{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1d034b1a-b52f-4d87-a741-2084280acb02", "code": "207122-15-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=207122-15-4", "code_system": "CAS", "references": [ "80253f53-0333-4e02-96e9-a7377b4fbf30", "635d1735-1081-406b-8354-611c048ea573" ] }, { "uuid": "661b055d-3288-4187-adf7-f68094f71341", "code": "15509898", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15509898", "code_system": "PUBCHEM", "references": [ "80253f53-0333-4e02-96e9-a7377b4fbf30" ] }, { "uuid": "d4b28b70-18ed-09e1-3411-4b4ba5b86385", "code": "DTXSID3052692", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3052692", "code_system": "EPA CompTox", "references": [ "b5cdb723-aa2b-8d72-b44b-bb8e31e765ff" ] }, { "uuid": "264d0278-d34f-4541-8fe0-718ab05b5606", "code": "OGY508QK5U", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "161146c0-ed7e-458a-b2f1-c2a73598c005", "name": "2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER", "stdName": "2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "620a9383-c0bb-457a-8687-84997ae92325", "e2f5fdae-b852-43a5-9514-4248c24769ba" ], "display_name": true }, { "uuid": "28a0ea51-5d04-4e0c-a8f8-2b79ee53fba1", "name": "BENZENE, 1,3,5-TRIBROMO-2-(2,4,5-TRIBROMOPHENOXY)-", "stdName": "BENZENE, 1,3,5-TRIBROMO-2-(2,4,5-TRIBROMOPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "620a9383-c0bb-457a-8687-84997ae92325", "e2f5fdae-b852-43a5-9514-4248c24769ba" ], "display_name": false }, { "uuid": "cbdd9a81-b509-496a-a07e-fc9e0f329e6d", "name": "PBDE 154", "stdName": "PBDE 154", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "620a9383-c0bb-457a-8687-84997ae92325", "e2f5fdae-b852-43a5-9514-4248c24769ba" ], "display_name": false } ], "references": [ { "uuid": "620a9383-c0bb-457a-8687-84997ae92325", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e2f5fdae-b852-43a5-9514-4248c24769ba", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80253f53-0333-4e02-96e9-a7377b4fbf30", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391493000, "tags": [ "NOMEN" ] }, { "uuid": "3e355f43-e75a-45aa-8ed4-509881306e3e", "citation": "SRS import [OGY508QK5U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OGY508QK5U", "doc_type": "SRS", "public_domain": true, "document_date": 1493391493000, "tags": [ "NOMEN" ] }, { "uuid": "9116bc9d-ec9f-4ba8-bf2f-b047474b8f36", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5cdb723-aa2b-8d72-b44b-bb8e31e765ff", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=207122-15-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "635d1735-1081-406b-8354-611c048ea573", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b46d888e-fd1b-4b8d-967c-af3d7db8908c", "id": "b46d888e-fd1b-4b8d-967c-af3d7db8908c", "molfile": "\n Marvin 01132109202D \n\n 19 20 0 0 0 0 999 V2000\n 10.3616 -4.1305 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6476 -4.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6403 -5.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9216 -5.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9143 -6.5891 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2106 -5.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4920 -5.7526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7807 -5.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7882 -4.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -4.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0844 -3.2685 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3584 -4.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6471 -4.0796 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3510 -5.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0623 -5.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0549 -6.5636 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2179 -4.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5067 -4.1051 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9364 -4.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 19 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 17 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 15 2 0 0 0 0\n 10 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)Oc2cc(c(cc2Br)Br)Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "83442f7c-aa9d-4d2f-a913-13a7479ee866" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "66fc1091-beae-4b5c-9b0a-c1f2575a5b27", "version": "3", "structure": { "id": "f73ffa78-b5f3-443f-b3f7-9e42347dceca", "molfile": "\n Marvin 01132112492D \n\n 19 20 0 0 0 0 999 V2000\n 7.4920 -5.7526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7807 -5.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0623 -5.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3510 -5.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3584 -4.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -4.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7882 -4.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0844 -3.2685 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6471 -4.0796 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0549 -6.5636 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2106 -5.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2179 -4.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9364 -4.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6476 -4.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6403 -5.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9216 -5.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9143 -6.5891 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3616 -4.1305 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5067 -4.1051 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 5 9 1 0 0 0 0\n 3 10 1 0 0 0 0\n 1 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 12 19 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Br)Oc2cc(c(cc2Br)Br)Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "references": [ "3e355f43-e75a-45aa-8ed4-509881306e3e", "9116bc9d-ec9f-4ba8-bf2f-b047474b8f36" ], "stereo_centers": 0 }, "unii": "OGY508QK5U" } ] }