{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cfb7f893-be07-457a-bf7e-767a634f18ad",
          "code": "2814-77-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2814-77-9",
          "code_system": "CAS",
          "references": [
            "744d3e15-4cba-4862-a3dd-e5e98f35f662",
            "9f5deb06-d182-417b-ac99-ca39da8c336e"
          ]
        },
        {
          "uuid": "bc933dce-5603-44f9-9a4e-998f7aa76da3",
          "code": "C71665",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71665",
          "code_system": "NCI_THESAURUS",
          "references": [
            "744d3e15-4cba-4862-a3dd-e5e98f35f662"
          ]
        },
        {
          "uuid": "8ecc3480-6e75-4edc-a53c-fda03bfa84e7",
          "code": "220-562-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.693",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "744d3e15-4cba-4862-a3dd-e5e98f35f662"
          ]
        },
        {
          "uuid": "986077a8-8128-a444-4dc7-05e21f51cf43",
          "code": "7720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7720",
          "code_system": "HSDB",
          "references": [
            "c2464f54-a322-92cd-a8a2-edd30485de8e"
          ]
        },
        {
          "uuid": "d3128edf-c1d4-6ef3-a01a-9da796fd70ac",
          "code": "DTXSID7044637",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044637",
          "code_system": "EPA CompTox",
          "references": [
            "1b84da31-7f9e-6b9e-19f7-eaf39f40cccf"
          ]
        },
        {
          "uuid": "d72d3551-b617-4eee-999c-129635280d05",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "817062a8-50e2-fe24-fc7a-d8b372442406"
          ]
        },
        {
          "uuid": "e94457d5-956d-42d4-a9bd-f626588cd047",
          "code": "1426926",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426926/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "fd0eeaa0-6970-4d2d-be7f-64df93bd016c",
          "code": "OE8ZA0KN9Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "76c1d185-6a63-df5b-3fe8-52bf09b47440",
          "code": "OE8ZA0KN9Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OE8ZA0KN9Z",
          "code_system": "DAILYMED",
          "references": [
            "119601a8-d703-ebcc-e346-d26c431ef1a2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a25c143a-7be2-4360-9186-40ad5f99be28",
          "name": "2-NAPHTHALENOL, 1-((2-CHLORO-4-NITROPHENYL)AZO)-",
          "stdName": "2-NAPHTHALENOL, 1-((2-CHLORO-4-NITROPHENYL)AZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "018ff50d-4eb8-435b-a413-a5393fe21f51"
          ],
          "display_name": false
        },
        {
          "uuid": "24dcda8d-34e1-43f2-903d-34b167ca5faa",
          "name": "2-NAPHTHALENOL, 1-(2-(2-CHLORO-4-NITROPHENYL)DIAZENYL)-",
          "stdName": "2-NAPHTHALENOL, 1-(2-(2-CHLORO-4-NITROPHENYL)DIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "8de5cdf3-84ea-48c6-89ca-28ee5180c00b"
          ],
          "display_name": false
        },
        {
          "uuid": "a46d6b5b-1856-44d0-ba02-3fab1d745647",
          "name": "AKA228",
          "stdName": "AKA228",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "ce68ace1-9673-47f1-bab9-a12424fa7622",
            "018ff50d-4eb8-435b-a413-a5393fe21f51"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e3e67845-01ed-4b40-a470-12a656eb1532",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7fc0cba5-13f1-47f0-ab66-dff94713ddfb",
          "name": "C.I. PIGMENT RED 4 [HSDB]",
          "stdName": "C.I. PIGMENT RED 4 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04692b93-f5bd-4de0-870f-bab0d86037cc",
            "1180144d-ea08-48a4-9bcc-139db7992c67"
          ],
          "display_name": false
        },
        {
          "uuid": "ae6430be-3882-42eb-a782-7ed479edc519",
          "name": "CI 12085",
          "stdName": "CI 12085",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "5fab5f7e-350c-4eb6-834c-dc7a7791b3bf",
            "018ff50d-4eb8-435b-a413-a5393fe21f51",
            "64de89a6-e8ef-4173-9ff7-c721755838de"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f1ca2b2d-c9fd-40ec-a98b-47aa479f6154",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0aea371d-e76b-412a-9049-178a3d96dd06",
          "name": "D&C RED NO. 36",
          "stdName": "D&C RED NO. 36",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "872b8e5a-14da-4870-9a17-698693f6bba5",
            "c80d0c28-5c29-4f3a-b808-e70c59ce524d"
          ],
          "display_name": true
        },
        {
          "uuid": "8aa85e86-f3aa-44c8-a118-56dd49b603bb",
          "name": "D&C RED NO. 36 [II]",
          "stdName": "D&C RED NO. 36 [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c80d0c28-5c29-4f3a-b808-e70c59ce524d"
          ],
          "display_name": false
        },
        {
          "uuid": "b6fa6da8-5513-4b93-93fe-24beb7a2751b",
          "name": "DC RED NO. 36",
          "stdName": "DC RED NO. 36",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d007c26-4a8a-4d67-ad96-42159a0f831d",
            "1180144d-ea08-48a4-9bcc-139db7992c67"
          ],
          "display_name": false
        },
        {
          "uuid": "7c833c13-2ba5-46b3-a497-e1fea57dee50",
          "name": "PIGMENT RED 4",
          "stdName": "PIGMENT RED 4",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "165e51bc-3b6e-40d9-9f5d-58b44d1d5550",
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "018ff50d-4eb8-435b-a413-a5393fe21f51",
            "709e28dc-512a-4dce-82cc-639b1babb12d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "da40622e-adb0-45e3-99c5-e075e171e2a1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d45f178f-ac5e-41eb-bc2e-4f44a2710027",
          "name": "RED 36",
          "stdName": "RED 36",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1180144d-ea08-48a4-9bcc-139db7992c67",
            "843e998d-59dc-46e3-a457-10bb307726df",
            "018ff50d-4eb8-435b-a413-a5393fe21f51",
            "c2194a4e-a7f8-49bc-9b6a-3f0dc4efff7d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e6f0f531-ff5b-4cb0-b568-455eab0bce1f",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "c80d0c28-5c29-4f3a-b808-e70c59ce524d",
          "citation": "21CFR74.1336",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "134584a7-30fb-47c0-b572-bc22eba5ea1d",
          "citation": "ACD8.0(21CFR74.1336)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "018ff50d-4eb8-435b-a413-a5393fe21f51",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64de89a6-e8ef-4173-9ff7-c721755838de",
          "citation": "CTFA 2004",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8de5cdf3-84ea-48c6-89ca-28ee5180c00b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1180144d-ea08-48a4-9bcc-139db7992c67",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2194a4e-a7f8-49bc-9b6a-3f0dc4efff7d",
          "citation": "CTFA 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "165e51bc-3b6e-40d9-9f5d-58b44d1d5550",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04692b93-f5bd-4de0-870f-bab0d86037cc",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d007c26-4a8a-4d67-ad96-42159a0f831d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "744d3e15-4cba-4862-a3dd-e5e98f35f662",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390593000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a1660ee-63d4-4a7e-a068-dd62e1dae6a0",
          "citation": "SRS import [OE8ZA0KN9Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OE8ZA0KN9Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390593000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26c73282-7d63-4bdf-ade7-5609c5cd912e",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "843e998d-59dc-46e3-a457-10bb307726df",
          "citation": "RED 36 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5fab5f7e-350c-4eb6-834c-dc7a7791b3bf",
          "citation": "CI 12085 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce68ace1-9673-47f1-bab9-a12424fa7622",
          "citation": "AKA228 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "872b8e5a-14da-4870-9a17-698693f6bba5",
          "citation": "D&C RED NO. 36 [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "709e28dc-512a-4dce-82cc-639b1babb12d",
          "citation": "PIGMENT RED 4 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2464f54-a322-92cd-a8a2-edd30485de8e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2814-77-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b84da31-7f9e-6b9e-19f7-eaf39f40cccf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2814-77-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "817062a8-50e2-fe24-fc7a-d8b372442406",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9f5deb06-d182-417b-ac99-ca39da8c336e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "119601a8-d703-ebcc-e346-d26c431ef1a2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f15c6268-8fe4-4cff-9e67-8e2bf08d7172",
          "id": "f15c6268-8fe4-4cff-9e67-8e2bf08d7172",
          "molfile": "\n  Marvin  01132112312D          \n\n 23 25  0  0  0  0            999 V2000\n    7.3701   -7.0575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6172   -7.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5562   -8.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8059   -8.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1172   -8.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3771   -8.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6953   -8.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7570   -7.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5007   -6.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -7.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9258   -6.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9235   -6.1465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8508   -5.5236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8529   -4.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1361   -4.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1410   -3.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8627   -3.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5788   -3.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5739   -4.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2854   -4.7077    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8721   -2.2053    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.5981   -1.7969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.1553   -1.7805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 21  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  CHG  2  21   1  22  -1\nM  END",
          "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc(cc3Cl)[N+](=O)[O-])O",
          "formula": "C16H10ClN3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9a87bf4b-4062-453b-8d5f-a3c6edbae338"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "327.7224",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3264011b-4a64-4c67-b188-c63b6e638ea7",
      "version": "11",
      "structure": {
        "id": "cef5854a-080e-4a77-bbfc-e7c0e62ebe15",
        "molfile": "\n  Marvin  01132110412D          \n\n 23 25  0  0  0  0            999 V2000\n    5.9262   -6.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8063   -8.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5566   -8.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6176   -7.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1175   -8.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1792   -7.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5010   -6.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7572   -7.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6955   -8.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3774   -8.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3706   -7.0580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1413   -3.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1364   -4.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8532   -4.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5743   -4.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5792   -3.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8630   -3.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8724   -2.2054    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.5985   -1.7970    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.1556   -1.7806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8511   -5.5240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9239   -6.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2858   -4.7080    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  4 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n  5 10  1  0  0  0  0\n 17 18  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n  8  9  1  0  0  0  0\n 14 21  1  0  0  0  0\n  9 10  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22  1  1  0  0  0  0\n  5  6  2  0  0  0  0\n 15 23  1  0  0  0  0\nM  CHG  2  18   1  19  -1\nM  END",
        "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc(cc3Cl)[N+](=O)[O-])O",
        "formula": "C16H10ClN3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "327.7224",
        "optical_activity": "NONE",
        "references": [
          "26c73282-7d63-4bdf-ade7-5609c5cd912e",
          "1a1660ee-63d4-4a7e-a068-dd62e1dae6a0"
        ],
        "stereo_centers": 0
      },
      "unii": "OE8ZA0KN9Z"
    }
  ]
}