca1a71-ce35-4ae9-bd24-6fa3494a9e58",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eb7f689a-86a7-4575-93f1-b22aa0e91d7b",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6bbc4f2-14c8-425b-91ae-ff541aff2cfe",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87055e2e-9d9a-4d3f-be97-70a5b3b3cea5",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9322507-8963-4a8e-8eb8-da379ff30ad8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3a8c12a-3ba7-4d38-b2bb-c54549f479b9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "715a1281-7698-4a1d-8aa1-1f79cd803af8",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8f5acce-7171-4e52-b079-89822e26f1de",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e848181-8e61-4759-bbf1-1f91383225e9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cc5d44d-f11f-4ec4-a868-18423eacae05",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbf29726-c09f-41d6-b0c8-3c6504b56ed6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "326d5c36-d6e2-4dc9-959c-740c3eb5bc18",
          "citation": "SRS import [OL44PP5145]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OL44PP5145",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad245b7c-331d-4f44-ad5b-66714c95e168",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ef7805f-a40c-4ecb-9dcb-a8a5aa229f9c",
          "citation": "FLUFENACET [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60398146-9bfe-412f-9ecb-fbb2a3ea8f4a",
          "citation": "FLUFENACET [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6c6e559-9ce3-4e11-b2c8-b802e088cfcd",
          "citation": "FLUFENACET [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9bb11f0e-fdc8-767c-9410-04275aededae",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+142459-58-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3109ba98-fa55-3135-13bb-150ca48aaf99",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=142459-58-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cd02e3f9-9f7c-0cc4-a8b3-ff40f9096902",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c28606b2-1675-d928-b16c-c63f3b927b4d",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b3c64939-6381-4dae-a7be-a7e89907175b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "535e12b0-2475-4377-b84c-1df9c10b7d37",
          "id": "535e12b0-2475-4377-b84c-1df9c10b7d37",
          "molfile": "\n  Marvin  01132104202D          \n\n 24 25  0  0  0  0            999 V2000\n    4.9092   -2.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9092   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2055   -3.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6411   -3.8705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3445   -3.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3445   -2.6251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0623   -3.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7768   -3.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4975   -3.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2584   -3.4814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8139   -4.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4176   -4.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5923   -4.6573    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7557   -5.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0955   -6.3324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9999   -5.9263    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5210   -5.2438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6411   -4.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -5.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -5.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6689   -6.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6689   -7.1498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3828   -5.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3828   -5.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 18  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n 19 18  1  0  0  0  0\n 24 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CC(C)N(c1ccc(cc1)F)C(=O)COc2nnc(C(F)(F)F)s2",
          "formula": "C14H13F4N3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6786f1f5-ff19-472b-a1f2-67b8c73ecb9c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "363.3321",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c82b239e-157c-4df7-80cf-7b0575bbf5da",
      "version": "7",
      "structure": {
        "id": "8f1f0d87-7518-4520-b25b-f85f86a019e7",
        "molfile": "\n  Marvin  01132107252D          \n\n 24 25  0  0  0  0            999 V2000\n    9.4176   -4.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5923   -4.6573    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4975   -3.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7768   -3.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0623   -3.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3445   -3.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6411   -3.8705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6411   -4.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -5.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -5.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6689   -6.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3828   -5.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3828   -5.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6689   -7.1498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9092   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9092   -2.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2055   -3.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3445   -2.6251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2584   -3.4814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8139   -4.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7557   -5.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0955   -6.3324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9999   -5.9263    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5210   -5.2438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  8  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18  6  2  0  0  0  0\n 19  3  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20  1  2  0  0  0  0\n 21  1  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)N(c1ccc(cc1)F)C(=O)COc2nnc(C(F)(F)F)s2",
        "formula": "C14H13F4N3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "363.3321",
        "optical_activity": "NONE",
        "references": [
          "326d5c36-d6e2-4dc9-959c-740c3eb5bc18",
          "ad245b7c-331d-4f44-ad5b-66714c95e168"
        ],
        "stereo_centers": 0
      },
      "unii": "OL44PP5145"
    }
  ]
}