{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6d13f12d-7848-4725-9453-c5d6bd6e24c1",
          "code": "162030-43-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=162030-43-5",
          "code_system": "CAS",
          "references": [
            "6c323e09-e676-4eb1-bfd5-bc08af780c12",
            "08929628-70ac-4e25-aa5d-bde4d5934f50"
          ]
        },
        {
          "uuid": "562a4330-00ec-eda2-5a87-e6ff3b7510f2",
          "code": "137552091",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/137552091",
          "code_system": "PUBCHEM",
          "references": [
            "8075be54-663c-0801-5c04-5d4fe56a6994"
          ]
        },
        {
          "uuid": "a37f3141-40ce-9b42-e6a9-d9a28d831316",
          "code": "2560400",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2560400/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8458b0da-c1de-a02f-07e7-5d153fb00e39"
          ]
        },
        {
          "uuid": "f47aa058-ae74-459c-899e-26d0a879a2d1",
          "code": "OI1T4Z23RZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5f33a2e6-fff6-5be2-863d-9f106e23a893",
          "code": "OI1T4Z23RZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OI1T4Z23RZ",
          "code_system": "DAILYMED",
          "references": [
            "fd685271-5e40-1e2d-13ba-2ad264624710"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "578dc9a5-23db-4356-b983-c16f45daa7da",
          "name": "ACEFYLLINE METHYLSILANOL MANNURONATE",
          "stdName": "ACEFYLLINE METHYLSILANOL MANNURONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a6d19a-a733-4e30-ba94-467fc6b74d69",
            "160ceed4-4cf7-40e0-b7f8-901e77182ac3",
            "cdd41878-dac5-4906-94b8-80e6f638c3d3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "34029703-8086-4eef-b28e-499267dc5ef4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dabbe880-4c3e-4671-adcf-2ece47a0961a",
          "name": "MANNOPYRANURONIC ACID, 1-O-(HYDROXYMETHYL(((1,2,3,6-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-7H-PURIN-7-YL)ACETYL)OXY)SILYL)-",
          "stdName": "MANNOPYRANURONIC ACID, 1-O-(HYDROXYMETHYL(((1,2,3,6-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-7H-PURIN-7-YL)ACETYL)OXY)SILYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43c92728-3339-4608-b64d-373a921d5b74",
            "160ceed4-4cf7-40e0-b7f8-901e77182ac3"
          ],
          "display_name": false
        },
        {
          "uuid": "e9c03161-17dd-4afb-8257-2ad522de507e",
          "name": "XANTALGOSIL C",
          "stdName": "XANTALGOSIL C",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a6d19a-a733-4e30-ba94-467fc6b74d69",
            "160ceed4-4cf7-40e0-b7f8-901e77182ac3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "57a6d19a-a733-4e30-ba94-467fc6b74d69",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "160ceed4-4cf7-40e0-b7f8-901e77182ac3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43c92728-3339-4608-b64d-373a921d5b74",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c323e09-e676-4eb1-bfd5-bc08af780c12",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdd41878-dac5-4906-94b8-80e6f638c3d3",
          "citation": "ACEFYLLINE METHYLSILANOL MANNURONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8458b0da-c1de-a02f-07e7-5d153fb00e39",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "8075be54-663c-0801-5c04-5d4fe56a6994",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "08929628-70ac-4e25-aa5d-bde4d5934f50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fd685271-5e40-1e2d-13ba-2ad264624710",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "61263cb7-2055-4ee0-a1b6-79b6c29d4983",
          "id": "61263cb7-2055-4ee0-a1b6-79b6c29d4983",
          "molfile": "\n  Marvin  01132105022D          \n\n 33 35  0  0  1  0            999 V2000\n   15.9181  -15.2079    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   15.3661  -15.8210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6632  -14.4233    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   14.8562  -14.2517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6013  -13.4672    0.0000 Si  0  0  0  0  0  0  0  0  0  3  0  0\n   14.7728  -12.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3859  -13.2122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7943  -13.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5394  -12.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0914  -11.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7324  -12.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4774  -11.5549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9624  -10.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4774  -10.2201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6929  -10.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -10.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784   -9.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2640  -10.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5495  -10.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2640  -11.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5495  -11.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -11.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -12.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6929  -11.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2152  -13.8102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0222  -13.9817    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   17.5742  -13.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3192  -12.5840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3812  -13.5402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2771  -14.7664    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   18.0841  -14.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7251  -15.3795    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   16.9801  -16.1640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  3  1  1  0  0  0  0\n 32  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 25  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 24  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 24 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 30  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  2  0  0  0  0\n 30 31  1  1  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  6  0  0  0\nM  END",
          "smiles": "Cn1c2c(c(=O)n(C)c1=O)n(CC(=O)O[Si](C)(O)OC3[C@H]([C@H]([C@@H]([C@@H](C(=O)O)O3)O)O)O)cn2",
          "formula": "C16H22N4O12Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "acad587b-4d49-4fe2-96fd-4e5856984558"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "490.4515",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "13ea0a55-3391-482f-8f3b-42698c682103",
      "version": "8",
      "structure": {
        "id": "a355fd51-77f4-4a52-8732-a3ce6b3537d5",
        "molfile": "\n  Marvin  01132108292D          \n\n 33 35  0  0  1  0            999 V2000\n   12.7324  -12.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4774  -11.5549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9624  -10.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4774  -10.2201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6929  -10.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -10.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2640  -10.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5495  -10.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2640  -11.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5495  -11.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -11.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784  -12.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6929  -11.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9784   -9.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5394  -12.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0914  -11.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7943  -13.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6013  -13.4672    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   15.3859  -13.2122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7728  -12.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8562  -14.2517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6632  -14.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9181  -15.2079    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.3661  -15.8210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7251  -15.3795    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.9801  -16.1640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2771  -14.7664    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.0841  -14.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0222  -13.9817    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.5742  -13.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3192  -12.5840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3812  -13.5402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2152  -13.8102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13  5  2  0  0  0  0\n  2 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  6  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  1  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  6  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 33 29  1  0  0  0  0\n 22 33  1  0  0  0  0\nM  END",
        "smiles": "Cn1c2c(c(=O)n(C)c1=O)n(CC(=O)O[Si](C)(O)OC3[C@H]([C@H]([C@@H]([C@@H](C(=O)O)O3)O)O)O)cn2",
        "formula": "C16H22N4O12Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "490.4515",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "43c92728-3339-4608-b64d-373a921d5b74"
        ],
        "stereo_centers": 6
      },
      "unii": "OI1T4Z23RZ"
    }
  ]
}