{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c6140d46-dc9a-4f86-89de-66f7e84b3249", "code": "5102-83-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5102-83-0", "code_system": "CAS", "references": [ "198a2090-2738-4e79-948e-32a7c9a77403", "8016ff60-f64d-4c38-a17b-6b179856a98a" ] }, { "uuid": "004af941-c33b-44e9-9c24-4893416fd0e5", "code": "225-822-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.475", "code_system": "ECHA (EC/EINECS)", "references": [ "198a2090-2738-4e79-948e-32a7c9a77403" ] }, { "uuid": "f2d9a411-a5d4-61e4-8dfb-1fcba98c4a19", "code": "DTXSID0029268", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0029268", "code_system": "EPA CompTox", "references": [ "7a3d7d9c-edc4-7238-eed2-e0c3797852b2" ] }, { "uuid": "ca1e1b18-91b2-4a72-9ec4-03301474a7a7", "code": "O8RYS681QI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "cc2afd26-223b-1da3-3185-b95f7bb2321a", "code": "Pigment Yellow 13", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pigment_Yellow_13", "code_system": "WIKIPEDIA", "references": [ "376767fa-3f6a-3595-9a2c-20bdc0dfefc5" ] }, { "uuid": "fc355b3f-f3bb-5f3f-3d9c-c8c3deef052f", "code": "5336", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5336", "code_system": "NSC", "references": [ "6f46486f-991e-ae6b-4dd7-a642e0cb3352" ] } ], "substance_class": "chemical", "names": [ { "uuid": "61d42985-396c-4265-910b-0123a8635a53", "name": "(±)-PIGMENT YELLOW 13", "stdName": "(+/-)-PIGMENT YELLOW 13", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "3fe7ae61-be90-4a84-a9bf-80c7f39a106e" ], "display_name": false }, { "uuid": "8250b908-faf0-42a4-a223-9651a9eae30c", "name": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(2,4-DIMETHYLPHENYL)-3-OXO-", "stdName": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(N-(2,4-DIMETHYLPHENYL)-3-OXO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "7e4edee0-8fa1-4e7e-87b1-b764b66582a3", "name": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(AZO))BIS(N-(2,4-DIMETHYLPHENYL)-3-OXO-", "stdName": "BUTANAMIDE, 2,2'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(AZO))BIS(N-(2,4-DIMETHYLPHENYL)-3-OXO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "c3e1e0b7-4b0a-43f0-b40b-fc35ae1dd1a9", "name": "C.I. 21100", "stdName": "C.I. 21100", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "cbefe68c-1c68-4f89-8438-e28d04b62728", "name": "C.I. PIGMENT YELLOW 13", "stdName": "C.I. PIGMENT YELLOW 13", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "b474defe-a21b-4ad1-8dbe-2b957af40e71", "name": "HELIO FAST YELLOW GRF", "stdName": "HELIO FAST YELLOW GRF", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "b9509cbd-dc5b-46af-8ca4-19641581e5d5", "name": "MONOLITE YELLOW GL", "stdName": "MONOLITE YELLOW GL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "6071874b-8b3f-4a46-b8e8-dda232fdfacb", "name": "NSC-5336", "stdName": "NSC-5336", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "bcd1c877-0b98-4348-a1c2-6a0479031845" ], "display_name": false }, { "uuid": "b09779a4-984b-448e-ad00-1cc403c6e496", "name": "PERMANENT YELLOW GR 01", "stdName": "PERMANENT YELLOW GR 01", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "47a7594f-7c68-44b0-ace1-28de1cf598fd", "name": "PIGMENT YELLOW 13", "stdName": "PIGMENT YELLOW 13", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "04112db8-76a0-4789-90b1-91cfad0f0496", "3fe7ae61-be90-4a84-a9bf-80c7f39a106e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3384252c-2f5f-4aae-a389-9723b8ff82d3", "name_org": "INCI" } ] }, { "uuid": "e1ae7de9-28a6-4a99-954e-86ff1ce90e59", "name": "SANYO LIGHT FAST BENZIDINE YELLOW R", "stdName": "SANYO LIGHT FAST BENZIDINE YELLOW R", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false }, { "uuid": "6da37c58-7cb5-462c-b63e-99a4175d5c13", "name": "YELLOW ECY 210", "stdName": "YELLOW ECY 210", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e9adce75-c306-4a07-a259-9fbd3795e6ad", "e52e948e-9d96-4e4a-903b-7b0e87411dac" ], "display_name": false } ], "references": [ { "uuid": "3fe7ae61-be90-4a84-a9bf-80c7f39a106e", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e9adce75-c306-4a07-a259-9fbd3795e6ad", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e52e948e-9d96-4e4a-903b-7b0e87411dac", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bcd1c877-0b98-4348-a1c2-6a0479031845", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "198a2090-2738-4e79-948e-32a7c9a77403", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391543000, "tags": [ "NOMEN" ] }, { "uuid": "d95254c4-3381-465c-8f28-937141330158", "citation": "SRS import [O8RYS681QI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O8RYS681QI", "doc_type": "SRS", "public_domain": true, "document_date": 1493391543000, "tags": [ "NOMEN" ] }, { "uuid": "04112db8-76a0-4789-90b1-91cfad0f0496", "citation": "PIGMENT YELLOW 13 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7a3d7d9c-edc4-7238-eed2-e0c3797852b2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5102-83-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "376767fa-3f6a-3595-9a2c-20bdc0dfefc5", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "6f46486f-991e-ae6b-4dd7-a642e0cb3352", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "8016ff60-f64d-4c38-a17b-6b179856a98a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "81fb6dd9-d7de-4301-b797-fb9a52b4ae88", "id": "81fb6dd9-d7de-4301-b797-fb9a52b4ae88", "molfile": "\n Marvin 01132106452D \n\n 48 51 0 0 0 0 999 V2000\n 3.8523 -2.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6662 -2.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1854 -2.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9609 -3.7175 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7793 -3.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2985 -3.2031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1123 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4070 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2302 -4.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7494 -3.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4546 -2.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6268 -2.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3321 -1.9214 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5444 -3.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8391 -4.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6576 -4.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1721 -3.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9859 -4.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5143 -3.4650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3282 -3.5959 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.8427 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6658 -3.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5480 -2.1834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6229 -4.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4320 -4.5033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1037 -4.9896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3983 -5.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2121 -5.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5115 -6.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9876 -7.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2010 -8.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1738 -7.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8792 -6.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0606 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8774 -3.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3966 -2.5670 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0635 -3.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4417 -4.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6279 -4.2227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7363 -5.1066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2172 -5.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5118 -6.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9973 -7.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1835 -7.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6012 -7.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8795 -6.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4080 -5.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1134 -4.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 38 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 12 7 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 14 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 37 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 35 17 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 24 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 33 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 2 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 35 1 0 0 0 0\n 38 39 2 0 0 0 0\n 38 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 47 2 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 46 44 2 0 0 0 0\n 47 46 1 0 0 0 0\n 47 48 1 0 0 0 0\nM END", "smiles": "Cc1ccc(c(C)c1)NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccc(C)cc4C", "formula": "C36H34Cl2N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "047dd7a7-a4d2-4164-a59a-e1f0f24366d7" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "685.6002", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "9c76573a-eebe-431a-9742-e7c38791ca54", "version": "7", "structure": { "id": "080d8dd8-7c08-41f5-a442-fde5dec3e1b2", "molfile": "\n Marvin 01132100412D \n\n 48 51 0 0 0 0 999 V2000\n 3.1835 -7.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9876 -7.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9973 -7.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1134 -4.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8795 -6.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5115 -6.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0606 -6.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1738 -7.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5118 -6.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4080 -5.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2121 -5.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8792 -6.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2172 -5.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3983 -5.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1854 -2.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8523 -2.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6279 -4.2227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7363 -5.1066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5480 -2.1834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6658 -3.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4320 -4.5033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1037 -4.9896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6662 -2.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4417 -4.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8427 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6229 -4.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9609 -3.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3282 -3.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7793 -3.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5143 -3.4650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2985 -3.2031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9859 -4.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3321 -1.9214 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1123 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3966 -2.5670 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1721 -3.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4070 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6268 -2.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6576 -4.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8774 -3.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2302 -4.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4546 -2.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8391 -4.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0635 -3.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7494 -3.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5444 -3.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6012 -7.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2010 -8.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 37 34 1 0 0 0 0\n 39 36 1 0 0 0 0\n 5 1 2 0 0 0 0\n 8 2 2 0 0 0 0\n 9 3 2 0 0 0 0\n 10 4 1 0 0 0 0\n 10 5 1 0 0 0 0\n 11 6 2 0 0 0 0\n 12 7 1 0 0 0 0\n 12 8 1 0 0 0 0\n 13 9 1 0 0 0 0\n 13 10 2 0 0 0 0\n 14 11 1 0 0 0 0\n 14 12 2 0 0 0 0\n 18 13 1 0 0 0 0\n 22 14 1 0 0 0 0\n 23 15 2 0 0 0 0\n 23 16 1 0 0 0 0\n 24 17 2 0 0 0 0\n 24 18 1 0 0 0 0\n 25 19 2 0 0 0 0\n 25 20 1 0 0 0 0\n 26 21 2 0 0 0 0\n 26 22 1 0 0 0 0\n 27 23 1 0 0 0 0\n 27 24 1 0 0 0 0\n 28 25 1 0 0 0 0\n 28 26 1 0 0 0 0\n 29 27 1 0 0 0 0\n 30 28 1 0 0 0 0\n 31 29 2 0 0 0 0\n 32 30 2 0 0 0 0\n 34 31 1 0 0 0 0\n 36 32 1 0 0 0 0\n 38 33 1 0 0 0 0\n 38 34 2 0 0 0 0\n 40 35 1 0 0 0 0\n 40 36 2 0 0 0 0\n 41 37 2 0 0 0 0\n 42 38 1 0 0 0 0\n 43 39 2 0 0 0 0\n 44 40 1 0 0 0 0\n 45 41 1 0 0 0 0\n 45 42 2 0 0 0 0\n 46 43 1 0 0 0 0\n 46 44 2 0 0 0 0\n 46 45 1 0 0 0 0\n 1 47 1 0 0 0 0\n 2 48 1 0 0 0 0\nM END", "smiles": "Cc1ccc(c(C)c1)NC(=O)C(C(=O)C)/N=N/c2ccc(cc2Cl)-c3ccc(c(c3)Cl)/N=N/C(C(=O)C)C(=O)Nc4ccc(C)cc4C", "formula": "C36H34Cl2N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "685.6002", "optical_activity": "UNSPECIFIED", "references": [ "e52e948e-9d96-4e4a-903b-7b0e87411dac", "d95254c4-3381-465c-8f28-937141330158" ], "stereo_centers": 2 }, "unii": "O8RYS681QI" } ] }