{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a210aee4-5f5e-47bc-a922-de975a9610f4",
          "code": "C87343",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87343",
          "code_system": "NCI_THESAURUS",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "c053e4c1-2fc3-40d8-8b19-ba8c542db4c6",
          "code": "8589",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8589/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "cfce51d1-2667-49eb-97a4-8dc794744d63",
          "code": "SUB16458MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "cf0977b2-ae7c-4595-95a3-3dd1bf7da2f5",
          "code": "SUB120237",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "5d710c69-5709-4ca8-852a-4fcbc6c46d4a",
          "code": "SUB21950",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "5a3c2c9c-752b-497d-afe6-14b369946bad",
          "code": "CHEMBL2106910",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106910",
          "code_system": "ChEMBL",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "433f876a-5db3-4eef-8c0a-ef6eb6819e90",
          "code": "CHEMBL2104827",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104827",
          "code_system": "ChEMBL",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "318711f0-3d1c-42ed-979f-f422fd8260ff",
          "code": "SUB129951",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "7c24af36-b5d6-46a7-937c-6c55233dd66f",
          "code": "71586907",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71586907",
          "code_system": "PUBCHEM",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5"
          ]
        },
        {
          "uuid": "c246ee80-9794-4220-9a78-b221dce22f4d",
          "code": "7259-25-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7259-25-8",
          "code_system": "CAS",
          "references": [
            "94d95060-43e7-4464-aa09-5e92ba087fb5",
            "0972e659-0fce-4b90-920d-d3d7cee76c06"
          ]
        },
        {
          "uuid": "5bd5c82d-33af-ed0a-ec65-5f55403b9b7b",
          "code": "DTXSID70222914",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70222914",
          "code_system": "EPA CompTox",
          "references": [
            "e7e4790c-cc85-dd54-c0ea-4d809f5e8197"
          ]
        },
        {
          "uuid": "1a956159-7351-dec1-db58-66383d281063",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "97f0ce91-189c-e86c-15b4-ad92d4420abc"
          ]
        },
        {
          "uuid": "8fad1a14-c64d-4104-b6c3-870ab3c712a2",
          "code": "OC4598NZEQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ec1eed24-c9b6-3906-0c66-bc452426f150",
          "code": "OC4598NZEQ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OC4598NZEQ",
          "code_system": "DAILYMED",
          "references": [
            "c1396295-6669-dec3-30b6-48c1fc3642f4"
          ]
        },
        {
          "uuid": "9c699597-c26c-0f98-b3d3-0e921c64691f",
          "code": "100000088904",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4bb27fd0-b030-d37a-329a-499a025e7f88"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6362ddbe-04ae-41c0-b4d4-d938d42163af",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3e5cc0fb-7c78-43fd-a8a7-5e970ec488bf",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1550aeb1-0286-4bf7-b588-e70033e6d5e2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "8015c539-c06e-49b3-ab9c-ed2da94ac957",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6dd03303-0236-4deb-bbc9-a762f0a4bb24",
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "a9e785f4-cf39-41d7-b696-8e05e477b9b9"
          ],
          "related_substance": {
            "uuid": "597e02af-c27c-463f-965e-b9218d9df171",
            "refuuid": "fbca844b-6ce8-4e84-bee9-3b79470ae12d",
            "name": "POTASSIUM ASPARTATE ANHYDROUS",
            "unii": "E9VW2509NH",
            "linking_id": "E9VW2509NH",
            "ref_pname": "POTASSIUM ASPARTATE ANHYDROUS",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1eb98703-d65c-40ab-83b1-85cac7ecb7d8",
          "name": "ASPARTATE POTASSIUM",
          "stdName": "ASPARTATE POTASSIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45e791c0-00a4-4909-8564-dc5b5aa6b92e"
          ],
          "display_name": false
        },
        {
          "uuid": "4b8e57ea-edbd-437f-8e6d-28a30efbda0c",
          "name": "ASPARTIC ACID, MONOPOTASSIUM SALT, HEMIHYDRATE, L-",
          "stdName": "ASPARTIC ACID, MONOPOTASSIUM SALT, HEMIHYDRATE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "376c9d49-1bb1-4e63-bc7f-99db0a392ace"
          ],
          "display_name": false
        },
        {
          "uuid": "3983cc59-8540-4abe-bb4e-3a6b503e4a64",
          "name": "L-ASPARTATE POTASSIUM",
          "stdName": "L-ASPARTATE POTASSIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b975e131-8a79-4d39-af10-64c347ff4725"
          ],
          "display_name": false
        },
        {
          "uuid": "48c622ce-b081-4437-a44b-be3e211e309a",
          "name": "L-ASPARTIC ACID, MONOPOTASSIUM SALT, HYDRATE (2:1)",
          "stdName": "L-ASPARTIC ACID, MONOPOTASSIUM SALT, HYDRATE (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "376c9d49-1bb1-4e63-bc7f-99db0a392ace"
          ],
          "display_name": false
        },
        {
          "uuid": "44501f16-7925-44c0-9dac-6e98750bffb8",
          "name": "MONOPOTASSIUM ASPARTATE HEMIHYDRATE",
          "stdName": "MONOPOTASSIUM ASPARTATE HEMIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49339764-10a4-4397-9653-8e64e2df5605"
          ],
          "display_name": false
        },
        {
          "uuid": "bf5de57a-9102-4dfa-b8f9-932b50c1d71d",
          "name": "POTASSIUM ASPARTATE",
          "stdName": "POTASSIUM ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5fa9416-d4b1-4c57-90f4-c87c1d0d60a0",
            "0c32d44d-3c4e-464d-8ef8-4f05f6578d3a",
            "594bb432-0808-4cf4-b3e5-a08e57f7242c",
            "f2cf3db6-aee9-4318-8c35-897ef48f4561",
            "440e80ea-d81c-4239-903a-6bf45ce4587c",
            "21c23030-e4ed-40ad-b831-f83b1e2c6e27",
            "c196628f-1d33-4517-87c0-675b138b8498"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a4ba72c9-9870-4c5e-bdc9-fd6b415e8cf8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d9cbc819-18dc-4390-a6e1-b8dcaa478054",
          "name": "POTASSIUM ASPARTATE HEMIHYDRATE",
          "stdName": "POTASSIUM ASPARTATE HEMIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "376c9d49-1bb1-4e63-bc7f-99db0a392ace"
          ],
          "display_name": false
        },
        {
          "uuid": "62b352e9-c074-4652-ace4-26325a9238f3",
          "name": "POTASSIUM ASPARTATE [MART.]",
          "stdName": "POTASSIUM ASPARTATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2cf3db6-aee9-4318-8c35-897ef48f4561"
          ],
          "display_name": false
        },
        {
          "uuid": "5badd118-9cab-48e6-9cf0-e71f0b111e97",
          "name": "POTASSIUM HYDROGEN ASPARTATE HEMIHYDRATE",
          "stdName": "POTASSIUM HYDROGEN ASPARTATE HEMIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b47f06bd-88c9-4cd8-ba48-9533bd4d3019"
          ],
          "display_name": false
        },
        {
          "uuid": "3a82171e-0b2c-8d21-1d3f-a7be8d858fa7",
          "name": "POTASSIUM HYDROGEN ASPARTATE HEMIHYDRATE [EP MONOGRAPH]",
          "stdName": "POTASSIUM HYDROGEN ASPARTATE HEMIHYDRATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2a10a13-eed0-50ae-ca29-060a62247810"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e8443b-ed9e-4917-95ae-269299238da8",
          "name": "Potassium aspartate [WHO-DD]",
          "stdName": "POTASSIUM ASPARTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da7755e4-aba0-30b5-3d69-b6594770f657"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c196628f-1d33-4517-87c0-675b138b8498",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b975e131-8a79-4d39-af10-64c347ff4725",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45e791c0-00a4-4909-8564-dc5b5aa6b92e",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2cf3db6-aee9-4318-8c35-897ef48f4561",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49339764-10a4-4397-9653-8e64e2df5605",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "376c9d49-1bb1-4e63-bc7f-99db0a392ace",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21c23030-e4ed-40ad-b831-f83b1e2c6e27",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c32d44d-3c4e-464d-8ef8-4f05f6578d3a",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b47f06bd-88c9-4cd8-ba48-9533bd4d3019",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94d95060-43e7-4464-aa09-5e92ba087fb5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ad737ef-1842-460b-b101-707ed47bfe39",
          "citation": "SRS import [OC4598NZEQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OC4598NZEQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c47fe0b-6ca1-4dd9-a5cf-03838586054f",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "440e80ea-d81c-4239-903a-6bf45ce4587c",
          "citation": "POTASSIUM ASPARTATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5fa9416-d4b1-4c57-90f4-c87c1d0d60a0",
          "citation": "POTASSIUM ASPARTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "594bb432-0808-4cf4-b3e5-a08e57f7242c",
          "citation": "POTASSIUM ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7e4790c-cc85-dd54-c0ea-4d809f5e8197",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7259-25-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "97f0ce91-189c-e86c-15b4-ad92d4420abc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b2a10a13-eed0-50ae-ca29-060a62247810",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "0972e659-0fce-4b90-920d-d3d7cee76c06",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "da7755e4-aba0-30b5-3d69-b6594770f657",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c1396295-6669-dec3-30b6-48c1fc3642f4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a9e785f4-cf39-41d7-b696-8e05e477b9b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4bb27fd0-b030-d37a-329a-499a025e7f88",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bfffde87-0122-4e37-981f-0ca4c2ebc826",
          "id": "bfffde87-0122-4e37-981f-0ca4c2ebc826",
          "molfile": "\n  Marvin  04262122382D          \n\n  1  0  0  0  1  0            999 V2000\n   13.7757   -5.4238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d0946f4-72cd-441a-aad2-b2a20bffc3b0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "61343710-2621-4412-a64d-1b7f01b8614d",
          "id": "61343710-2621-4412-a64d-1b7f01b8614d",
          "molfile": "\n  Marvin  04262122382D          \n\n  9  8  0  0  1  0            999 V2000\n    5.4855   -4.4979    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2014   -4.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9198   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9084   -3.6531    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6130   -3.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3336   -3.6335    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6016   -2.4060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1879   -3.2505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2127   -5.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  6  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\nM  CHG  2   1  -1   6  -1\nM  END",
          "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-]",
          "formula": "C4H5NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "ef5845d5-24a0-41d9-afc5-3a2eb866699a"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "131.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "53b27c6b-617e-4840-9044-37d6ffc38bfc",
          "id": "53b27c6b-617e-4840-9044-37d6ffc38bfc",
          "molfile": "\n  Marvin  04262122382D          \n\n  1  0  0  0  1  0            999 V2000\n    1.0892   -2.9509    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "43900b1c-aa59-4f78-8409-11ba891831b3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "80ad58cd-ed1e-4bf6-87ed-86ddcce22e2f",
          "id": "80ad58cd-ed1e-4bf6-87ed-86ddcce22e2f",
          "molfile": "\n  Marvin  04262122382D          \n\n  1  0  0  0  1  0            999 V2000\n   12.3616   -2.5461    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "91134cb9-2f90-4f62-a9bb-0aa4efa38426"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "479e2aac-fcc1-4d8e-bf48-2c3dbbdbaae3",
      "version": "12",
      "structure": {
        "id": "5965220a-9264-4cf2-b14e-3a6ea743649b",
        "molfile": "\n  Marvin  01132104382D          \n\n 23 16  0  0  1  0            999 V2000\n   13.7757   -5.4238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4855   -4.4979    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2014   -4.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9198   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9084   -3.6531    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6130   -3.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3336   -3.6335    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6016   -2.4060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1879   -3.2505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2127   -5.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0892   -2.9509    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   12.3616   -2.5461    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n    1.0892   -2.9509    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4855   -4.4979    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2014   -4.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9198   -4.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9084   -3.6531    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6130   -3.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3336   -3.6335    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.6016   -2.4060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1879   -3.2505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2127   -5.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3616   -2.5461    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  5  9  1  6  0  0  0\n  3 10  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 22  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 21  1  6  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  CHG  8   2  -1   7  -1  11   1  12   1  13   1  14  -1  19  -1  23   1\nM  STY  3   1 MUL   2 MUL   3 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  11  13\nM  SPA   1  1  11\nM  SDI   1  4    0.6692   -3.3709    0.6692   -2.5309\nM  SDI   1  4    1.5092   -2.5309    1.5092   -3.3709\nM  SMT   1 2\nM  SCN  1   2 HT \nM  SAL   2 15   2   3   4   5   6   7   8   9  10  14  15  16  17  18  19\nM  SAL   2  3  20  21  22\nM  SPA   2  9   2   3   4   5   6   7   8   9  10\nM  SDI   2  4    5.0655   -6.1407    5.0655   -1.9860\nM  SDI   2  4    8.7536   -1.9860    8.7536   -6.1407\nM  SMT   2 2\nM  SCN  1   3 HT \nM  SAL   3  2  12  23\nM  SPA   3  1  12\nM  SDI   3  4   11.9416   -2.9661   11.9416   -2.1261\nM  SDI   3  4   12.7816   -2.1261   12.7816   -2.9661\nM  SMT   3 2\nM  END",
        "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-].C([C@@H](C(=O)[O-])N)C(=O)[O-].[K+].[K+].O.[H+].[H+]",
        "formula": "2C4H5NO4.2K.2H.H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "360.4017",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3c47fe0b-6ca1-4dd9-a5cf-03838586054f",
          "2ad737ef-1842-460b-b101-707ed47bfe39"
        ],
        "stereo_centers": 2
      },
      "unii": "OC4598NZEQ"
    }
  ]
}