{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ae41ae15-0a72-4e2a-b9dd-431558913446",
          "code": "N02BB04",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02BB04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "7afc0317-28e9-4d57-a021-6994c2255fdc",
          "code": "QN02BB54",
          "comments": "VATC|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02BB54&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "2260f749-d43d-4668-93ab-a6e9b94a8ceb",
          "code": "QN02BB74",
          "comments": "VATC|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02BB74&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "772c75a8-f1bd-4d55-84e5-9f1a562cc566",
          "code": "QN02BB04",
          "comments": "VATC|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02BB04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "c3ecbbf0-24a7-402d-bb76-a505b7ec667b",
          "code": "479-92-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=479-92-5",
          "code_system": "CAS",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa",
            "e0e051c4-e561-4ef0-b408-dd1c8c3f688e"
          ]
        },
        {
          "uuid": "842c40d9-b9a4-4fd6-afb5-c5513e1fe6d4",
          "code": "C72124",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72124",
          "code_system": "NCI_THESAURUS",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "d8c63431-063f-4f07-8316-4dcb51e5ecda",
          "code": "C009077",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67009077",
          "code_system": "MESH",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "fe007ab7-6a52-4a9c-bf14-fda54c6c1585",
          "code": "N02BB54",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02BB54&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "650026c9-d3b6-44e2-bd1a-7d1cfdb30ec2",
          "code": "N02BB74",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Pyrazolones|propyphenazone, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02BB74&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "56d3ec99-6a2d-489a-af35-e0aafcecd826",
          "code": "SUB10125MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "7272da64-1f51-4a02-bb51-285704a8e275",
          "code": "2848",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2848",
          "code_system": "INN",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "828a559a-b16c-4040-bba9-d596362b4471",
          "code": "34710",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/34710/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "24c8c34b-6ea4-4508-9c04-d6f5b4bcf2f6",
          "code": "m9252",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9252?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "bd1a1093-24b8-4c46-97af-1992b3a4dbac",
          "code": "CHEMBL28318",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL28318",
          "code_system": "ChEMBL",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "156c4c12-5121-4a4d-bc4a-367d58af81b5",
          "code": "207-539-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.855",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "c67a80fe-b4f7-4fdc-9673-b929c5449f93",
          "code": "3778",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3778",
          "code_system": "PUBCHEM",
          "references": [
            "be105091-4a06-4fbd-825b-25c56533b5aa"
          ]
        },
        {
          "uuid": "adaeff8a-5085-569f-17e0-ddefcce624ab",
          "code": "Propyphenazone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propyphenazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "0d1ee899-39b4-2a5c-054d-8a9897dadbe0"
          ]
        },
        {
          "uuid": "e1006eec-75cd-43ad-1e65-5c1de6ff6b7a",
          "code": "DTXSID6023529",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023529",
          "code_system": "EPA CompTox",
          "references": [
            "30bcc2ca-6808-b71a-0762-8a8565c86e8b"
          ]
        },
        {
          "uuid": "92c8cd7f-f6e1-7004-0016-fba81ec6f424",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "006d532f-f0c2-35a4-288c-2eef31ef5fba"
          ]
        },
        {
          "uuid": "648aa039-b823-4db8-9a28-a0528d1e3084",
          "code": "OED8FV75PY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "41be0181-525a-4b62-8609-d977a3aa947a",
          "code": "2309",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2309",
          "code_system": "DRUG CENTRAL",
          "references": [
            "006d532f-f0c2-35a4-288c-2eef31ef5fba"
          ]
        },
        {
          "uuid": "fec5aa57-8e43-2f48-6ab6-b90ab6bf427d",
          "code": "DB13524",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13524",
          "code_system": "DRUG BANK",
          "references": [
            "006d532f-f0c2-35a4-288c-2eef31ef5fba"
          ]
        },
        {
          "uuid": "ec368a92-cd3d-72c0-9b56-ebbeb2e0573e",
          "code": "135538",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:135538",
          "code_system": "CHEBI",
          "references": [
            "006d532f-f0c2-35a4-288c-2eef31ef5fba"
          ]
        },
        {
          "uuid": "f07cc15a-7c91-e0b9-4cb2-97026e038f93",
          "code": "OED8FV75PY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OED8FV75PY",
          "code_system": "DAILYMED",
          "references": [
            "0e1d8af6-8841-b0a7-c022-2cd07cf1388a"
          ]
        },
        {
          "uuid": "0347e002-4835-54fe-7ada-7324955f65a6",
          "code": "100000092130",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ebd2053f-58f9-3e4e-535e-d5804b4bff72"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "67037c99-5062-43d5-b009-b051bd29d66a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "59e3b552-e479-4c52-98af-ef2b635cb257",
            "refuuid": "e6fd63bc-0c9d-4deb-a230-0b15d468f0ea",
            "name": "PROPYPHENAZONE",
            "unii": "OED8FV75PY",
            "linking_id": "OED8FV75PY",
            "ref_pname": "PROPYPHENAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f42e6d5b-99b8-4f85-bff1-d07fb55d7305",
          "amount": {
            "uuid": "722cf118-0254-455c-af2e-48113f3cb4c7",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "824cc465-7553-497f-8f59-dfd39baef2b2"
          ],
          "related_substance": {
            "uuid": "cd507fb7-4cee-4245-bd81-c101b6d6af1f",
            "refuuid": "773a0ffb-9706-4f50-9973-628bdf152d66",
            "name": "ANTIPYRINE",
            "unii": "T3CHA1B51H",
            "linking_id": "T3CHA1B51H",
            "ref_pname": "ANTIPYRINE"
          }
        },
        {
          "uuid": "b38f1f2b-0e8b-4fcf-b8be-9559853e1689",
          "amount": {
            "uuid": "2a596632-1b5a-4e27-8ff9-d0b6057faa34",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2b9fafa8-7ade-468e-9f22-512cf6448626"
          ],
          "related_substance": {
            "uuid": "fed7f05e-5bcc-4300-970e-993b964bd28b",
            "refuuid": "2581ae12-f9fd-49d5-aa12-c1d835ff07c3",
            "name": "1,5-DIMETHYL-4-((2RS)-4-METHYLPENTAN-2-YL)-2-PHENYL-1,2-DIHYDRO-3H-PYRAZOL-3-ONE",
            "unii": "VX3F4Y54RC",
            "linking_id": "VX3F4Y54RC",
            "ref_pname": "1,5-DIMETHYL-4-((2RS)-4-METHYLPENTAN-2-YL)-2-PHENYL-1,2-DIHYDRO-3H-PYRAZOL-3-ONE"
          }
        },
        {
          "uuid": "042929f7-3926-44c8-ada3-643c38e33ef9",
          "amount": {
            "uuid": "8a47fc77-3635-47f9-afd0-0acdb527fd9f",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "04bffff3-0f68-492f-9698-fe16db9b0256"
          ],
          "related_substance": {
            "uuid": "08fec5fa-0030-4caa-a8a6-71c9576c8728",
            "refuuid": "86bafcc9-c04c-4ceb-abb9-2d15aacc9811",
            "name": "5-METHOXY-3-METHYL-1-PHENYL-4-(PROPAN-2-YL)-1H-PYRAZOLE",
            "unii": "G3EK8NUR96",
            "linking_id": "G3EK8NUR96",
            "ref_pname": "5-METHOXY-3-METHYL-1-PHENYL-4-(PROPAN-2-YL)-1H-PYRAZOLE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "352b2a83-0aa5-4410-a7cf-528459192bd1",
          "name": "4-ISOPROPYL-2,3-DIMETHYL-1-PHENYL-3-PYRAZOLIN-5-ONE",
          "stdName": "4-ISOPROPYL-2,3-DIMETHYL-1-PHENYL-3-PYRAZOLIN-5-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4dc9d0c-5042-4621-9bff-17cee09ee6c2"
          ],
          "display_name": false
        },
        {
          "uuid": "28e171e0-b120-49cc-a400-a6e5f5640d65",
          "name": "ISOPROPYLANTIPYRINE",
          "stdName": "ISOPROPYLANTIPYRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d446b2d-c6ec-43fa-a252-6cdea031d33a"
          ],
          "display_name": false
        },
        {
          "uuid": "00875b71-b6fb-4b09-af89-146a6d949598",
          "name": "ISOPROPYLANTIPYRINE [JAN]",
          "stdName": "ISOPROPYLANTIPYRINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ceece8c-bf09-fbb3-1a7e-1b1507d7bb16"
          ],
          "display_name": false
        },
        {
          "uuid": "a5fb2b68-8833-4208-be89-628c445d39e2",
          "name": "ISOPROPYLPHENAZONE",
          "stdName": "ISOPROPYLPHENAZONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e0f92d9-3052-4173-8c6a-f600c8202425",
            "1c45b9bc-aed8-4fb2-b89c-d0a065c70f6b"
          ],
          "display_name": false
        },
        {
          "uuid": "4d173237-fd81-4564-bb29-69d808fb430a",
          "name": "PROPYPHENAZONE",
          "stdName": "PROPYPHENAZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "623543e2-a1a6-4676-80ab-a3cd4fc1426a",
            "41919c71-510b-4498-9ab0-70e6ba475c9d",
            "ba196d58-8763-4a45-beb8-73ea747075eb",
            "0e0f92d9-3052-4173-8c6a-f600c8202425",
            "12aa8d02-bf1b-45d0-8e0b-b078509c7189",
            "6450dc33-0677-4a34-b284-860ae2ebe8c3",
            "833831e8-19e8-4596-8c45-0bc484683d17",
            "d114d533-f479-494a-a2ca-033efd2cfc6f",
            "6a3ec146-f887-4d9d-9635-95b979322d0e",
            "c7892610-2ffd-4ae9-8ee9-2bb1b3338a04",
            "7e17541e-c003-4334-b1b1-4653066e085d",
            "488724e5-65e5-4641-8643-95547232fff5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ef9d6985-f07e-4315-a340-f36275626b87",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bd757f9b-923b-b58b-21e9-9f9f8a2ebfaa",
          "name": "PROPYPHENAZONE [EP MONOGRAPH]",
          "stdName": "PROPYPHENAZONE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdf7c5ef-edc3-9e81-90ad-8cf426218ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "d61e12c0-b682-4d64-917f-b1b222be01a3",
          "name": "PROPYPHENAZONE [MART.]",
          "stdName": "PROPYPHENAZONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba196d58-8763-4a45-beb8-73ea747075eb"
          ],
          "display_name": false
        },
        {
          "uuid": "39472d08-7a1a-4e10-8569-f870c14a5a69",
          "name": "PROPYPHENAZONE [MI]",
          "stdName": "PROPYPHENAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e0f92d9-3052-4173-8c6a-f600c8202425",
            "d114d533-f479-494a-a2ca-033efd2cfc6f"
          ],
          "display_name": false
        },
        {
          "uuid": "854ea076-ec78-09a3-5cc8-de26b897aeea",
          "name": "Propyphenazone [WHO-DD]",
          "stdName": "PROPYPHENAZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fce47a4a-7eba-2c25-99dc-eb85265e6a73"
          ],
          "display_name": false
        },
        {
          "uuid": "dc2a3ee3-196f-4bf1-abcc-909b6344bd9b",
          "name": "YOSHIPYRIN",
          "stdName": "YOSHIPYRIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27086d47-6d17-422c-84bd-fc830d51e562",
            "adb12da8-859a-4b7f-922c-75d2f892cbf2"
          ],
          "display_name": false
        },
        {
          "uuid": "124853ce-c32b-4295-a9bb-903fe0674c66",
          "name": "propyphenazone [INN]",
          "stdName": "PROPYPHENAZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41919c71-510b-4498-9ab0-70e6ba475c9d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12aa8d02-bf1b-45d0-8e0b-b078509c7189",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a4dc9d0c-5042-4621-9bff-17cee09ee6c2",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d446b2d-c6ec-43fa-a252-6cdea031d33a",
          "citation": "USP 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41919c71-510b-4498-9ab0-70e6ba475c9d",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6450dc33-0677-4a34-b284-860ae2ebe8c3",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c45b9bc-aed8-4fb2-b89c-d0a065c70f6b",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e0f92d9-3052-4173-8c6a-f600c8202425",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba196d58-8763-4a45-beb8-73ea747075eb",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d114d533-f479-494a-a2ca-033efd2cfc6f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27086d47-6d17-422c-84bd-fc830d51e562",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adb12da8-859a-4b7f-922c-75d2f892cbf2",
          "citation": "D01380",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "488724e5-65e5-4641-8643-95547232fff5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be105091-4a06-4fbd-825b-25c56533b5aa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389718000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95c5992c-3fbc-4654-9aa4-16f42991e8d2",
          "citation": "SRS import [OED8FV75PY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OED8FV75PY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389718000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9aae1ad3-3e87-4f0b-ab2e-12d391731dfe",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e17541e-c003-4334-b1b1-4653066e085d",
          "citation": "PROPYPHENAZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "833831e8-19e8-4596-8c45-0bc484683d17",
          "citation": "PROPYPHENAZONE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "623543e2-a1a6-4676-80ab-a3cd4fc1426a",
          "citation": "PROPYPHENAZONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7892610-2ffd-4ae9-8ee9-2bb1b3338a04",
          "citation": "PROPYPHENAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a3ec146-f887-4d9d-9635-95b979322d0e",
          "citation": "PROPYPHENAZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ceece8c-bf09-fbb3-1a7e-1b1507d7bb16",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d1ee899-39b4-2a5c-054d-8a9897dadbe0",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Propyphenazone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30bcc2ca-6808-b71a-0762-8a8565c86e8b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=479-92-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "006d532f-f0c2-35a4-288c-2eef31ef5fba",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e0e051c4-e561-4ef0-b408-dd1c8c3f688e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "824cc465-7553-497f-8f59-dfd39baef2b2",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "cdf7c5ef-edc3-9e81-90ad-8cf426218ff8",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "2b9fafa8-7ade-468e-9f22-512cf6448626",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04bffff3-0f68-492f-9698-fe16db9b0256",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fce47a4a-7eba-2c25-99dc-eb85265e6a73",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0e1d8af6-8841-b0a7-c022-2cd07cf1388a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ebd2053f-58f9-3e4e-535e-d5804b4bff72",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45ea1649-a43c-410b-91ef-aa5b7cd246d1",
          "id": "45ea1649-a43c-410b-91ef-aa5b7cd246d1",
          "molfile": "\n  Marvin  01132103402D          \n\n 17 18  0  0  0  0            999 V2000\n    4.3765   -3.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4545   -2.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2003   -2.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7840   -1.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7840   -1.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4467   -0.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9965   -0.7979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7314    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4949   -1.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6555   -1.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2474   -0.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4210   -0.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4210   -2.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2345   -2.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9965   -2.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7392   -2.9393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 16  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 16  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
          "smiles": "CC(C)c1c(C)n(C)n(-c2ccccc2)c1=O",
          "formula": "C14H18N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d8893c13-e8b3-4a5f-b6d9-484901cc8f45"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.306",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6fd63bc-0c9d-4deb-a230-0b15d468f0ea",
      "version": "23",
      "structure": {
        "id": "f521517b-5c9c-4081-a197-7f7ecb77c1ac",
        "molfile": "\n  Marvin  01132112422D          \n\n 17 18  0  0  0  0            999 V2000\n    3.7840   -1.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9965   -0.7979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9965   -2.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4949   -1.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7840   -1.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7392   -2.9393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6555   -1.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4545   -2.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7314    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4467   -0.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2345   -2.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2474   -0.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3765   -3.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2003   -2.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4210   -0.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4210   -2.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  4  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 15  1  0  0  0  0\n  2  4  1  0  0  0  0\n 16 17  2  0  0  0  0\nM  END",
        "smiles": "CC(C)c1c(C)n(C)n(-c2ccccc2)c1=O",
        "formula": "C14H18N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "230.306",
        "optical_activity": "NONE",
        "references": [
          "9aae1ad3-3e87-4f0b-ab2e-12d391731dfe",
          "95c5992c-3fbc-4654-9aa4-16f42991e8d2",
          "41919c71-510b-4498-9ab0-70e6ba475c9d"
        ],
        "stereo_centers": 0
      },
      "unii": "OED8FV75PY"
    }
  ]
}