{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4020d782-8739-4782-ab36-45f7c9269d1f",
          "code": "921-53-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=921-53-9",
          "code_system": "CAS",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e",
            "8c745101-3aef-400c-b653-1b12f49831a8"
          ]
        },
        {
          "uuid": "12037772-2bb3-4c7f-92a3-dc8878bed756",
          "code": "C029768",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67029768",
          "code_system": "MESH",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "1a1dd2c7-0145-435a-817c-5b323216d276",
          "code": "POTASSIUM TARTRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Potassium_tartrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "9ad0f7eb-7af7-487a-8eba-8ab6d0a63b0e",
          "code": "INS-336(II)",
          "comments": "Codex Alimentarius|Functional Classification|Acidity regulator|Emulsifying salt|Sequestrant|Stabilizer",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=167",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "085c834b-1e3f-4564-9ce9-54eea7c81c64",
          "code": "INS-336(II)",
          "comments": "JECFA|Functional Classification|SEQUESTRANT|STABILIZER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=336(ii)",
          "code_system": "JECFA EVALUATION",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "5f74d079-b5a0-4c1d-8a2b-127ee043c160",
          "code": "213-067-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.880",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "619cd92d-0ce7-4554-911a-da43ce3fa2f8",
          "code": "55024",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/55024/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "168f88d0-f60c-49f7-9f52-a44a2786d3d7",
          "code": "m9066",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9066?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "30d8cb65-bd03-4ba9-8282-a5ad546c31a0",
          "code": "SUB22598",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "d6643e2b-d9d1-442d-af83-508401bf681c",
          "code": "8984",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8984",
          "code_system": "PUBCHEM",
          "references": [
            "3e9d86a7-c881-48f6-b4fa-91424e147b3e"
          ]
        },
        {
          "uuid": "a72e72f7-d043-4cf3-93b4-1e2d26690b23",
          "code": "O9WLL1ZL8S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f785db3b-eff6-b7bd-87d0-61ac07b05483",
          "code": "63018",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:63018",
          "code_system": "CHEBI",
          "references": [
            "b50c6918-0bc0-f256-dfc4-5e91ef5864c7"
          ]
        },
        {
          "uuid": "d4381e84-a702-578d-3390-30d00c2770d6",
          "code": "O9WLL1ZL8S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=O9WLL1ZL8S",
          "code_system": "DAILYMED",
          "references": [
            "8a607621-7c6c-a8d7-e4c2-51da83e8609f"
          ]
        },
        {
          "uuid": "0fadcbb7-9cab-b22a-d863-31f760f64137",
          "code": "DTXSID90889442",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90889442",
          "code_system": "EPA CompTox",
          "references": [
            "b50c6918-0bc0-f256-dfc4-5e91ef5864c7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8669d624-c33f-4d03-b9ea-3194f8f27e93",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "7158832f-f796-45cb-8065-fc4c33122078",
            "refuuid": "9e65d0a0-88fc-46ac-bd17-7204cdea03e9",
            "name": "Tartaric Acid",
            "unii": "W4888I119H",
            "linking_id": "W4888I119H",
            "ref_pname": "Tartaric Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "87527e3e-b48e-050b-9c1f-2252676e3496",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "8c745101-3aef-400c-b653-1b12f49831a8"
          ],
          "related_substance": {
            "uuid": "8ba3b984-c932-4d50-8640-4906795afa5e",
            "refuuid": "04036401-366e-4ea7-863e-31dc6e5d0b85",
            "name": "POTASSIUM TARTRATE HEMIHYDRATE",
            "unii": "GM5EY0N07D",
            "linking_id": "GM5EY0N07D",
            "ref_pname": "POTASSIUM TARTRATE HEMIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "862a2997-1d32-4893-afd6-752e7cfb1e1e",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, DIPOTASSIUM SALT",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, DIPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "6d1e090d-664a-444b-9de2-4b896309fee6"
          ],
          "display_name": false
        },
        {
          "uuid": "ae49a10e-a538-4186-b3c2-3e03dfda98ed",
          "name": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, POTASSIUM SALT (1:2)",
          "stdName": "BUTANEDIOIC ACID, 2,3-DIHYDROXY- (2R,3R)-, POTASSIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "6d1e090d-664a-444b-9de2-4b896309fee6"
          ],
          "display_name": false
        },
        {
          "uuid": "f8868081-0855-4948-ba8e-7f2e0fe6c96f",
          "name": "DIPOTASSIUM L-(+)-TARTRATE",
          "stdName": "DIPOTASSIUM L-(+)-TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "6d1e090d-664a-444b-9de2-4b896309fee6"
          ],
          "display_name": false
        },
        {
          "uuid": "36b4f626-bcf3-4ba8-911c-d4a244fc16cc",
          "name": "DIPOTASSIUM L-TARTRATE",
          "stdName": "DIPOTASSIUM L-TARTRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "6d1e090d-664a-444b-9de2-4b896309fee6"
          ],
          "display_name": false
        },
        {
          "uuid": "9a376f02-dd64-45e0-8837-2877f4989f53",
          "name": "DIPOTASSIUM TARTRATE (336(II))",
          "stdName": "DIPOTASSIUM TARTRATE (336(II))",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0322f7ef-868e-45e2-a7c1-a39e7a9e46e8",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e"
          ],
          "display_name": false
        },
        {
          "uuid": "9913114d-5955-4720-87dd-397f135a5560",
          "name": "E-336(II)",
          "stdName": "E-336(II)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0322f7ef-868e-45e2-a7c1-a39e7a9e46e8",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e"
          ],
          "display_name": false
        },
        {
          "uuid": "8326f769-fd78-4cb3-8bac-8af5c4cbba8f",
          "name": "INS NO.336(II)",
          "stdName": "INS NO.336(II)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0322f7ef-868e-45e2-a7c1-a39e7a9e46e8",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e"
          ],
          "display_name": false
        },
        {
          "uuid": "d2c95cf8-ddfa-46f3-8256-dbaea700a478",
          "name": "INS-336(II)",
          "stdName": "INS-336(II)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0322f7ef-868e-45e2-a7c1-a39e7a9e46e8",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e"
          ],
          "display_name": false
        },
        {
          "uuid": "e7c2090a-503e-4fca-a8ce-54b4ab6a93a8",
          "name": "POTASSIUM TARTRATE",
          "stdName": "POTASSIUM TARTRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77d21594-8718-4b18-9b5b-776946169e0a",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "bd0702e3-17ae-4940-a954-c055f3ee1e44",
            "7c53d023-339c-46a6-886e-0388653ed726",
            "1349dcd7-fc05-4473-9812-e33a1ee6c7b1",
            "564077df-1901-44a2-9066-daa155335f0e",
            "0a5abd8b-4034-486f-b300-2a875eb56d62",
            "e576e428-79c9-4c6b-8792-ceefacda622b",
            "2a5969cc-19a7-4189-91d6-1898ae624604",
            "f7aef5ec-0344-4af2-a7f3-4c8113af9415"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8035ed7e-8b34-402b-9784-a94b57f20e46",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d9464447-6b32-48e2-a7c3-f8b729ec8435",
          "name": "POTASSIUM TARTRATE [MART.]",
          "stdName": "POTASSIUM TARTRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "564077df-1901-44a2-9066-daa155335f0e"
          ],
          "display_name": false
        },
        {
          "uuid": "00128c6d-95ce-4cff-93d6-4b264722b5a9",
          "name": "POTASSIUM TARTRATE [MI]",
          "stdName": "POTASSIUM TARTRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77d21594-8718-4b18-9b5b-776946169e0a",
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e"
          ],
          "display_name": false
        },
        {
          "uuid": "0fc8c757-e040-e157-86e8-bf5d63cc60fc",
          "name": "Potassium Tartrate [WHO-DD]",
          "stdName": "POTASSIUM TARTRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51eae6e6-42b3-57a9-8dd7-9704ae8e33c2"
          ],
          "display_name": false
        },
        {
          "uuid": "b354e77a-116a-487d-9ff2-51ff34f7e0ab",
          "name": "SOLUBLE TARTAR",
          "stdName": "SOLUBLE TARTAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
            "1349dcd7-fc05-4473-9812-e33a1ee6c7b1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1349dcd7-fc05-4473-9812-e33a1ee6c7b1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d2a401bb-ea59-4117-a0b8-a3fdc4b4d35e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "564077df-1901-44a2-9066-daa155335f0e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77d21594-8718-4b18-9b5b-776946169e0a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a5abd8b-4034-486f-b300-2a875eb56d62",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c53d023-339c-46a6-886e-0388653ed726",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0322f7ef-868e-45e2-a7c1-a39e7a9e46e8",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=167",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=167",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d1e090d-664a-444b-9de2-4b896309fee6",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e9d86a7-c881-48f6-b4fa-91424e147b3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0e432ce-46f0-455b-b32d-9392167751d2",
          "citation": "SRS import [O9WLL1ZL8S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O9WLL1ZL8S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd0702e3-17ae-4940-a954-c055f3ee1e44",
          "citation": "POTASSIUM TARTRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a5969cc-19a7-4189-91d6-1898ae624604",
          "citation": "POTASSIUM TARTRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f7aef5ec-0344-4af2-a7f3-4c8113af9415",
          "citation": "POTASSIUM TARTRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e576e428-79c9-4c6b-8792-ceefacda622b",
          "citation": "POTASSIUM TARTRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c745101-3aef-400c-b653-1b12f49831a8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b50c6918-0bc0-f256-dfc4-5e91ef5864c7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "51eae6e6-42b3-57a9-8dd7-9704ae8e33c2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8a607621-7c6c-a8d7-e4c2-51da83e8609f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d286070d-5b01-4e95-804e-0bcae2439ee7",
          "id": "d286070d-5b01-4e95-804e-0bcae2439ee7",
          "molfile": "\n  Marvin  01132110532D          \n\n  1  0  0  0  1  0            999 V2000\n    8.1585   -2.2839    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "37bbd32c-0f64-4e51-96e8-0711446a22dc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "799b1399-26fa-49f3-8051-df230596448a",
          "id": "799b1399-26fa-49f3-8051-df230596448a",
          "molfile": "\n  Marvin  01132106192D          \n\n 10  9  0  0  1  0            999 V2000\n    4.8099   -2.7265    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.8057   -3.5532    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0960   -2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3820   -2.7265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0918   -1.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -2.3132    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.5197   -1.4865    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2379   -2.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9519   -2.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2337   -3.5532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  2   2  -1   7  -1\nM  END",
          "smiles": "[C@@H]([C@H](C(=O)O)[O-])(C(=O)O)[O-]",
          "formula": "C4H4O6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "974275e5-d062-48bd-996b-fdf26fd5318a"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "148.0711",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4449698b-7f25-4a54-a089-d7c80d0a8b80",
      "version": "10",
      "structure": {
        "id": "56b3eaf8-581d-4f2c-b630-68e4bdf1527d",
        "molfile": "\n  Marvin  01132104302D          \n\n 12  9  0  0  1  0            999 V2000\n    8.1585   -2.2839    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n    3.3820   -2.7265    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0960   -2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8099   -2.7265    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5239   -2.3132    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2379   -2.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9519   -2.3132    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0918   -1.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2337   -3.5532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5197   -1.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8057   -3.5532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1585   -2.2839    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  6  9  2  0  0  0  0\n  5 10  1  1  0  0  0\n  4  5  1  0  0  0  0\n  4 11  1  1  0  0  0\nM  CHG  4   1   1   2  -1   7  -1  12   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1  12\nM  SPA   1  1   1\nM  SDI   1  4    7.7385   -2.7039    7.7385   -1.8639\nM  SDI   1  4    8.5785   -1.8639    8.5785   -2.7039\nM  SMT   1 2\nM  END",
        "smiles": "[C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O.[K+].[K+]",
        "formula": "C4H4O6.2K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "226.2677",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b0e432ce-46f0-455b-b32d-9392167751d2",
          "1349dcd7-fc05-4473-9812-e33a1ee6c7b1"
        ],
        "stereo_centers": 2
      },
      "unii": "O9WLL1ZL8S"
    }
  ]
}