{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5037751d-379a-4d10-b3cd-0e40f7b6acf1",
          "code": "50649-56-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50649-56-4",
          "code_system": "CAS",
          "references": [
            "11080cba-a4c5-4395-a496-4aaf7c9db5bb",
            "856110cc-f956-4287-9d18-c543660cabb8"
          ]
        },
        {
          "uuid": "b1db89cd-dff5-4e11-a6ac-942b31752715",
          "code": "256-682-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.512",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "11080cba-a4c5-4395-a496-4aaf7c9db5bb"
          ]
        },
        {
          "uuid": "45d47212-483e-4e6e-b9ee-da513541518b",
          "code": "3016539",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3016539",
          "code_system": "PUBCHEM",
          "references": [
            "11080cba-a4c5-4395-a496-4aaf7c9db5bb"
          ]
        },
        {
          "uuid": "c4947a3f-7116-7c3b-da1f-bd92575bd48f",
          "code": "DTXSID80198691",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80198691",
          "code_system": "EPA CompTox",
          "references": [
            "def7dee2-7452-b375-93bb-0360356573aa"
          ]
        },
        {
          "uuid": "3f3d484e-5f58-4900-9fc1-9b5462162159",
          "code": "OIC716N0BU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63365faf-614f-4a34-9287-12bc5e37cf8f",
          "name": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-PENTYLPHENYL ESTER",
          "stdName": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-PENTYLPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09651683-a5f2-4480-9927-c7e1ab0aa280",
            "ca4d4456-9d9d-4f30-b47d-912e63b361d5"
          ],
          "display_name": false
        },
        {
          "uuid": "daaa5187-eee9-426b-8ece-7abfedddb85e",
          "name": "P-PENTYLPHENYL P-OCTYLOXYBENZOATE",
          "stdName": "P-PENTYLPHENYL P-OCTYLOXYBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09651683-a5f2-4480-9927-c7e1ab0aa280",
            "ca4d4456-9d9d-4f30-b47d-912e63b361d5"
          ],
          "display_name": false
        },
        {
          "uuid": "75028720-7c41-4c07-a1f8-6d276ecbe8f8",
          "name": "PENTYLPHENYL OCTYLOXYBENZOATE",
          "stdName": "PENTYLPHENYL OCTYLOXYBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08170d23-37bc-4ce4-b9c8-ef53979638ce",
            "1cbbc789-4141-4995-a219-7fd1f3a8e4c7",
            "ca4d4456-9d9d-4f30-b47d-912e63b361d5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b9f993de-7692-447f-9c45-2affc1c1b521",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "08170d23-37bc-4ce4-b9c8-ef53979638ce",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ca4d4456-9d9d-4f30-b47d-912e63b361d5",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09651683-a5f2-4480-9927-c7e1ab0aa280",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11080cba-a4c5-4395-a496-4aaf7c9db5bb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7965f82d-822d-4772-b587-d80cea3c8390",
          "citation": "SRS import [OIC716N0BU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OIC716N0BU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cbbc789-4141-4995-a219-7fd1f3a8e4c7",
          "citation": "PENTYLPHENYL OCTYLOXYBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "def7dee2-7452-b375-93bb-0360356573aa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50649-56-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "856110cc-f956-4287-9d18-c543660cabb8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0ce7b7f1-4038-480a-816b-653d9b1e0902",
          "id": "0ce7b7f1-4038-480a-816b-653d9b1e0902",
          "molfile": "\n  Marvin  01132100552D          \n\n 29 30  0  0  0  0            999 V2000\n    1.6271   -4.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4570   -4.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9067   -5.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7367   -5.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1864   -5.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -5.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4718   -6.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2960   -6.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7456   -7.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5757   -7.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0254   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8496   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2127   -7.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7861   -6.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9561   -6.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0369   -7.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4824   -7.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4174   -6.2941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2417   -6.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6221   -5.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4521   -5.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9018   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7319   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1180   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9422   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3227   -4.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1527   -4.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5272   -6.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6913   -6.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 29  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 28 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(CCCCC)cc2",
          "formula": "C26H36O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "beebb93e-9fef-4b04-b74d-5d41f49c7c10"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "396.5632",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "379e34b9-5cb5-4232-aa6a-233e9c3d7b77",
      "version": "4",
      "structure": {
        "id": "98ab843e-edd3-427a-b66a-7ddd4a09d7ef",
        "molfile": "\n  Marvin  01132107562D          \n\n 29 30  0  0  0  0            999 V2000\n   10.4824   -7.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6271   -4.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4570   -4.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1527   -4.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9067   -5.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3227   -4.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7367   -5.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9422   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1864   -5.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1180   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -5.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7319   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4718   -6.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9018   -6.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2960   -6.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4521   -5.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5272   -6.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7456   -7.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6221   -5.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6913   -6.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5757   -7.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2417   -6.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0254   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9561   -6.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4174   -6.2941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8496   -7.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7861   -6.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0369   -7.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2127   -7.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 28  1  2  0  0  0  0\n 16 14  1  0  0  0  0\n 23 21  2  0  0  0  0\n  3  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 17 14  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 19  1  0  0  0  0\n 22 20  2  0  0  0  0\n 24 21  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 23  1  0  0  0  0\n 27 24  2  0  0  0  0\n 28 25  1  0  0  0  0\n 29 26  2  0  0  0  0\n 29 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(CCCCC)cc2",
        "formula": "C26H36O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "396.5632",
        "optical_activity": "NONE",
        "references": [
          "09651683-a5f2-4480-9927-c7e1ab0aa280",
          "7965f82d-822d-4772-b587-d80cea3c8390"
        ],
        "stereo_centers": 0
      },
      "unii": "OIC716N0BU"
    }
  ]
}