{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d313cb15-b5c2-48af-904f-2893adce8cad",
          "code": "72-20-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72-20-8",
          "code_system": "CAS",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97",
            "72d003d4-13d7-4146-bccc-932c0dea910a"
          ]
        },
        {
          "uuid": "bb893790-e697-48ab-a3b8-108fc276741b",
          "code": "D004732",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004732",
          "code_system": "MESH",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "a9f8c8fb-96e3-4d81-a866-6726f1ffb228",
          "code": "ENDRIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Endrin",
          "code_system": "WIKIPEDIA",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "5a56379f-a3b3-49bd-8d13-98755e5a250f",
          "code": "41601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2261",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "1ff24925-7bab-487f-88fe-b9f0dac2c66e",
          "code": "m4903",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4903?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "429714b9-88cd-412a-a143-863c0179ecd8",
          "code": "200-775-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.705",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "64d69621-abfe-44c7-96bf-fdb2a61dcc57",
          "code": "12358480",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12358480",
          "code_system": "PUBCHEM",
          "references": [
            "4da7319d-fe35-4967-afa2-f8f78fad7d97"
          ]
        },
        {
          "uuid": "bf13fd8f-e1f9-2d76-25af-ce33d76dedd7",
          "code": "198",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/198",
          "code_system": "HSDB",
          "references": [
            "4897ad64-4d5f-7384-1387-fe9f7eb137bf"
          ]
        },
        {
          "uuid": "8fa548e0-a80b-f738-e5f4-ddf47b8ef325",
          "code": "Endrin",
          "comments": "IARC|GROUP 3 ( Not classifiable as to its carcinogenicity to humans)",
          "type": "PRIMARY",
          "code_system": "IARC",
          "references": [
            "0e644239-77b0-feec-2bbd-13c9fb4b591f"
          ]
        },
        {
          "uuid": "456f5226-94f1-4296-8b65-1a02c781d3e9",
          "code": "OB9NVE7YCL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7c52f02e-02f8-b11f-85de-0d194967055d",
          "code": "81526",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81526",
          "code_system": "CHEBI",
          "references": [
            "b8d224e4-7fd3-6443-5d66-2d54b202a28d"
          ]
        },
        {
          "uuid": "3a102f26-593b-9d05-3e8c-b29588a6d8e0",
          "code": "8935",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8935",
          "code_system": "NSC",
          "references": [
            "b253bf7b-7aea-0299-7942-da081043ff07"
          ]
        },
        {
          "uuid": "54add841-6550-1ad0-bb48-e36db0d31845",
          "code": "endrin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/endrin.html",
          "code_system": "ALANWOOD",
          "references": [
            "73294a7a-8885-3ff1-7022-dd79b17deeb6"
          ]
        },
        {
          "uuid": "3d3dc0a0-176e-541c-c069-9ffc2f7a5e37",
          "code": "DTXSID6020561",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020561",
          "code_system": "EPA CompTox",
          "references": [
            "1cd4f3c7-717a-65f0-d908-2148d4f35717"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "873fcdaf-3951-4f13-a98b-4cbb65a609fb",
          "name": "(1AR,2R,2AR,3R,6S,6AS,7S,7AS)-REL-3,4,5,6,9,9-HEXACHLORO-1A,2,2A,3,6,6A,7,7A-OCTAHYDRO-2,7:3,6-DIMETHANONAPHTH(2,3-B)OXIRENE",
          "stdName": "(1AR,2R,2AR,3R,6S,6AS,7S,7AS)-REL-3,4,5,6,9,9-HEXACHLORO-1A,2,2A,3,6,6A,7,7A-OCTAHYDRO-2,7:3,6-DIMETHANONAPHTH(2,3-B)OXIRENE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dcb4164-722c-474c-bac7-860badf0063d",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "ae6f05d7-cf33-4f0e-bcfd-9d808caf4c80",
          "name": "ENDRIN",
          "stdName": "ENDRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc729bb1-db49-4bf3-bba2-48a6f409c61a",
            "76e4d359-aa5c-4181-aca6-a8ef9f064afe",
            "fcadf4fc-21d5-4697-a8b5-d4eac74b950a",
            "3a9b9896-021a-40aa-b6c3-96ab3b5c24cb",
            "42ab85fe-1e97-4132-9c76-a986109a7a85",
            "e5d97397-79f1-4510-ba99-5fcec5a93e97",
            "1a6a861d-94be-444e-a941-18befe26b7ae",
            "ce5597ee-3378-48f0-b998-2ebe32294df5",
            "5834089d-fd85-4e7e-883c-0c68f996ef6a",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": true
        },
        {
          "uuid": "7b19c07a-c36e-43a6-8967-bc758998bfbc",
          "name": "ENDRIN [HSDB]",
          "stdName": "ENDRIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5597ee-3378-48f0-b998-2ebe32294df5",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "6901ab37-84f3-a52c-65ae-a1ebef9fe2c4",
          "name": "ENDRIN [IARC]",
          "stdName": "ENDRIN [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e644239-77b0-feec-2bbd-13c9fb4b591f"
          ],
          "display_name": false
        },
        {
          "uuid": "49005bb3-ed99-46b9-b708-79383d16e6ec",
          "name": "ENDRIN [ISO]",
          "stdName": "ENDRIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc729bb1-db49-4bf3-bba2-48a6f409c61a",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "83106d6e-7a67-4837-9dcd-890bd8343f7d",
          "name": "ENDRIN [MART.]",
          "stdName": "ENDRIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a9b9896-021a-40aa-b6c3-96ab3b5c24cb",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "5aaa7002-2a0c-4f79-8442-780fe506851d",
          "name": "ENDRIN [MI]",
          "stdName": "ENDRIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcadf4fc-21d5-4697-a8b5-d4eac74b950a",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "f58e06cd-8192-4fd9-a6f7-028e91aa87c3",
          "name": "ENT-17251",
          "stdName": "ENT-17251",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dcb4164-722c-474c-bac7-860badf0063d",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "9479f525-f6bc-4284-afa2-1c71cb8070db",
          "name": "MENDRIN",
          "stdName": "MENDRIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12807da7-8ff7-47d9-8e2d-86cffae89a80",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "85f0f8ce-741d-4464-9b3d-0503df1da347",
          "name": "NENDRIN",
          "stdName": "NENDRIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dcb4164-722c-474c-bac7-860badf0063d",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        },
        {
          "uuid": "1fb3fa04-e5b3-4605-a8c5-f6acacacddad",
          "name": "NSC-8935",
          "stdName": "NSC-8935",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29",
            "9392434d-1860-4b18-88d8-aba8d43b8053"
          ],
          "display_name": false
        },
        {
          "uuid": "54bc5698-1319-4490-ac21-810dc681865d",
          "name": "SD-3419",
          "stdName": "SD-3419",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dcb4164-722c-474c-bac7-860badf0063d",
            "d9bd4015-1b16-4ce2-9faf-2fa447ceed29"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1a6a861d-94be-444e-a941-18befe26b7ae",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d9bd4015-1b16-4ce2-9faf-2fa447ceed29",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12807da7-8ff7-47d9-8e2d-86cffae89a80",
          "citation": "SITTIGS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dcb4164-722c-474c-bac7-860badf0063d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcadf4fc-21d5-4697-a8b5-d4eac74b950a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a9b9896-021a-40aa-b6c3-96ab3b5c24cb",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce5597ee-3378-48f0-b998-2ebe32294df5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc729bb1-db49-4bf3-bba2-48a6f409c61a",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9392434d-1860-4b18-88d8-aba8d43b8053",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4da7319d-fe35-4967-afa2-f8f78fad7d97",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecc282ca-cfe2-4a60-89a4-3224ddab961f",
          "citation": "SRS import [OB9NVE7YCL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OB9NVE7YCL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5834089d-fd85-4e7e-883c-0c68f996ef6a",
          "citation": "ENDRIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "42ab85fe-1e97-4132-9c76-a986109a7a85",
          "citation": "ENDRIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76e4d359-aa5c-4181-aca6-a8ef9f064afe",
          "citation": "ENDRIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5d97397-79f1-4510-ba99-5fcec5a93e97",
          "citation": "ENDRIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4897ad64-4d5f-7384-1387-fe9f7eb137bf",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+72-20-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4dc55418-746c-5178-4abb-f1adeb0eb549",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72-20-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0e644239-77b0-feec-2bbd-13c9fb4b591f",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "73294a7a-8885-3ff1-7022-dd79b17deeb6",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "72d003d4-13d7-4146-bccc-932c0dea910a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b8d224e4-7fd3-6443-5d66-2d54b202a28d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b253bf7b-7aea-0299-7942-da081043ff07",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1cd4f3c7-717a-65f0-d908-2148d4f35717",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4438a2a2-2afe-4016-adbf-597a05c6d3f8",
          "id": "4438a2a2-2afe-4016-adbf-597a05c6d3f8",
          "molfile": "\n  Marvin  01132103362D          \n\n 19 23  0  0  0  0            999 V2000\n    7.5333   -2.9208    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.2541   -3.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5458   -3.7500    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8333   -4.1542    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.2958   -3.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8333   -2.5042    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.1250   -2.9250    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.1250   -3.7500    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4083   -4.1542    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4000   -4.9792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7000   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9833   -4.1542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7000   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9833   -2.5125    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4083   -2.5042    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.4000   -1.6792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7958   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5750   -2.0792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9250   -3.2917    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  3  2  1  1  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  8  4  1  6  0  0  0\n  6  5  1  1  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n  9 17  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
          "smiles": "C1[C@H]2[C@H]3[C@@H]([C@@H]1[C@@H]4[C@H]2O4)[C@]5(C(=C([C@@]3(C5(Cl)Cl)Cl)Cl)Cl)Cl",
          "formula": "C12H8Cl6O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94e9c1ce-8486-4077-be49-c2fbe83db80b"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "380.9094",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5efebdf1-89a6-4261-b385-9edaad05f15a",
      "version": "13",
      "structure": {
        "id": "436b18e0-e6d0-4a33-8fdb-b90738707971",
        "molfile": "\n  Marvin  01132103332D          \n\n 21 25  0  0  1  0            999 V2000\n    5.4083   -4.1542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4083   -2.5042    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7958   -3.2917    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7000   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7000   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5333   -2.9208    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5458   -3.7500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2541   -3.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1250   -3.7500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1250   -2.9250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.8333   -2.5042    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.8333   -4.1542    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2958   -3.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4000   -1.6792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4000   -4.9792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5750   -2.0792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9250   -3.2917    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9833   -4.1542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9833   -2.5125    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1208   -4.5750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1208   -2.1000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  1  0  0  0\n  1  3  1  1  0  0  0\n  4  1  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14  2  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17  3  1  0  0  0  0\n 18  4  1  0  0  0  0\n 19  5  1  0  0  0  0\n  9 20  1  1  0  0  0\n 10 21  1  1  0  0  0\n  2  5  1  0  0  0  0\n  2 10  1  0  0  0  0\n 11 13  1  1  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  1  0  0  0\nM  END",
        "smiles": "C1[C@H]2[C@@]3([H])[C@@]([H])([C@@H]1[C@@H]4[C@H]2O4)[C@]5(C(=C([C@@]3(C5(Cl)Cl)Cl)Cl)Cl)Cl",
        "formula": "C12H8Cl6O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "380.9094",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ecc282ca-cfe2-4a60-89a4-3224ddab961f",
          "1dcb4164-722c-474c-bac7-860badf0063d"
        ],
        "stereo_centers": 8
      },
      "unii": "OB9NVE7YCL"
    }
  ]
}