{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d6251a32-321d-4211-b0cc-96d2fd884925", "code": "135099-97-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=135099-97-7", "code_system": "CAS", "references": [ "f53a1c1f-41b6-426f-81aa-4604d5e97648", "4f277219-6133-4da8-b21e-8ae02ea95a49" ] }, { "uuid": "60f5b330-66e9-4396-8adc-b7a464814ec8", "code": "11334563", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11334563", "code_system": "PUBCHEM", "references": [ "f53a1c1f-41b6-426f-81aa-4604d5e97648" ] }, { "uuid": "467f94da-acf2-703b-90b2-119215795ea8", "code": "DTXSID70159251", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70159251", "code_system": "EPA CompTox", "references": [ "0b8ef9e6-cdf1-b32d-3624-e2eb17b14ddc" ] }, { "uuid": "5dfff435-0ccd-403b-996c-137c7b33d072", "code": "OE6086D537", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "19c4a246-70aa-4ded-bf29-e297587b5706", "name": "1,3-PENTANEDIONE, 1-(3,4-DIMETHOXYPHENYL)-4,4-DIMETHYL-", "stdName": "1,3-PENTANEDIONE, 1-(3,4-DIMETHOXYPHENYL)-4,4-DIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "12c76c1e-c3d1-4890-99cb-bca61d62b69a", "90461724-87cf-4c65-b500-7fab3a8ad356" ], "display_name": false }, { "uuid": "ee2620af-809a-49cf-8411-1191060dd0a6", "name": "1-(3,4-DIMETHOXYPHENYL)-4,4-DIMETHYL-1,3-PENTANEDIONE", "stdName": "1-(3,4-DIMETHOXYPHENYL)-4,4-DIMETHYL-1,3-PENTANEDIONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "90461724-87cf-4c65-b500-7fab3a8ad356", "1383c41b-8de8-4f0e-9eee-200f7cc9c0f7", "a5449dfb-c286-4e49-8f27-9af7ef6d0ec4" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "a42d8ae9-83e6-40f7-b000-833283e6423e", "name_org": "INCI" } ] } ], "references": [ { "uuid": "a5449dfb-c286-4e49-8f27-9af7ef6d0ec4", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "90461724-87cf-4c65-b500-7fab3a8ad356", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12c76c1e-c3d1-4890-99cb-bca61d62b69a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f53a1c1f-41b6-426f-81aa-4604d5e97648", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391407000, "tags": [ "NOMEN" ] }, { "uuid": "7f17cef7-e0fc-4753-a5a8-78d48d4dc155", "citation": "SRS import [OE6086D537]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OE6086D537", "doc_type": "SRS", "public_domain": true, "document_date": 1493391407000, "tags": [ "NOMEN" ] }, { "uuid": "1383c41b-8de8-4f0e-9eee-200f7cc9c0f7", "citation": "1-(3,4-DIMETHOXYPHENYL)-4,4-DIMETHYL-1,3-PENTANEDIONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0b8ef9e6-cdf1-b32d-3624-e2eb17b14ddc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=135099-97-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4f277219-6133-4da8-b21e-8ae02ea95a49", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "58209e37-0a4b-49fe-bcaa-2c2ac33b608c", "id": "58209e37-0a4b-49fe-bcaa-2c2ac33b608c", "molfile": "\n Marvin 01132104342D \n\n 19 19 0 0 0 0 999 V2000\n 9.5721 -9.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8577 -9.4358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8577 -8.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -7.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8576 -6.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -7.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4287 -8.6108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7143 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8576 -6.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -5.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -5.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -4.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8576 -4.4858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2866 -4.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0010 -4.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8741 -3.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6991 -5.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 11 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\nM END", "smiles": "CC(C)(C)C(=O)CC(=O)c1ccc(c(c1)OC)OC", "formula": "C15H20O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2af8c3bf-096d-47e0-a213-3c6e9c81abd9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.3175", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c6410c5e-c5af-4351-aadc-f2c58e1d93db", "version": "4", "structure": { "id": "0d388df5-ea49-48e6-a594-38bda8dfb9ce", "molfile": "\n Marvin 01132100562D \n\n 19 19 0 0 0 0 999 V2000\n 8.8576 -4.4858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -5.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4287 -8.6108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8577 -9.4358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2866 -4.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -4.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0010 -4.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8741 -3.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6991 -5.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -5.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8576 -6.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8576 -6.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -7.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -7.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1432 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8577 -8.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7143 -8.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5721 -9.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 6 2 0 0 0 0\n 2 11 2 0 0 0 0\n 3 15 1 0 0 0 0\n 3 18 1 0 0 0 0\n 4 16 1 0 0 0 0\n 4 19 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 5 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 17 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CC(C)(C)C(=O)CC(=O)c1ccc(c(c1)OC)OC", "formula": "C15H20O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.3175", "optical_activity": "NONE", "references": [ "7f17cef7-e0fc-4753-a5a8-78d48d4dc155", "a5449dfb-c286-4e49-8f27-9af7ef6d0ec4" ], "stereo_centers": 0 }, "unii": "OE6086D537" } ] }