{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74bae3a5-7d2c-4044-891a-4ae5c01dd76c",
          "code": "959-55-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=959-55-7",
          "code_system": "CAS",
          "references": [
            "c6b3d1b1-bbad-441d-9b9a-d8c737420bda",
            "5bee2049-473e-450d-a436-397270ac7791"
          ]
        },
        {
          "uuid": "49a3eb46-d3fa-42ad-8ffa-fc4e152ab286",
          "code": "213-502-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.275",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c6b3d1b1-bbad-441d-9b9a-d8c737420bda"
          ]
        },
        {
          "uuid": "69a8aef1-d353-4254-94e5-62cd97c2e12a",
          "code": "13740",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13740",
          "code_system": "PUBCHEM",
          "references": [
            "c6b3d1b1-bbad-441d-9b9a-d8c737420bda"
          ]
        },
        {
          "uuid": "2a498ed6-a13c-8861-9014-b861cc741f2d",
          "code": "DTXSID6041634",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041634",
          "code_system": "EPA CompTox",
          "references": [
            "91ae7011-ee94-f477-1759-8c5860bb26a0"
          ]
        },
        {
          "uuid": "b8ceb749-2fff-b27e-ae6d-e59194654a05",
          "code": "2399551",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2399551/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a7b80071-a7a6-b7a6-5df6-dda28041fc1e"
          ]
        },
        {
          "uuid": "65254965-a3e9-4d4d-88f4-34f37585582a",
          "code": "OC19CZY82T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "30545484-7857-54e5-eb69-baff83effa10",
          "code": "OC19CZY82T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=OC19CZY82T",
          "code_system": "DAILYMED",
          "references": [
            "0f33effd-f1ba-2a82-186f-3e96ba670d8a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9fc75130-8e42-4a38-828e-64a1ba4c1997",
          "name": "AMMONIUM, BENZYLDIMETHYLOCTYL-, CHLORIDE",
          "stdName": "AMMONIUM, BENZYLDIMETHYLOCTYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "e9bd89f8-ffc1-4bfa-bff8-6eb09c8d0ef7",
          "name": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE",
          "stdName": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "5e07402a-8940-4178-9825-c9589e5e840c",
          "name": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE (1:1)",
          "stdName": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "605a2c5c-37ab-4d2c-8ea2-6099f898fd8a",
          "name": "BENZYLDIMETHYLOCTYLAMMONIUM CHLORIDE",
          "stdName": "BENZYLDIMETHYLOCTYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": true
        },
        {
          "uuid": "2e6c6bd8-ae96-4e16-9d6b-973955b9e44c",
          "name": "CAPRYLYLALKONIUM CHLORIDE",
          "stdName": "CAPRYLYLALKONIUM CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "560b094c-47ec-4fe7-8911-1b04b94ef497",
            "0adfea09-5cb8-4f54-bd95-d0f595b78ff1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "30560a01-8170-4e6b-b093-e8f2f63f6045",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5f07bd1f-9985-4c6e-87be-8867aed3b2ab",
          "name": "DIMETHYLBENZYL-N-OCTYLAMMONIUM CHLORIDE",
          "stdName": "DIMETHYLBENZYL-N-OCTYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "b2259a80-bebd-43bf-bdf1-0afbaa8b6961",
          "name": "N,N-DIMETHYL-N-OCTYLBENZENEMETHANAMINIUM CHLORIDE",
          "stdName": "N,N-DIMETHYL-N-OCTYLBENZENEMETHANAMINIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "a999324a-2bd0-4ade-9e66-055749d358e8",
          "name": "N-BENZYL-N,N-DIMETHYLOCTAN-1-AMINIUM CHLORIDE",
          "stdName": "N-BENZYL-N,N-DIMETHYLOCTAN-1-AMINIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "0d449e02-a89c-406d-8cb5-8b6032251f2a",
          "name": "N-OCTYL DIMETHYL BENZYL AMMONIUM CHLORIDE",
          "stdName": "N-OCTYL DIMETHYL BENZYL AMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67737c70-3c5f-4914-840d-1a86989d137a"
          ],
          "display_name": false
        },
        {
          "uuid": "fd5fb535-c9c4-4bae-8785-2a5f5f5c402d",
          "name": "OCTYLBENZYLDIMETHYLAMMONIUM CHLORIDE",
          "stdName": "OCTYLBENZYLDIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        },
        {
          "uuid": "f3b363f7-8733-4088-9810-c3e0750fc902",
          "name": "OCTYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "stdName": "OCTYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
            "530807f6-8689-4462-89f2-3887176300e9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "67737c70-3c5f-4914-840d-1a86989d137a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0adfea09-5cb8-4f54-bd95-d0f595b78ff1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4239fb88-0590-4d89-95f9-f1a4fe9eb5a9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "530807f6-8689-4462-89f2-3887176300e9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6b3d1b1-bbad-441d-9b9a-d8c737420bda",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391852000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df03cfd6-8f33-41af-a2c4-3a07d33ce4ac",
          "citation": "SRS import [OC19CZY82T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OC19CZY82T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391852000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e217a821-4e0c-436f-8dc7-8763e8106b34",
          "citation": "http://www.chemfrog.com/chemical_info/377999/",
          "url": "http://www.chemfrog.com/chemical_info/377999/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "560b094c-47ec-4fe7-8911-1b04b94ef497",
          "citation": "CAPRYLYLALKONIUM CHLORIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91ae7011-ee94-f477-1759-8c5860bb26a0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=959-55-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7b80071-a7a6-b7a6-5df6-dda28041fc1e",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "5bee2049-473e-450d-a436-397270ac7791",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0f33effd-f1ba-2a82-186f-3e96ba670d8a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acc57550-2af7-4b36-8f39-8d34e183df53",
          "id": "acc57550-2af7-4b36-8f39-8d34e183df53",
          "molfile": "\n  Marvin  01132108582D          \n\n  1  0  0  0  0  0            999 V2000\n    9.2587   -1.7018    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f7270ad0-c13d-4b56-a225-227575ac4a42"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "292fd5f0-3a86-4502-ba5b-3e5f8cf0499f",
          "id": "292fd5f0-3a86-4502-ba5b-3e5f8cf0499f",
          "molfile": "\n  Marvin  01132102152D          \n\n 18 18  0  0  0  0            999 V2000\n    0.0000   -0.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6983   -1.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1285   -1.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578   -0.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5561   -1.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2828   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9837   -1.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7130   -0.8250    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    5.7440    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4423   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4113   -1.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3802   -2.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0785   -2.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0552   -3.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3259   -3.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6276   -3.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6587   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  1   9   1\nM  END",
          "smiles": "CCCCCCCC[N+](C)(C)Cc1ccccc1",
          "formula": "C17H30N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0829ada-55d7-4f37-b28c-a9120a431e1c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "248.4274",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ada01cea-626c-48fe-8341-95d16b14f13a",
      "version": "6",
      "structure": {
        "id": "a4a62b66-4f42-408a-a482-a623bdaee807",
        "molfile": "\n  Marvin  01132108332D          \n\n 19 18  0  0  0  0            999 V2000\n    5.7130   -0.8250    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.4113   -1.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3802   -2.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9837   -1.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7440    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4423   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6587   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0785   -2.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2828   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6983   -1.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1285   -1.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578   -0.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5561   -1.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6276   -3.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0552   -3.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3259   -3.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2587   -1.7018    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  3  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17  8  2  0  0  0  0\n 18 16  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  2   1   1  19  -1\nM  END",
        "smiles": "CCCCCCCC[N+](C)(C)Cc1ccccc1.[Cl-]",
        "formula": "C17H30N.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "283.8804",
        "optical_activity": "NONE",
        "references": [
          "df03cfd6-8f33-41af-a2c4-3a07d33ce4ac",
          "e217a821-4e0c-436f-8dc7-8763e8106b34"
        ],
        "stereo_centers": 0
      },
      "unii": "OC19CZY82T"
    }
  ]
}