{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0aef3c53-606f-4ede-980e-b9eb06320e13",
          "code": "307297-39-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=307297-39-8",
          "code_system": "CAS",
          "references": [
            "fa2aff5d-70e1-4970-8208-aa405a923ce0",
            "9c52dd61-3e48-4fda-80b6-debf032f09a5"
          ]
        },
        {
          "uuid": "abbdcba8-7e75-4b85-b115-0f4231fa2dc8",
          "code": "C421253",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67421253",
          "code_system": "MESH",
          "references": [
            "fa2aff5d-70e1-4970-8208-aa405a923ce0"
          ]
        },
        {
          "uuid": "6513e1d1-53d1-49e7-880d-fa97b21b2a55",
          "code": "219042",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/219042",
          "code_system": "PUBCHEM",
          "references": [
            "fa2aff5d-70e1-4970-8208-aa405a923ce0"
          ]
        },
        {
          "uuid": "e95b55de-2015-eef2-9f44-e10ff8944809",
          "code": "312010",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of retinitis pigmentosa",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=312010",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "c7eab28d-2635-4026-9e25-a362f602b033",
          "code": "O65P17785G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c621df79-c195-546d-b25d-174c4bd37b93",
          "code": "Epitalon",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Epitalon",
          "code_system": "WIKIPEDIA",
          "references": [
            "0312ee5e-f589-f511-cf15-a9b37ef6902e"
          ]
        },
        {
          "uuid": "9c92eacc-4e3d-5f12-3b2d-ca6d38d94709",
          "code": "DTXSID80952957",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80952957",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "75632065-364d-4ac8-b9f4-28f956fad6c7",
          "amount": {
            "uuid": "67cca46a-2f9c-4600-9faa-2818a3213438"
          },
          "type": "TARGET->ACTIVATOR OF EXPRESSION",
          "references": [
            "baf325d5-a284-4e1d-bf98-d225a0594da8"
          ],
          "related_substance": {
            "uuid": "7d682230-46cf-46a5-a0d0-68f4e6c364b5",
            "refuuid": "161a9f1e-dd8c-40ef-86be-58b41e35aa2c",
            "name": "TELOMERASE REVERSE TRANSCRIPTASE",
            "unii": "NH2W5DQ1DO",
            "linking_id": "NH2W5DQ1DO",
            "ref_pname": "TELOMERASE REVERSE TRANSCRIPTASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c418b76b-9865-45c6-a0e0-cde3c3e7d91f",
          "amount": {
            "uuid": "8182edf4-5bb2-4d66-8b4f-dcb9e2401502"
          },
          "comments": "May play a role in anti-aging. ",
          "type": "ACTIVE MOIETY",
          "references": [
            "baf325d5-a284-4e1d-bf98-d225a0594da8"
          ],
          "related_substance": {
            "uuid": "ac27e57c-e3b3-4241-a7a7-9c217386112d",
            "refuuid": "8935bdb8-2a50-40e6-9ed8-728928f30231",
            "name": "EPITALON",
            "unii": "O65P17785G",
            "linking_id": "O65P17785G",
            "ref_pname": "EPITALON",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fb2fa7b8-9904-49e3-be4c-d2a6a1fa2ba4",
          "name": "ALA-GLU-ASP-GLY",
          "stdName": "ALA-GLU-ASP-GLY",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b40717c-a831-41f9-97dc-f39ba7b43178"
          ],
          "display_name": false
        },
        {
          "uuid": "6cdd3bfb-a7af-44a4-a4db-f3aca6bca98a",
          "name": "EPITALON",
          "stdName": "EPITALON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5135b323-7dfd-4ff2-b25f-dbbe60c6fd23"
          ],
          "display_name": true
        },
        {
          "uuid": "0c573721-e8ea-4d74-a6bd-1ab519b5fbc5",
          "name": "EPITHALON",
          "stdName": "EPITHALON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0058bf-e9c8-4a60-ad13-2f6d1bb33fe5"
          ],
          "display_name": false
        },
        {
          "uuid": "88534329-6f61-4f56-9d78-ea1b516a8072",
          "name": "GLYCINE, L-ALANYL-L-.ALPHA.-GLUTAMYL-L-.ALPHA.-ASPARTYL-",
          "stdName": "GLYCINE, L-ALANYL-L-.ALPHA.-GLUTAMYL-L-.ALPHA.-ASPARTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0058bf-e9c8-4a60-ad13-2f6d1bb33fe5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5135b323-7dfd-4ff2-b25f-dbbe60c6fd23",
          "citation": "ORPHAN DRUG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1c0058bf-e9c8-4a60-ad13-2f6d1bb33fe5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b40717c-a831-41f9-97dc-f39ba7b43178",
          "citation": "Biogerontology, 4:4, 193-202 (2003)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa2aff5d-70e1-4970-8208-aa405a923ce0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391641000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e9eed15-6703-406d-8e2a-718d8772fa8f",
          "citation": "SRS import [O65P17785G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O65P17785G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391641000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d881ca08-d32f-4ef9-9a54-d805d301ea75",
          "citation": "http://www.demogr.mpg.de/en/projects_publications/publications_1904/",
          "url": "http://www.demogr.mpg.de/en/projects_publications/publications_1904/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0312ee5e-f589-f511-cf15-a9b37ef6902e",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "9c52dd61-3e48-4fda-80b6-debf032f09a5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8c7fe8b4-0a3f-d7c2-cfae-11ff2e34d43d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "baf325d5-a284-4e1d-bf98-d225a0594da8",
          "citation": "Palmer, Raymond D. \"Biomedicines in Longevity and Aging the Quest to Resist Biological Decline.\" BioMedicine 14.1 (2024): 10.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC10962562/",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f70deaae-5f80-4fa9-ab66-616e40953897",
          "id": "f70deaae-5f80-4fa9-ab66-616e40953897",
          "molfile": "\n  Marvin  01132112482D          \n\n 27 26  0  0  1  0            999 V2000\n   -0.1053   -3.6229    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.1053   -2.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8183   -4.0381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6107   -4.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6107   -4.8578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3236   -3.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0396   -4.0275    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.0396   -4.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7618   -5.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7618   -6.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4778   -6.4971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0488   -6.5024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7526   -3.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7526   -2.7873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4685   -4.0222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1815   -3.6070    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.1815   -2.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8913   -2.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8913   -1.5419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6074   -2.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8975   -4.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8975   -4.8418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6104   -3.6016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3264   -4.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0393   -3.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0393   -2.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7554   -4.0062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
          "smiles": "C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N",
          "formula": "C14H22N4O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90e86afe-5a5d-43d2-8c21-7c9e3d1f4101"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "390.3465",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8935bdb8-2a50-40e6-9ed8-728928f30231",
      "version": "11",
      "structure": {
        "id": "cab6dbfa-4371-4ad6-914f-40338f201d41",
        "molfile": "\n  Marvin  01132110282D          \n\n 27 26  0  0  1  0            999 V2000\n   -0.8183   -4.0381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1053   -3.6229    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6107   -4.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3236   -3.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0396   -4.0275    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7526   -3.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4685   -4.0222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1815   -3.6070    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8975   -4.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6104   -3.6016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3264   -4.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0393   -3.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0393   -2.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7554   -4.0062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8975   -4.8418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1815   -2.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8913   -2.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8913   -1.5419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6074   -2.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7526   -2.7873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0396   -4.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7618   -5.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7618   -6.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4778   -6.4971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0488   -6.5024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6107   -4.8578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1053   -2.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n  9 15  2  0  0  0  0\n  8 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n  6 20  2  0  0  0  0\n  5 21  1  6  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n  3 26  2  0  0  0  0\n  2 27  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N",
        "formula": "C14H22N4O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "390.3465",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d881ca08-d32f-4ef9-9a54-d805d301ea75",
          "4e9eed15-6703-406d-8e2a-718d8772fa8f"
        ],
        "stereo_centers": 3
      },
      "unii": "O65P17785G"
    }
  ]
}