{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a3e958f8-d184-467f-ae91-0f37be701d81",
          "code": "1428450-95-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1428450-95-6",
          "code_system": "CAS",
          "references": [
            "9b816fa0-4f15-4fee-bf7e-0c8959f32353",
            "52884778-e0cf-4dd9-81ee-dcc951ff36b5"
          ]
        },
        {
          "uuid": "f047c093-311f-5321-b507-291adca76495",
          "code": "71543007",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71543007",
          "code_system": "PUBCHEM",
          "references": [
            "6ebe5149-5951-d57b-bf89-7b6fb2c7109d"
          ]
        },
        {
          "uuid": "855901c0-108b-7314-c71a-136d3eabc243",
          "code": "DTXSID901020949",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901020949",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "bd1b16a1-c0e6-49d1-b164-1135ad660cd4",
          "code": "OH3UOW0EHH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "c5301bd1-d918-4227-b013-735c258fbe78",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2b6daaea-bacc-4fc3-ac7f-a37de703edb4",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "186d3851-3fc5-42ed-8d48-388b6b5feeee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b816fa0-4f15-4fee-bf7e-0c8959f32353",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b29ab9e-d45c-4871-ae87-1c2e7613c90a",
          "citation": "SRS import [OH3UOW0EHH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OH3UOW0EHH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a62f36d-3927-4b19-a304-c1d5730a6e6f",
          "citation": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ebe5149-5951-d57b-bf89-7b6fb2c7109d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "52884778-e0cf-4dd9-81ee-dcc951ff36b5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "af3e984f-2630-4772-87c1-b276c20aa9c0",
          "citation": "Ghani, Usman. \"Azole inhibitors of mushroom and human tyrosinases: Current advances and prospects of drug development for melanogenic dermatological disorders.\" European Journal of Medicinal Chemistry (2022): 114525.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0223523422004275",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9cb45b43-8ed6-3c99-9da8-c862cd2557e3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "807c10c6-854e-4d00-a7f1-be1986af23cd",
          "id": "807c10c6-854e-4d00-a7f1-be1986af23cd",
          "molfile": "\n  Marvin  01132106402D          \n\n 19 20  0  0  0  0            999 V2000\n   10.7956   -6.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7956   -6.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0811   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5100   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5100   -8.1812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2245   -6.9437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9390   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6926   -7.0206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2446   -7.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8321   -8.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0252   -8.1766    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0651   -7.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4006   -6.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2211   -6.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7060   -7.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5264   -7.2888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3704   -8.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5500   -8.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2144   -8.9685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 11  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 18 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C(=O)Nc1nc(cs1)-c2ccc(cc2O)O",
          "formula": "C13H14N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7c5e5b2d-5630-4ec3-a706-303c3ad8df3a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.3284",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "69674e79-e756-4938-91cf-54cf38705e24",
      "version": "10",
      "structure": {
        "id": "5e379015-bc1d-45fb-8c23-ed2be094f2bc",
        "molfile": "\n  Marvin  01132104532D          \n\n 19 20  0  0  0  0            999 V2000\n   15.2144   -8.9685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5500   -8.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3704   -8.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7060   -7.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5264   -7.2888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2211   -6.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4006   -6.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0651   -7.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2446   -7.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8321   -8.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0252   -8.1766    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9390   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2245   -6.9437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5100   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5100   -8.1812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7956   -6.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7956   -6.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0811   -7.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6926   -7.0206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 12  2  0  0  0  0\n  9 19  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(=O)Nc1nc(cs1)-c2ccc(cc2O)O",
        "formula": "C13H14N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.3284",
        "optical_activity": "NONE",
        "references": [
          "186d3851-3fc5-42ed-8d48-388b6b5feeee",
          "7b29ab9e-d45c-4871-ae87-1c2e7613c90a"
        ],
        "stereo_centers": 0
      },
      "unii": "OH3UOW0EHH",
      "relationships": [
        {
          "uuid": "e2d8acf1-6df2-4e7d-ae60-b9df8d1dd91a",
          "amount": {
            "uuid": "d716bd47-86ea-4128-a27e-2c6a40984743",
            "average": 1100,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "af3e984f-2630-4772-87c1-b276c20aa9c0"
          ],
          "related_substance": {
            "uuid": "f65939f3-63da-4aca-96e8-74e791416bed",
            "refuuid": "c8e7ead5-cfcb-4d4a-a327-938877c82bda",
            "name": "TYROSINASE",
            "unii": "G2UX40NTG9",
            "linking_id": "G2UX40NTG9",
            "ref_pname": "TYROSINASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "084f3dc0-1e5a-45a3-9589-2466ac100acc",
          "amount": {
            "uuid": "6fc75d7c-a33f-49d1-aea8-d27c437e5d5e"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "af3e984f-2630-4772-87c1-b276c20aa9c0"
          ],
          "related_substance": {
            "uuid": "f5d5163f-c27e-4db2-96c3-093903a6d165",
            "refuuid": "69674e79-e756-4938-91cf-54cf38705e24",
            "name": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL",
            "unii": "OH3UOW0EHH",
            "linking_id": "OH3UOW0EHH",
            "ref_pname": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "b923be3f-e77e-4591-bd1d-3099f0b769a6",
          "name": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL",
          "stdName": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b6daaea-bacc-4fc3-ac7f-a37de703edb4",
            "9a62f36d-3927-4b19-a304-c1d5730a6e6f",
            "c5301bd1-d918-4227-b013-735c258fbe78"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1bcf903a-602b-4515-bf37-6e54cee4ab0f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3b1d3568-a1c4-a93d-5321-52608162e15a",
          "name": "Isobutylamido thiazolyl resorcinol [WHO-DD]",
          "stdName": "ISOBUTYLAMIDO THIAZOLYL RESORCINOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cb45b43-8ed6-3c99-9da8-c862cd2557e3"
          ],
          "display_name": false
        },
        {
          "uuid": "530082fb-dba4-49f1-b9a1-1d2ff8c5b7fc",
          "name": "PROPANAMIDE, N-(4-(2,4-DIHYDROXYPHENYL)-2-THIAZOLYL)-2-METHYL-",
          "stdName": "PROPANAMIDE, N-(4-(2,4-DIHYDROXYPHENYL)-2-THIAZOLYL)-2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "186d3851-3fc5-42ed-8d48-388b6b5feeee",
            "2b6daaea-bacc-4fc3-ac7f-a37de703edb4"
          ],
          "display_name": false
        },
        {
          "uuid": "744c42bb-e2d4-4259-8633-7dafa32c4a02",
          "name": "Thiamidol",
          "stdName": "THIAMIDOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af3e984f-2630-4772-87c1-b276c20aa9c0"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "6f29a9c7-96ec-4f1c-9de2-66c482a404f5"
      }
    }
  ]
}