{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "64d11348-f9b0-460c-aa21-f75d34422e15",
          "code": "26650-05-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26650-05-5",
          "code_system": "CAS",
          "references": [
            "a13a5779-74fc-4c2c-a4d2-be34164e0992",
            "3a16d011-1c30-4413-96a0-52115721c99a"
          ]
        },
        {
          "uuid": "d4e04aeb-cdb8-4cf7-b5ad-7e4d228d814a",
          "code": "247-873-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.506",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a13a5779-74fc-4c2c-a4d2-be34164e0992"
          ]
        },
        {
          "uuid": "1707af5f-6c1d-4457-2ac7-d03d11ed6538",
          "code": "117833",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/117833",
          "code_system": "PUBCHEM",
          "references": [
            "44f0adc7-2aa2-2ed9-1f37-aa7fbaa9fa15"
          ]
        },
        {
          "uuid": "e61b022e-d061-4ced-a767-08167d09a781",
          "code": "OIC30Y2OQZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c21ebc7b-ed53-61cf-51ab-37cd8fdebd07",
          "code": "DTXSID40889694",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40889694",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f22f60f1-26a0-4a9c-9f05-d9810cd3e91c",
          "name": "BUTANEDIOIC ACID, 2-SULFO-, 4-(2-((1-OXO-10-UNDECEN-1-YL)AMINO)ETHYL) ESTER, SODIUM SALT (1:2)",
          "stdName": "BUTANEDIOIC ACID, 2-SULFO-, 4-(2-((1-OXO-10-UNDECEN-1-YL)AMINO)ETHYL) ESTER, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6877113c-7e99-43c3-ab82-c1fabb8c27a4",
            "2b72701a-0fb8-48c2-bbee-5f2319b06a98"
          ],
          "display_name": false
        },
        {
          "uuid": "9d55ceb8-6497-45eb-8d68-45464eb5b045",
          "name": "DISODIUM 4-(UNDECYLENIC MONOETHANOLAMIDE) SULFOSUCCINATE",
          "stdName": "DISODIUM 4-(UNDECYLENIC MONOETHANOLAMIDE) SULFOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1361434a-b4a1-4930-9f53-e80e81e67ab6",
            "2b72701a-0fb8-48c2-bbee-5f2319b06a98"
          ],
          "display_name": true
        },
        {
          "uuid": "4e14fd30-9527-4062-a8e5-ecf93bc4e1ab",
          "name": "DISODIUM UNDECYLENOYL MONOETHANOLAMIDE SULFOSUCCINATE",
          "stdName": "DISODIUM UNDECYLENOYL MONOETHANOLAMIDE SULFOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64e514cb-ffdd-475a-a8ec-e5cc93dc7d5b",
            "2b72701a-0fb8-48c2-bbee-5f2319b06a98"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6877113c-7e99-43c3-ab82-c1fabb8c27a4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2b72701a-0fb8-48c2-bbee-5f2319b06a98",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64e514cb-ffdd-475a-a8ec-e5cc93dc7d5b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1361434a-b4a1-4930-9f53-e80e81e67ab6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a13a5779-74fc-4c2c-a4d2-be34164e0992",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e77054c-82e6-4a75-adb4-80ff20bc1dba",
          "citation": "SRS import [OIC30Y2OQZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OIC30Y2OQZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44f0adc7-2aa2-2ed9-1f37-aa7fbaa9fa15",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3a16d011-1c30-4413-96a0-52115721c99a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8aee073f-276d-4a82-a2a1-f906d59ce9f8",
          "id": "8aee073f-276d-4a82-a2a1-f906d59ce9f8",
          "molfile": "\n  Marvin  01132107132D          \n\n  1  0  0  0  0  0            999 V2000\n    1.4018   -2.6180    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "a58a45df-37ce-458b-9ecf-fb80fdf701ca"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "78e75bcf-abeb-4a01-b341-3ad4c405b6e3",
          "id": "78e75bcf-abeb-4a01-b341-3ad4c405b6e3",
          "molfile": "\n  Marvin  01132106172D          \n\n 27 26  0  0  0  0            999 V2000\n   10.3343   -0.9977    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6325   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6325    0.2178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9309   -0.9977    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.2291   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -0.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -1.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8257   -0.5926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1111   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3965   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6818   -1.0048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9672   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9672    0.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2526   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5379   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8233   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1087   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3941   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3205   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0351   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7498   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4644   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1790   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1406   -1.7803    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3048   -2.4024    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.4027   -1.8586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7312   -1.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 24  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  2  0  0  0  0\nM  CHG  2   1  -1  25  -1\nM  END",
          "smiles": "C=CCCCCCCCCC(=O)NCCOC(=O)CC(C(=O)[O-])S(=O)(=O)[O-]",
          "formula": "C17H27NO8S",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "104b58d5-76b3-4001-9e0a-212bf8f2a414"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "405.4649",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eda3b9d3-ae41-42e8-8b57-6c66556a7aa9",
      "version": "4",
      "structure": {
        "id": "44340cd8-c2b3-4fac-9728-183f0404fe7f",
        "molfile": "\n  Marvin  01132103362D          \n\n 29 26  0  0  0  0            999 V2000\n    6.8257   -0.5926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1111   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3965   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6818   -1.0048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9672   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9672    0.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2526   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5379   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8233   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1087   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3941   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3205   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0351   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7498   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4644   -1.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1790   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -0.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2291   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9309   -0.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6325   -0.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3343   -0.9977    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6325    0.2178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1406   -1.7803    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4027   -1.8586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3048   -2.4024    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.7312   -1.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5274   -1.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4018   -2.6180    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    1.4018   -2.6180    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 19 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  2  0  0  0  0\n 17 27  2  0  0  0  0\n  2  1  1  0  0  0  0\nM  CHG  4  21  -1  25  -1  28   1  29   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  28  29\nM  SPA   1  1  28\nM  SDI   1  4    0.9818   -3.0380    0.9818   -2.1980\nM  SDI   1  4    1.8218   -2.1980    1.8218   -3.0380\nM  SMT   1 2\nM  END",
        "smiles": "C=CCCCCCCCCC(=O)NCCOC(=O)CC(C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C17H27NO8S.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "451.4445",
        "optical_activity": "( + / - )",
        "references": [
          "6877113c-7e99-43c3-ab82-c1fabb8c27a4",
          "5e77054c-82e6-4a75-adb4-80ff20bc1dba"
        ],
        "stereo_centers": 1
      },
      "unii": "OIC30Y2OQZ"
    }
  ]
}