{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "63db071f-c6ec-42ec-90bf-b99297dadb51",
          "code": "1478-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1478-61-1",
          "code_system": "CAS",
          "references": [
            "35499e69-e3a8-41c2-adaa-56d325fadb44",
            "8145db92-7392-4bfc-b212-ab17e6e380aa"
          ]
        },
        {
          "uuid": "1e4b4023-c512-4f5e-bdbd-4a285b175e1f",
          "code": "BISPHENOL AF",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bisphenol_AF",
          "code_system": "WIKIPEDIA",
          "references": [
            "35499e69-e3a8-41c2-adaa-56d325fadb44"
          ]
        },
        {
          "uuid": "e2b82fa6-ceef-4586-ab1f-f5987b0368ce",
          "code": "216-036-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.579",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "35499e69-e3a8-41c2-adaa-56d325fadb44"
          ]
        },
        {
          "uuid": "8505cc4d-7bb5-423d-9921-2919735ee303",
          "code": "73864",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73864",
          "code_system": "PUBCHEM",
          "references": [
            "35499e69-e3a8-41c2-adaa-56d325fadb44"
          ]
        },
        {
          "uuid": "960d0726-9dae-c3b3-8812-6ae16347ccb4",
          "code": "8090",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8090",
          "code_system": "HSDB",
          "references": [
            "2de9d55f-9483-921e-f8ea-06b0877fdadb"
          ]
        },
        {
          "uuid": "9a8830d0-4455-d832-20d8-2c7e399dc24e",
          "code": "DTXSID7037717",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7037717",
          "code_system": "EPA CompTox",
          "references": [
            "b8e602b0-909f-766f-65e7-173aef25f533"
          ]
        },
        {
          "uuid": "53a9ac38-c0f7-467d-ac0f-ad0819f56df7",
          "code": "OH7IX8A37J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "82e5c0f7-d002-f440-8372-6003685d7700",
          "code": "72754",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:72754",
          "code_system": "CHEBI",
          "references": [
            "32ae8cbb-449d-2875-3d45-2ae2ac3a3eef"
          ]
        },
        {
          "uuid": "5271cf60-cc6a-e4de-3df5-917c45d302a2",
          "code": "152522",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=152522",
          "code_system": "NSC",
          "references": [
            "b64e3d31-a3bf-d77d-e6fc-c7b73a8a754d"
          ]
        },
        {
          "uuid": "f9beafc8-429a-24e6-01e5-0dbd486213a5",
          "code": "300000053120",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6b6da05e-05ea-29d8-2229-552ccb96c22b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "50b26b13-48dd-4f5e-82fa-4ef1cdaff400",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bad29588-b7bb-475a-9e25-ce5d08c0cdbd",
            "refuuid": "95a7e8a7-9799-4a5a-bb0c-dcb5fda203e3",
            "name": "DIPOTASSIUM 4,4'-(HEXAFLUOROISOPROPYLIDENE)BISPHENOXIDE",
            "unii": "534Y44IYGE",
            "linking_id": "534Y44IYGE",
            "ref_pname": "DIPOTASSIUM 4,4'-(HEXAFLUOROISOPROPYLIDENE)BISPHENOXIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7a0fa256-2c4f-4f4a-a3fd-20265329e3b9",
          "name": "1,1,1,3,3,3-HEXAFLUORO-2,2-BIS(4-HYDROXYPHENYL)PROPANE",
          "stdName": "1,1,1,3,3,3-HEXAFLUORO-2,2-BIS(4-HYDROXYPHENYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa90d570-b7dc-4dad-8159-ced9113499ea",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        },
        {
          "uuid": "d5d488c4-76fe-4901-8faf-d1cac455e415",
          "name": "2,2-BIS(4'-HYDROXYPHENYL)HEXAFLUOROPROPANE",
          "stdName": "2,2-BIS(4'-HYDROXYPHENYL)HEXAFLUOROPROPANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa90d570-b7dc-4dad-8159-ced9113499ea",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        },
        {
          "uuid": "7ab2a9cf-64f3-49fc-a6c2-7dc1d9853d3c",
          "name": "2,2-BIS(4-HYDROXYPHENYL)HEXAFLUOROPROPANE",
          "stdName": "2,2-BIS(4-HYDROXYPHENYL)HEXAFLUOROPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa90d570-b7dc-4dad-8159-ced9113499ea",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        },
        {
          "uuid": "201e08f6-cb23-40d4-9499-f30503f3ba8f",
          "name": "BISPHENOL AF",
          "stdName": "BISPHENOL AF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b074523-513a-4264-b1a3-25ad4c36ec0d"
          ],
          "display_name": true
        },
        {
          "uuid": "3786d0cb-d3f6-4423-a217-52613a232646",
          "name": "CURATIVE 30",
          "stdName": "CURATIVE 30",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa90d570-b7dc-4dad-8159-ced9113499ea",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        },
        {
          "uuid": "c2c3d646-766e-46e9-a96b-3004f8ff80ac",
          "name": "HEXAFLUOROBISPHENOL A",
          "stdName": "HEXAFLUOROBISPHENOL A",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa90d570-b7dc-4dad-8159-ced9113499ea",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        },
        {
          "uuid": "c1cdef46-eb57-4926-b88a-3a875721dc4d",
          "name": "NSC-152522",
          "stdName": "NSC-152522",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f2a8ca8-5d09-4d77-8b79-cc4bfe78d242",
            "f2135331-9837-475e-9d00-9e504b951df2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5b074523-513a-4264-b1a3-25ad4c36ec0d",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fa90d570-b7dc-4dad-8159-ced9113499ea",
          "citation": "http://ntp.niehs.nih.gov/ntp/htdocs/Chem_Background/ExSumPdf/BisphenolAF_093008_508.pdf",
          "url": "http://ntp.niehs.nih.gov/ntp/htdocs/Chem_Background/ExSumPdf/BisphenolAF_093008_508.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2135331-9837-475e-9d00-9e504b951df2",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f2a8ca8-5d09-4d77-8b79-cc4bfe78d242",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35499e69-e3a8-41c2-adaa-56d325fadb44",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391010000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68a13ade-c0fe-4b0e-9f3a-93d927ed8dac",
          "citation": "SRS import [OH7IX8A37J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OH7IX8A37J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391010000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19e9632c-17f8-4926-ae45-71369dec2f43",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2de9d55f-9483-921e-f8ea-06b0877fdadb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1478-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8e602b0-909f-766f-65e7-173aef25f533",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1478-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8145db92-7392-4bfc-b212-ab17e6e380aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "32ae8cbb-449d-2875-3d45-2ae2ac3a3eef",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b64e3d31-a3bf-d77d-e6fc-c7b73a8a754d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6b6da05e-05ea-29d8-2229-552ccb96c22b",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d8110f79-5bdc-4d4d-86d4-fc68ad14deea",
          "id": "d8110f79-5bdc-4d4d-86d4-fc68ad14deea",
          "molfile": "\n  Marvin  01132111122D          \n\n 23 24  0  0  0  0            999 V2000\n    4.7355   -6.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4515   -6.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4515   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1595   -4.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8744   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8744   -6.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1595   -6.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0146   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4090   -5.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8802   -6.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1657   -7.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9729   -7.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2555   -8.0360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4996   -6.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2213   -5.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2772   -3.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4614   -3.9008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9919   -2.9780    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9868   -3.3419    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3115   -4.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8415   -5.0264    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0312   -3.6284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0261   -3.9873    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  8  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 16  8  1  0  0  0  0\n  8 20  1  0  0  0  0\n  9 10  1  0  0  0  0\n 15  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C(c2ccc(cc2)O)(C(F)(F)F)C(F)(F)F)O",
          "formula": "C15H10F6O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c254f51c-3b53-45b5-a03d-d512b2bb226f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "336.2297",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d15d767c-526a-4059-bfe3-c8346b4cda78",
      "version": "7",
      "structure": {
        "id": "ac690773-1d6b-4a18-9fb4-d915b810d307",
        "molfile": "\n  Marvin  01132108572D          \n\n 23 24  0  0  0  0            999 V2000\n    6.4614   -3.9008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2772   -3.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9919   -2.9780    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9868   -3.3419    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0146   -4.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8744   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1595   -4.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4515   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4515   -6.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7355   -6.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1595   -6.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8744   -6.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4090   -5.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8802   -6.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1657   -7.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9729   -7.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2555   -8.0360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4996   -6.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2213   -5.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3115   -4.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8415   -5.0264    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0312   -3.6284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0261   -3.9873    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  6  2  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 13  2  0  0  0  0\n  5 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C(c2ccc(cc2)O)(C(F)(F)F)C(F)(F)F)O",
        "formula": "C15H10F6O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.2297",
        "optical_activity": "NONE",
        "references": [
          "68a13ade-c0fe-4b0e-9f3a-93d927ed8dac",
          "19e9632c-17f8-4926-ae45-71369dec2f43"
        ],
        "stereo_centers": 0
      },
      "unii": "OH7IX8A37J"
    }
  ]
}