{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fabd311e-b487-4eed-9fcf-bd6bdf77a973",
          "code": "51-26-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-26-3",
          "code_system": "CAS",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42",
            "42d08a0f-7311-4d87-8b41-f4b8aeda7193"
          ]
        },
        {
          "uuid": "050d3b1a-fbf3-45ce-977e-92f0b412fad2",
          "code": "904",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=904",
          "code_system": "INN",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42"
          ]
        },
        {
          "uuid": "0428d514-42d5-40d5-977c-8716c0ec4744",
          "code": "m10837",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10837?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42"
          ]
        },
        {
          "uuid": "ba72ce0e-8cb0-46e0-9d25-60bb1e1d8984",
          "code": "SUB10995MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42"
          ]
        },
        {
          "uuid": "6f2d8dc2-4bac-4d66-92f4-dc378f6e2222",
          "code": "CHEMBL291053",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL291053",
          "code_system": "ChEMBL",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42"
          ]
        },
        {
          "uuid": "15a79020-d3ae-4285-9c13-6d0e11f57ab4",
          "code": "5804",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5804",
          "code_system": "PUBCHEM",
          "references": [
            "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42"
          ]
        },
        {
          "uuid": "257b674b-67de-fc47-682a-5cde81ac32f6",
          "code": "DTXSID20198998",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20198998",
          "code_system": "EPA CompTox",
          "references": [
            "95930cf5-b133-d185-87f5-96922e6f7130"
          ]
        },
        {
          "uuid": "13f153c7-0ad8-d1f0-83f1-0c1fa22ad719",
          "code": "C152594",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152594",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dbad55a3-97bf-2a9d-79c1-be4ccad58ed3"
          ]
        },
        {
          "uuid": "30b3456b-bab8-d5bd-98b6-92579abdc519",
          "code": "C1553",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Thyroid Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1553",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c57ffeea-c1bc-9f55-bfdb-6aabeb0b0f9b"
          ]
        },
        {
          "uuid": "1a054437-cabd-bae8-7d18-9a8d142ecf8a",
          "code": "C29703",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29703",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c57ffeea-c1bc-9f55-bfdb-6aabeb0b0f9b"
          ]
        },
        {
          "uuid": "9e8323b8-b7a1-4db9-8f51-d1ba1fc758c6",
          "code": "OK7481S22O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "389a7f93-343b-7352-a71b-6105b635f7ec",
          "code": "3604",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3604",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c57ffeea-c1bc-9f55-bfdb-6aabeb0b0f9b"
          ]
        },
        {
          "uuid": "ec71f2ee-288e-5eaf-1e6f-79926ae3e32c",
          "code": "100000082152",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a627cb38-84d6-80c5-d040-234c6ccaf01a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d08e0176-5dbb-4520-9518-60b546009186",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b89b5d1b-70db-4809-a046-0cf608b34c8c",
            "refuuid": "82ccc1da-8c3c-4d92-aa19-0a4600035761",
            "name": "THYROPROPIC ACID",
            "unii": "OK7481S22O",
            "linking_id": "OK7481S22O",
            "ref_pname": "THYROPROPIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d33621e5-17a1-4171-901c-2ba2e02251bb",
          "name": "4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODOHYDROCINNAMIC ACID",
          "stdName": "4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODOHYDROCINNAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "447c48cb-25db-4beb-b279-8e4491553ac8"
          ],
          "display_name": false
        },
        {
          "uuid": "d449da21-e46c-4313-9c14-10c5ab101a69",
          "name": "THYROPROPIC ACID",
          "stdName": "THYROPROPIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fad93c90-376d-464c-8719-d3223c662058",
            "8a13ba48-db30-4502-a10a-a4c0fcd1c422",
            "7e4ad5bb-3fcd-475a-b54e-62cf98f0b04b",
            "447c48cb-25db-4beb-b279-8e4491553ac8",
            "69bb4c30-e70d-4ba8-acde-541b5338565f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2d13a34f-5c8d-4595-b826-45ee3abfbf8d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3c758063-b186-44d8-9e41-0d49c1be10cf",
          "name": "THYROPROPIC ACID [MI]",
          "stdName": "THYROPROPIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e4ad5bb-3fcd-475a-b54e-62cf98f0b04b"
          ],
          "display_name": false
        },
        {
          "uuid": "43206267-01cb-45ee-bdfe-367e61adc84e",
          "name": "thyropropic acid [INN]",
          "stdName": "THYROPROPIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a13ba48-db30-4502-a10a-a4c0fcd1c422"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "447c48cb-25db-4beb-b279-8e4491553ac8",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a13ba48-db30-4502-a10a-a4c0fcd1c422",
          "citation": "INN Proposed List 10",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL10.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7e4ad5bb-3fcd-475a-b54e-62cf98f0b04b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f7e212d-3971-4aa5-8c1d-cd6db15bdd42",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdd7fffd-9b26-4856-8300-62616999c0f4",
          "citation": "SRS import [OK7481S22O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OK7481S22O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69bb4c30-e70d-4ba8-acde-541b5338565f",
          "citation": "THYROPROPIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fad93c90-376d-464c-8719-d3223c662058",
          "citation": "THYROPROPIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "95930cf5-b133-d185-87f5-96922e6f7130",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-26-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dbad55a3-97bf-2a9d-79c1-be4ccad58ed3",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c57ffeea-c1bc-9f55-bfdb-6aabeb0b0f9b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "42d08a0f-7311-4d87-8b41-f4b8aeda7193",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a627cb38-84d6-80c5-d040-234c6ccaf01a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f07cf9cd-cbde-4759-bd92-71862228f9ff",
          "id": "f07cf9cd-cbde-4759-bd92-71862228f9ff",
          "molfile": "\n  Marvin  01132112292D          \n\n 22 23  0  0  0  0            999 V2000\n    0.2454   -1.3460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2480   -2.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4702   -2.5913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9611   -2.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6767   -2.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4337   -2.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4337   -3.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -3.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -4.6193    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8546   -3.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5754   -3.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2936   -3.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2807   -2.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9938   -2.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7223   -2.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4276   -2.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7275   -3.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4483   -3.7306    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0222   -3.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8675   -2.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5522   -2.1262    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1416   -2.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 22  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 20 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 19 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)c1cc(c(c(c1)I)Oc2ccc(c(c2)I)O)I",
          "formula": "C15H11I3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2f48f9a4-cf0b-4b96-9213-0253fdeb7c67"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "635.9594",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "82ccc1da-8c3c-4d92-aa19-0a4600035761",
      "version": "9",
      "structure": {
        "id": "b308f08d-9fd1-42be-8635-524f94a729f2",
        "molfile": "\n  Marvin  01132109162D          \n\n 22 23  0  0  0  0            999 V2000\n    3.8546   -3.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -3.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8675   -2.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5754   -3.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7275   -3.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0222   -3.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2480   -2.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2936   -3.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1416   -2.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4337   -3.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7223   -2.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4337   -2.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2454   -1.3460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9938   -2.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -4.6193    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5522   -2.1262    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4483   -3.7306    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9611   -2.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2807   -2.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6767   -2.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4702   -2.5913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4276   -2.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  7 18  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11 14  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14 19  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19  8  2  0  0  0  0\n 20 12  1  0  0  0  0\n 21  7  1  0  0  0  0\n 22 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  5 11  1  0  0  0  0\nM  END",
        "smiles": "C(CC(=O)O)c1cc(c(c(c1)I)Oc2ccc(c(c2)I)O)I",
        "formula": "C15H11I3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "635.9594",
        "optical_activity": "NONE",
        "references": [
          "bdd7fffd-9b26-4856-8300-62616999c0f4",
          "447c48cb-25db-4beb-b279-8e4491553ac8",
          "8a13ba48-db30-4502-a10a-a4c0fcd1c422"
        ],
        "stereo_centers": 0
      },
      "unii": "OK7481S22O"
    }
  ]
}