{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5d2f1072-013a-4a87-a387-a50b04739f49", "code": "4531-49-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4531-49-1", "code_system": "CAS", "references": [ "80229efc-11cc-4638-99f8-5a0ec251e087", "3df36d56-e89f-4d3a-b7a7-26c5b3a2f869" ] }, { "uuid": "430b3819-128f-483f-beb1-9112b1da545c", "code": "224-867-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.608", "code_system": "ECHA (EC/EINECS)", "references": [ "80229efc-11cc-4638-99f8-5a0ec251e087" ] }, { "uuid": "dae9974c-8e71-422d-a516-ef4668d25fa5", "code": "91539", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91539", "code_system": "PUBCHEM", "references": [ "80229efc-11cc-4638-99f8-5a0ec251e087" ] }, { "uuid": "8add9ac6-d6f7-4df0-925c-e012eb6de9a2", "code": "OE5UP31E08", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bb7b4a8b-0fa5-bcd9-515e-dd27b17c96d1", "code": "DTXSID60863411", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60863411", "code_system": "EPA CompTox", "references": [ "12afeb47-8867-9251-3d36-97bf24a99b44" ] } ], "substance_class": "chemical", "names": [ { "uuid": "39196b20-b90e-4b38-999b-6b9535625db3", "name": "2,2''-((3,3'-DICHLORO-4,4'-BIPHENYLYLENE)BIS(AZO))BIS(O-ACETOACETANISIDIDE)", "stdName": "2,2''-((3,3'-DICHLORO-4,4'-BIPHENYLYLENE)BIS(AZO))BIS(O-ACETOACETANISIDIDE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ade18642-604e-4100-ae4a-0655dca1c825", "92d5b0b5-7c84-42c7-8957-3506573568e5" ], "display_name": false }, { "uuid": "85d9c09c-ab9e-4a07-bbe6-4c8e7d67a157", "name": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(2-METHOXYPHENYL)-3-OXO-", "stdName": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(2-METHOXYPHENYL)-3-OXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ade18642-604e-4100-ae4a-0655dca1c825", "92d5b0b5-7c84-42c7-8957-3506573568e5" ], "display_name": false }, { "uuid": "22d0ac3b-a653-40ee-9a6d-52cb4b6226e7", "name": "C.I. 21105", "stdName": "C.I. 21105", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ade18642-604e-4100-ae4a-0655dca1c825", "92d5b0b5-7c84-42c7-8957-3506573568e5" ], "display_name": false }, { "uuid": "0565b60f-0ab2-4dbb-a55a-5f7bb116ad9d", "name": "C.I. PIGMENT YELLOW 17", "stdName": "C.I. PIGMENT YELLOW 17", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac6090d0-dbc1-4740-95d1-475421be7808", "92d5b0b5-7c84-42c7-8957-3506573568e5" ], "display_name": false }, { "uuid": "159a6269-3289-485d-b7d7-3c6041f30f9e", "name": "PIGMENT YELLOW 17", "stdName": "PIGMENT YELLOW 17", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "92d5b0b5-7c84-42c7-8957-3506573568e5", "32ef5d28-c1d3-4a78-8a1e-a929dbf33839" ], "display_name": true } ], "references": [ { "uuid": "32ef5d28-c1d3-4a78-8a1e-a929dbf33839", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "92d5b0b5-7c84-42c7-8957-3506573568e5", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac6090d0-dbc1-4740-95d1-475421be7808", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ade18642-604e-4100-ae4a-0655dca1c825", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80229efc-11cc-4638-99f8-5a0ec251e087", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392052000, "tags": [ "NOMEN" ] }, { "uuid": "cb42858b-1eb2-4e8d-8617-05c8e59075db", "citation": "SRS import [OE5UP31E08]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OE5UP31E08", "doc_type": "SRS", "public_domain": true, "document_date": 1493392052000, "tags": [ "NOMEN" ] }, { "uuid": "3df36d56-e89f-4d3a-b7a7-26c5b3a2f869", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "12afeb47-8867-9251-3d36-97bf24a99b44", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "63b85037-ef25-4f79-9bf0-4e5e9d1ea26c", "id": "63b85037-ef25-4f79-9bf0-4e5e9d1ea26c", "molfile": "\n Marvin 01132105112D \n\n 48 51 0 0 0 0 999 V2000\n -5.3585 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -3.2151 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.9296 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 46 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 20 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 22 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 45 2 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 43 25 2 0 0 0 0\n 27 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 32 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 40 2 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 45 43 1 0 0 0 0\n 46 47 1 0 0 0 0\n 46 48 2 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccccc4OC", "formula": "C34H30Cl2N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d178430e-524a-4728-b44d-2366434441cd" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "689.5458", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "e90ef919-8682-4928-9ef8-c9f644b0ea7f", "version": "5", "structure": { "id": "20ef0e1f-1052-4f2d-8926-f70c0b69342e", "molfile": "\n Marvin 01132101522D \n\n 48 51 0 0 0 0 999 V2000\n -0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 0.2062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 -1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0730 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5019 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7875 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3585 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0730 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5019 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7875 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3585 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 2 0 0 0 0\n 1 7 1 0 0 0 0\n 9 13 1 0 0 0 0\n 3 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 4 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 10 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 19 24 1 0 0 0 0\n 21 25 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 26 31 2 0 0 0 0\n 32 33 1 0 0 0 0\n 27 32 1 0 0 0 0\n 24 26 1 0 0 0 0\n 15 20 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 34 38 2 0 0 0 0\n 34 39 1 0 0 0 0\n 36 40 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 41 46 2 0 0 0 0\n 47 48 1 0 0 0 0\n 42 47 1 0 0 0 0\n 39 41 1 0 0 0 0\n 17 35 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccccc4OC", "formula": "C34H30Cl2N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "689.5458", "optical_activity": "UNSPECIFIED", "references": [ "cb42858b-1eb2-4e8d-8617-05c8e59075db", "ade18642-604e-4100-ae4a-0655dca1c825" ], "stereo_centers": 2 }, "unii": "OE5UP31E08" } ] }