{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ff622d3a-74d4-4b03-9949-2b7e90d2ef39",
          "code": "5302-45-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5302-45-4",
          "code_system": "CAS",
          "references": [
            "8eaeb9b9-0018-4d36-bda6-db0131e6617f",
            "2bd4a68c-f7d1-49be-aa37-375c87f76060"
          ]
        },
        {
          "uuid": "e15d74b2-1de9-4cf1-b43d-0562e773db66",
          "code": "440259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440259",
          "code_system": "PUBCHEM",
          "references": [
            "8eaeb9b9-0018-4d36-bda6-db0131e6617f"
          ]
        },
        {
          "uuid": "b92a69a3-1d91-72f6-3e73-6dcde6073a9e",
          "code": "Dencichin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dencichin",
          "code_system": "WIKIPEDIA",
          "references": [
            "b57bdc6b-5b7f-b197-a6bb-4c5697e2e1b2"
          ]
        },
        {
          "uuid": "9f801e4f-8e55-4326-9347-4de5cf946045",
          "code": "O8VT5BZ48B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "92c8eb60-42d1-a280-b151-7551f7e18c58",
          "code": "16399",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16399",
          "code_system": "CHEBI",
          "references": [
            "12da3c86-a3b0-d780-f37b-98c8be9d639c"
          ]
        },
        {
          "uuid": "0a9c56be-50d2-e8fe-1734-24e91353c2a0",
          "code": "DTXSID90967517",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90967517",
          "code_system": "EPA CompTox",
          "references": [
            "12da3c86-a3b0-d780-f37b-98c8be9d639c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a601f706-2f0a-44e4-a584-e5ab6c87c90e",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "3eea99c2-0fa0-4a10-8d8a-80c087e73c4c",
            "refuuid": "19241c41-71b4-4eaa-8679-fd9297c9a93f",
            "name": "PANAX NOTOGINSENG ROOT",
            "unii": "GQX1C1175U",
            "linking_id": "GQX1C1175U",
            "ref_pname": "PANAX NOTOGINSENG ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e882f16-fbb8-40ac-986c-2ff8cece8432",
          "name": "3-((CARBOXYCARBONYL)AMINO)-L-ALANINE",
          "stdName": "3-((CARBOXYCARBONYL)AMINO)-L-ALANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "7e3bb30d-c6d5-4bd1-a25d-09623d9d2445"
          ],
          "display_name": false
        },
        {
          "uuid": "bc6aeb49-0ae8-4586-9b65-bce69ef9770d",
          "name": "3-((CARBOXYCARBONYL)AMINO)ALANINE, L-",
          "stdName": "3-((CARBOXYCARBONYL)AMINO)ALANINE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "e77eff39-ef3c-4428-bc6e-00aad5ecc28e"
          ],
          "display_name": false
        },
        {
          "uuid": "137b48c5-dbd9-44df-b12d-45f062d5399b",
          "name": "3-N-OXALYL-L-2,3-DIAMINOPROPANOIC ACID",
          "stdName": "3-N-OXALYL-L-2,3-DIAMINOPROPANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        },
        {
          "uuid": "72355ea3-958d-468a-b6ee-67ade85e0c5e",
          "name": "BOAA",
          "stdName": "BOAA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        },
        {
          "uuid": "1bfb1bff-0fb2-4d7a-b2ec-7bf37c851d16",
          "name": "DENCICHIN",
          "stdName": "DENCICHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": true
        },
        {
          "uuid": "d074544f-e8f1-4277-9ca0-b73872f12861",
          "name": "DENCICHINE",
          "stdName": "DENCICHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "94d8538b-b29e-4d16-8a66-734edb0f79d0"
          ],
          "display_name": false
        },
        {
          "uuid": "ee08dd12-7434-4450-868f-59dc169399ff",
          "name": "L-ALANINE, 3-((CARBOXYCARBONYL)AMINO)-",
          "stdName": "L-ALANINE, 3-((CARBOXYCARBONYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        },
        {
          "uuid": "752d8da8-7567-4d30-9eff-11d4cc21e902",
          "name": "L-DENCICHIN",
          "stdName": "L-DENCICHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        },
        {
          "uuid": "54ec64b5-c0f3-4647-80ab-0d6363a826f3",
          "name": "N.BETA.-OXALYLAMINO-L-ALANINE",
          "stdName": "N.BETA.-OXALYLAMINO-L-ALANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        },
        {
          "uuid": "44f6bc92-a884-4a75-ae3a-5c290da74184",
          "name": "OXAMIC ACID, (2-AMINO-2-CARBOXYETHYL)-, L-",
          "stdName": "OXAMIC ACID, (2-AMINO-2-CARBOXYETHYL)-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d3d363c-98f2-49d5-a85f-c95443325e47",
            "66e408da-da9f-4f63-b428-8ec25ee49766"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "66e408da-da9f-4f63-b428-8ec25ee49766",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1d3d363c-98f2-49d5-a85f-c95443325e47",
          "citation": "SPECIALTY CHEMICALS",
          "doc_type": "SPECIALTY CHEMICALS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e3bb30d-c6d5-4bd1-a25d-09623d9d2445",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94d8538b-b29e-4d16-8a66-734edb0f79d0",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e77eff39-ef3c-4428-bc6e-00aad5ecc28e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eaeb9b9-0018-4d36-bda6-db0131e6617f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392719000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "653bbfd1-ddfd-4be6-9ce7-8e2855930a13",
          "citation": "SRS import [O8VT5BZ48B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O8VT5BZ48B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392719000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b57bdc6b-5b7f-b197-a6bb-4c5697e2e1b2",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Dencichin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12da3c86-a3b0-d780-f37b-98c8be9d639c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2bd4a68c-f7d1-49be-aa37-375c87f76060",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0dba0e80-503a-44bb-ad97-55c68d653e70",
          "id": "0dba0e80-503a-44bb-ad97-55c68d653e70",
          "molfile": "\n  Marvin  01132100572D          \n\n 12 11  0  0  1  0            999 V2000\n    0.7280   -1.2234    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.0129   -0.8012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4387   -0.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1538   -1.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8775   -0.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8818    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5883   -1.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5796   -2.0677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3076   -0.8357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -2.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4345   -2.4683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)NC(=O)C(=O)O",
          "formula": "C5H8N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "48b02974-2d95-4bee-bc29-1e9d861d5930"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "176.1276",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f30fd844-66bd-4998-8884-101414486f41",
      "version": "6",
      "structure": {
        "id": "38c50ed0-92dc-4535-9a0f-4d42b3dde22c",
        "molfile": "\n  Marvin  01132103012D          \n\n 12 11  0  0  1  0            999 V2000\n    2.8775   -0.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5883   -1.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -2.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7280   -1.2234    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1538   -1.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4387   -0.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8818    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5796   -2.0677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4345   -2.4683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0129   -0.8012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3076   -0.8357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  7  2  0  0  0  0\n  2  8  2  0  0  0  0\n  2 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  2  0  0  0  0\n  3 12  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4 10  1  1  0  0  0\n  5  6  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H](C(=O)O)N)NC(=O)C(=O)O",
        "formula": "C5H8N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "176.1276",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "653bbfd1-ddfd-4be6-9ce7-8e2855930a13",
          "7e3bb30d-c6d5-4bd1-a25d-09623d9d2445"
        ],
        "stereo_centers": 1
      },
      "unii": "O8VT5BZ48B"
    }
  ]
}