{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d113a22f-689d-4808-8b65-ae779604d3df", "code": "292821-68-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=292821-68-2", "code_system": "CAS", "references": [ "a71a4036-f758-481f-b7c0-e29c741a4860", "9d3f1812-a531-44f5-af50-61fb550cc6c9" ] }, { "uuid": "67ff8e2f-aafd-2e72-21ca-dc8cf4d4e53e", "code": "91936862", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936862", "code_system": "PUBCHEM", "references": [ "fe056940-c6ea-d4a2-bb79-3d7d98164a7f" ] }, { "uuid": "1edb44fe-df83-4878-82f0-c146fce5865c", "code": "O8LSL6YBW5", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "61d7eecb-9646-4edf-926e-587fbb647ada", "name": "2-PROPENAMIDE, N-(AMINOIMINOMETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-", "stdName": "2-PROPENAMIDE, N-(AMINOIMINOMETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "280bd2b9-11d4-4fcb-9f1f-1a5481642f96", "700f3ab0-7093-4b01-a1c7-4d0b438d192e" ], "display_name": false }, { "uuid": "32ac3c0b-d6d5-4f0f-9924-6305e81becd3", "name": "GUANIDINE FERULAMIDE", "stdName": "GUANIDINE FERULAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "13adc525-09d2-4ee9-a7ed-34261354cfa8", "70b756a5-8535-4094-89c5-20e8b67de2d2", "280bd2b9-11d4-4fcb-9f1f-1a5481642f96" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f891a425-4c94-4db1-b222-0516c9a5290f", "name_org": "INCI" } ] } ], "references": [ { "uuid": "70b756a5-8535-4094-89c5-20e8b67de2d2", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "280bd2b9-11d4-4fcb-9f1f-1a5481642f96", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "700f3ab0-7093-4b01-a1c7-4d0b438d192e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a71a4036-f758-481f-b7c0-e29c741a4860", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392848000, "tags": [ "NOMEN" ] }, { "uuid": "02afc3ef-b69a-4d78-8b66-7350c5c63ceb", "citation": "SRS import [O8LSL6YBW5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O8LSL6YBW5", "doc_type": "SRS", "public_domain": true, "document_date": 1493392848000, "tags": [ "NOMEN" ] }, { "uuid": "13adc525-09d2-4ee9-a7ed-34261354cfa8", "citation": "GUANIDINE FERULAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fe056940-c6ea-d4a2-bb79-3d7d98164a7f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "9d3f1812-a531-44f5-af50-61fb550cc6c9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3d56e5e4-e0ac-4543-a0a1-a15c18c46ebf", "id": "3d56e5e4-e0ac-4543-a0a1-a15c18c46ebf", "molfile": "\n Marvin 01132103152D \n\n 17 17 0 0 0 0 999 V2000\n 6.7020 -7.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -7.0177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -6.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1309 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1309 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8454 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5599 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -3.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9889 -4.9552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9889 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7034 -6.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -6.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7020 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7020 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9875 -6.1926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 16 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 14 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "COc1cc(ccc1O)/C=C/C(=O)NC(=N)N", "formula": "C11H13N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3f938e25-4ffc-4991-b5ec-bea5d6814c65" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "235.2396", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "dd63064e-1231-44ff-a9f7-6863b299a8ea", "version": "5", "structure": { "id": "8b2b419d-bf1c-4cf6-89ee-a939e19dc711", "molfile": "\n Marvin 01132107142D \n\n 17 17 0 0 0 0 999 V2000\n 8.8454 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1309 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7020 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7020 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9875 -6.1926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -6.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4164 -7.0177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7020 -7.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1309 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5599 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9889 -4.9552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9889 -5.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7034 -6.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -6.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2744 -3.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 7 2 0 0 0 0\n 2 10 1 0 0 0 0\n 1 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 14 2 0 0 0 0\n 12 17 2 0 0 0 0\nM END", "smiles": "COc1cc(ccc1O)/C=C/C(=O)NC(=N)N", "formula": "C11H13N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "235.2396", "optical_activity": "NONE", "references": [ "02afc3ef-b69a-4d78-8b66-7350c5c63ceb", "700f3ab0-7093-4b01-a1c7-4d0b438d192e" ], "stereo_centers": 0 }, "unii": "O8LSL6YBW5" } ] }