{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ac62ddaf-7aa4-496b-8953-8551fea7fdf8",
          "code": "129558-76-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129558-76-5",
          "code_system": "CAS",
          "references": [
            "8e0b5705-27b1-4678-ae65-46d8b120210c",
            "2a2a3128-0537-402d-ae7c-fb0ef625e329"
          ]
        },
        {
          "uuid": "f3738521-b239-4be0-a60a-f2b8392e85e0",
          "code": "90111",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4071",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8e0b5705-27b1-4678-ae65-46d8b120210c"
          ]
        },
        {
          "uuid": "61c373b0-7eab-4da8-a7fd-5561fc155e67",
          "code": "10110536",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10110536",
          "code_system": "PUBCHEM",
          "references": [
            "8e0b5705-27b1-4678-ae65-46d8b120210c"
          ]
        },
        {
          "uuid": "7c49f583-2567-61ab-5492-14c94b8dd6b4",
          "code": "DTXSID6057952",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6057952",
          "code_system": "EPA CompTox",
          "references": [
            "2db4ccee-c509-be19-04d9-14b20338238c"
          ]
        },
        {
          "uuid": "57b065d4-4555-c1e3-7876-0363e4ed278a",
          "code": "38628",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38628",
          "code_system": "CHEBI",
          "references": [
            "d799f63d-e68a-14fd-1014-2070436c335f"
          ]
        },
        {
          "uuid": "e071d78c-b9ae-4241-b55d-7ca744829666",
          "code": "OHA74571QT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "33dd9535-e917-2001-55c4-f4281eb2a2f1",
          "code": "tolfenpyrad",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tolfenpyrad.html",
          "code_system": "ALANWOOD",
          "references": [
            "0d7cf4fb-e727-c200-19a0-1854b048d7ea"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "36326558-6465-4315-ae45-17be0434d0cd",
          "name": "4-CHLORO-3-ETHYL-1-METHYL-N-((4-(4-METHYLPHENOXY)PHENYL)METHYL)-1H-PYRAZOLE-5-CARBOXAMIDE",
          "stdName": "4-CHLORO-3-ETHYL-1-METHYL-N-((4-(4-METHYLPHENOXY)PHENYL)METHYL)-1H-PYRAZOLE-5-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "570c2eba-b11a-4b81-a96b-a3d1255d0f32",
            "a8a48ca7-89ea-4011-836e-a9a945f51164"
          ],
          "display_name": false
        },
        {
          "uuid": "a872f1d0-cf35-4a85-b198-3b5b83e52578",
          "name": "4-CHLORO-3-ETHYL-1-METHYL-N-(4-(P-TOLYLOXY)BENZYL)PYRAZOLE-5-CARBOXAMIDE",
          "stdName": "4-CHLORO-3-ETHYL-1-METHYL-N-(4-(P-TOLYLOXY)BENZYL)PYRAZOLE-5-CARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30768a69-bced-4059-85f7-bfbc9ae3f0f3",
            "a8a48ca7-89ea-4011-836e-a9a945f51164"
          ],
          "display_name": false
        },
        {
          "uuid": "30bb142c-ea8a-41b9-a299-191ca8da057e",
          "name": "TOLFENPYRAD",
          "stdName": "TOLFENPYRAD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e26641da-f880-405d-8072-d4470866be9d",
            "6c2e93d5-7c24-4e6f-b581-3b02916f4109",
            "32cc3dea-9368-406f-bbff-8e37f38071e0",
            "180febef-23c9-4366-82d0-4bf1a432a357"
          ],
          "display_name": true
        },
        {
          "uuid": "85c64d45-12ca-4b08-812d-de7bd24129af",
          "name": "TOLFENPYRAD [ISO]",
          "stdName": "TOLFENPYRAD [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32cc3dea-9368-406f-bbff-8e37f38071e0",
            "180febef-23c9-4366-82d0-4bf1a432a357"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a8a48ca7-89ea-4011-836e-a9a945f51164",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30768a69-bced-4059-85f7-bfbc9ae3f0f3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "570c2eba-b11a-4b81-a96b-a3d1255d0f32",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e26641da-f880-405d-8072-d4470866be9d",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32cc3dea-9368-406f-bbff-8e37f38071e0",
          "citation": "http://www.alanwood.net/pesticides/tolfenpyrad.html",
          "url": "http://www.alanwood.net/pesticides/tolfenpyrad.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "180febef-23c9-4366-82d0-4bf1a432a357",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e0b5705-27b1-4678-ae65-46d8b120210c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e985392-d929-438c-ad4a-438b00e9ea43",
          "citation": "SRS import [OHA74571QT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OHA74571QT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "148106cf-070e-4322-8ff0-e932cde0296f",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c2e93d5-7c24-4e6f-b581-3b02916f4109",
          "citation": "TOLFENPYRAD [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2db4ccee-c509-be19-04d9-14b20338238c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=129558-76-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d7cf4fb-e727-c200-19a0-1854b048d7ea",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d799f63d-e68a-14fd-1014-2070436c335f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2a2a3128-0537-402d-ae7c-fb0ef625e329",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d1ade98a-7884-4ef2-9869-344bf81149db",
          "id": "d1ade98a-7884-4ef2-9869-344bf81149db",
          "molfile": "\n  Marvin  01132110502D          \n\n 27 29  0  0  0  0            999 V2000\n    2.6142   -6.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2785   -6.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7661   -5.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5108   -4.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1781   -4.2275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1781   -3.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8454   -4.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -4.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8010   -3.6515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2405   -5.0129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0241   -4.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6404   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3553   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0655   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0655   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7805   -6.5463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4954   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4954   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2102   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9252   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6401   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9252   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2102   -6.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3553   -6.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6404   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5901   -5.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0732   -6.1661    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3 26  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 26  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 25  2  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 24 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 23  2  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCc1c(c(C(=O)NCc2ccc(cc2)Oc3ccc(C)cc3)n(C)n1)Cl",
          "formula": "C21H22ClN3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "286b016b-aedb-46d8-a19c-7e0f6ca17bc7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "383.872",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b0d51ed6-cd83-445c-9fc5-6679c5e9babd",
      "version": "5",
      "structure": {
        "id": "e1f59829-859d-4ba7-8d1e-bd6378177b2d",
        "molfile": "\n  Marvin  01132111422D          \n\n 27 29  0  0  0  0            999 V2000\n    2.7661   -5.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5108   -4.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1781   -4.2275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8454   -4.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5901   -5.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0732   -6.1661    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -4.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8010   -3.6515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2405   -5.0129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0241   -4.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6404   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3553   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0655   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0655   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3553   -6.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6404   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7805   -6.5463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4954   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4954   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2102   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9252   -5.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9252   -6.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2102   -6.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6401   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1781   -3.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2785   -6.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6142   -6.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 11 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 18 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n  3 25  1  0  0  0  0\n  1 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "CCc1c(c(C(=O)NCc2ccc(cc2)Oc3ccc(C)cc3)n(C)n1)Cl",
        "formula": "C21H22ClN3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "383.872",
        "optical_activity": "NONE",
        "references": [
          "148106cf-070e-4322-8ff0-e932cde0296f",
          "8e985392-d929-438c-ad4a-438b00e9ea43"
        ],
        "stereo_centers": 0
      },
      "unii": "OHA74571QT"
    }
  ]
}