{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1d1871c9-9d4a-4a55-a1fb-aec7319934ba",
          "code": "1918-02-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1918-02-1",
          "code_system": "CAS",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5",
            "4d2b59a3-a286-45c3-9939-dff68b3274ac"
          ]
        },
        {
          "uuid": "4064360f-48b8-4bcc-a7b8-8e81faead447",
          "code": "D010846",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010846",
          "code_system": "MESH",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "a5347179-8df9-4dc8-884c-8c88274ac9b6",
          "code": "PICLORAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Picloram",
          "code_system": "WIKIPEDIA",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "e6d7cece-c90b-4fb3-b779-2fabbd6572ae",
          "code": "5101",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3415",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "5cb80c0b-229b-465b-b77a-5ceef2148ca3",
          "code": "m8779",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8779?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "8e742c51-d3b1-49c7-b5ab-8b81fea8b25d",
          "code": "217-636-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.034",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "05a4a018-7876-467d-a12c-646cbd856572",
          "code": "15965",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15965",
          "code_system": "PUBCHEM",
          "references": [
            "3a4636dc-86fe-4c21-87df-d954f99dacf5"
          ]
        },
        {
          "uuid": "ab5f126d-2ef2-47a7-372c-570e57735b38",
          "code": "1151",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1151",
          "code_system": "HSDB",
          "references": [
            "c5ecb126-9d8d-f1bf-4e6b-dd5d33ed973c"
          ]
        },
        {
          "uuid": "69a607e9-b83d-a7af-874f-57b1840b3741",
          "code": "DTXSID1021160",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1021160",
          "code_system": "EPA CompTox",
          "references": [
            "e9d87a7b-09c2-fc9c-c238-c72f4c3b656d"
          ]
        },
        {
          "uuid": "1d7a725e-7df3-471d-8833-e6a3a625e47d",
          "code": "O7437X49DW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2dc338e5-ccfd-bc05-f156-a33aab50c93d",
          "code": "34922",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34922",
          "code_system": "CHEBI",
          "references": [
            "bf696d13-04b7-3c7e-5d75-ce3e67345ebb"
          ]
        },
        {
          "uuid": "ce0c6621-69b9-f77f-a3b4-0a8db46c6daa",
          "code": "picloram",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/picloram.html",
          "code_system": "ALANWOOD",
          "references": [
            "2a0252bc-aee7-8bf4-fd66-dfff4335b82c"
          ]
        },
        {
          "uuid": "62666a61-5b98-4b6d-44b4-83a58b275f62",
          "code": "233899",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=233899",
          "code_system": "NSC",
          "references": [
            "6f623a65-bdb4-a6b9-7cd2-7893d1c03ff1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1c570354-d9cb-449f-afdd-3de73c87ef44",
          "amount": {
            "uuid": "49ba0fc4-9d09-4233-90a7-550290b5147c"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "919ff1af-a281-418a-b917-ef2fb789a971"
          ],
          "related_substance": {
            "uuid": "7050c486-f261-41ac-9c7a-23312234feec",
            "refuuid": "13f82db0-8185-4ebe-97ac-ae4ab37803c5",
            "name": "Picloram sodium salt",
            "unii": "W5TCV2WJ5N",
            "linking_id": "W5TCV2WJ5N",
            "ref_pname": "Picloram sodium salt",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ba73e850-4f9a-4f23-9f70-3ddcebc2eabd",
          "name": "2-PYRIDINECARBOXYLIC ACID, 4-AMINO-3,5,6-TRICHLORO-",
          "stdName": "2-PYRIDINECARBOXYLIC ACID, 4-AMINO-3,5,6-TRICHLORO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "85906428-86dd-44b3-8cad-c106ea124439"
          ],
          "display_name": false
        },
        {
          "uuid": "184322f0-70b6-457c-8960-a579bb4edf41",
          "name": "4-AMINO-3,5,6-TRICHLOROPYRIDINE-2-CARBOXYLIC ACID",
          "stdName": "4-AMINO-3,5,6-TRICHLOROPYRIDINE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "85906428-86dd-44b3-8cad-c106ea124439"
          ],
          "display_name": false
        },
        {
          "uuid": "0c0103dd-8ad2-4a83-bb92-6f078f5e5900",
          "name": "NCI-C00237",
          "stdName": "NCI-C00237",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "85906428-86dd-44b3-8cad-c106ea124439"
          ],
          "display_name": false
        },
        {
          "uuid": "56dbe936-cae8-4c21-a7a8-1bc3f2558a66",
          "name": "NSC-233899",
          "stdName": "NSC-233899",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "85906428-86dd-44b3-8cad-c106ea124439"
          ],
          "display_name": false
        },
        {
          "uuid": "c5aee437-3448-4abf-bd12-afb3c72bafea",
          "name": "PICLORAM",
          "stdName": "PICLORAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eab67689-678a-4fa4-9fbb-d37089aad5b5",
            "cd1b6d7e-66fa-4a27-b857-4a1cc121f904",
            "50b804f1-2684-42c8-83dd-85f87d965058",
            "db36caaf-f6d3-410f-8863-a0213338c02b",
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "8f1363bf-54f4-44d1-bc48-93afa18b6809",
            "83b95859-62d3-4187-89f9-10a2e79f8a1a",
            "1c11f49a-baeb-4e59-9acf-c16c789e795e"
          ],
          "display_name": true
        },
        {
          "uuid": "60158691-7620-4a7c-bad5-f450b3af9a44",
          "name": "PICLORAM [HSDB]",
          "stdName": "PICLORAM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eab67689-678a-4fa4-9fbb-d37089aad5b5",
            "9e57ee9e-277f-4dae-a7c0-25096457c94a"
          ],
          "display_name": false
        },
        {
          "uuid": "d43017e8-1941-2f2f-0af2-10a1eb880b07",
          "name": "PICLORAM [IARC]",
          "stdName": "PICLORAM [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00c2173b-5b68-9e31-03b2-d53b0fb2fc42"
          ],
          "display_name": false
        },
        {
          "uuid": "fa601f90-bbd5-4c9e-a221-6d2881adf900",
          "name": "PICLORAM [ISO]",
          "stdName": "PICLORAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db36caaf-f6d3-410f-8863-a0213338c02b",
            "9e57ee9e-277f-4dae-a7c0-25096457c94a"
          ],
          "display_name": false
        },
        {
          "uuid": "46c87a80-07bb-47d4-af4e-e0c0bd2f075d",
          "name": "PICLORAM [MI]",
          "stdName": "PICLORAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "8f1363bf-54f4-44d1-bc48-93afa18b6809"
          ],
          "display_name": false
        },
        {
          "uuid": "878741fe-b5d2-413d-b61a-ce9347ee6664",
          "name": "TORDON",
          "stdName": "TORDON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e57ee9e-277f-4dae-a7c0-25096457c94a",
            "85906428-86dd-44b3-8cad-c106ea124439"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "85906428-86dd-44b3-8cad-c106ea124439",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e57ee9e-277f-4dae-a7c0-25096457c94a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c11f49a-baeb-4e59-9acf-c16c789e795e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f1363bf-54f4-44d1-bc48-93afa18b6809",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eab67689-678a-4fa4-9fbb-d37089aad5b5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db36caaf-f6d3-410f-8863-a0213338c02b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a4636dc-86fe-4c21-87df-d954f99dacf5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e5576be-82d7-4992-8a51-32d29dc7b482",
          "citation": "SRS import [O7437X49DW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O7437X49DW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50b804f1-2684-42c8-83dd-85f87d965058",
          "citation": "PICLORAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "83b95859-62d3-4187-89f9-10a2e79f8a1a",
          "citation": "PICLORAM [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd1b6d7e-66fa-4a27-b857-4a1cc121f904",
          "citation": "PICLORAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5ecb126-9d8d-f1bf-4e6b-dd5d33ed973c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1918-02-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e9d87a7b-09c2-fc9c-c238-c72f4c3b656d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1918-02-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00c2173b-5b68-9e31-03b2-d53b0fb2fc42",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "2a0252bc-aee7-8bf4-fd66-dfff4335b82c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "bf696d13-04b7-3c7e-5d75-ce3e67345ebb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6f623a65-bdb4-a6b9-7cd2-7893d1c03ff1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4d2b59a3-a286-45c3-9939-dff68b3274ac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "919ff1af-a281-418a-b917-ef2fb789a971",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9d265379-6c9f-4508-9f07-595deba1d4ed",
          "id": "9d265379-6c9f-4508-9f07-595deba1d4ed",
          "molfile": "\n  Marvin  01132108102D          \n\n 13 13  0  0  0  0            999 V2000\n    1.4297    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8263    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4813    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -3.3101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5743   -2.0695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -0.8263    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
          "smiles": "c1(c(c(c(Cl)nc1C(=O)O)Cl)N)Cl",
          "formula": "C6H3Cl3N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f7c40a4c-a89e-4114-8023-e9ab9fdbaf04"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "241.4593",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2b9b5d39-6cdc-4ed2-b94d-51b18e90ec79",
      "version": "10",
      "structure": {
        "id": "0563f717-31b9-4a7f-a59a-17971f18c996",
        "molfile": "\n  Marvin  01132100342D          \n\n 13 13  0  0  0  0            999 V2000\n    2.1446   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1446   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -3.3101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8263    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8543   -0.8263    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4813    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5743   -2.0695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  7  1  0  0  0  0\n  6  4  1  0  0  0  0\nM  END",
        "smiles": "c1(c(c(c(Cl)nc1C(=O)O)Cl)N)Cl",
        "formula": "C6H3Cl3N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "241.4593",
        "optical_activity": "NONE",
        "references": [
          "6e5576be-82d7-4992-8a51-32d29dc7b482",
          "1c11f49a-baeb-4e59-9acf-c16c789e795e"
        ],
        "stereo_centers": 0
      },
      "unii": "O7437X49DW"
    }
  ]
}