{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "89470139-d7bc-446d-9999-549fed3af7ad",
          "code": "6926-08-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6926-08-5",
          "code_system": "CAS",
          "references": [
            "636f721d-cb9e-40d7-a3f5-f0def9dd1a89",
            "afff815b-7e3e-40b0-a0f3-32cf257fcbba"
          ]
        },
        {
          "uuid": "c07075a0-82bf-4262-8316-dd53e5a41df3",
          "code": "230-050-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.318",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "636f721d-cb9e-40d7-a3f5-f0def9dd1a89"
          ]
        },
        {
          "uuid": "dcb57f66-2de3-4bc6-ba7b-60d4306d4a78",
          "code": "93045",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93045",
          "code_system": "PUBCHEM",
          "references": [
            "636f721d-cb9e-40d7-a3f5-f0def9dd1a89"
          ]
        },
        {
          "uuid": "85e5053b-3aba-4d1c-9286-b59a30023395",
          "code": "OF59XHX7SR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e101c06e-8632-a487-7192-1b71694f1d98",
          "code": "DTXSID30988983",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30988983",
          "code_system": "EPA CompTox",
          "references": [
            "0e0d71fa-778e-0546-54c8-44094f2e43e3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2c3a1e5a-493a-4de8-8075-3ce3fb774f5d",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "12efd86f-1c4b-499e-b351-e7f2083fb28b",
            "refuuid": "5e494203-2ea9-4a36-8094-04a0ba669a9b",
            "name": "HARPAGOPHYTUM ZEYHERI ROOT",
            "unii": "1CTB7R80VI",
            "linking_id": "1CTB7R80VI",
            "ref_pname": "HARPAGOPHYTUM ZEYHERI ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "866dd270-db75-4f61-b1b7-72478e15a142",
          "name": "(1S-(1A,4AA,5A,7A,7A))-1,4A,5,6,7,7A-HEXAHYDRO-4A,5,7-TRIHYDROXY-7-METHYLCYCLOPENTA(C)PYRAN-1-YL BETA-D-GLUCOPYRANOSIDE",
          "stdName": "(1S-(1A,4AA,5A,7A,7A))-1,4A,5,6,7,7A-HEXAHYDRO-4A,5,7-TRIHYDROXY-7-METHYLCYCLOPENTA(C)PYRAN-1-YL BETA-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1b13675-9bba-4f42-8833-2a95ac1c0610",
            "29bfae09-d95d-4432-9d05-ba0cd8cfdd37"
          ],
          "display_name": false
        },
        {
          "uuid": "98d056ef-bd29-468e-8126-cd2f28b6c312",
          "name": "HARPAGIDE",
          "stdName": "HARPAGIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12600567-9f43-4706-bda8-52d4bc088ddb",
            "3c1ef28f-f7a2-4d1f-9667-ba68e7cbdf62",
            "5b4a2cb8-4bdb-4ff0-8b04-d6e82bdba829",
            "29bfae09-d95d-4432-9d05-ba0cd8cfdd37"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dbc3256f-a1c7-4820-8b90-c3e290beadbd",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "12600567-9f43-4706-bda8-52d4bc088ddb",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c1ef28f-f7a2-4d1f-9667-ba68e7cbdf62",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29bfae09-d95d-4432-9d05-ba0cd8cfdd37",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1b13675-9bba-4f42-8833-2a95ac1c0610",
          "citation": "http://www.chemblink.com/products/6926-08-5.htm",
          "url": "http://www.chemblink.com/products/6926-08-5.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "636f721d-cb9e-40d7-a3f5-f0def9dd1a89",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11e9e8ea-eaf1-4280-a870-4ac8bc5f42f5",
          "citation": "SRS import [OF59XHX7SR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OF59XHX7SR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bce607c-6f41-43f4-98f3-e22faa2d9028",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b4a2cb8-4bdb-4ff0-8b04-d6e82bdba829",
          "citation": "HARPAGIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "afff815b-7e3e-40b0-a0f3-32cf257fcbba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e0d71fa-778e-0546-54c8-44094f2e43e3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a9ad3fc-6764-452d-831b-5db49e865d2e",
          "id": "6a9ad3fc-6764-452d-831b-5db49e865d2e",
          "molfile": "\n  Marvin  01132105322D          \n\n 25 27  0  0  1  0            999 V2000\n    4.7715   -3.9677    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.9633   -4.1317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1068   -3.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9336   -3.2213    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.6785   -2.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7144   -2.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0968   -4.1203    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.7985   -4.5248    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.5204   -4.1196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2175   -4.5295    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.9394   -4.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6424   -4.5342    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.3630   -4.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1250   -4.4737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6424   -5.3592    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.3341   -5.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9150   -5.7590    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.9150   -6.5841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2175   -5.3545    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4915   -5.7545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7985   -5.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0724   -5.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3748   -5.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3748   -4.5201    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.4658   -5.0742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 24  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  1  0  0  0\n  7  8  1  0  0  0  0\n  7 24  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 21  1  0  0  0  0\n 10  9  1  6  0  0  0\n 10 11  1  0  0  0  0\n 19 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  6  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  6  0  0  0\nM  END",
          "smiles": "CC1(C[C@H]([C@@]2(C=CO[C@H]([C@H]12)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O",
          "formula": "C15H24O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "45927422-43cf-4a62-8069-667df81839ec"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "364.3457",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ea75fff4-d096-448b-b410-bc4bdd845a8a",
      "version": "7",
      "structure": {
        "id": "1ce363e2-c9ff-4472-846d-a372cd02c2ed",
        "molfile": "\n  Marvin  01132101402D          \n\n 27 29  0  0  1  0            999 V2000\n    6.0968   -4.1203    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3748   -4.5201    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7715   -3.9677    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9633   -4.1317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1068   -3.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9336   -3.2213    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7144   -2.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6785   -2.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3748   -5.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0724   -5.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7985   -5.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7985   -4.5248    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5204   -4.1196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2175   -4.5295    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2175   -5.3545    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9150   -5.7590    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9150   -6.5841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6424   -5.3592    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.6424   -4.5342    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9394   -4.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3630   -4.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1250   -4.4737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3341   -5.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4915   -5.7545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5152   -4.9503    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4658   -5.0742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8082   -3.7072    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  1  0  0  0\n  9  2  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n 12 13  1  6  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 14  1  0  0  0  0\n 19 21  1  6  0  0  0\n 22 21  1  0  0  0  0\n 18 23  1  1  0  0  0\n 15 24  1  1  0  0  0\n 14 25  1  1  0  0  0\n  2 26  1  6  0  0  0\n  1 27  1  6  0  0  0\nM  END",
        "smiles": "C[C@@]1(C[C@H]([C@@]2(C=CO[C@H]([C@]12[H])O[C@@]3([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O",
        "formula": "C15H24O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "364.3457",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "11e9e8ea-eaf1-4280-a870-4ac8bc5f42f5",
          "9bce607c-6f41-43f4-98f3-e22faa2d9028"
        ],
        "stereo_centers": 10
      },
      "unii": "OF59XHX7SR"
    }
  ]
}