{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2e553a19-790e-4c5b-b9ba-4a293a7d9eb4",
          "code": "541-70-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=541-70-8",
          "code_system": "CAS",
          "references": [
            "1b3fdbad-f82d-4b01-a288-5ba55228269e",
            "afe661ad-71e0-4f37-9418-22612498dbe6"
          ]
        },
        {
          "uuid": "baa45b1b-0a34-4e45-a795-21e3a55496a8",
          "code": "208-791-6",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1b3fdbad-f82d-4b01-a288-5ba55228269e"
          ]
        },
        {
          "uuid": "c95298f5-4d1d-44bc-bd2b-7535af9bba78",
          "code": "10942",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10942",
          "code_system": "PUBCHEM",
          "references": [
            "1b3fdbad-f82d-4b01-a288-5ba55228269e"
          ]
        },
        {
          "uuid": "3edb03a0-17fc-92ec-ed40-8a15307e01b8",
          "code": "6245",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6245",
          "code_system": "HSDB",
          "references": [
            "f0fb93b1-617a-7271-6a6d-b8fb695e9a4d"
          ]
        },
        {
          "uuid": "a0e7e2fa-b133-c847-8a6f-b19ee308da1f",
          "code": "DTXSID7060251",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7060251",
          "code_system": "EPA CompTox",
          "references": [
            "a1e9978f-f17c-6c66-9b39-c26fd926726e"
          ]
        },
        {
          "uuid": "02cc2b81-498a-4be6-a836-722234d63e4b",
          "code": "O7CFS23KOR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "82414f69-fce0-4945-9ef3-aaa7de57ca19",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "83522606-f901-4f15-89d4-3be1970261a8",
            "refuuid": "f1474960-48d9-4fcd-9258-c5332aab813e",
            "name": "M-PHENYLENEDIAMINE",
            "unii": "OE624J2447",
            "linking_id": "OE624J2447",
            "ref_pname": "M-PHENYLENEDIAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e242ef8e-5562-4a4a-afb7-3d03b6f5c542",
          "name": "1,3-BENZENEDIAMINE SULFATE [HSDB]",
          "stdName": "1,3-BENZENEDIAMINE SULFATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28901029-3c5e-4a79-a043-f5f48c1a78d9",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        },
        {
          "uuid": "1a8269f8-e54c-4c8c-96bc-5551cffa7177",
          "name": "1,3-BENZENEDIAMINE, SULFATE",
          "stdName": "1,3-BENZENEDIAMINE, SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faf61e7-4870-4a1b-9859-25de6219db29",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        },
        {
          "uuid": "45f00b93-f832-429e-9903-8fee249b9eb0",
          "name": "1,3-BENZENEDIAMINE, SULFATE (1:1)",
          "stdName": "1,3-BENZENEDIAMINE, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d",
            "8566aeff-628a-41a8-9a3d-69871b43dc43"
          ],
          "display_name": false
        },
        {
          "uuid": "6c2b6f44-cac2-4e9f-8ac1-530f96574269",
          "name": "1,3-PHENYLENEDIAMINE SULFATE",
          "stdName": "1,3-PHENYLENEDIAMINE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faf61e7-4870-4a1b-9859-25de6219db29",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        },
        {
          "uuid": "923ddcea-dab9-433f-8137-06e0b9aa048b",
          "name": "COLOREX MPDS",
          "stdName": "COLOREX MPDS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faf61e7-4870-4a1b-9859-25de6219db29",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        },
        {
          "uuid": "769c0b2e-45c6-4185-8fd9-9bd0bfb58a81",
          "name": "M-PHENYLENEDIAMINE SULFATE",
          "stdName": "M-PHENYLENEDIAMINE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7accb8ec-5b88-4983-90aa-6c5da2eb9ef9",
            "186fa91b-792f-4916-84ab-fb7501f64985",
            "0faf61e7-4870-4a1b-9859-25de6219db29",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5c056371-be10-461b-8ce6-b4b91bd60e5f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "64db8b94-4d19-440a-8854-f6a19161bac0",
          "name": "PHENYLENEDIAMINE SULFATE, M-",
          "stdName": "PHENYLENEDIAMINE SULFATE, M-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e2fb2ed-7841-484e-8322-8f6585696f9e",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        },
        {
          "uuid": "05f73320-4e18-41fc-9ced-3d64ee8c03ca",
          "name": "RODOL MPDS",
          "stdName": "RODOL MPDS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faf61e7-4870-4a1b-9859-25de6219db29",
            "71d66f34-65ef-4c4c-a928-ab0ba5be239d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0faf61e7-4870-4a1b-9859-25de6219db29",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "71d66f34-65ef-4c4c-a928-ab0ba5be239d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8566aeff-628a-41a8-9a3d-69871b43dc43",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7accb8ec-5b88-4983-90aa-6c5da2eb9ef9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28901029-3c5e-4a79-a043-f5f48c1a78d9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e2fb2ed-7841-484e-8322-8f6585696f9e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b3fdbad-f82d-4b01-a288-5ba55228269e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07a363f2-26f3-49df-b4e9-9eae8ca7e3fa",
          "citation": "SRS import [O7CFS23KOR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O7CFS23KOR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "186fa91b-792f-4916-84ab-fb7501f64985",
          "citation": "M-PHENYLENEDIAMINE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0fb93b1-617a-7271-6a6d-b8fb695e9a4d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+541-70-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a1e9978f-f17c-6c66-9b39-c26fd926726e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=541-70-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "afe661ad-71e0-4f37-9418-22612498dbe6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "21067980-95dc-49e3-a4b2-32d7c2560fcf",
          "id": "21067980-95dc-49e3-a4b2-32d7c2560fcf",
          "molfile": "\n  Marvin  01132101522D          \n\n  5  4  0  0  0  0            999 V2000\n    3.6124   -0.8589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7874   -0.8589    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5739   -0.0620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9749   -1.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8593   -1.6807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b8579340-e061-4041-8d7d-fc6a4c5bb8fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "77145058-8d93-4366-b17c-63b5d7615c1d",
          "id": "77145058-8d93-4366-b17c-63b5d7615c1d",
          "molfile": "\n  Marvin  01132106112D          \n\n  8  8  0  0  0  0            999 V2000\n    0.7452   -0.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0306   -0.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0306   -1.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6839   -2.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3983   -1.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3983   -0.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1129   -0.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6839   -0.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)N)N",
          "formula": "C6H8N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "816adf11-d68e-458d-a8b3-0b4038019fe5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "108.1413",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba679723-5353-45c0-8cd7-cfa39b6624d2",
      "version": "5",
      "structure": {
        "id": "cf4f79b0-cdbb-4fdd-8de5-dcd0ac356513",
        "molfile": "\n  Marvin  01132110432D          \n\n 13 12  0  0  0  0            999 V2000\n    2.7876   -0.8590    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6127   -0.8590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5741   -0.0620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9750   -1.0023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -1.6808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3983   -1.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3983   -0.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6839   -0.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0306   -0.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0306   -1.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6839   -2.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7452   -0.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1129   -0.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  6  1  0  0  0  0\n  9 12  1  0  0  0  0\n  7 13  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)N)N.OS(=O)(=O)O",
        "formula": "C6H8N2.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.2209",
        "optical_activity": "NONE",
        "references": [
          "0faf61e7-4870-4a1b-9859-25de6219db29",
          "07a363f2-26f3-49df-b4e9-9eae8ca7e3fa"
        ],
        "stereo_centers": 0
      },
      "unii": "O7CFS23KOR"
    }
  ]
}