{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba09b99d-c296-47ce-b8c7-1b06ba816f43",
          "code": "64902-72-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64902-72-3",
          "code_system": "CAS",
          "references": [
            "e1fe6d5d-4754-4cac-b660-a5bd2720ce64",
            "ffd37a54-72a0-4935-9e1e-cd62d1351f91"
          ]
        },
        {
          "uuid": "ba1fafd9-b596-4864-97c6-67bfcbed9ffd",
          "code": "118601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1825",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e1fe6d5d-4754-4cac-b660-a5bd2720ce64"
          ]
        },
        {
          "uuid": "3ee3dcf2-54a9-41dc-8814-87de6867076f",
          "code": "m3467",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3467?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e1fe6d5d-4754-4cac-b660-a5bd2720ce64"
          ]
        },
        {
          "uuid": "29eea574-42cf-4a83-b684-187cf774cfa4",
          "code": "265-268-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.316",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e1fe6d5d-4754-4cac-b660-a5bd2720ce64"
          ]
        },
        {
          "uuid": "a19cb5c7-aa77-405e-b577-56bf5e193a8a",
          "code": "47491",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/47491",
          "code_system": "PUBCHEM",
          "references": [
            "e1fe6d5d-4754-4cac-b660-a5bd2720ce64"
          ]
        },
        {
          "uuid": "27370d7b-7208-b951-0292-9e6f978d9d19",
          "code": "6847",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6847",
          "code_system": "HSDB",
          "references": [
            "c7c14e14-6ae0-ec19-e0fa-614343e7e61f"
          ]
        },
        {
          "uuid": "bbee96d6-7f65-2ea6-7013-ff03eaffc584",
          "code": "DTXSID7023980",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023980",
          "code_system": "EPA CompTox",
          "references": [
            "f808fa5c-f4a5-bf79-6720-8623a51706de"
          ]
        },
        {
          "uuid": "b3a0cd95-f249-4969-8694-c245dd421e02",
          "code": "O6S620ML45",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "023072d1-1292-5340-c53a-f177f2f1f041",
          "code": "3652",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3652",
          "code_system": "CHEBI",
          "references": [
            "ea129c92-bc73-adbc-2312-8e97370cc796"
          ]
        },
        {
          "uuid": "b4562bae-c967-35ee-fd2b-a4725644c2b6",
          "code": "Chlorsulfuron",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorsulfuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "2fb6986c-d567-bd76-b453-1804519026f8"
          ]
        },
        {
          "uuid": "e0ea07b6-f2fb-cedc-733e-fb247e5f37a4",
          "code": "chlorsulfuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlorsulfuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "876c8451-20c1-ea4e-72bf-6899dfa7a20e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fbb3716b-8a17-441c-a745-9c08c963b5ef",
          "name": "1-(2-CHLOROPHENYLSULFONYL)-3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)UREA",
          "stdName": "1-(2-CHLOROPHENYLSULFONYL)-3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c9087aa-f743-4656-91ff-f234e7dfd246",
            "f53d7a16-8986-4300-a3f2-3d0d76924a19"
          ],
          "display_name": false
        },
        {
          "uuid": "d343be08-f57d-4aa6-834c-777ec470cd5e",
          "name": "2-CHLORO-N-(((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)BENZENESULFONAMIDE",
          "stdName": "2-CHLORO-N-(((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)BENZENESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c9087aa-f743-4656-91ff-f234e7dfd246",
            "b2677f17-ca77-4cf5-9083-695fc5feb912"
          ],
          "display_name": false
        },
        {
          "uuid": "a4ac3e6b-68f3-4b12-8bb1-cebb30e95ecb",
          "name": "CHLORSULFURON",
          "stdName": "CHLORSULFURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4647d1a7-df99-4644-b830-aa870f1ad5a7",
            "bbb85b97-5095-4fe7-a599-af5fe99ccebb",
            "d299e273-ff40-4f40-b528-a9c81c13c5a2",
            "def682f2-3b31-4e34-9182-31b9726e1c60",
            "871e920e-f8dc-4eaa-b1a1-3a63f0295f94",
            "662af9df-154e-4c0d-8c38-89f4fe30ad68",
            "bc06944f-8e69-49f6-bee8-4f2f145be4f4",
            "65911ecf-74a4-494b-b5f8-0cdcd3cb90c1"
          ],
          "display_name": true
        },
        {
          "uuid": "37dada48-60ae-4b7a-870f-e7fa698ab825",
          "name": "CHLORSULFURON [HSDB]",
          "stdName": "CHLORSULFURON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbb85b97-5095-4fe7-a599-af5fe99ccebb",
            "bc06944f-8e69-49f6-bee8-4f2f145be4f4"
          ],
          "display_name": false
        },
        {
          "uuid": "d8b945bf-441a-4a33-9782-f4eacdf8b4fe",
          "name": "CHLORSULFURON [ISO]",
          "stdName": "CHLORSULFURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def682f2-3b31-4e34-9182-31b9726e1c60",
            "bc06944f-8e69-49f6-bee8-4f2f145be4f4"
          ],
          "display_name": false
        },
        {
          "uuid": "b03fd4d8-65c7-4f7c-8731-57d7f0ee0b0d",
          "name": "CHLORSULFURON [MI]",
          "stdName": "CHLORSULFURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4647d1a7-df99-4644-b830-aa870f1ad5a7",
            "bc06944f-8e69-49f6-bee8-4f2f145be4f4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "662af9df-154e-4c0d-8c38-89f4fe30ad68",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9c9087aa-f743-4656-91ff-f234e7dfd246",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f53d7a16-8986-4300-a3f2-3d0d76924a19",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2677f17-ca77-4cf5-9083-695fc5feb912",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4647d1a7-df99-4644-b830-aa870f1ad5a7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc06944f-8e69-49f6-bee8-4f2f145be4f4",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbb85b97-5095-4fe7-a599-af5fe99ccebb",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "def682f2-3b31-4e34-9182-31b9726e1c60",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1fe6d5d-4754-4cac-b660-a5bd2720ce64",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ce9f96c-07c6-4cd5-a09c-1772e68027bf",
          "citation": "SRS import [O6S620ML45]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O6S620ML45",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1361433c-a66c-461d-a476-3980055696b0",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "871e920e-f8dc-4eaa-b1a1-3a63f0295f94",
          "citation": "CHLORSULFURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65911ecf-74a4-494b-b5f8-0cdcd3cb90c1",
          "citation": "CHLORSULFURON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d299e273-ff40-4f40-b528-a9c81c13c5a2",
          "citation": "CHLORSULFURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7c14e14-6ae0-ec19-e0fa-614343e7e61f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+64902-72-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f808fa5c-f4a5-bf79-6720-8623a51706de",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64902-72-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2fb6986c-d567-bd76-b453-1804519026f8",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "876c8451-20c1-ea4e-72bf-6899dfa7a20e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ea129c92-bc73-adbc-2312-8e97370cc796",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ffd37a54-72a0-4935-9e1e-cd62d1351f91",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b91e2b9f-727b-46c4-97fe-8b6882ab0804",
          "id": "b91e2b9f-727b-46c4-97fe-8b6882ab0804",
          "molfile": "\n  Marvin  01132109352D          \n\n 23 24  0  0  0  0            999 V2000\n    4.3408   -6.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -5.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3408   -5.2961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3408   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6280   -4.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -4.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7664   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4746   -4.0470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1873   -4.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1873   -5.2808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8961   -4.0394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -4.0394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -3.2143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -4.8606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5470   -4.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9558   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7809   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1896   -4.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7809   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9558   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5470   -2.6138    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7664   -5.2847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 23  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 23  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)nc(n1)OC",
          "formula": "C12H12ClN5O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc1f4155-c581-4d94-9bab-9a15e9dbeaaf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "357.7743",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4c6a2b1-d104-4424-affb-db6a9df4c89e",
      "version": "7",
      "structure": {
        "id": "52ad22b6-21f3-4849-a0a4-40dc9661732b",
        "molfile": "\n  Marvin  01132104182D          \n\n 23 24  0  0  0  0            999 V2000\n    9.5470   -4.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -4.0394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8961   -4.0394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1873   -4.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4746   -4.0470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7664   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7664   -5.2847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -5.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3408   -5.2961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3408   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -4.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6280   -4.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0574   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3408   -6.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1873   -5.2808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -3.2143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7220   -4.8606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9558   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7809   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1896   -4.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7809   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9558   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5470   -2.6138    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  4 15  2  0  0  0  0\n  2 16  2  0  0  0  0\n  2 17  2  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n  1 22  2  0  0  0  0\n 18 23  1  0  0  0  0\nM  END",
        "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)nc(n1)OC",
        "formula": "C12H12ClN5O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "357.7743",
        "optical_activity": "NONE",
        "references": [
          "0ce9f96c-07c6-4cd5-a09c-1772e68027bf",
          "1361433c-a66c-461d-a476-3980055696b0"
        ],
        "stereo_centers": 0
      },
      "unii": "O6S620ML45"
    }
  ]
}