{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6e7c600-deb4-46ca-ac0e-f2f54ba0ba08",
          "code": "m8044",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8044?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "92736bb6-cb45-46da-9acd-e75be82f94c2"
          ]
        },
        {
          "uuid": "f386fabd-4257-4212-b0c2-039bcafd8916",
          "code": "797-58-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=797-58-0",
          "code_system": "CAS",
          "references": [
            "92736bb6-cb45-46da-9acd-e75be82f94c2",
            "1a06c5d2-e2a3-49d0-9420-173d46e0bb17"
          ]
        },
        {
          "uuid": "d074b1e1-86a2-499c-8e8f-5777c2c1a9f8",
          "code": "O60979L83F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "016afabe-7e3f-830e-f2ee-9f0415a223d7",
          "code": "66255",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66255",
          "code_system": "PUBCHEM",
          "references": [
            "051ff8d7-3d9b-f655-02e2-085b0e994f6f"
          ]
        },
        {
          "uuid": "fff749ce-81b4-8618-260d-c025ecd5a990",
          "code": "89791",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=89791",
          "code_system": "NSC",
          "references": [
            "28940be1-6998-54f7-629e-cdca066de852"
          ]
        },
        {
          "uuid": "da48036d-e684-cf5c-c7fe-efddf300dca3",
          "code": "DTXSID801015371",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801015371",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "24d2eab4-829d-48b4-9012-4a28e6adbd73",
          "amount": {
            "uuid": "07ee9e83-c30f-4078-9904-5fba52b2ce83"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "7dddc9b0-d4eb-468f-9d8e-f55f304a0a62",
            "refuuid": "0834e9f5-df1f-422f-80ab-4e30adc43df2",
            "name": "NORBOLETHONE, (-)-",
            "unii": "1981B5HEE8",
            "linking_id": "1981B5HEE8",
            "ref_pname": "NORBOLETHONE, (-)-"
          }
        },
        {
          "uuid": "45eabec6-f82f-4781-aa7b-42d8820f64e5",
          "amount": {
            "uuid": "6876035d-10ed-457c-a3a0-95078486752e"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "823f4230-9e06-49e0-ae4b-edf9a11fb02f",
            "refuuid": "6f64ec4d-5f9b-4c19-9ece-cf18fa44e727",
            "name": "NORBOLETHONE",
            "unii": "U3BZU2241A",
            "linking_id": "U3BZU2241A",
            "ref_pname": "NORBOLETHONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "90ec13fe-db6e-4073-abce-17050c644c2b",
          "name": "(17.ALPHA.)-13-ETHYL-17-HYDROXY-18,19-DINORPREGN-4-EN-3-ONE",
          "stdName": "(17.ALPHA.)-13-ETHYL-17-HYDROXY-18,19-DINORPREGN-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "3ff6de98-7fb7-42b3-b56e-c4d695b9329b",
          "name": "13,17.ALPHA.-DIETHYL-17-HYDROXYGON-4-EN-3-ONE",
          "stdName": "13,17.ALPHA.-DIETHYL-17-HYDROXYGON-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "330fd67b-8905-40e8-8de4-260bf610f60e",
          "name": "13-ETHYL-17-HYDROXY-18,19-DINOR-17.ALPHA.-PREGN-4-EN-3-ONE",
          "stdName": "13-ETHYL-17-HYDROXY-18,19-DINOR-17.ALPHA.-PREGN-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "56d5f9be-d188-43c2-a184-a168b7a405c1",
          "name": "18,19-DINOR-17.ALPHA.-PREGN-4-EN-3-ONE, 13-ETHYL-17-HYDROXY-",
          "stdName": "18,19-DINOR-17.ALPHA.-PREGN-4-EN-3-ONE, 13-ETHYL-17-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "80ea08df-0f04-4dfe-a930-f94a2cfafb0d",
          "name": "18,19-DINORPREGN-4-EN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "stdName": "18,19-DINORPREGN-4-EN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "036785c8-fdfb-4f99-8d6c-a3085bf5a2cc",
          "name": "D-NORBOLETHONE",
          "stdName": "D-NORBOLETHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        },
        {
          "uuid": "7e86942f-6344-40ce-8c40-83d0354b139c",
          "name": "NORBOLETHONE D-FORM [MI]",
          "stdName": "NORBOLETHONE D-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5148aa94-2ff4-41a7-af60-43d4c69264fc",
            "b7539b2a-d796-4a84-8723-114fec10acdd"
          ],
          "display_name": false
        },
        {
          "uuid": "ceb5b862-a06c-42d7-9657-ad55469bf288",
          "name": "NORBOLETHONE, (+)-",
          "stdName": "NORBOLETHONE, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5148aa94-2ff4-41a7-af60-43d4c69264fc",
            "1080feeb-90c5-4922-9411-8fd8aaa3e972"
          ],
          "display_name": true
        },
        {
          "uuid": "9299dad1-3a4d-40a8-a598-f521a3149b3b",
          "name": "NORBOLETONE, (+)-",
          "stdName": "NORBOLETONE, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5148aa94-2ff4-41a7-af60-43d4c69264fc",
            "1080feeb-90c5-4922-9411-8fd8aaa3e972"
          ],
          "display_name": false
        },
        {
          "uuid": "d4b664ff-189f-43d7-9508-8e3daa7c9ca0",
          "name": "NSC-89791",
          "stdName": "NSC-89791",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4255372-fc70-4f08-9caa-9c8b616a440f",
            "5148aa94-2ff4-41a7-af60-43d4c69264fc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1080feeb-90c5-4922-9411-8fd8aaa3e972",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5148aa94-2ff4-41a7-af60-43d4c69264fc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7539b2a-d796-4a84-8723-114fec10acdd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4255372-fc70-4f08-9caa-9c8b616a440f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92736bb6-cb45-46da-9acd-e75be82f94c2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392764000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "090dc767-6d7d-410d-b35f-7f3666dd8785",
          "citation": "SRS import [O60979L83F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O60979L83F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392764000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "051ff8d7-3d9b-f655-02e2-085b0e994f6f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "1a06c5d2-e2a3-49d0-9420-173d46e0bb17",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "28940be1-6998-54f7-629e-cdca066de852",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "25147f5c-3071-23c4-6d0b-1c52c56e637e",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "261e8e38-060b-4a8d-997d-1b28b25fd1ae",
          "id": "261e8e38-060b-4a8d-997d-1b28b25fd1ae",
          "molfile": "\n  Marvin  01132102062D          \n\n 23 26  0  0  1  0            999 V2000\n    8.2006  -10.7653    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.9838  -11.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4814  -10.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0068   -9.6920    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.0068   -8.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7117   -9.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4257   -9.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2006   -9.9363    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.2006   -9.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5006   -8.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5052   -9.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725   -9.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725  -10.7470    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.0586  -11.1616    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.3446  -10.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6352  -11.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6352  -11.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9212  -12.3915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3446  -12.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0586  -11.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7680  -12.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4821  -11.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4821  -11.1708    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 23  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 13 23  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 20  1  6  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  6  0  0  0\nM  END",
          "smiles": "CC[C@@]12CC[C@@H]3[C@H]4CCC(=O)C=C4CC[C@H]3[C@@H]2CC[C@]1(CC)O",
          "formula": "C21H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a78f3b58-b73a-4fcd-9120-414552f51ee9"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "316.4784",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "143d5158-64dc-4edf-9845-570d4cc4d51a",
      "version": "13",
      "structure": {
        "id": "0ddc996f-40ec-4c67-a815-7457c5076fc9",
        "molfile": "\n  Marvin  01132100572D          \n\n 27 30  0  0  1  0            999 V2000\n    8.2006   -9.9363    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2006  -10.7653    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4821  -11.1708    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7725  -10.7470    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0586  -11.1616    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3446  -10.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6352  -11.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6352  -11.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3446  -12.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0586  -11.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7680  -12.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4821  -11.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9212  -12.3915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0586  -10.3370    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725  -11.5715    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725   -9.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5052   -9.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4821  -10.3507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9838  -11.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4814  -10.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0068   -9.6920    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0068   -8.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7117   -9.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4257   -9.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2006  -11.5808    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2006   -9.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5006   -8.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  3  1  0  0  0  0\n 10  5  1  0  0  0  0\n 13  8  2  0  0  0  0\n  5 14  1  1  0  0  0\n  4 15  1  6  0  0  0\n 16  4  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  1  1  0  0  0  0\n  3 18  1  1  0  0  0\n 19  2  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21  1  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n  2 25  1  6  0  0  0\n  1 26  1  1  0  0  0\n 27 26  1  0  0  0  0\nM  END",
        "smiles": "CC[C@@]12CC[C@]3([H])[C@@]4([H])CCC(=O)C=C4CC[C@@]3([H])[C@]2([H])CC[C@]1(CC)O",
        "formula": "C21H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "316.4784",
        "optical_activity": "( + )",
        "references": [
          "b4255372-fc70-4f08-9caa-9c8b616a440f",
          "090dc767-6d7d-410d-b35f-7f3666dd8785"
        ],
        "stereo_centers": 6
      },
      "unii": "O60979L83F"
    }
  ]
}