{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9cfee7b0-a2ed-483d-a9a1-91a7743dfe08", "code": "33036-33-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=33036-33-8", "code_system": "CAS", "references": [ "2eb52c7d-db9d-4174-9951-7fff4f0d1a87", "56043da5-b7e5-48ce-9ba2-c97ab713e763" ] }, { "uuid": "88f3e549-345c-4fda-997a-26ae3a883675", "code": "14009228", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14009228", "code_system": "PUBCHEM", "references": [ "2eb52c7d-db9d-4174-9951-7fff4f0d1a87" ] }, { "uuid": "e37790b9-8f1d-41d6-ba0b-083c855f4ecd", "code": "O5Z6602I6U", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5d62d86f-c7b3-4af5-8928-1c0d09bfe914", "code": "36412", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36412", "code_system": "CHEBI", "references": [ "63285bc3-19a9-2e56-ad3c-8b82eb2ea5a2" ] }, { "uuid": "e4a69e55-262e-2404-a905-a786b247524a", "code": "19-Noretiocholanolone", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/19-Noretiocholanolone", "code_system": "WIKIPEDIA", "references": [ "448a7c7e-9224-3885-5bd1-04155c1b2511" ] }, { "uuid": "fbb3244c-0997-89f8-77a1-4592b37b28e9", "code": "DTXSID601043346", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601043346", "code_system": "EPA CompTox", "references": [ "63285bc3-19a9-2e56-ad3c-8b82eb2ea5a2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "fd173749-be9d-4597-8827-6c595af64873", "name": "(3.ALPHA.,5.BETA.)-3-HYDROXYESTRAN-17-ONE", "stdName": "(3.ALPHA.,5.BETA.)-3-HYDROXYESTRAN-17-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": false }, { "uuid": "e3ec8c20-f0a9-46b2-af95-5df60d58b0fa", "name": "19-NORETIOCHOLAN-3.ALPHA.-OL-17-ONE", "stdName": "19-NORETIOCHOLAN-3.ALPHA.-OL-17-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": false }, { "uuid": "0beeee14-5b7d-46b7-82f1-d80c3d1c37f8", "name": "19-NORETIOCHOLANOLONE", "stdName": "19-NORETIOCHOLANOLONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": true }, { "uuid": "0d6bef88-7fd7-4f59-afc5-a10f65b30d8b", "name": "3.ALPHA.-HYDROXY-5.BETA.-ESTRAN-17-ONE", "stdName": "3.ALPHA.-HYDROXY-5.BETA.-ESTRAN-17-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": false }, { "uuid": "93d37c38-e00e-48bd-869d-b06eeab56e6b", "name": "5.BETA.-ESTRAN-3.ALPHA.-OL-17-ONE", "stdName": "5.BETA.-ESTRAN-3.ALPHA.-OL-17-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": false }, { "uuid": "8c0cabe0-a1fa-48c7-b852-85c4bc86df61", "name": "ESTRAN-17-ONE, 3-HYDROXY-, (3.ALPHA.,5.BETA.)-", "stdName": "ESTRAN-17-ONE, 3-HYDROXY-, (3.ALPHA.,5.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "334761d5-aa9f-473c-9b33-ee4e1cd24346" ], "display_name": false } ], "references": [ { "uuid": "334761d5-aa9f-473c-9b33-ee4e1cd24346", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2eb52c7d-db9d-4174-9951-7fff4f0d1a87", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393228000, "tags": [ "NOMEN" ] }, { "uuid": "f067b91f-275f-435c-9e27-3292cff0ce11", "citation": "SRS import [O5Z6602I6U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O5Z6602I6U", "doc_type": "SRS", "public_domain": true, "document_date": 1493393228000, "tags": [ "NOMEN" ] }, { "uuid": "3289f547-d10b-4e03-bf08-9a14e1c549cc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "448a7c7e-9224-3885-5bd1-04155c1b2511", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "63285bc3-19a9-2e56-ad3c-8b82eb2ea5a2", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "56043da5-b7e5-48ce-9ba2-c97ab713e763", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3c052547-51ca-41cc-86af-e728ff787637", "id": "3c052547-51ca-41cc-86af-e728ff787637", "molfile": "\n Marvin 01132103112D \n\n 20 23 0 0 1 0 999 V2000\n 9.3107 -4.4143 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.1039 -4.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5716 -3.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0719 -3.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3111 -2.5291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2940 -3.5924 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.3611 -2.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5732 -3.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8653 -3.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8827 -4.4476 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.6072 -4.8416 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.6246 -5.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9211 -6.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1966 -5.7013 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.4932 -6.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7678 -5.7300 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.0643 -6.1573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7503 -4.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4538 -4.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1792 -4.8748 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1 2 1 1 0 0 0\n 1 6 1 0 0 0 0\n 11 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 1 0 0 0\n 10 11 1 0 0 0 0\n 20 10 1 0 0 0 0\n 11 12 1 6 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 6 0 0 0\n 20 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 6 0 0 0\n 16 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 6 0 0 0\nM END", "smiles": "C[C@@]12CC[C@@H]3[C@H]4CC[C@H](C[C@H]4CC[C@H]3[C@@H]2CCC1=O)O", "formula": "C18H28O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "82f999d7-4ac2-4522-b3ab-beea61a3639f" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "276.4144", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "e2444646-8fe3-4c34-a34d-f03c9a1adfbe", "version": "5", "structure": { "id": "a0811480-f0c3-448a-a642-1b242b662465", "molfile": "\n Marvin 01132108202D \n\n 25 28 0 0 1 0 999 V2000\n 9.3611 -2.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2940 -3.5924 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.0719 -3.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3111 -2.5291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5716 -3.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1039 -4.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3107 -4.4143 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.4186 -5.2350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6072 -4.8416 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.5906 -4.0195 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6246 -5.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9211 -6.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1966 -5.7013 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2177 -6.5222 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4932 -6.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7678 -5.7300 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0643 -6.1573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7503 -4.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4538 -4.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1792 -4.8748 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.1617 -4.0484 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8827 -4.4476 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.9047 -5.2732 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8653 -3.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5732 -3.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 6 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 13 1 0 0 0 0\n 20 21 1 1 0 0 0\n 22 20 1 0 0 0 0\n 9 22 1 0 0 0 0\n 22 23 1 6 0 0 0\n 24 22 1 0 0 0 0\n 25 24 1 0 0 0 0\n 2 25 1 0 0 0 0\nM END", "smiles": "C[C@@]12CC[C@]3([H])[C@@]4([H])CC[C@H](C[C@@]4([H])CC[C@@]3([H])[C@]2([H])CCC1=O)O", "formula": "C18H28O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "276.4144", "optical_activity": "UNSPECIFIED", "references": [ "3289f547-d10b-4e03-bf08-9a14e1c549cc", "f067b91f-275f-435c-9e27-3292cff0ce11" ], "stereo_centers": 7 }, "unii": "O5Z6602I6U" } ] }