{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b4b85ce2-a9dd-48f5-af46-86a4fe5250cb",
          "code": "132866-11-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=132866-11-6",
          "code_system": "CAS",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e",
            "7f91ca91-281d-4ffa-a83e-f2b7eea8cb50"
          ]
        },
        {
          "uuid": "3404a78f-e126-42c6-9ac2-ac781e5efbc0",
          "code": "C87685",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87685",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "34e63b8a-183f-4a6e-8192-be326b1e4f6a",
          "code": "C060343",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67060343",
          "code_system": "MESH",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "e9f87a39-9ed5-4505-8e9e-9a6d83da749b",
          "code": "153679",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/153679/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "00745648-25e1-4fe7-80a4-0797fc3c89ce",
          "code": "m6770",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6770?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "c17eef1e-f8c2-430a-ae3e-23b7d200103c",
          "code": "SUB02894MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "8f230842-d7ef-426c-ae37-07233d4dac2f",
          "code": "CHEMBL250270",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL250270",
          "code_system": "ChEMBL",
          "references": [
            "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e"
          ]
        },
        {
          "uuid": "a19946f4-7abc-1323-8bad-6ae2f8a77f39",
          "code": "DTXSID3046665",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3046665",
          "code_system": "EPA CompTox",
          "references": [
            "54b3a77a-fa36-6607-5d12-2119dfc2a293"
          ]
        },
        {
          "uuid": "b2dd826d-43e5-0e22-9ef3-ad8bf6298767",
          "code": "C333",
          "comments": "Pharmacologic Substance[C1909]|Cation Channel Blocker[C93038]|Calcium Channel Blocker",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C333",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8d2fc0a3-ec81-2f7f-5ad4-136c936e8752"
          ]
        },
        {
          "uuid": "e7a46882-cb73-4a82-43c3-3c98e384d98f",
          "code": "157917",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/157917",
          "code_system": "PUBCHEM",
          "references": [
            "1805fb25-3d6b-4255-f3d3-edf663d83223"
          ]
        },
        {
          "uuid": "024af71e-8f9b-4e68-82f4-aabb00b32cb1",
          "code": "OA8TFX68PE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b1ca84ca-c612-f843-8fe6-ff944d1ac0cc",
          "code": "100000091632",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a4cfcfde-b615-87e7-f7b7-ff6f2029cf2a"
          ]
        },
        {
          "uuid": "ada28ab7-a5ec-65e3-e254-039e0891f319",
          "code": "OO-76",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/OO-76/relevant/1/",
          "code_system": "USAN",
          "references": [
            "1913afbe-6231-0c65-880d-8d55344e261b"
          ]
        },
        {
          "uuid": "e859c777-6495-455f-869c-a04fbae4ed01",
          "code": "100427-27-8",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=100427-27-8",
          "code_system": "CAS",
          "references": [
            "edf6cde0-2532-4511-a6ce-691b7d5559d5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "51019cc0-538e-4f91-b1f8-6e205e26357a",
          "amount": {
            "uuid": "eef41de2-e85f-43cc-a33c-343086316570"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "60547391-a823-45aa-8af9-67865287bc09",
            "refuuid": "cb0b4eda-71be-4b01-a1c8-a7b2a021b548",
            "name": "LERCANIDIPINE",
            "unii": "V7XTJ4R0BH",
            "linking_id": "V7XTJ4R0BH",
            "ref_pname": "LERCANIDIPINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8a369ff6-d146-4fac-b01f-05a3b022ae9e",
          "amount": {
            "uuid": "79dc86c2-290a-4605-8b51-03072b86a68b"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0e90808a-31b9-4507-af01-3eeef52991f9",
            "refuuid": "cb0b4eda-71be-4b01-a1c8-a7b2a021b548",
            "name": "LERCANIDIPINE",
            "unii": "V7XTJ4R0BH",
            "linking_id": "V7XTJ4R0BH",
            "ref_pname": "LERCANIDIPINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "703df7f2-7d5e-4c44-9ad1-fe96a05cbb83",
          "amount": {
            "uuid": "68a7b58b-3744-41ac-8ac6-43ecf9fbb352"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "2ed26c7c-bc14-4eb5-9f6d-1dc44e51bd9f",
            "refuuid": "f178b60d-596c-4973-9c37-3dc69771ceeb",
            "name": "LERCANIDIPINE HYDROCHLORIDE, (R)-",
            "unii": "E9V8K0B0F0",
            "linking_id": "E9V8K0B0F0",
            "ref_pname": "LERCANIDIPINE HYDROCHLORIDE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "13fcbe2b-f25e-474d-9bbe-bec56571e8c4",
          "amount": {
            "uuid": "fdedec89-e362-4868-a626-ba70c5d14518"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "767ec3a3-312f-4ccb-83b3-7b9a280fb4b6",
            "refuuid": "4c0146aa-683a-413c-b441-067bb124817d",
            "name": "LERCANIDIPINE HYDROCHLORIDE, (S)-",
            "unii": "4613R830EU",
            "linking_id": "4613R830EU",
            "ref_pname": "LERCANIDIPINE HYDROCHLORIDE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb9e4119-9a80-423a-9fa3-302ab7521fd8",
          "amount": {
            "uuid": "816c8f2e-37ed-4ac8-aeef-6b52d75cc497"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "edf6cde0-2532-4511-a6ce-691b7d5559d5"
          ],
          "related_substance": {
            "uuid": "1c5edf66-3067-4d06-9503-4cec7f4f31a0",
            "refuuid": "a6e1eb0c-f397-497b-a1b4-a0607fc168d4",
            "name": "LERCANIDIPINE HYDROCHLORIDE HEMIHYDRATE",
            "unii": "9YZG49F7RC",
            "linking_id": "9YZG49F7RC",
            "ref_pname": "LERCANIDIPINE HYDROCHLORIDE HEMIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1736c1b1-f56a-4f53-b1b5-c1f868d4f762",
          "name": "2-[(3,3-Diphenylpropyl)methylamino]-1,1-dimethylethyl methyl (4RS)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate monohydrochloride",
          "stdName": "2-((3,3-DIPHENYLPROPYL)METHYLAMINO)-1,1-DIMETHYLETHYL METHYL (4RS)-2,6-DIMETHYL-4-(3-NITROPHENYL)-1,4-DIHYDROPYRIDINE-3,5-DICARBOXYLATE MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4089a4c9-8cbc-403d-a407-1ae63ad9cb60"
          ],
          "display_name": false
        },
        {
          "uuid": "51eaaaf4-2e88-4f70-a912-1fbbd7106770",
          "name": "3,5-PYRIDINEDICARBOXYLIC ACID, 1,4-DIHYDRO-2,6-DIMETHYL-4-(3-NITROPHENYL)-, 2-((3,3-DIPHENYLPROPYL)METHYLAMINO)-1,1-DIMETHYLETHYL METHYL ESTER, MONOHYDROCHLORIDE",
          "stdName": "3,5-PYRIDINEDICARBOXYLIC ACID, 1,4-DIHYDRO-2,6-DIMETHYL-4-(3-NITROPHENYL)-, 2-((3,3-DIPHENYLPROPYL)METHYLAMINO)-1,1-DIMETHYLETHYL METHYL ESTER, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb5ff715-9fc4-45a3-ba6d-a2e72d8463d3"
          ],
          "display_name": false
        },
        {
          "uuid": "c46a8167-aa59-4a4e-8c63-ed15ba375b78",
          "name": "CARDIOVASC",
          "stdName": "CARDIOVASC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c49e9a71-11c6-464d-afa9-9909af85298b",
            "2e904c0c-aa64-4f47-a5f3-f393621f5691"
          ],
          "display_name": false
        },
        {
          "uuid": "6fd18cbc-ddb5-476c-9ecb-b4c6c66f29d8",
          "name": "LERCANIDIPINE HCL",
          "stdName": "LERCANIDIPINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57f5b233-526e-4382-9518-890f8ea1f41a"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5c94b0-242c-4847-a347-02afaa24a07d",
          "name": "LERCANIDIPINE HYDROCHLORIDE",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea7cc8bd-a7ff-4d87-a389-429095328bd7",
            "4bf07056-49da-4847-833b-11232c80cb65",
            "d9139180-9649-4164-9a74-5a0764da8b64",
            "3f98909e-4574-4dc2-a871-cf7f60ec96c4",
            "27569e8f-3677-43c8-826f-0c34d3ddc01f",
            "b6f126a9-4c75-4abb-91f1-b4aa9a2abc76",
            "c5ba736f-e882-4f1c-9d43-074a0ae49311",
            "e9bca53b-8237-447b-a476-982673e1a596",
            "5f69839b-6f46-4f46-8de5-b2ba37d9b3fc",
            "37d2ec71-af47-4c8c-b6a4-406e465b6a49",
            "2e904c0c-aa64-4f47-a5f3-f393621f5691",
            "2bf60d47-4187-463f-9ea5-d8ea83abaa5d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b86e9a6a-eba6-454b-92cb-913813e5c20c",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "069c6c27-0700-4599-8574-94b1baa53d9d",
          "name": "LERCANIDIPINE HYDROCHLORIDE [JAN]",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e904c0c-aa64-4f47-a5f3-f393621f5691",
            "2bf60d47-4187-463f-9ea5-d8ea83abaa5d"
          ],
          "display_name": false
        },
        {
          "uuid": "1eb5742b-d746-4ca8-ae8c-79e1a355b17e",
          "name": "LERCANIDIPINE HYDROCHLORIDE [MART.]",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9bca53b-8237-447b-a476-982673e1a596"
          ],
          "display_name": false
        },
        {
          "uuid": "25587bc7-4c18-4795-a935-7d917ec67869",
          "name": "LERCANIDIPINE HYDROCHLORIDE [MI]",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea7cc8bd-a7ff-4d87-a389-429095328bd7",
            "2bf60d47-4187-463f-9ea5-d8ea83abaa5d"
          ],
          "display_name": false
        },
        {
          "uuid": "b13a56bb-bcca-4635-938a-db2e1bbb0a6b",
          "name": "LERCANIDIPINE HYDROCHLORIDE [USAN]",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bf07056-49da-4847-833b-11232c80cb65"
          ],
          "display_name": false
        },
        {
          "uuid": "062318f8-0b6f-7546-ef0e-3d377bea5208",
          "name": "Lercanidipine hydrochloride [WHO-DD]",
          "stdName": "LERCANIDIPINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6df90970-97f4-cfd0-8bd7-660545d3d5f6"
          ],
          "display_name": false
        },
        {
          "uuid": "4fd71115-f4ae-4f1d-a706-2931ffd580ef",
          "name": "REC-15/2375",
          "stdName": "REC-15/2375",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4089a4c9-8cbc-403d-a407-1ae63ad9cb60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8692dd60-bda3-4952-8de3-dc7a707fec69",
          "citation": "SRS import [OA8TFX68PE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=OA8TFX68PE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6f126a9-4c75-4abb-91f1-b4aa9a2abc76",
          "citation": "LERCANIDIPINE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f98909e-4574-4dc2-a871-cf7f60ec96c4",
          "citation": "LERCANIDIPINE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9139180-9649-4164-9a74-5a0764da8b64",
          "citation": "LERCANIDIPINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37d2ec71-af47-4c8c-b6a4-406e465b6a49",
          "citation": "LERCANIDIPINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "27569e8f-3677-43c8-826f-0c34d3ddc01f",
          "citation": "LERCANIDIPINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f69839b-6f46-4f46-8de5-b2ba37d9b3fc",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4089a4c9-8cbc-403d-a407-1ae63ad9cb60",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb5ff715-9fc4-45a3-ba6d-a2e72d8463d3",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57f5b233-526e-4382-9518-890f8ea1f41a",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bf07056-49da-4847-833b-11232c80cb65",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e904c0c-aa64-4f47-a5f3-f393621f5691",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bf60d47-4187-463f-9ea5-d8ea83abaa5d",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9bca53b-8237-447b-a476-982673e1a596",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c49e9a71-11c6-464d-afa9-9909af85298b",
          "citation": "D01849",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5ba736f-e882-4f1c-9d43-074a0ae49311",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea7cc8bd-a7ff-4d87-a389-429095328bd7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fdb3cfe-a47e-40bf-8688-d5a4c2533a0e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54b3a77a-fa36-6607-5d12-2119dfc2a293",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=132866-11-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d2fc0a3-ec81-2f7f-5ad4-136c936e8752",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e6762885-8213-0d29-2a76-6948e6be737d",
          "citation": "USAN COUN 2002",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f91ca91-281d-4ffa-a83e-f2b7eea8cb50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1913afbe-6231-0c65-880d-8d55344e261b",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "1805fb25-3d6b-4255-f3d3-edf663d83223",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6df90970-97f4-cfd0-8bd7-660545d3d5f6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b16b3cb8-10b7-0fd8-0d67-33480741326c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "edf6cde0-2532-4511-a6ce-691b7d5559d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4cfcfde-b615-87e7-f7b7-ff6f2029cf2a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2bdd1a83-9779-4550-8826-46db412813a9",
          "id": "2bdd1a83-9779-4550-8826-46db412813a9",
          "molfile": "\n  Marvin  01132102222D          \n\n  1  0  0  0  0  0            999 V2000\n    9.7502   -2.2207    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8560a204-8e37-4646-95bf-b6a0d11c6882"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b6a7e42e-a043-49a0-bddf-1382d554249f",
          "id": "b6a7e42e-a043-49a0-bddf-1382d554249f",
          "molfile": "\n  Marvin  01132109272D          \n\n 45 48  0  0  0  0            999 V2000\n   -2.6718   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9615   -2.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -1.4007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5358   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5358   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894   -3.8806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9023   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9023   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.1894   -1.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4660   -1.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4660   -0.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894    0.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8474   -0.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8474   -1.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5578    0.1346    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.2706   -0.2692    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.5578    0.9620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -1.4007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3279   -2.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0408   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6270   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4544   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7560   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4764   -2.2282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4764   -1.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1917   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9020   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3301   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0479   -2.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7608   -2.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7533   -1.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0305   -0.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3201   -1.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -3.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -4.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -4.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9618   -4.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9618   -3.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 12  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 22 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 28 25  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 40 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 39 34  2  0  0  0  0\n 36 35  2  0  0  0  0\n 37 36  1  0  0  0  0\n 37 38  2  0  0  0  0\n 38 39  1  0  0  0  0\n 41 40  1  0  0  0  0\n 45 40  2  0  0  0  0\n 42 41  2  0  0  0  0\n 43 42  1  0  0  0  0\n 43 44  2  0  0  0  0\n 44 45  1  0  0  0  0\nM  CHG  2  19   1  20  -1\nM  END",
          "smiles": "CC1=C(C(c2cccc(c2)[N+](=O)[O-])C(=C(C)N1)C(=O)OC(C)(C)CN(C)CCC(c3ccccc3)c4ccccc4)C(=O)OC",
          "formula": "C36H41N3O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1b1b5716-3441-47d7-b187-1b4964682002"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "611.7286",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f1c2a23c-5cc7-4a2e-aedb-de2993e21105",
      "version": "20",
      "structure": {
        "id": "d9588fce-cfa7-428f-b07c-8cb4ef9d20db",
        "molfile": "\n  Marvin  01132111162D          \n\n 46 48  0  0  0  0            999 V2000\n    0.9023   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5358   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9023   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5358   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894   -3.8806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5578    0.1346    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.1894   -1.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8474   -0.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3279   -2.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8474   -1.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2706   -0.2692    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0408   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5578    0.9620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -1.4007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9020   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -1.4007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3301   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7560   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4764   -2.2282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1917   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9615   -2.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2462   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6151   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4660   -1.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1894    0.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4660   -0.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -3.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0479   -2.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3201   -1.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9618   -3.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4764   -1.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6718   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7608   -2.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0305   -0.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9618   -4.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2703   -4.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7533   -1.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -4.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6270   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4544   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7502   -2.2207    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  7  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8 11  1  0  0  0  0\n  3  9  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17  8  2  0  0  0  0\n 18  6  2  0  0  0  0\n 19 25  1  0  0  0  0\n 20 10  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 15  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 10  1  0  0  0  0\n 27  5  1  0  0  0  0\n 28  4  1  0  0  0  0\n 29  9  2  0  0  0  0\n 30 31  2  0  0  0  0\n 31 29  1  0  0  0  0\n 32 22  2  0  0  0  0\n 33 21  2  0  0  0  0\n 34 21  1  0  0  0  0\n 35 22  1  0  0  0  0\n 36 24  1  0  0  0  0\n 37 26  1  0  0  0  0\n 38 33  1  0  0  0  0\n 39 34  2  0  0  0  0\n 40 35  2  0  0  0  0\n 41 32  1  0  0  0  0\n 42 39  1  0  0  0  0\n 43 41  2  0  0  0  0\n  2  5  2  0  0  0  0\n 30 11  1  0  0  0  0\n 43 40  1  0  0  0  0\n 42 38  2  0  0  0  0\n 15 44  1  0  0  0  0\n 15 45  1  0  0  0  0\n  2  3  1  0  0  0  0\nM  CHG  2   8   1  14  -1\nM  END",
        "smiles": "CC1=C(C(c2cccc(c2)[N+](=O)[O-])C(=C(C)N1)C(=O)OC(C)(C)CN(C)CCC(c3ccccc3)c4ccccc4)C(=O)OC.Cl",
        "formula": "C36H41N3O6.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "648.1895",
        "optical_activity": "( + / - )",
        "references": [
          "8692dd60-bda3-4952-8de3-dc7a707fec69",
          "4089a4c9-8cbc-403d-a407-1ae63ad9cb60"
        ],
        "stereo_centers": 1
      },
      "unii": "OA8TFX68PE"
    }
  ]
}