{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "952a1c99-0824-48c8-86da-863adaec6566", "code": "299157-54-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=299157-54-3", "code_system": "CAS", "references": [ "3c322b59-465c-4cc2-ab4f-59b175b85f30", "722d7336-0bc4-4eb1-a788-dadced21c998" ] }, { "uuid": "f071c410-8574-48f0-a359-3efc4ffe7151", "code": "1368137", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368137/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "3c322b59-465c-4cc2-ab4f-59b175b85f30" ] }, { "uuid": "045bc5e1-c943-44af-a8c8-1e358f8d1ec5", "code": "11534242", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11534242", "code_system": "PUBCHEM", "references": [ "3c322b59-465c-4cc2-ab4f-59b175b85f30" ] }, { "uuid": "cd15cbf1-7f26-4f65-8590-c518d06f0fc7", "code": "O6380721VA", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "448e7f4c-039f-006e-8f37-8bf942f79711", "code": "DTXSID70184028", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70184028", "code_system": "EPA CompTox", "references": [ "8e60106a-e4ca-5fcd-cbb1-9c87048d288d" ] }, { "uuid": "aec1c219-2f3c-62d6-8922-9145611e287d", "code": "O6380721VA", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=O6380721VA", "code_system": "DAILYMED", "references": [ "43cee8c7-d4be-b664-3635-673c6505ee10" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7bbb1a8b-54ac-40a0-bd69-0c2267c2cf33", "name": "BIOTIN-GHK", "stdName": "BIOTIN-GHK", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b397df5e-475d-4bcf-9945-9ed9e5f13364", "18dd97ae-d49b-4acb-9f97-e13fc4e4b934" ], "display_name": false }, { "uuid": "04a05ef6-344d-495b-9755-e5f68f4b45b9", "name": "BIOTINOYL TRIPEPTIDE-1", "stdName": "BIOTINOYL TRIPEPTIDE-1", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "18dd97ae-d49b-4acb-9f97-e13fc4e4b934", "2c5b66ac-3535-425d-be40-78799af37abd", "76386b61-066e-4e39-a248-90465a48674c" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "48ab0e83-37ce-4514-bfa1-54e43e69893b", "name_org": "INCI" } ] }, { "uuid": "0366d9a3-7ff1-4b19-a22c-3527d3fae2e2", "name": "L-LYSINE, N-(5-((3AS,4S,6AR)-HEXAHYDRO-2-OXO-1H-THIENO(3,4-D)IMIDAZOL-4-YL)-1-OXOPENTYL)GLYCYL-L-HISTIDYL-", "stdName": "L-LYSINE, N-(5-((3AS,4S,6AR)-HEXAHYDRO-2-OXO-1H-THIENO(3,4-D)IMIDAZOL-4-YL)-1-OXOPENTYL)GLYCYL-L-HISTIDYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "18dd97ae-d49b-4acb-9f97-e13fc4e4b934", "a24ccf30-05eb-4e51-b615-c5c56e6e5d8d" ], "display_name": false } ], "references": [ { "uuid": "76386b61-066e-4e39-a248-90465a48674c", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "18dd97ae-d49b-4acb-9f97-e13fc4e4b934", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b397df5e-475d-4bcf-9945-9ed9e5f13364", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a24ccf30-05eb-4e51-b615-c5c56e6e5d8d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3c322b59-465c-4cc2-ab4f-59b175b85f30", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391497000, "tags": [ "NOMEN" ] }, { "uuid": "c3fa22cc-8fef-49de-b0c3-6127d765b994", "citation": "SRS import [O6380721VA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O6380721VA", "doc_type": "SRS", "public_domain": true, "document_date": 1493391497000, "tags": [ "NOMEN" ] }, { "uuid": "65347238-05fb-48ac-833b-fca60a2fb51e", "citation": "web pafge", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2c5b66ac-3535-425d-be40-78799af37abd", "citation": "BIOTINOYL TRIPEPTIDE-1 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a42ae7ba-4b0e-1578-2fc0-05805aae857d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=299157-54-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "722d7336-0bc4-4eb1-a788-dadced21c998", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "43cee8c7-d4be-b664-3635-673c6505ee10", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "8e60106a-e4ca-5fcd-cbb1-9c87048d288d", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "40542eb8-701a-4ef0-a249-abb08e6918bc", "id": "40542eb8-701a-4ef0-a249-abb08e6918bc", "molfile": "\n Marvin 01132103242D \n\n 39 41 0 0 1 0 999 V2000\n 8.2838 0.2555 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.5662 -0.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9341 -1.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2162 -1.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5842 -2.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8664 -3.1312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4714 0.3988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0588 -0.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4714 -1.0303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2337 -0.3158 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.8212 0.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9648 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1763 0.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7017 1.0488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1971 1.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9777 1.4414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8212 -1.0303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0086 -0.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8111 -0.3442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4783 -1.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6657 -1.3758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 -1.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8359 -2.5181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2615 -1.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5858 -1.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9263 -1.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2504 -1.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4090 -1.1816 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -0.4090 -0.3664 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1843 -0.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6635 -0.7741 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -2.4388 -1.0259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4388 -1.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0982 -2.3203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6635 -2.0929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1843 -1.4335 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.8143 0.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6268 0.7442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5321 1.6629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 7 1 6 0 0 0\n 1 37 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 17 1 1 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 12 16 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 1 0 0 0\n 28 29 1 0 0 0 0\n 28 36 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 1 0 0 0\n 36 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 33 1 0 0 0 0\n 36 35 1 1 0 0 0\n 37 38 1 0 0 0 0\n 37 39 2 0 0 0 0\nM END", "smiles": "C(CCC(=O)NCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCCN)C(=O)O)C[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3", "formula": "C24H38N8O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e381d712-8327-41fd-ad69-9c11763afdb9" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "566.6756", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "588101cc-26fb-4a23-a870-d6aa6f0b11a0", "version": "8", "structure": { "id": "b8c188fa-4a53-496b-96fe-9ee422a35dc7", "molfile": "\n Marvin 01132109332D \n\n 41 43 0 0 1 0 999 V2000\n 14.5274 -3.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7249 -4.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5375 -4.3892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9501 -3.6747 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.7752 -3.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1878 -2.9601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0002 -3.1034 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 18.2826 -3.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6505 -4.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9326 -5.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3006 -5.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5828 -6.4901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5307 -2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3432 -2.6147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2485 -1.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1878 -4.3892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5375 -2.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6811 -2.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6811 -1.9175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9134 -1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4180 -2.3101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8926 -2.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1946 -4.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3820 -4.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6374 -5.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9778 -4.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3021 -5.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6426 -4.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9667 -5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3073 -4.5405 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5320 -4.7924 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.0527 -5.4518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2774 -5.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2774 -4.3848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0527 -4.1330 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5320 -3.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3073 -3.7253 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5736 -3.4734 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6180 -5.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0112 -5.4518 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5522 -5.8770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 6 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 5 16 2 0 0 0 0\n 4 17 1 1 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 18 2 0 0 0 0\n 23 2 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 1 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 30 37 1 0 0 0 0\n 35 38 1 6 0 0 0\n 31 35 1 0 0 0 0\n 39 33 2 0 0 0 0\n 31 40 1 6 0 0 0\n 41 25 2 0 0 0 0\nM END", "smiles": "C(CCC(=O)NCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CCCCN)C(=O)O)C[C@H]2[C@]3([H])[C@]([H])(CS2)NC(=O)N3", "formula": "C24H38N8O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "566.6756", "optical_activity": "UNSPECIFIED", "references": [ "c3fa22cc-8fef-49de-b0c3-6127d765b994", "65347238-05fb-48ac-833b-fca60a2fb51e" ], "stereo_centers": 5 }, "unii": "O6380721VA" } ] }